diff options
Diffstat (limited to 'Board/EM/MeWrapper')
191 files changed, 33462 insertions, 0 deletions
diff --git a/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.c b/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.c new file mode 100644 index 0000000..4315c31 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.c @@ -0,0 +1,485 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/ASF Verbosity/ASFVerbosity.c 2 4/24/12 12:46a Klzhan $ +// +// $Revision: 2 $ +// +// $Date: 4/24/12 12:46a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/ASF Verbosity/ASFVerbosity.c $ +// +// 2 4/24/12 12:46a Klzhan +// Update module to latest +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 2 6/10/11 4:21a Klzhan +// Update ASF_INDUSTRY_IANA and ASF_INTEL_IANA ID. +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: ASFVerbosity.c +// +// Description: Shows ASF POST Message +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include <AmiDxeLib.h> +#include <Protocol\ConsoleControl.h> +#include <Protocol\SimpleTextOut.h> +#include <Protocol\SmBios.h> +#include <Protocol\SmbiosGetFlashDataProtocol.h> +#include <ReferenceCode\ME\Protocol\AlertStandardFormat\AlertStandardFormat.h> +#include <ReferenceCode\ME\Library\Amt\Include\Amt.h> + +#define AMI_EFI_SOL_POST_MESSAGE_GUID \ +{ 0xf42f3752, 0x12e, 0x4812, 0x99, 0xe6, 0x49, 0xf9, 0x43, 0x4, 0x84, 0x54 } + +#define SOL_NORMAL 0x00 +#define SOL_VERB 0x40 +#define SOL_QUIET 0x20 +#define SOL_BLANK 0x60 +#define SOL_SETUP 0x00 + +EFI_GUID guidEfiVar = EFI_GLOBAL_VARIABLE; +EFI_GUID gSmbiosProtocolGuid = EFI_SMBIOS_PROTOCOL_GUID; +EFI_GUID gConsoleControlProtocolGuid = EFI_CONSOLE_CONTROL_PROTOCOL_GUID; +EFI_GUID gAmiEfiSolPostMessageGuid = AMI_EFI_SOL_POST_MESSAGE_GUID; + + +SMBIOS_TABLE_ENTRY_POINT *SmBiosTableEntryPoint = 0; + +static CHAR16 *SolString[] = { + L"Intel Corporation. Copyright 2004-2009.\r\n", + L"Intel Active Management Technology - Serial Over LAN operational mode.\r\n\r\n", + L"BIOS Revision: ", + L"\r\n\r\nBIOS Settings: <F2>\r\n", +#if defined SETUP_BBS_POPUP_ENABLE && SETUP_BBS_POPUP_ENABLE + L"One Time Boot Menu: <F7>\r\n", +#else + L"\r\n", +#endif + L"Intel(R) AMT Client BIOS Setup Entry\r\n", + L"Intel Remote PC Assist Technology - Serial Over LAN operational mode.\r\n\r\n", +}; + +//<AMI_SHDR_START> +//---------------------------------------------------------------------------- +// Name: DMIHDR +// +// Description: This structure represents DMI variable +// +// Fields: Name Type Description +// ------------------------------------------------------------------ +// Type UINT8 Type of DMI variable +// Length UINT8 Length of the variable +// Handle UINT16 SmBios handle for DMI +// +//---------------------------------------------------------------------------- +//<AMI_SHDR_END> +typedef struct { + UINT8 Type; + UINT8 Length; + UINT16 Handle; +} DMIHDR; + +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: AsciiStrLength +// +// Description: Computes Ascii string length including 0-terminator +// +// Input: +// IN CHAR8 *String Pointer to input ASCII string +// +// +// +// Output: +// UINTN +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +UINTN AsciiStrLength(IN CHAR8* String) +{ + + UINTN Length = 0; + if (String == NULL) + return Length; + while (String[Length++] != 0); + + return Length; +} +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: AsciiToUnicode +// +// Description: Transfer Ascii code to Unicode +// +// Input: +// IN CHAR8 *String Pointer to input ASCII string +// +// +// +// Output: +// UINTN +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID AsciiToUnicode ( + IN CHAR8 *AsciiString, + OUT CHAR16 *UnicodeString +) +{ + UINT8 Index = 0; + + while (AsciiString[Index] != 0) { + UnicodeString[Index] = (CHAR16) AsciiString[Index]; + Index++; + } +} + +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: AsciiToUnicodeSmBiosString +// +// Description: Converts Ascii string to Unicode string +// +// Input: +// IN CHAR8 *AsciiString Pointer to input Ascii string +// OUT CHAR16* UnicodeString Pointer to output Unicode string +// +// +// Output: +// VOID +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID AsciiToUnicodeSmBiosString +( + IN CHAR8* AsciiString, + OUT CHAR16* UnicodeString +) +{ + + + do { + *(UnicodeString++) = (CHAR16)*AsciiString ; + } while (*(AsciiString++) != 0); + +} + + +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: GetSmBiosStructureLength +// +// Description: Finds the length of SmBios structure +// +// Input: +// IN VOID* SmBiosStructure Pointer to SmBios structure +// +// Output: +// UINTN +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +UINTN GetSmBiosStructureLength +( + IN VOID* SmBiosStructure +) +{ + + UINT8* SmBiosStringsBlockPtr; + UINTN Length = 0; + SmBiosStringsBlockPtr = (UINT8*) SmBiosStructure + \ + ((DMIHDR*)SmBiosStructure)->Length; + while ( *(CHAR16*)(SmBiosStringsBlockPtr + Length) != 0) Length++; + + // determine the right value + return ((DMIHDR*)SmBiosStructure)->Length + Length + 2; +} +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: GetSmBiosStructureByHandle +// +// Description: Finds SmBios structure given a handle +// +// Input: +// IN UINT16 Handle Handle to SmBios structure +// +// Output: +// VOID* Pointer to SmBios structure +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID* GetSmBiosStructureByHandle +( + IN UINT16 Handle +) +{ + + UINT8* SmBiosStructurePtr = (UINT8*)(SmBiosTableEntryPoint->TableAddress); + UINT8* SmBiosEnd = SmBiosStructurePtr + SmBiosTableEntryPoint->TableLength; + + while (SmBiosStructurePtr < SmBiosEnd) { + + if (((DMIHDR*)SmBiosStructurePtr)->Handle == Handle) + return SmBiosStructurePtr; + SmBiosStructurePtr += GetSmBiosStructureLength(SmBiosStructurePtr); + } + + return NULL; +} + +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: GetSmBiosAsciiString +// +// Description: Finds SmBios data (Ascii string) inside SmBios structure +// +// Input: +// IN VOID* SmBiosStructure Pointer to SmBios structure +// IN UINT8 StringNumber SmBios String number +// +// Output: +// CHAR8* +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +CHAR8* GetSmBiosAsciiString +( + IN VOID* SmBiosStructure, + IN UINT8 StringOffset +) +{ + + CHAR8* SmBiosStringPtr; + UINT8 StringNumber = *((UINT8*)SmBiosStructure + StringOffset); + + SmBiosStringPtr = (CHAR8*)SmBiosStructure + \ + ((DMIHDR*)SmBiosStructure)->Length; + if (StringNumber == 0) + return NULL; + + if (SmBiosStructure != NULL) + while ( (StringNumber--) != 1) + SmBiosStringPtr += AsciiStrLength(SmBiosStringPtr); + + return SmBiosStringPtr; +} +EFI_ASF_BOOT_OPTIONS *mAsfBootOptions = NULL; +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: DisplaySolMessageEvent +// +// Description: Dispaly Sol Message +// +// Input: +// +// +// +// Output: +// +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID DisplaySolMessageEvent(IN EFI_EVENT Event, IN VOID *Context) +{ + EFI_STATUS Status; + UINT8 i; + UINT8 CastlePeak; + UINTN Size = 0; + CHAR8 *SmBiosData = NULL; + CHAR16 *SmBiosString; + EFI_SMBIOS_PROTOCOL *SmbiosProtocol; + EFI_CONSOLE_CONTROL_SCREEN_MODE ScreenMode; + EFI_CONSOLE_CONTROL_PROTOCOL *ConsoleControl; + EFI_GUID gEfiAlertStandardFormatProtocolGuid = EFI_ALERT_STANDARD_FORMAT_PROTOCOL_GUID; + EFI_ALERT_STANDARD_FORMAT_PROTOCOL *Asf; + Status = pBS->LocateProtocol ( + &gEfiAlertStandardFormatProtocolGuid, + NULL, + &Asf + ); + if (EFI_ERROR (Status)) + return; + + Status = Asf->GetBootOptions (Asf, &mAsfBootOptions); + if((mAsfBootOptions->IanaId != ASF_INTEL_CONVERTED_IANA) && + (mAsfBootOptions->IanaId != ASF_INDUSTRY_CONVERTED_IANA)) + return; + Status = pBS->LocateProtocol (&gSmbiosProtocolGuid, NULL, &SmbiosProtocol); + if (EFI_ERROR(Status))return; + + Status = pBS->LocateProtocol (&gEfiConsoleControlProtocolGuid, \ + NULL, (VOID**)&ConsoleControl); + if (EFI_ERROR(Status))return; + + + SmBiosTableEntryPoint = SmbiosProtocol->SmbiosGetTableEntryPoint(); + + SmBiosData = GetSmBiosAsciiString( GetSmBiosStructureByHandle(0x00), 0x05); + + Size = AsciiStrLength(SmBiosData) + 1; + + Status = pBS->AllocatePool(EfiBootServicesData, \ + Size*sizeof(CHAR16), &SmBiosString); + if (EFI_ERROR(Status))return; + + if (SmBiosData[0] != 0x20) { + MemSet(SmBiosString, Size*sizeof(CHAR16), 0); + AsciiToUnicodeSmBiosString(SmBiosData, SmBiosString); + } + + CastlePeak = FALSE; + ConsoleControl->GetMode(ConsoleControl, &ScreenMode, NULL, NULL); + if (ScreenMode == EfiConsoleControlScreenGraphics) { + ConsoleControl->SetMode( ConsoleControl, EfiConsoleControlScreenText ); + } + pST->ConOut->EnableCursor( pST->ConOut, FALSE ); + pST->ConOut->ClearScreen( pST->ConOut); + pST->ConOut->SetCursorPosition( pST->ConOut, 0, 0 ); + + TRACE((-1,"mAsfBootOptions->BootOptions = %08x",mAsfBootOptions->BootOptions)); + + // SOL Normal Mode and SOL Setup Mode + switch (((mAsfBootOptions->BootOptions)>>8)) { + case SOL_NORMAL: + case SOL_VERB: + + for (i = 0; i <= 4; i++) { + // AMT or Castle Peak ? + if (i == 1 && CastlePeak) { + pST->ConOut->OutputString ( pST->ConOut, SolString[6]); + } else pST->ConOut->OutputString ( pST->ConOut, SolString[i]); + + if (i == 2)pST->ConOut->OutputString ( pST->ConOut, SmBiosString ); + } + + break; + + case SOL_QUIET: + pST->ConOut->OutputString ( pST->ConOut, SolString[0]); + pST->ConOut->OutputString ( pST->ConOut, L"\n\r"); + pST->ConOut->OutputString ( pST->ConOut, SolString[2]); + pST->ConOut->OutputString ( pST->ConOut, SmBiosString); + pST->ConOut->OutputString ( pST->ConOut, L"\n\r\n\r" ); + break; + + case SOL_BLANK: + break; + default: + break; + }//switch + + // SOL_SETUP + if ((mAsfBootOptions->SpecialCommandParam & BIT3)) + pST->ConOut->OutputString ( pST->ConOut, SolString[5]); + + // Kill Event + pBS->CloseEvent(Event); +} + +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: SolPostMessage +// +// Description: Sol Post Message +// +// Input: NULL +// +// +// Output: EFI_STATUS +// +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS SolPostMessage(VOID) +{ + EFI_STATUS Status; + VOID* Registration; + EFI_EVENT gEvtSolMessage; + + + // + // Register for callback to 'AmiEfiSolPostMessage' protocol installation + // + Status = pBS->CreateEvent( + EFI_EVENT_NOTIFY_SIGNAL, + TPL_CALLBACK, + DisplaySolMessageEvent, + NULL, + &gEvtSolMessage + ); + ASSERT_EFI_ERROR(Status); + + + // + // Register for protocol notifications on this event + // + Status = pBS->RegisterProtocolNotify (&gAmiEfiSolPostMessageGuid, + gEvtSolMessage, + &Registration); + ASSERT_EFI_ERROR (Status); + + return EFI_SUCCESS; +} + +EFI_STATUS ASFVerbosityEntryPoint( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + InitAmiLib(ImageHandle, SystemTable); + SolPostMessage(); + return EFI_SUCCESS; +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2009, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.cif b/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.cif new file mode 100644 index 0000000..23ba968 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.cif @@ -0,0 +1,10 @@ +<component> + name = "ASF Verbosity" + category = ModulePart + LocalRoot = "Board\EM\MEWrapper\AmtWrapper\ASFVerbosity" + RefName = "ASFVerbosity" +[files] +"ASFVerbosity.mak" +"ASFVerbosity.sdl" +"ASFVerbosity.c" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.mak b/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.mak new file mode 100644 index 0000000..64a3a0a --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.mak @@ -0,0 +1,89 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/ASF Verbosity/ASFVerbosity.mak 1 2/08/12 1:10a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:10a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/ASF Verbosity/ASFVerbosity.mak $ +# +# 1 2/08/12 1:10a Klzhan +# Initial Check in +# +# 1 2/25/11 1:44a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** + +#<AMI_FHDR_START> +#----------------------------------------------------------------------- +# +# Name: ASFVerbosity.mak +# +# Description: This make file build ASFVerbosity +# components and link them to respective binary +# +#----------------------------------------------------------------------- +#<AMI_FHDR_END> + +all : ASFVERB + +BUILD_ASF_VWEBOSITY_DIR = $(BUILD_DIR)\$(ASF_VWEBOSITY_DIR) + +#--------------------------------------------------------------------------- +# Generic AMT dependencies +#--------------------------------------------------------------------------- +$(BUILD_DIR)\ASFVerbosity.mak : $(ASF_VWEBOSITY_DIR)\ASFVerbosity.cif $(BUILD_RULES) + $(CIF2MAK) $(ASF_VWEBOSITY_DIR)\ASFVerbosity.cif $(CIF2MAK_DEFAULTS) +#--------------------------------------------------------------------------- + +#--------------------------------------------------------------------------- +# Create ASF Verbosity DXE Component +#--------------------------------------------------------------------------- +ASFVERB: $(BUILD_DIR)\ASFVerbosity.mak ASFVERBBin + +ASFVERBBin : $(AMIDXELIB) + $(MAKE) /$(MAKEFLAGS) $(BUILD_DEFAULTS)\ + /f $(BUILD_DIR)\ASFVerbosity.mak all\ + GUID=4f4ff580-b8a0-4332-a6b0-e2e568e36c9c \ + ENTRY_POINT=ASFVerbosityEntryPoint \ + TYPE=BS_DRIVER \ + COMPRESS=1 +#--------------------------------------------------------------------------- + + + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.sdl b/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.sdl new file mode 100644 index 0000000..acb2810 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/ASFVerbosity/ASFVerbosity.sdl @@ -0,0 +1,78 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* + +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/ASF Verbosity/ASFVerbosity.sdl 1 2/08/12 1:10a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:10a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/ASF Verbosity/ASFVerbosity.sdl $ +# +# 1 2/08/12 1:10a Klzhan +# Initial Check in +# +# 1 2/25/11 1:44a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# 1 10/05/25 5:56p Klzhan +# Initial Check-in with RC 0.71. +# +#********************************************************************** + +TOKEN + Name = "ASF_VERB_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + TargetH = Yes + Master = Yes +End + +PATH + Name = "ASF_VWEBOSITY_DIR" +End + +MODULE + Help = "Includes AMTSetup.mak to Project" + File = "ASFVerbosity.mak" +End + +ELINK + Name = "$(BUILD_DIR)\ASFVerbosity.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtInt9.asm b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtInt9.asm new file mode 100644 index 0000000..a40f50e --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtInt9.asm @@ -0,0 +1,277 @@ + + TITLE AMTINT9.ASM -- OEM INTERRUPT IMPLEMENTATION + +;************************************************************************* +;************************************************************************* +;** ** +;** (C)Copyright 1985-2010, American Megatrends, Inc. ** +;** ** +;** All Rights Reserved. ** +;** ** +;** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +;** ** +;** Phone: (770)-246-8600 ** +;** ** +;************************************************************************* +;************************************************************************* +; +; $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtLockKBD/AmtInt9.asm 1 2/08/12 1:10a Klzhan $ +; +; $Date: 2/08/12 1:10a $ +; +;**************************************************************************** +; Revision History +; ---------------- +; $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtLockKBD/AmtInt9.asm $ +; +; 1 2/08/12 1:10a Klzhan +; Initial Check in +; +; 2 7/13/11 4:03a Klzhan +; Fix Lock KBD can't work without SOL enable. +; +; 1 2/25/11 1:45a Klzhan +; Initial Check-in +; +; 1 12/03/10 5:11a Klzhan +; Initial Check-in. +; +; +;**************************************************************************** +;<AMI_FHDR_START> +; +; Name: AMTInt9.asm +; +; Description: Hook Int 9 for Legacy Serial Redirection. +; +;<AMI_FHDR_END> +;**************************************************************************** + +;---------------------------------------------------------------------------- +; INCLUDE FILES +;---------------------------------------------------------------------------- +include token.equ +;---------------------------------------------------------------------------- +; EQUATES & STRUCTURES +;---------------------------------------------------------------------------- +refresh_port equ 61h +kb_data_port equ 60h ; keyboard data port +kb_stat_port equ 64h ; keyboard status port +kbcCMDPort EQU 64h ; Keyboard controller command port +enKeyboardCMD EQU 0aeh ; Enable keyboard command +diKeyboardCMD EQU 0adh ; Disable keyboard command +IBFTimeoutCount EQU 0f000h ; Check keyboart input buffer count +kbcIBF EQU 00000010b; Keyboard input buffer full +;---------------------------------------------------------------------------- +; EXTERNS USED +;---------------------------------------------------------------------------- + +;---------------------------------------------------------------------------- +; CSMOEM_CSEG S E G M E N T STARTS +;---------------------------------------------------------------------------- +CSMOEM_CSEG SEGMENT PARA PUBLIC 'CODE' USE16 + ASSUME cs:CSMOEM_CSEG, ds:CSMOEM_CSEG +.386p +;---------------------------------------------------------------------------- + +OldIntHandler LABEL DWORD + IntSegSav dw 0 + IntOfsSav dw 0 + +;<AMI_PHDR_START> +;---------------------------------------------------------------------------- +; +; Procedure: AMTINT09Proc +; +; Description: +; +; Input: +; +; Output: +; +; Modified: +; +;---------------------------------------------------------------------------- +;<AMI_PHDR_END> +AMTINT09Proc PROC NEAR PUBLIC + pushf + cmp cs:dSredirInterruptPtr, 0 + jnz lock_local_keyboard + popf + jmp DWORD PTR cs:[OldIntHandler] +lock_local_keyboard: + push ds + push si + ; DS:SI = *dSredirInterruptPtr + lds si, DWORD PTR cs:dSredirInterruptPtr +; cmp WORD PTR ds:[si], 0 ; does interrutp come from redirection ? + test BYTE PTR ds:[si], 1 ; does interrutp come from redirection ? + jz not_serial_redirection_interrupt ; br not redirection interrupt + ; jmp to original Int 9 vector to service redirection interrupt + pushf + push cs + push OFFSET returnFromInt9 + push DWORD PTR cs:OldIntHandler + retf +returnFromInt9: +; mov WORD PTR ds:[si], 0 ; clear redirection interrupt flag + mov BYTE PTR ds:[si], 0 ; clear redirection interrupt flag + jmp redirection_return_to_caller +not_serial_redirection_interrupt: + ; do nothing and return to caller. + push ax + call disable_keyboard + call enable_keyboard + ; clear EOI + mov al, 20h ; end of INT code + out 20h, al ; out to INT CONTROLLER port + pop ax +redirection_return_to_caller: + pop si + pop ds + popf + retf 2 + +AMTINT09Proc ENDP +;<AMI_PHDR_START> +;---------------------------------------------------------------------------- +; Procedure: CheckKBCController +; +; Description: Check KBC controller present. +; +; Input: None. +; +; Output: None. +; +; Modified: ZF = 0 KBC controller present. +; = 1 No KBC controller. +; +; Referrals: +; +;---------------------------------------------------------------------------- +;<AMI_PHDR_END> +CheckKBCController PROC NEAR + push ax + in al, kb_stat_port + cmp al, 0ffh + pop ax + ret +CheckKBCController ENDP +;<AMI_PHDR_START> +;---------------------------------------------------------------------------- +; Procedure: enable_keyboard +; +; Description: Enables KBD interface. Also CPU interrupt will be enabled +; here. +; +; Input: None. +; +; Output: None. +; +; Modified: AL. +; +; Referrals: ib_free. +; +;---------------------------------------------------------------------------- +;<AMI_PHDR_END> + +enable_keyboard PROC NEAR PUBLIC + + call CheckKBCController + jz short Enable_keyboardExit + call ib_free ; Wait for input buffer free. + mov al, enKeyboardCMD ; CMD to enable KBD interface. + out kbcCMDPort, al ; Write command to KBC. + call ib_free ; Wait for input buffer free. +Enable_keyboardExit: ;(BUG4128+) + sti + ret + +enable_keyboard ENDP +;<AMI_PHDR_START> +;---------------------------------------------------------------------------- +; Procedure: disable_keyboard +; +; Description: Disables KBD interface and reads the data from KBC data port. +; +; Input: None. +; +; Output: AL - Data read from KBC data port. +; +; Modified: AL. +; +; Referrals: ib_free. +; +;---------------------------------------------------------------------------- +;<AMI_PHDR_END> + +disable_keyboard PROC NEAR PUBLIC + call CheckKBCController + jz short Disable_keyboardExit + call ib_free ; Wait for input buffer free. + mov al, diKeyboardCMD ; CMD to disable KBD interface. + out kbcCMDPort, al ; Write command to KBC. + call ib_free ; Wait for input buffer free. + in al, kb_data_port ; Read the data.(BUG2673+) +Disable_keyboardExit: ; + ret + +disable_keyboard ENDP +;<AMI_PHDR_START> +;---------------------------------------------------------------------------- +; Procedure: ib_free +; +; Description: This routine waits until the KBC input buffer is free. +; +; Input: None. +; +; Output: None. +; +; Modified: AL. +; +; Referrals: None. +; +; Notes: DO NOT USE STACK. This routine may be called with RET_SP +; macro. +; +;---------------------------------------------------------------------------- +;<AMI_PHDR_END> +ib_free PROC NEAR PUBLIC + push cx + mov cx, IBFTimeoutCount +IbFreeLp: + in al, kb_stat_port + call CheckKBCController + jz short IbFreeExit + out 0ebh, al + out 0ebh, al + out 0ebh, al + test al, kbcIBF + loopnz IbFreeLp +IbFreeExit: + pop cx + ret +ib_free ENDP + +;---------------------------------------------------------------------------- +LockKeyBoardSignature DB '$LKb' +dSredirInterruptPtr DD 0 +dLockKBD DD 0 +;---------------------------------------------------------------------------- +; CSMOEM_CSEG S E G M E N T ENDS +;---------------------------------------------------------------------------- +CSMOEM_CSEG ENDS +END +;**************************************************************************** +;**************************************************************************** +;** ** +;** (C)Copyright 1985-2009, American Megatrends, Inc. ** +;** ** +;** All Rights Reserved. ** +;** ** +;** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +;** ** +;** Phone (770)-246-8600 ** +;** ** +;**************************************************************************** +;****************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.c b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.c new file mode 100644 index 0000000..aea8c99 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.c @@ -0,0 +1,507 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtLockKBD/AmtLockKBD.c 4 4/30/13 3:35a Tristinchou $ +// +// $Revision: 4 $ +// +// $Date: 4/30/13 3:35a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtLockKBD/AmtLockKBD.c $ +// +// 4 4/30/13 3:35a Tristinchou +// [TAG] EIP119188 +// [Category] Bug Fix +// [Severity] Normal +// [Symptom] Lock keyboard will be no function +// [Solution] Lock keyboard directly +// [Files] AmtLockKBD.c +// +// 3 12/11/12 2:40a Klzhan +// Fix exception error when Secure Boot Enabled. +// +// 2 4/24/12 12:45a Klzhan +// Update module to latest +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 4 7/24/11 10:12a Klzhan +// Remove un-used debug message. +// +// 3 7/13/11 4:03a Klzhan +// Fix Lock KBD can't work without SOL enable. +// +// 2 6/28/11 7:32a Klzhan +// Enable Legacy SreDir before getting signature. +// +// 1 2/25/11 1:45a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTLockKBD.c +// +// Description: AMT Lock KeyBoard Functions. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include <token.h> +#include <EFI.h> +#include <DXE.h> +#include <AmiDxeLib.h> +#include <..\Include\Protocol\ConsoleControl.h> +#if (defined(CSM_SUPPORT) && (CSM_SUPPORT != 0)) +#include "..\core\em\csm\csm.h" +#endif +#include "..\Include\Protocol\DevicePath.h" +#include "..\Include\Protocol\DataHub.h" +#include "..\Include\Protocol\SimpleTextIn.h" +#include "..\Include\Protocol\SimpleTextInEx.h" +#include <ReferenceCode\ME\Protocol\AlertStandardFormat\AlertStandardFormat.h> +#include "Protocol\LegacySredir.h" +#include <Protocol\SmmPowerButtonDispatch.h> + +//============================================================================ +// Local defines for transaction types +//============================================================================ +#define EFI_SIGNATURE_16(A,B) ((A) | ((B)<<8)) +#define EFI_SIGNATURE_32(A,B,C,D) \ + (EFI_SIGNATURE_16((A),(B)) | (EFI_SIGNATURE_16((C),(D)) << 16)) + +#define AMT_INT9_SIGNATURE EFI_SIGNATURE_32 ('$', 'L', 'K', 'b') +#define SREDIR_FLAG_SIGNATURE EFI_SIGNATURE_32 ('$', 'S', 'r', 'F') + +#define BDS_ALL_DRIVERS_CONNECTED_PROTOCOL_GUID \ + { 0xdbc9fd21, 0xfad8, 0x45b0, 0x9e, 0x78, 0x27, 0x15, 0x88, 0x67, 0xcc, 0x93 } +EFI_GUID gBdsAllDriversConnectedProtocolGuid = \ + BDS_ALL_DRIVERS_CONNECTED_PROTOCOL_GUID; +EFI_GUID gEfiSimpleTextInExProtocolGuid = \ + EFI_SIMPLE_TEXT_INPUT_EX_PROTOCOL_GUID; +EFI_GUID gEfiSimpleTextInProtocolGuid = EFI_SIMPLE_TEXT_INPUT_PROTOCOL_GUID; +EFI_GUID ConInStartedProtocolGuid = CONSOLE_IN_DEVICES_STARTED_PROTOCOL_GUID; + +#define BDS_CONNECT_DRIVERS_PROTOCOL_GUID \ + { 0x3aa83745, 0x9454, 0x4f7a, 0xa7, 0xc0, 0x90, 0xdb, 0xd0, 0x2f, 0xab, 0x8e } +EFI_GUID gEfiSmmPowerButtonDispatchProtocolGuid = \ + EFI_SMM_POWER_BUTTON_DISPATCH_PROTOCOL_GUID; +EFI_GUID gBdsConnectDriversProtocolGuid = \ + BDS_CONNECT_DRIVERS_PROTOCOL_GUID; +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: ClearPowerButtonSmi +// +// Description: This routine disables Power Button SMI if Lock Power Button +// bit of Boot Option BitMask is set. +// +// Input: None. +// +// Output: None. +// +// Notes: None. +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +ClearPowerButtonSmi (VOID) +{ + UINT32 dPwrMgValue; + + // Read PM_1 Status/Enable Register + dPwrMgValue = IoRead32(PM_BASE_ADDRESS); + dPwrMgValue |= BIT08; // clear Power Button Status + dPwrMgValue &= ~BIT24; // clear Power Button Enable + IoWrite32 ( PM_BASE_ADDRESS, dPwrMgValue ); +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: DisablePowerButtonSmiEvent +// +// Description: This routine disables Power Button SMI if Lock Power Button +// bit of Boot Option BitMask is set. +// +// Input: EFI_EVENT - Event +// VOID* - Context +// +// Output: EFI_STATUS +// +// Notes: None. +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +DisablePowerButtonSmiEvent ( + IN EFI_EVENT Event, + IN VOID *Context + ) +{ + EFI_STATUS Status; + EFI_SMM_POWER_BUTTON_DISPATCH_PROTOCOL *PowerButton; + + Status = pBS->LocateProtocol ( &gEfiSmmPowerButtonDispatchProtocolGuid, \ + NULL, \ + &PowerButton ); + if(EFI_ERROR( Status )) return Status; + + ClearPowerButtonSmi(); + + pBS->CloseEvent(Event); + + return EFI_SUCCESS; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: ASFRegisterPowerButtonCallBack +// +// Description: This routine register a Protocol Callback for Lock Power Button +// if Lock Power Button bit of Boot Option BitMask is set. +// +// Input: None. +// +// Output: None. +// +// Notes: None. +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +ASFRegisterPowerButtonCallBack (VOID) +{ + EFI_STATUS Status = EFI_SUCCESS; + EFI_EVENT EvtASFSmmPwrBtn, EvtASFBdsConnectDrivers; + VOID *RgnASFSmmPwrBtn, *RgnASFBdsConnectDrivers; + + // Clear Power Button Status before Power Button SMI is registered. + Status = RegisterProtocolCallback ( \ + &gEfiSmmPowerButtonDispatchProtocolGuid, \ + DisablePowerButtonSmiEvent, \ + NULL, \ + &EvtASFSmmPwrBtn, \ + &RgnASFSmmPwrBtn ); + + DisablePowerButtonSmiEvent ( EvtASFSmmPwrBtn, NULL ); + + Status = RegisterProtocolCallback ( \ + &gBdsConnectDriversProtocolGuid, \ + DisablePowerButtonSmiEvent, \ + NULL, \ + &EvtASFBdsConnectDrivers, \ + &RgnASFBdsConnectDrivers ); + return ; +} +#if (defined(CSM_SUPPORT) && (CSM_SUPPORT != 0)) + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: GetLegacyDriverSignaturePtr +// +// Description: Aux roution to find the Signature in Legacy Reagon +// +// Input: +// +// Output: +// +// Notes: +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +UINT32 +GetLegacyDriverSignaturePtr ( + IN UINT32 dStartAddress, + IN UINT32 dSize, + IN UINT32 dSignature +) +{ + UINT8 *pStartAddr = (UINT8 *)(UINTN)dStartAddress; + + for ( ;(UINTN)pStartAddr < (UINTN)(dStartAddress + dSize); pStartAddr++ ) + if ( *(UINT32 *)pStartAddr == dSignature ) return ((UINT32)pStartAddr); + return FALSE; +} + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: LegacyBiosLockLocalKeyboard +// +// Description: Sub-roution lock keyboard. +// +// Input: +// +// Output: +// +// Notes: +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +LegacyBiosLockLocalKeyboard (VOID) +{ + + EFI_STATUS Status; + UINT32 dAMTInt9Ptr = 0, dSRedirFlagPtr = 0; + EFI_LEGACY_BIOS_PROTOCOL *LegacyBios; + BIOS_INFO *Private; + + // Get AMT Int 9h signature pointer. + dAMTInt9Ptr = GetLegacyDriverSignaturePtr ( \ + 0xe0000, 0x20000, AMT_INT9_SIGNATURE ); + // Get Legacy Serial Redirection Flag signature pointer. + dSRedirFlagPtr = GetLegacyDriverSignaturePtr ( \ + 0x90000, 0x10000, SREDIR_FLAG_SIGNATURE ); + if ( !dAMTInt9Ptr ) return ; + // Locate Legacy Bios Protocol for lock/unlock shadow ram. + Status = pBS->LocateProtocol ( &gEfiLegacyBiosProtocolGuid, \ + NULL, \ + &LegacyBios ); + if ( EFI_ERROR( Status ) ) return; + Private = (BIOS_INFO *) LegacyBios; + // Unlock Shadow ram. + Private->iRegion->UnLock ( Private->iRegion, 0xE0000, 0x20000, NULL ); + // Update Legacy Serial Redirection Flag pointer to AMT Int 9h. + if(!dSRedirFlagPtr) + dSRedirFlagPtr = (dAMTInt9Ptr + 4); + *(UINT32*)(dAMTInt9Ptr + 4) = (UINT32)(((UINTN)dSRedirFlagPtr & 0xFFFF) + \ + (((UINTN)dSRedirFlagPtr & 0xF0000) << 12) + \ + sizeof ( SREDIR_FLAG_SIGNATURE )); + // Lock Shadow ram. + Private->iRegion->Lock ( Private->iRegion, 0xE0000, 0x20000, NULL ); + +} +#endif +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: EventAllConsoleDevicesStarted +// +// Description: Sub-Roution to check if need disable keyboard or not +// from IntelAMT extersion ASF Boot Option Message. +// +// Input: +// +// Output: +// +// Notes: +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +EventAllConsoleDevicesStarted +( + IN EFI_EVENT Event, + IN VOID *Context +) +{ + EFI_STATUS Status; + EFI_HANDLE *SimpleTextInHandle; + UINTN HandleNum, Index; + EFI_DEVICE_PATH_PROTOCOL *DevicePathNode; + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + EFI_SIMPLE_TEXT_INPUT_PROTOCOL *SimpleTextIn; + EFI_SIMPLE_TEXT_INPUT_EX_PROTOCOL *SimpleTextInEx; + PCI_DEVICE_PATH *PciDevicePath; + EFI_GUID gEfiAlertStandardFormatProtocolGuid = EFI_ALERT_STANDARD_FORMAT_PROTOCOL_GUID; + EFI_ALERT_STANDARD_FORMAT_PROTOCOL *Asf; + EFI_ASF_BOOT_OPTIONS *mAsfBootOptions; + + Status = pBS->LocateProtocol ( + &gEfiAlertStandardFormatProtocolGuid, + NULL, + &Asf + ); + + if (EFI_ERROR (Status)) { + return; + } + + Status = Asf->GetBootOptions (Asf, &mAsfBootOptions); + // If not Lock keyboard, return !! + if(!((mAsfBootOptions->BootOptions) & 0x20)) + return; + + // 2. Uninstall all the console spliter drivers except SOL. + // Locate Simple Text Input Protocol Handle Buffer. + Status = pBS->LocateHandleBuffer ( ByProtocol, \ + &gEfiSimpleTextInProtocolGuid, \ + NULL, \ + &HandleNum, \ + &SimpleTextInHandle ); + if ( EFI_ERROR ( Status ) ) return ; + + // Search USB keyboard and Generic PS2 Keyboard Device Path. + for ( Index = 0; Index < HandleNum; Index++ ) { + + // Locate Simple Text Input Protocol. + Status = pBS->HandleProtocol ( SimpleTextInHandle[Index], \ + &gEfiDevicePathProtocolGuid, \ + (VOID *)&DevicePath ); + if ( EFI_ERROR ( Status ) ) continue; + + DevicePathNode = DevicePath; + while ( !isEndNode ( DevicePathNode ) ) { + PciDevicePath = (PCI_DEVICE_PATH *) DevicePathNode; + // Is USB Device Path or Generic SIO Device Path (SouthBridge)? + if ((( DevicePathNode->Type == MESSAGING_DEVICE_PATH ) && \ + ( DevicePathNode->SubType == MSG_USB_DP )) || \ + (( DevicePathNode->Type == HARDWARE_DEVICE_PATH ) && \ + ( DevicePathNode->SubType == HW_PCI_DP ) && \ + ( PciDevicePath->Device == 0x1f ) && \ + ( PciDevicePath->Function == 0 ))) { + + // Locate Simple Text Input Protocol. + Status = pBS->HandleProtocol ( SimpleTextInHandle[Index], \ + &gEfiSimpleTextInProtocolGuid, \ + (VOID **)&SimpleTextIn ); + if ( EFI_ERROR ( Status ) ) break; + + // Uninstall Simple Text Input Protocol for stopping keyboard. + Status = pBS->UninstallProtocolInterface ( \ + SimpleTextInHandle[Index], \ + &gEfiSimpleTextInProtocolGuid, \ + SimpleTextIn ); + if ( EFI_ERROR ( Status ) ) break; + + // Locate Simple Text Input EX Protocol. + Status = pBS->HandleProtocol ( \ + SimpleTextInHandle[Index], \ + &gEfiSimpleTextInExProtocolGuid, \ + (VOID **)&SimpleTextInEx ); + if ( EFI_ERROR ( Status ) ) break; + + // Uninstall Simple Text Input EX Protocol for stopping + // SIO keyboard. + Status = pBS->UninstallProtocolInterface ( \ + SimpleTextInHandle[Index], \ + &gEfiSimpleTextInExProtocolGuid, \ + SimpleTextInEx ); + break; + } + DevicePathNode = NEXT_NODE ( DevicePathNode ); + } + } +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: LockLegacyKBD +// +// Description: Sub-Roution to check if need disable keyboard or not +// from IntelAMT extersion ASF Boot Option Message. +// +// Input: +// +// Output: +// +// Notes: +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +LockLegacyKBD +( + IN EFI_EVENT Event, + IN VOID *Context +) +{ + // 1. Hook Int 9h for locking local keyboard but keep the Legacy SOL + // working in CSM and Legacy OS. +#if (defined(CSM_SUPPORT) && (CSM_SUPPORT != 0)) + LegacyBiosLockLocalKeyboard (); +#endif +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: AMTLOCKKBDEntryPoint +// +// Description: Lock keyboard Entrypoint. +// +// Input: +// +// Output: +// +// Notes: +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS AMTLOCKKBDEntryPoint( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + EFI_STATUS Status; + EFI_EVENT ConInConnectEvt; + VOID *ConInNotifyReg; + EFI_EVENT ConInExConnectEvt; + VOID *ConInExNotifyReg; + EFI_EVENT AllDriverConnectEvt; + VOID *AllDriverExNotifyReg; + + EFI_GUID gEfiAlertStandardFormatProtocolGuid = EFI_ALERT_STANDARD_FORMAT_PROTOCOL_GUID; + EFI_ALERT_STANDARD_FORMAT_PROTOCOL *Asf; + EFI_ASF_BOOT_OPTIONS *mAsfBootOptions; + + InitAmiLib(ImageHandle, SystemTable); + Status = pBS->LocateProtocol (&gEfiAlertStandardFormatProtocolGuid, \ + NULL, &Asf ); + if (EFI_ERROR (Status)) return Status; + + Status = Asf->GetBootOptions (Asf, &mAsfBootOptions); + if (EFI_ERROR (Status)) return Status; + + // If not Lock keyboard, return !! + if (mAsfBootOptions->BootOptions & 0x20) { + + Status = RegisterProtocolCallback( + &gEfiSimpleTextInExProtocolGuid, + EventAllConsoleDevicesStarted, + NULL, + &ConInExConnectEvt, + &ConInExNotifyReg); + + Status = RegisterProtocolCallback( + &gEfiSimpleTextInProtocolGuid, + EventAllConsoleDevicesStarted, + NULL, + &ConInConnectEvt, + &ConInNotifyReg); + + Status = RegisterProtocolCallback( + &gBdsAllDriversConnectedProtocolGuid, + LockLegacyKBD, + NULL, + &AllDriverConnectEvt, + &AllDriverExNotifyReg); + + } + if (mAsfBootOptions->BootOptions & 0x2) ASFRegisterPowerButtonCallBack (); + return EFI_SUCCESS; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.cif b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.cif new file mode 100644 index 0000000..33e5afa --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.cif @@ -0,0 +1,13 @@ +<component> + name = "AmtLockKBD" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\AmtLockKBD\" + RefName = "AmtLockKBD" +[files] +"AmtLockKBD.sdl" +"AmtLockKBD.mak" +"AmtLockKBD.c" +"AmtLockKBD.h" +"AmtLockKBD.dxs" +"AmtInt9.asm" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.dxs b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.dxs new file mode 100644 index 0000000..87b05c8 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.dxs @@ -0,0 +1,6 @@ +#include <ReferenceCode\ME\Protocol\AlertStandardFormat\AlertStandardFormat.h> + +DEPENDENCY_START + EFI_ALERT_STANDARD_FORMAT_PROTOCOL_GUID +DEPENDENCY_END + diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.h b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.h new file mode 100644 index 0000000..6e23ec6 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.h @@ -0,0 +1,77 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtLockKBD/AmtLockKBD.h 1 2/08/12 1:10a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:10a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtLockKBD/AmtLockKBD.h $ +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 1 2/25/11 1:45a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTLockKBD.h +// +// Description: AMT Lock KeyBoard Includes. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#ifndef _AMT_INT16_H +#define _AMT_INT16_H + +#include "Tiano.h" +#include "EfiDriverLib.h" +#include "Protocol\AmtWrapper\AmtWrapper.h" + +#include EFI_PROTOCOL_CONSUMER (AmtWrapper) +#include EFI_PROTOCOL_CONSUMER (LegacyBios) + +#define AMT_INT16_CSM_GUID \ + {0x6046e678, 0x24ef, 0x4005, 0xba, 0x39, 0xbd, 0xa1, 0x1f, 0x6d, 0x55, 0x5d} + +EFI_GUID gEfiFirmwareVolumeProtocolGuid = EFI_FIRMWARE_VOLUME_PROTOCOL_GUID; +EFI_GUID gAmtInt16CsmGuid = AMT_INT16_CSM_GUID; +EFI_GUID gLegacyBiosProtocolGuid = EFI_LEGACY_BIOS_PROTOCOL_GUID; +EFI_GUID gEfiAmtWrapperProtocolGuid = EFI_AMT_WRAPPER_PROTOCOL_GUID; +EFI_GUID gEfiEventReadyToBootGuid = EFI_EVENT_GROUP_READY_TO_BOOT; + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.mak b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.mak new file mode 100644 index 0000000..0680ae3 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.mak @@ -0,0 +1,88 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtLockKBD/AmtLockKBD.mak 1 2/08/12 1:10a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:10a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtLockKBD/AmtLockKBD.mak $ +# +# 1 2/08/12 1:10a Klzhan +# Initial Check in +# +# 1 2/25/11 1:45a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:11a Klzhan +# Initial Check-in. +# +#********************************************************************** + +#<AMI_FHDR_START> +#--------------------------------------------------------------------------- +# Name: AMTLockKBD.mak +# +# Description: AMT Lock KeyBoard. +# +#--------------------------------------------------------------------------- +#<AMI_FHDR_END> +all : AMTLOCKKBD $(BUILD_DIR)\AmtInt9.obj + +AMT_LOCKKBD_BUILD_DIR = $(BUILD_DIR)\$(AmtLockKBD_DIR) + +#--------------------------------------------------------------------------- +# Generic AMT dependencies +#--------------------------------------------------------------------------- +$(BUILD_DIR)\AmtLockKBD.mak : $(AmtLockKBD_DIR)\AmtLockKBD.cif $(BUILD_RULES) + $(CIF2MAK) $(AmtLockKBD_DIR)\AmtLockKBD.cif $(CIF2MAK_DEFAULTS) + +$(BUILD_DIR)\AmtInt9.obj: $(AmtLockKBD_DIR)\AmtInt9.asm + $(ASM16) /c /nologo /Fo$(BUILD_DIR)\ $(AmtLockKBD_DIR)\AmtInt9.asm + +#--------------------------------------------------------------------------- + +AMT_LOCKKBD_OBJECTS = \ +$(BUILD_DIR)\$(AmtLockKBD_DIR)\AmtLockKBD.obj + +#--------------------------------------------------------------------------- +# Create ASF Verbosity DXE Component +#--------------------------------------------------------------------------- +AMTLOCKKBD: $(BUILD_DIR)\AmtLockKBD.mak AMTLOCKKBDBin + +AMTLOCKKBDBin : $(AMIDXELIB) + $(MAKE) /$(MAKEFLAGS) $(BUILD_DEFAULTS)\ + /f $(BUILD_DIR)\AmtLockKBD.mak all\ + MAKEFILE=$(BUILD_DIR)\AmtLockKBD.mak \ + OBJECTS="$(AMT_LOCKKBD_OBJECTS)" \ + GUID=5507247A-846B-4f22-B55F-72B4049435EF \ + ENTRY_POINT=AMTLOCKKBDEntryPoint \ + TYPE=BS_DRIVER \ + COMPRESS=1 +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.sdl b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.sdl new file mode 100644 index 0000000..ad810bd --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtLockKBD/AmtLockKBD.sdl @@ -0,0 +1,38 @@ +TOKEN + Name = "AmtLockKBD_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes + Help = "Main switch to enable AmtInt16 support in Project" +End + +MODULE + Help = "Includes AmtInt16.mak to Project" + File = "AmtLockKBD.mak" +End + +PATH + Name = "AmtLockKBD_DIR" +End + +ELINK + Name = "AMTINT09Proc" + Parent = "CsmOemInterrupts" + ProcID = 09h + SrcFile = "Board\EM\MEWrapper\AmtWrapper\Dxe\AmtInt9.asm" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\AmtInt9.obj" + Parent = "CSM_OEMINT_OBJS" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\AmtLockKBD.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.c b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.c new file mode 100644 index 0000000..774d8f9 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.c @@ -0,0 +1,863 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/AmtPetAlert.c 8 6/18/14 3:16a Larryliu $ +// +// $Revision: 8 $ +// +// $Date: 6/18/14 3:16a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/AmtPetAlert.c $ +// +// 8 6/18/14 3:16a Larryliu +// [TAG] EIP173999 +// [Category] Improvement +// [Description] [HWR]Remove useless comments from Intel ME +// component.(except RC) +// [Files] AmtPetAlert.c +// +// 6 5/14/14 9:38p Tristinchou +// [TAG] EIP160730 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 5 12/25/12 12:56a Klzhan +// Fix AMT_TC007 fail. +// +// 4 11/07/12 8:45a Klzhan +// Improvement : Set Booted HDD as expected Boot device +// +// 3 9/19/12 6:58a Klzhan +// Correct PET Alert behavior. +// +// 2 6/05/12 2:33a Klzhan +// [TAG] EIP90325 +// [Category] Improvement +// [Description] To pass Win8 SCT test. +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 2 6/30/11 5:49a Klzhan +// Fix AMT TC007 fail with Fixed bootorder. +// +// 1 2/25/11 1:45a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AmtPetAlert.c +// +// Description: AMT Pet Alert Functions. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "AmtPetAlert.h" +#include <ReferenceCode\ME\Protocol\AlertStandardFormat\AlertStandardFormat.h> + +EFI_GUID gEfiAmtWrapperProtocolGuid = EFI_AMT_WRAPPER_PROTOCOL_GUID; +EFI_GUID gEfiSetupGuid = SETUP_GUID; +EFI_GUID gEfiGlobalVariableGuid = EFI_GLOBAL_VARIABLE_GUID; +EFI_GUID gEfiLegacyBiosProtocolGuid = EFI_LEGACY_BIOS_PROTOCOL_GUID; +EFI_GUID gEfiEventReadyToBootGuid = EFI_EVENT_GROUP_READY_TO_BOOT; +EFI_GUID gEfiDiskInfoProtocolGuid = EFI_DISK_INFO_PROTOCOL_GUID; +EFI_GUID gEfiDevicePathProtocolGuid = EFI_DEVICE_PATH_PROTOCOL_GUID; +EFI_GUID gEfiHeciProtocolGuid = HECI_PROTOCOL_GUID; +EFI_GUID gEfiBlockIoProtocolGuid = EFI_BLOCK_IO_PROTOCOL_GUID; +EFI_GUID gEfiSimpleFileSystemProtocolGuid = EFI_SIMPLE_FILE_SYSTEM_PROTOCOL_GUID; + +VOID +InitializeAmtPetAlert ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + EFI_STATUS Status; + EFI_EVENT ReadyToBootEvent; + EFI_EVENT LegacyBootEvent; + + EfiInitializeDriverLib (ImageHandle, SystemTable); + + // + // Register Ready to Boot Event for AMT Wrapper + // + Status = EfiCreateEventReadyToBoot( + EFI_TPL_CALLBACK, + AmtPetAlertReadyToBoot, + (VOID *)&ImageHandle, + &ReadyToBootEvent + ); + + Status = EfiCreateEventLegacyBoot( + EFI_TPL_CALLBACK, + AmtPetAlertLegacyBoot, + NULL, + &LegacyBootEvent + ); + + return; +} + +VOID SwapEntries ( + IN CHAR8 *Data, + IN UINT16 Size +) +{ + UINT16 Index; + CHAR8 Temp8; + + for (Index = 0; (Index+1) < Size; Index+=2) { + Temp8 = Data[Index]; + Data[Index] = Data[Index + 1]; + Data[Index + 1] = Temp8; + } +} + +CHAR8 * +ConvertChar16ToChar8 ( + IN CHAR16 *Src +) +{ + UINTN l; + CHAR8 *Output; + CHAR8 *Dest; + EFI_STATUS Status; + + l = EfiStrLen(Src) + 1; + Status = gBS->AllocatePool( + EfiBootServicesData, + l, + &Output + ); + ASSERT_EFI_ERROR(Status); + + Dest = Output; + while (*Src) { + *Dest++ = (UINT8) (*Src++); + } + *Dest = 0; + + return Output; +} + +// Example 1: 16 10 0F 6F 02 68 08 FF FF 00 00 40 13 XX XX XX +// Example 2: 15 10 0F 6F 02 68 10 FF FF 22 00 AA 13 03 03 02 +BOOT_AUDIT_ENTRY PetAlertWithoutChange = { + 0x15, 0x10, 0x0F, 0x6F, 0x02, 0x68, 0x08, 0xFF, 0xFF, 0x22, 0x00, 0x40, 0x13, 0x00, 0x00, 0x00 +}; + +BOOT_AUDIT_ENTRY PetAlertWithChange = { + 0x15, 0x10, 0x0F, 0x6F, 0x02, 0x68, 0x10, 0xFF, 0xFF, 0x22, 0x00, 0xAA, 0x13, 0x03, 0x03, 0x02 +}; + +EFI_STATUS +SendBaeMessage( + BOOT_AUDIT_ENTRY *Buffer +) +{ + EFI_HECI_PROTOCOL *Heci; + UINT32 HeciLength; + BOOT_AUDIT_ENTRY_PACK Pack; + UINT32 MeStatus; + EFI_STATUS TempStatus; + EFI_STATUS Status; + + gBS->CopyMem(&Pack.Data, Buffer, sizeof(BOOT_AUDIT_ENTRY)); + Pack.Command = EFI_ASF_MESSAGE_COMMAND_MESSAGE; // 0x04 + Pack.ByteCount = sizeof(BOOT_AUDIT_ENTRY); + HeciLength = sizeof(BOOT_AUDIT_ENTRY_PACK); // length include Command & ByteCount + + Status = gBS->LocateProtocol ( + &gEfiHeciProtocolGuid, + NULL, + &Heci + ); + if (!EFI_ERROR(Status)) { + TempStatus = Heci->GetMeStatus(&MeStatus); + ASSERT_EFI_ERROR(TempStatus); + + // + // Only send ASF Push Progress code when ME is ready. Ignore FW Init Status. + // + if (ME_STATUS_ME_STATE_ONLY(MeStatus) == ME_READY) { + Status = Heci->SendMsg( + (UINT32*)&Pack, + HeciLength, + BIOS_ASF_HOST_ADDR, + HECI_ASF_MESSAGE_ADDR + ); + if (EFI_ERROR(Status)) { + + } + } else { + + } + } else { + + } + + return Status; +} + +EFI_STATUS +PetAlert( + UINT8 DeviceType, + CHAR8 *HarddriveTag +) +{ + PET_ALERT_CFG PetAlertCfg[4]; + UINTN VarSize; + UINT32 VarAttr; + BOOLEAN BootChange = FALSE; + EFI_STATUS Status; + UINT8 BootHDD = 0, i; + + VarSize = sizeof(PetAlertCfg); + Status = gRT->GetVariable ( + L"PetAlertCfg", + &gEfiAmtWrapperProtocolGuid, + &VarAttr, + &VarSize, + &PetAlertCfg + ); + if (EFI_ERROR (Status)) { + VarAttr = EFI_VARIABLE_NON_VOLATILE | EFI_VARIABLE_BOOTSERVICE_ACCESS; + + PetAlertCfg[0].BootQueue = DeviceType; + PetAlertCfg[1].BootQueue = DeviceType; + PetAlertCfg[2].BootQueue = DeviceType; + PetAlertCfg[3].BootQueue = DeviceType; + + if(DeviceType == BBS_TYPE_HARDDRIVE) + EfiAsciiStrCpy(PetAlertCfg[0].BootHarddriveTag, HarddriveTag); + else + EfiAsciiStrCpy(PetAlertCfg[0].BootHarddriveTag, ""); + EfiAsciiStrCpy(PetAlertCfg[1].BootHarddriveTag, ""); + EfiAsciiStrCpy(PetAlertCfg[2].BootHarddriveTag, ""); + EfiAsciiStrCpy(PetAlertCfg[3].BootHarddriveTag, ""); + BootChange = TRUE; + }else + { + if(DeviceType != BBS_HARDDISK) + BootChange = TRUE; + else + // If Boot HDD, check ModelSerialNumber + { + // last boot is not HD boot + if(PetAlertCfg[0].BootQueue != DeviceType) + { + BootChange = TRUE; + }else + { + // If this HDD is "excepted" or not + for(i = 0 ; i < 4 ; i++) + { + if((!EfiAsciiStrCmp(HarddriveTag,PetAlertCfg[i].BootHarddriveTag))) + BootHDD++; + } + // Not "Excepted", Set BootChanged + if(BootHDD == 0) + BootChange = TRUE; + } + } + if((DeviceType == BBS_HARDDISK) && BootChange) + PetAlertWithChange.EventData3 = 0x02; + // Not Frist Boot, update PET BAE variable. + PetAlertCfg[3].BootQueue = PetAlertCfg[2].BootQueue; + PetAlertCfg[2].BootQueue = PetAlertCfg[1].BootQueue; + PetAlertCfg[1].BootQueue = PetAlertCfg[0].BootQueue; + PetAlertCfg[0].BootQueue = DeviceType; + + // Update for HDD string + EfiAsciiStrCpy(PetAlertCfg[3].BootHarddriveTag, PetAlertCfg[2].BootHarddriveTag); + EfiAsciiStrCpy(PetAlertCfg[2].BootHarddriveTag, PetAlertCfg[1].BootHarddriveTag); + EfiAsciiStrCpy(PetAlertCfg[1].BootHarddriveTag, PetAlertCfg[0].BootHarddriveTag); + EfiAsciiStrCpy(PetAlertCfg[0].BootHarddriveTag, HarddriveTag); + } + + if (BootChange) + SendBaeMessage(&PetAlertWithChange); + else + SendBaeMessage(&PetAlertWithoutChange); + + VarSize = sizeof(PetAlertCfg); + Status = gRT->SetVariable ( + L"PetAlertCfg", + &gEfiAmtWrapperProtocolGuid, + VarAttr, + VarSize, + PetAlertCfg + ); + + return Status; +} + +BOOLEAN +ComparePathNode( + IN EFI_DEVICE_PATH_PROTOCOL *PathNode1, + IN EFI_DEVICE_PATH_PROTOCOL *PathNode2 +) +{ + BOOLEAN st = FALSE; + UINTN Size1, Size2; + UINT8 *p1, *p2; + + if (PathNode1 == PathNode2) { + st = TRUE; + } else if (PathNode1 == NULL) { + } else if (PathNode2 == NULL) { + } else { + Size1 = DevicePathNodeLength(PathNode1); + Size2 = DevicePathNodeLength(PathNode2); + p1 = (UINT8 *)PathNode1; + p2 = (UINT8 *)PathNode2; + if ((Size1 == Size2) + && (DevicePathType(PathNode1) == DevicePathType(PathNode2)) + && (EfiCompareMem(p1+1, p2+1, Size1-1) == 0)) { + st = TRUE; + } + } + + return st; +} + +UINT8 +GetDeviceType( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath + ) +{ + UINT8 DeviceType = 0; + EFI_DEVICE_PATH_PROTOCOL *DevPathNode; + + // + // Find HDD Node in BootDevPath + // + DevPathNode = BdsLibUnpackDevicePath(DevPath); + ASSERT (DevPathNode); + + while (!IsDevicePathEnd(DevPathNode)) { + if (DevicePathType(DevPathNode) == MEDIA_DEVICE_PATH) { + if (DevicePathSubType(DevPathNode) == MEDIA_HARDDRIVE_DP) { + DeviceType = BBS_TYPE_HARDDRIVE; // 2 + break; + } else if (DevicePathSubType(DevPathNode) == MEDIA_CDROM_DP) { + DeviceType = BBS_TYPE_CDROM; // 3 + break; + } else if (DevicePathSubType(DevPathNode) == MEDIA_FILEPATH_DP) { + DeviceType = BBS_TYPE_FLOPPY; // 1 + break; + } + } + // + // Next device path node + // + DevPathNode = NextDevicePathNode(DevPathNode); + } + + return DeviceType; +} + +EFI_DEVICE_PATH_PROTOCOL * +GetMediaPathNode ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath +) +{ + EFI_DEVICE_PATH_PROTOCOL *DevPathNode; + EFI_DEVICE_PATH_PROTOCOL *MediaPathNode = NULL; + + // + // Find HDD Node in BootDevPath + // + DevPathNode = BdsLibUnpackDevicePath(DevPath); + ASSERT (DevPathNode); + + while (!IsDevicePathEnd(DevPathNode)) { + if (DevicePathType(DevPathNode) == MEDIA_FILEPATH_DP) { + MediaPathNode = DevPathNode; + break; + } + // + // Next device path node + // + DevPathNode = NextDevicePathNode(DevPathNode); + } + + return MediaPathNode; +} + +BOOLEAN +CompareMediaPathNode( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath1, + IN EFI_DEVICE_PATH_PROTOCOL *DevPath2 +) +{ + EFI_DEVICE_PATH_PROTOCOL *PathNode1; + EFI_DEVICE_PATH_PROTOCOL *PathNode2; + BOOLEAN st = FALSE; + + PathNode1 = GetMediaPathNode(DevPath1); + PathNode2 = GetMediaPathNode(DevPath2); + st = ComparePathNode(PathNode1, PathNode2); + + return st; +} + +VOID +Trim( + CHAR8 *sDesc, + CHAR8 *sSrc +) +{ + UINTN p1 ,p2; + CHAR8 ch; + UINTN i,l; + + p1 = 0xFF; + p2 = 0xFF; + i = 0; + for(;;) { + ch = *(sSrc+i); + if (ch == 0) { + break; + } else if (ch != 0x20) { + p2 = i; + if (p1 == 0xFF) { + p1 = i; + } + } + i++; + } + + l = (p2 - p1) + 1; + gBS->CopyMem(sDesc, sSrc+p1, l); + *(sDesc+l) = 0; +} + +EFI_STATUS +GetModelSerialNumber( + IN EFI_HANDLE Handle, + OUT CHAR8 *ModelSerialNumber +) +{ + EFI_STATUS Status = EFI_NOT_FOUND; + EFI_DISK_INFO_PROTOCOL *DiskInfo; + IDENTIFY_DATA *IdentifyDriveInfo = NULL; + UINT32 BufferSize; + CHAR8 ModelNumber[42]; + CHAR8 SerialNumber[22]; + EFI_DEVICE_PATH_PROTOCOL *DevicePath = NULL; + + EfiAsciiStrCpy(ModelSerialNumber, ""); + + for(;;) { + Status = gBS->HandleProtocol( + Handle, + &gEfiDevicePathProtocolGuid, + &DevicePath); + if (EFI_ERROR(Status)) + break; + + Status = gBS->LocateDevicePath ( + &gEfiDiskInfoProtocolGuid, + &DevicePath, + &Handle + ); + if (EFI_ERROR (Status)) { + break; + } + + Status = gBS->HandleProtocol ( + Handle, + &gEfiDiskInfoProtocolGuid, + &DiskInfo + ); + if (EFI_ERROR(Status)) + break; + + Status = gBS->AllocatePool( + EfiBootServicesData, + sizeof (IDENTIFY_DATA), + &IdentifyDriveInfo + ); + if (EFI_ERROR(Status)) + break; + + gBS->SetMem(IdentifyDriveInfo, sizeof (IDENTIFY_DATA), 0); + BufferSize = sizeof (IDENTIFY_DATA); + Status = DiskInfo->Identify ( + DiskInfo, + IdentifyDriveInfo, + &BufferSize + ); + if (EFI_ERROR(Status)) + break; + + gBS->CopyMem(SerialNumber, IdentifyDriveInfo->Serial_Number_10, 20); + SwapEntries (SerialNumber, 20); + SerialNumber[20] = '\0'; + Trim(SerialNumber, SerialNumber); + + gBS->CopyMem(ModelNumber, IdentifyDriveInfo->Model_Number_27, 40); + SwapEntries (ModelNumber, 40); + ModelNumber[40] = '\0'; + Trim(ModelNumber, ModelNumber); + + EfiAsciiStrCpy(ModelSerialNumber, ModelNumber); + EfiAsciiStrCat(ModelSerialNumber, "_"); + EfiAsciiStrCat(ModelSerialNumber, SerialNumber); + + Status = EFI_SUCCESS; + break; + } + + if (IdentifyDriveInfo != NULL) + gBS->FreePool(IdentifyDriveInfo); + + return Status; +} + +EFI_DEVICE_PATH_PROTOCOL * +GetDevicePathFromBBS( + UINT8 DeviceType, + CHAR8 *ModelSerialNumber + +) +{ + EFI_LEGACY_BIOS_PROTOCOL *LegacyBios; + UINT16 HddCount = 0; + HDD_INFO *LocalHddInfo = NULL; + UINT16 BbsCount = 0; + BBS_TABLE *BbsTable; + EFI_STATUS Status; + BBS_TABLE *BbsEntry; + EFI_DEVICE_PATH_PROTOCOL *DevicePath = NULL; + UINTN i; + EFI_HANDLE Handle; + UINTN DeviceIndex; + UINTN DevicePriority; + + Status = gBS->LocateProtocol (&gEfiLegacyBiosProtocolGuid, NULL, &LegacyBios); + if (!EFI_ERROR (Status)) { + Status = LegacyBios->GetBbsInfo ( + LegacyBios, + &HddCount, + &LocalHddInfo, + &BbsCount, + &BbsTable + ); + if (!EFI_ERROR (Status)) { + // + // Find match index by prioridy + // + DeviceIndex = (UINTN)-1; + DevicePriority = (UINTN)-1; + for (i = 0; i < BbsCount; i++) { + BbsEntry = BbsTable+i; + if (BbsEntry->BootPriority == BBS_IGNORE_ENTRY) + continue; + if (BbsEntry->DeviceType == DeviceType) { + if (DevicePriority > BbsEntry->BootPriority) { + DevicePriority = BbsEntry->BootPriority; + DeviceIndex = i; + } + } + } + + // + // Get model and serial number + // + if (DeviceIndex != (UINTN)-1) { + BbsEntry = BbsTable + DeviceIndex; + Handle = *(VOID**)(&BbsEntry->IBV1); + GetModelSerialNumber(Handle, ModelSerialNumber); + } + } + } + + return DevicePath; +} + +EFI_STATUS +NotifyPetAlert( + EFI_EVENT Event, + VOID *ParentImageHandle +) +{ + EFI_STATUS Status = EFI_SUCCESS; + UINTN i; + UINT16 BootCurrent; + UINTN VarSize; + CHAR16 BootXXXX[16]; + EFI_LOAD_OPTION *BootOption = NULL; + UINT8 *pDP; + BBS_BBS_DEVICE_PATH *bDP; // DP for BBS + UINTN LegacyBoot = 1; + EFI_DEVICE_PATH_PROTOCOL *BootDevicePath = NULL; + UINT8 DeviceType; + CHAR8 ModelSerialNumber[64]; + EFI_ASF_BOOT_OPTIONS *mAsfBootOptions; + EFI_ALERT_STANDARD_FORMAT_PROTOCOL *Asf; + EFI_GUID gEfiAlertStandardFormatProtocolGuid = EFI_ALERT_STANDARD_FORMAT_PROTOCOL_GUID; + + Status = gBS->LocateProtocol ( + &gEfiAlertStandardFormatProtocolGuid, + NULL, + &Asf + ); + + if (EFI_ERROR (Status)) return Status; + Status = Asf->GetBootOptions (Asf, &mAsfBootOptions); + if (EFI_ERROR (Status)) mAsfBootOptions = NULL; + + EfiAsciiStrCpy(ModelSerialNumber, ""); + + // + // BootCurrent + // + VarSize = sizeof (UINT16); + Status = gRT->GetVariable ( + L"BootCurrent", + &gEfiGlobalVariableGuid, + NULL, + &VarSize, + &BootCurrent + ); + if (!EFI_ERROR (Status)) { + } else { + BootCurrent = 0; + } + + SPrint(BootXXXX, sizeof(BootXXXX), L"Boot%04x", BootCurrent); + + VarSize = 0; + Status = gRT->GetVariable ( + BootXXXX, + &gEfiGlobalVariableGuid, + NULL, + &VarSize, + NULL + ); + if (Status != EFI_BUFFER_TOO_SMALL) { + return Status; + } + + // + // Allocate Memory for BootXXXX + // + Status = gBS->AllocatePool( + EfiBootServicesData, + VarSize, + &BootOption + ); + ASSERT_EFI_ERROR(Status); + + Status = gRT->GetVariable ( + BootXXXX, + &gEfiGlobalVariableGuid, + NULL, + &VarSize, + BootOption + ); + if (!EFI_ERROR (Status)) { + pDP = (UINT8*)(BootOption+1); + pDP += (EfiStrLen((CHAR16*)pDP) + 1) * sizeof(CHAR16); + + BootDevicePath = EfiDuplicateDevicePath((EFI_DEVICE_PATH_PROTOCOL *)pDP); + + // + // Free Memory for BootXXXX + // + if (BootOption != NULL) { + gBS->FreePool(BootOption); + BootOption = NULL; + } + } + + if (BootDevicePath != NULL) { + bDP = (BBS_BBS_DEVICE_PATH *)BootDevicePath; + if (bDP->Header.Type == BBS_DEVICE_PATH && bDP->Header.SubType == BBS_BBS_DP) { + LegacyBoot = 1; + } else { + LegacyBoot = 0; + } + } + + //------------------------------------------------------------------------- + // EFI Boot + //------------------------------------------------------------------------- + if (LegacyBoot == 0) { + UINTN HandleCount; + EFI_HANDLE *HandleBuffer; + EFI_HANDLE Handle; + EFI_DEVICE_PATH_PROTOCOL *DPath; + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + EFI_DEVICE_PATH_PROTOCOL *BootDeviceHandle; + + if (BootDevicePath == NULL) { + // + // Boot to EFI Shell + // + //Need Save "BootXXXX" in setup when launch entry after add boot option without Save + } + else { + DevicePath = EfiDuplicateDevicePath(BootDevicePath); + Status = gBS->LocateDevicePath ( + &gEfiSimpleFileSystemProtocolGuid, + &DevicePath, + &BootDeviceHandle + ); + if (EFI_ERROR (Status)) { + BootDeviceHandle = NULL; + } + + Status = gBS->LocateHandleBuffer ( + ByProtocol, + &gEfiSimpleFileSystemProtocolGuid, + NULL, + &HandleCount, + &HandleBuffer + ); + if (!EFI_ERROR (Status)) { + for (i = 0; i < HandleCount; i ++) { + BOOLEAN st; + + Handle = HandleBuffer[i]; + Status = gBS->HandleProtocol ( + Handle, + &gEfiDevicePathProtocolGuid, + &DPath + ); + if (!EFI_ERROR (Status)) { + // + // !!! CompareMedia only work with HDD & CD-ROM !!! + // + st = CompareMediaPathNode(BootDevicePath, DPath); + if (st == FALSE) { + // + // for USB MassStorage + // + if (Handle == BootDeviceHandle) { + st = TRUE; + } + } + + if (st) { + DeviceType = GetDeviceType(BootDevicePath); + + if (DeviceType == BBS_TYPE_HARDDRIVE) { + GetModelSerialNumber(Handle, ModelSerialNumber); + } else { + EfiAsciiStrCpy(ModelSerialNumber, ""); + } + PetAlert(DeviceType, ModelSerialNumber); + } + } + } + if (HandleBuffer != NULL) { + gBS->FreePool (HandleBuffer); + } + } + } + } + //------------------------------------------------------------------------- + // Legacy Boot + //------------------------------------------------------------------------- + else { + if (BootDevicePath != NULL) { + bDP = (BBS_BBS_DEVICE_PATH *)BootDevicePath; + DeviceType = (UINT8) bDP->DeviceType; + } else { + DeviceType = BBS_TYPE_HARDDRIVE; + } + if ((mAsfBootOptions != NULL) && (mAsfBootOptions->SubCommand == 0x16)) { + switch (mAsfBootOptions->SpecialCommand ) { + case 1: DeviceType = BBS_TYPE_EMBEDDED_NETWORK; + break; + case 2: + case 3: DeviceType = BBS_TYPE_HARDDRIVE; + break; + case 5: DeviceType = BBS_TYPE_CDROM; + break; + } + } + + switch (DeviceType) { + case BBS_TYPE_EMBEDDED_NETWORK: + case BBS_TYPE_FLOPPY: + case BBS_TYPE_CDROM: + PetAlert(DeviceType, NULL); + break; + + case BBS_TYPE_HARDDRIVE: + GetDevicePathFromBBS(BBS_TYPE_HARDDRIVE, ModelSerialNumber); + PetAlert(DeviceType, ModelSerialNumber); + break; + + default: + // + // Add code for process if run here + // + PetAlert(DeviceType, NULL); + break; + } + } + + return Status; +} + +EFI_STATUS +AmtPetAlertReadyToBoot( + EFI_EVENT Event, + VOID *ParentImageHandle +) +{ + EFI_STATUS Status = EFI_SUCCESS; + + Status = NotifyPetAlert(Event, ParentImageHandle); + + return Status; +} + +EFI_STATUS +AmtPetAlertLegacyBoot( + EFI_EVENT Event, + VOID *ParentImageHandle +) +{ + EFI_STATUS Status = EFI_SUCCESS; + + return Status; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.cif b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.cif new file mode 100644 index 0000000..d346ae9 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.cif @@ -0,0 +1,14 @@ +<component> + name = "AmtPetAlert" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\AmtPetAlert\" + RefName = "AmtPetAlert" +[files] +"AmtPetAlert.sdl" +"AmtPetAlert.mak" +"AmtPetAlert.c" +"AmtPetAlert.h" +"AmtPetAlert.dxs" +"DevicePath.h" +"DevicePath.c" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.dxs b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.dxs new file mode 100644 index 0000000..29ac1c9 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.dxs @@ -0,0 +1,68 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/AmtPetAlert.dxs 1 2/08/12 1:10a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:10a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/AmtPetAlert.dxs $ +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 1 2/25/11 1:45a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AmtPeiAlert.dxs +// +// Description: This file is the dependency file for AmtPetAlert driver. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include <Protocol\Variable.h> + +#include EFI_PROTOCOL_DEFINITION (ActiveManagement) +#include EFI_PROTOCOL_DEFINITION (Heci) + +DEPENDENCY_START + EFI_HECI_PROTOCOL_GUID AND + EFI_ACTIVE_MANAGEMENT_PROTOCOL_GUID AND + EFI_VARIABLE_ARCH_PROTOCOL_GUID AND + EFI_VARIABLE_WRITE_ARCH_PROTOCOL_GUID +DEPENDENCY_END + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.h b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.h new file mode 100644 index 0000000..de37961 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.h @@ -0,0 +1,205 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/AmtPetAlert.h 1 2/08/12 1:10a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:10a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/AmtPetAlert.h $ +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 1 2/25/11 1:45a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AmtPetAlert.h +// +// Description: Header file of AmtPetAlert module. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#ifndef __AMT_PET_ALERT_H__ +#define __AMT_PET_ALERT_H__ + +#include "Tiano.h" +#include "EfiDriverLib.h" +#include "EfiPrintLib.h" +#include "EfiCommonLib.h" +#include "Amt.h" +#include "EfiScriptLib.h" +#include "AmtLib.h" +#include "MeLib.h" +#include "Include\Protocol\PDiskInfo.h" +#include "DevicePath.h" +#include "HeciRegs.h" + +#include EFI_PROTOCOL_CONSUMER (AmtPlatformPolicy) +#include EFI_PROTOCOL_CONSUMER (AmtWrapper) +#include EFI_PROTOCOL_CONSUMER (DiskInfo) +#include EFI_PROTOCOL_CONSUMER (Heci) +#include EFI_PROTOCOL_CONSUMER (BlockIo) +#include EFI_PROTOCOL_CONSUMER (SimpleFileSystem) +#include EFI_PROTOCOL_DEFINITION (LegacyBios) +#include EFI_GUID_DEFINITION (GlobalVariable) + +#define SETUP_GUID { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } +//#define EFI_GLOBAL_VARIABLE_GUID { 0x8BE4DF61, 0x93CA, 0x11D2, 0xAA, 0x0D, 0x00, 0xE0, 0x98, 0x03, 0x2B, 0x8C } + +// Based on ATA/ATAPI-6 +typedef struct _IDENTIFY_DATA{ + + UINT16 General_Config_0; + UINT16 Reserved_1; + UINT16 Special_Config_2; + UINT16 Reserved_3; + UINT16 Reserved_4; + UINT16 Reserved_5; + UINT16 Reserved_6; + UINT16 Reserved_7; + UINT16 Reserved_8; + UINT16 Reserved_9; + UINT8 Serial_Number_10[20]; + UINT16 Reserved_20; + UINT16 Reserved_21; + UINT16 Reserved_22; + UINT8 Firmware_Revision_23[8]; + UINT8 Model_Number_27[40]; + UINT16 Maximum_Sector_Multiple_Command_47; + UINT16 Reserved_48; + UINT16 Capabilities_49; + UINT16 Capabilities_50; + UINT16 PIO_Mode_51; + UINT16 Reserved_52; + UINT16 Valid_Bits_53; + UINT16 Reserved_54_58[5]; + UINT16 Valid_Bits_59; + UINT32 Addressable_Sector_60; + UINT16 SingleWord_DMA_62; + UINT16 MultiWord_DMA_63; + UINT16 PIO_Mode_64; + UINT16 Min_Multiword_DMA_timing_65; + UINT16 Manuf_Multiword_DMA_timing_66; + UINT16 Min_PIO_Mode_timing_67; + UINT16 Min_PIO_Mode_timing_68; + UINT16 Reserved_69_74[6]; + UINT16 Queue_Depth_75; + UINT16 Reserved_76_79[4]; + UINT16 Major_Revision_80; + UINT16 Minor_Revision_81; + UINT16 Command_Set_Supported_82; + UINT16 Command_Set_Supported_83; + UINT16 Command_Set_Supported_84; + UINT16 Command_Set_Enabled_85; + UINT16 Command_Set_Enabled_86; + UINT16 Command_Set_Enabled_87; + UINT16 UDMA_Mode_88; + UINT16 Time_security_Earse_89; + UINT16 Time_Esecurity_Earse_90; + UINT16 Current_Power_Level_91; + UINT16 Master_Password_Rev_92; + UINT16 Hard_Reset_Value_93; + UINT16 Acoustic_Level_94; + UINT16 Reserved_95_99[5]; + UINT64 LBA_48; + UINT16 Reserved_104_126[23]; + UINT16 Status_Notification_127; + UINT16 Security_Status_128; + UINT16 Reserved_129_159[31]; + UINT16 CFA_Power_Mode_160; + UINT16 Reserved_161_175[15]; + UINT16 Media_Serial_Number_176_205[30]; + UINT16 Reserved_206_254[49]; + UINT16 Checksum_255; +} IDENTIFY_DATA; + +#pragma pack(push,1) +typedef struct { + UINT32 Attributes; + UINT16 FilePathListLength; +} EFI_LOAD_OPTION; + +// Example 1: 16 10 0F 6F 02 68 08 FF FF 00 00 40 13 XX XX XX +// Example 2: 15 10 0F 6F 02 68 10 FF FF 22 00 AA 13 03 03 02 + +typedef struct { + UINT8 SubCommand; // 0x00 + UINT8 VersionNumber; // 0x01 + UINT8 EventSensorType; // 0x02 + UINT8 EventType; // 0x03 + UINT8 EventOffset; // 0x04 + UINT8 EventSourceType; // 0x05 + UINT8 EventSeverity; // 0x06 + UINT8 SensorDevice; // 0x07 + UINT8 Sensornumber; // 0x08 + UINT8 Entity; // 0x09 + UINT8 EntityInstance; // 0x0A + UINT8 EventData1; // 0x0B + UINT8 EventData2; // 0x0C + UINT8 EventData3; // 0x0D + UINT8 EventData4; // 0x0E + UINT8 EventData5; // 0x0F +} BOOT_AUDIT_ENTRY; + +typedef struct { + UINT8 Command; + UINT8 ByteCount; + BOOT_AUDIT_ENTRY Data; +} BOOT_AUDIT_ENTRY_PACK; + +typedef struct { + UINT8 BootQueue; + UINT8 BootHarddriveTag[64]; +} PET_ALERT_CFG; + +#pragma pack(pop) + +EFI_STATUS +AmtPetAlertReadyToBoot( + EFI_EVENT Event, + VOID *ParentImageHandle +); + +EFI_STATUS +AmtPetAlertLegacyBoot( + EFI_EVENT Event, + VOID *ParentImageHandle +); + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.mak b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.mak new file mode 100644 index 0000000..cf5d5a4 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.mak @@ -0,0 +1,82 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/AmtPetAlert.mak 1 2/08/12 1:10a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:10a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/AmtPetAlert.mak $ +# +# 1 2/08/12 1:10a Klzhan +# Initial Check in +# +# 1 2/25/11 1:45a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:11a Klzhan +# Initial Check-in. +# +#********************************************************************** +# +#<AMI_FHDR_START> +#--------------------------------------------------------------------------- +# Name: AmtPetAlert.mak +# +# Description: Makefile for AMT Pet Alert Module. +# +#--------------------------------------------------------------------------- +#<AMI_FHDR_END> +#--------------------------------------------------------------------------- +# Create AMT PET Alert Screens +#--------------------------------------------------------------------------- +All : AmtPetAlert + +AmtPetAlert : $(BUILD_DIR)\AmtPetAlert.mak AmtPetAlertBin + +$(BUILD_DIR)\AmtPetAlert.mak : $(AMT_PET_ALERT_DIR)\$(@B).cif $(AMT_PET_ALERT_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(AMT_PET_ALERT_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +AmtPetAlert_INCLUDES= \ + $(EDK_INCLUDES) \ + $(MISCFRAMEWORK_INCLUDES) \ + $(ME_INCLUDES) \ + $(IndustryStandard_INCLUDES)\ + +AmtPetAlertBin : $(EFIDRIVERLIB) $(EDKFRAMEWORKPROTOCOLLIB) $(PRINTLIB) $(EFICOMMONLIB) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\AmtPetAlert.mak all \ + "MY_INCLUDES=$(AmtPetAlert_INCLUDES)"\ + GUID=290EA249-6E88-423c-B0DA-75CDDE7920CC \ + TYPE=BS_DRIVER \ + ENTRY_POINT=InitializeAmtPetAlert \ + DEPEX1=$(AMT_PET_ALERT_DIR)\AmtPetAlert.dxs \ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + COMPRESS=1 +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.sdl b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.sdl new file mode 100644 index 0000000..36ac23b --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/AmtPetAlert.sdl @@ -0,0 +1,24 @@ +TOKEN + Name = "AmtPetAlert_SUPPORT" + Value = "1" + Help = "Main switch to enable AMT PET Alert support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "AMT_PET_ALERT_DIR" +End + +MODULE + Help = "Includes AmtPetAlert.mak to Project" + File = "AmtPetAlert.mak" +End + +ELINK + Name = "$(BUILD_DIR)\AmtPetAlert.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/DevicePath.c b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/DevicePath.c new file mode 100644 index 0000000..0aec0b3 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/DevicePath.c @@ -0,0 +1,1049 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/DevicePath.c 1 2/08/12 1:10a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:10a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/DevicePath.c $ +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 1 2/25/11 1:45a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: DevicePath.c +// +// Description: DevicePath functions for AMT Pet Alert. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "DevicePath.h" + +EFI_GUID UnknownDeviceGuid = UNKNOWN_DEVICE_GUID; + +EFI_GUID mEfiMsgPcAnsiGuid = DEVICE_PATH_MESSAGING_PC_ANSI; +EFI_GUID mEfiMsgVt100Guid = DEVICE_PATH_MESSAGING_VT_100; +EFI_GUID mEfiMsgVt100PlusGuid = DEVICE_PATH_MESSAGING_VT_100_PLUS; +EFI_GUID mEfiMsgVt100Utf8Guid = DEVICE_PATH_MESSAGING_VT_UTF8; + +VOID * +ReallocatePool ( + IN VOID *OldPool, + IN UINTN OldSize, + IN UINTN NewSize +) +/*++ + +Routine Description: + + Adjusts the size of a previously allocated buffer. + +Arguments: + + OldPool - A pointer to the buffer whose size is being adjusted. + + OldSize - The size of the current buffer. + + NewSize - The size of the new buffer. + +Returns: + + EFI_SUCEESS - The requested number of bytes were allocated. + + EFI_OUT_OF_RESOURCES - The pool requested could not be allocated. + + EFI_INVALID_PARAMETER - The buffer was invalid. + +--*/ +{ + VOID *NewPool; + + NewPool = NULL; + if (NewSize) + { + NewPool = EfiLibAllocateZeroPool (NewSize); + } + + if (OldPool) + { + if (NewPool) + { + EfiCopyMem (NewPool, OldPool, OldSize < NewSize ? OldSize : NewSize); + } + + gBS->FreePool (OldPool); + } + + return NewPool; +} + +CHAR16 * +CatPrint ( + IN OUT POOL_PRINT *Str, + IN CHAR16 *fmt, + ... +) +/*++ + +Routine Description: + + Concatenates a formatted unicode string to allocated pool. + The caller must free the resulting buffer. + +Arguments: + + Str - Tracks the allocated pool, size in use, and + amount of pool allocated. + + fmt - The format string + +Returns: + + Allocated buffer with the formatted string printed in it. + The caller must free the allocated buffer. The buffer + allocation is not packed. + +--*/ +{ + UINT16 *AppendStr; + VA_LIST args; + UINTN strsize; + + AppendStr = EfiLibAllocateZeroPool (0x1000); + if (AppendStr == NULL) + { + return Str->str; + } + + VA_START (args, fmt); + VSPrint (AppendStr, 0x1000, fmt, args); + VA_END (args); + if (NULL == Str->str) + { + strsize = EfiStrSize (AppendStr); + Str->str = EfiLibAllocateZeroPool (strsize); + ASSERT (Str->str != NULL); + } + else + { + strsize = EfiStrSize (AppendStr) + EfiStrSize (Str->str) - sizeof (UINT16); + Str->str = ReallocatePool ( + Str->str, + EfiStrSize (Str->str), + strsize + ); + ASSERT (Str->str != NULL); + } + + Str->maxlen = MAX_CHAR * sizeof (UINT16); + if (strsize < Str->maxlen) + { + EfiStrCat (Str->str, AppendStr); + Str->len = strsize - sizeof (UINT16); + } + + gBS->FreePool (AppendStr); + return Str->str; +} + +EFI_DEVICE_PATH_PROTOCOL * +BdsLibUnpackDevicePath ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath +) +/*++ + +Routine Description: + + Function unpacks a device path data structure so that all the nodes + of a device path are naturally aligned. + +Arguments: + + DevPath - A pointer to a device path data structure + +Returns: + + If the memory for the device path is successfully allocated, then a + pointer to the new device path is returned. Otherwise, NULL is returned. + +--*/ +{ + EFI_DEVICE_PATH_PROTOCOL *Src; + EFI_DEVICE_PATH_PROTOCOL *Dest; + EFI_DEVICE_PATH_PROTOCOL *NewPath; + UINTN Size; + + // + // Walk device path and round sizes to valid boundries + // + Src = DevPath; + Size = 0; + for (;;) + { + Size += DevicePathNodeLength (Src); + Size += ALIGN_SIZE (Size); + + if (IsDevicePathEnd (Src)) + { + break; + } + + Src = NextDevicePathNode (Src); + } + // + // Allocate space for the unpacked path + // + NewPath = EfiLibAllocateZeroPool (Size); + if (NewPath) + { + + ASSERT (((UINTN) NewPath) % MIN_ALIGNMENT_SIZE == 0); + + // + // Copy each node + // + Src = DevPath; + Dest = NewPath; + for (;;) + { + Size = DevicePathNodeLength (Src); + EfiCopyMem (Dest, Src, Size); + Size += ALIGN_SIZE (Size); + SetDevicePathNodeLength (Dest, Size); + Dest->Type |= EFI_DP_TYPE_UNPACKED; + Dest = (EFI_DEVICE_PATH_PROTOCOL *) (((UINT8 *) Dest) + Size); + + if (IsDevicePathEnd (Src)) + { + break; + } + + Src = NextDevicePathNode (Src); + } + } + + return NewPath; +} + +VOID +DevPathPci ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + PCI_DEVICE_PATH *Pci; + + Pci = DevPath; + CatPrint (Str, L"Pci(%x|%x)", Pci->Device, Pci->Function); +} + +VOID +DevPathPccard ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + PCCARD_DEVICE_PATH *Pccard; + + Pccard = DevPath; + CatPrint (Str, L"Pcmcia(Function%x)", Pccard->FunctionNumber); +} + +VOID +DevPathMemMap ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + MEMMAP_DEVICE_PATH *MemMap; + + MemMap = DevPath; + CatPrint ( + Str, + L"MemMap(%d:%.lx-%.lx)", + MemMap->MemoryType, + MemMap->StartingAddress, + MemMap->EndingAddress + ); +} + +VOID +DevPathController ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + CONTROLLER_DEVICE_PATH *Controller; + + Controller = DevPath; + CatPrint (Str, L"Ctrl(%d)", Controller->Controller); +} + +VOID +DevPathVendor ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +/*++ + +Routine Description: + + Convert Vendor device path to device name + +Arguments: + + Str - The buffer store device name + DevPath - Pointer to vendor device path + +Returns: + + When it return, the device name have been stored in *Str. + +--*/ +{ + VENDOR_DEVICE_PATH *Vendor; + CHAR16 *Type; + INT32 *Temp; + + Vendor = DevPath; + Temp = (INT32 *) (&Vendor->Guid); + + switch (DevicePathType (&Vendor->Header)) + { + case HARDWARE_DEVICE_PATH: + // + // If the device is a winntbus device, we will give it a readable device name. + // + Type = L"Hw"; + break; + + case MESSAGING_DEVICE_PATH: + // + // If the device is a winntbus device, we will give it a readable device name. + // + if (EfiCompareGuid (&Vendor->Guid, &mEfiMsgPcAnsiGuid)) + { + CatPrint (Str, L"%s", L"PC-ANSI"); + return ; + } + else if (EfiCompareGuid (&Vendor->Guid, &mEfiMsgVt100Guid)) + { + CatPrint (Str, L"%s", L"VT100"); + return ; + } + else if (EfiCompareGuid (&Vendor->Guid, &mEfiMsgVt100PlusGuid)) + { + CatPrint (Str, L"%s", L"VT100+"); + return ; + } + else if (EfiCompareGuid (&Vendor->Guid, &mEfiMsgVt100Utf8Guid)) + { + CatPrint (Str, L"%s", L"VT100-UTF8"); + return ; + } + else + { + Type = L"Msg"; + break; + } + + case MEDIA_DEVICE_PATH: + Type = L"Media"; + break; + + default: + Type = L"?"; + break; + } + + CatPrint (Str, L"Ven%s(%g)", Type, &Vendor->Guid); +} + +VOID +DevPathAcpi ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + ACPI_HID_DEVICE_PATH *Acpi; + + Acpi = DevPath; + if ((Acpi->HID & PNP_EISA_ID_MASK) == PNP_EISA_ID_CONST) + { + CatPrint (Str, L"Acpi(PNP%04x,%x)", EISA_ID_TO_NUM (Acpi->HID), Acpi->UID); + } + else + { + CatPrint (Str, L"Acpi(%08x,%x)", Acpi->HID, Acpi->UID); + } +} + +VOID +DevPathAtapi ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + ATAPI_DEVICE_PATH *Atapi; + + Atapi = DevPath; + CatPrint ( + Str, + L"Ata(%s,%s)", + Atapi->PrimarySecondary ? L"Secondary" : L"Primary", + Atapi->SlaveMaster ? L"Slave" : L"Master" + ); +} + +VOID +DevPathScsi ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + SCSI_DEVICE_PATH *Scsi; + + Scsi = DevPath; + CatPrint (Str, L"Scsi(Pun%x,Lun%x)", Scsi->Pun, Scsi->Lun); +} + +VOID +DevPathFibre ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + FIBRECHANNEL_DEVICE_PATH *Fibre; + + Fibre = DevPath; + CatPrint (Str, L"Fibre(Wwn%lx,Lun%x)", Fibre->WWN, Fibre->Lun); +} + +VOID +DevPath1394 ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + F1394_DEVICE_PATH *F1394; + + F1394 = DevPath; + CatPrint (Str, L"1394(%g)", &F1394->Guid); +} + +VOID +DevPathUsb ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + USB_DEVICE_PATH *Usb; + + Usb = DevPath; + CatPrint (Str, L"Usb(%x, %x)", Usb->ParentPortNumber, Usb->InterfaceNumber); +} + +VOID +DevPathUsbClass ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + USB_CLASS_DEVICE_PATH *UsbClass; + + UsbClass = DevPath; + CatPrint ( + Str, + L"Usb Class(%x, %x, %x, %x, %x)", + UsbClass->VendorId, + UsbClass->ProductId, + UsbClass->DeviceClass, + UsbClass->DeviceSubClass, + UsbClass->DeviceProtocol + ); +} + +VOID +DevPathI2O ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + I2O_DEVICE_PATH *I2O; + + I2O = DevPath; + CatPrint (Str, L"I2O(%x)", I2O->Tid); +} + +VOID +DevPathMacAddr ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + MAC_ADDR_DEVICE_PATH *MAC; + UINTN HwAddressSize; + UINTN Index; + + MAC = DevPath; + + HwAddressSize = sizeof (EFI_MAC_ADDRESS); + if (MAC->IfType == 0x01 || MAC->IfType == 0x00) + { + HwAddressSize = 6; + } + + CatPrint (Str, L"Mac("); + + for (Index = 0; Index < HwAddressSize; Index++) + { + CatPrint (Str, L"%02x", MAC->MacAddress.Addr[Index]); + } + + CatPrint (Str, L")"); +} + +VOID +DevPathIPv4 ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + IPv4_DEVICE_PATH *IP; + + IP = DevPath; + CatPrint ( + Str, + L"IPv4(%d.%d.%d.%d:%d)", + IP->RemoteIpAddress.Addr[0], + IP->RemoteIpAddress.Addr[1], + IP->RemoteIpAddress.Addr[2], + IP->RemoteIpAddress.Addr[3], + IP->RemotePort + ); +} + +VOID +DevPathIPv6 ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + IPv6_DEVICE_PATH *IP; + + IP = DevPath; + CatPrint (Str, L"IP-v6(not-done)"); +} + +VOID +DevPathInfiniBand ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + INFINIBAND_DEVICE_PATH *InfiniBand; + + InfiniBand = DevPath; + CatPrint (Str, L"InfiniBand(not-done)"); +} + +VOID +DevPathUart ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + UART_DEVICE_PATH *Uart; + CHAR8 Parity; + + Uart = DevPath; + switch (Uart->Parity) + { + case 0: + Parity = 'D'; + break; + + case 1: + Parity = 'N'; + break; + + case 2: + Parity = 'E'; + break; + + case 3: + Parity = 'O'; + break; + + case 4: + Parity = 'M'; + break; + + case 5: + Parity = 'S'; + break; + + default: + Parity = 'x'; + break; + } + + if (Uart->BaudRate == 0) + { + CatPrint (Str, L"Uart(DEFAULT %c", Parity); + } + else + { + CatPrint (Str, L"Uart(%d %c", Uart->BaudRate, Parity); + } + + if (Uart->DataBits == 0) + { + CatPrint (Str, L"D"); + } + else + { + CatPrint (Str, L"%d", Uart->DataBits); + } + + switch (Uart->StopBits) + { + case 0: + CatPrint (Str, L"D)"); + break; + + case 1: + CatPrint (Str, L"1)"); + break; + + case 2: + CatPrint (Str, L"1.5)"); + break; + + case 3: + CatPrint (Str, L"2)"); + break; + + default: + CatPrint (Str, L"x)"); + break; + } +} + +VOID +DevPathHardDrive ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + HARDDRIVE_DEVICE_PATH *Hd; + + Hd = DevPath; + switch (Hd->SignatureType) + { + case SIGNATURE_TYPE_MBR: + CatPrint ( + Str, + L"HD(Part%d,Sig%08x)", + Hd->PartitionNumber, + *((UINT32 *) (&(Hd->Signature[0]))) + ); + break; + + case SIGNATURE_TYPE_GUID: + CatPrint ( + Str, + L"HD(Part%d,Sig%g)", + Hd->PartitionNumber, + (EFI_GUID *) &(Hd->Signature[0]) + ); + break; + + default: + CatPrint ( + Str, + L"HD(Part%d,MBRType=%02x,SigType=%02x)", + Hd->PartitionNumber, + Hd->MBRType, + Hd->SignatureType + ); + break; + } +} + +VOID +DevPathCDROM ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + CDROM_DEVICE_PATH *Cd; + + Cd = DevPath; + CatPrint (Str, L"CDROM(Entry%x)", Cd->BootEntry); +} + +VOID +DevPathFilePath ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + FILEPATH_DEVICE_PATH *Fp; + + Fp = DevPath; + CatPrint (Str, L"%s", Fp->PathName); +} + +VOID +DevPathMediaProtocol ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + MEDIA_PROTOCOL_DEVICE_PATH *MediaProt; + + MediaProt = DevPath; + CatPrint (Str, L"%g", &MediaProt->Protocol); +} + +VOID +DevPathFvFilePath ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + MEDIA_FW_VOL_FILEPATH_DEVICE_PATH *FvFilePath; + + FvFilePath = DevPath; + CatPrint (Str, L"%g", &FvFilePath->NameGuid); +} + +VOID +DevPathBssBss ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + BBS_BBS_DEVICE_PATH *Bbs; + CHAR16 *Type; + + Bbs = DevPath; + switch (Bbs->DeviceType) + { + case BBS_TYPE_FLOPPY: + Type = L"Floppy"; + break; + + case BBS_TYPE_HARDDRIVE: + Type = L"Harddrive"; + break; + + case BBS_TYPE_CDROM: + Type = L"CDROM"; + break; + + case BBS_TYPE_PCMCIA: + Type = L"PCMCIA"; + break; + + case BBS_TYPE_USB: + Type = L"Usb"; + break; + + case BBS_TYPE_EMBEDDED_NETWORK: + Type = L"Net"; + break; + + default: + Type = L"?"; + break; + } + // + // Since current Print function hasn't implemented %a (for ansi string) + // we will only print Unicode strings. + // + CatPrint (Str, L"Legacy-%s", Type); +} + +VOID +DevPathEndInstance ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + CatPrint (Str, L","); +} + +VOID +DevPathNodeUnknown ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + CatPrint (Str, L"?"); +} + +DEVICE_PATH_STRING_TABLE DevPathTable[] = { + HARDWARE_DEVICE_PATH, + HW_PCI_DP, + DevPathPci, + HARDWARE_DEVICE_PATH, + HW_PCCARD_DP, + DevPathPccard, + HARDWARE_DEVICE_PATH, + HW_MEMMAP_DP, + DevPathMemMap, + HARDWARE_DEVICE_PATH, + HW_VENDOR_DP, + DevPathVendor, + HARDWARE_DEVICE_PATH, + HW_CONTROLLER_DP, + DevPathController, + ACPI_DEVICE_PATH, + ACPI_DP, + DevPathAcpi, + MESSAGING_DEVICE_PATH, + MSG_ATAPI_DP, + DevPathAtapi, + MESSAGING_DEVICE_PATH, + MSG_SCSI_DP, + DevPathScsi, + MESSAGING_DEVICE_PATH, + MSG_FIBRECHANNEL_DP, + DevPathFibre, + MESSAGING_DEVICE_PATH, + MSG_1394_DP, + DevPath1394, + MESSAGING_DEVICE_PATH, + MSG_USB_DP, + DevPathUsb, + MESSAGING_DEVICE_PATH, + MSG_USB_CLASS_DP, + DevPathUsbClass, + MESSAGING_DEVICE_PATH, + MSG_I2O_DP, + DevPathI2O, + MESSAGING_DEVICE_PATH, + MSG_MAC_ADDR_DP, + DevPathMacAddr, + MESSAGING_DEVICE_PATH, + MSG_IPv4_DP, + DevPathIPv4, + MESSAGING_DEVICE_PATH, + MSG_IPv6_DP, + DevPathIPv6, + MESSAGING_DEVICE_PATH, + MSG_INFINIBAND_DP, + DevPathInfiniBand, + MESSAGING_DEVICE_PATH, + MSG_UART_DP, + DevPathUart, + MESSAGING_DEVICE_PATH, + MSG_VENDOR_DP, + DevPathVendor, + MEDIA_DEVICE_PATH, + MEDIA_HARDDRIVE_DP, + DevPathHardDrive, + MEDIA_DEVICE_PATH, + MEDIA_CDROM_DP, + DevPathCDROM, + MEDIA_DEVICE_PATH, + MEDIA_VENDOR_DP, + DevPathVendor, + MEDIA_DEVICE_PATH, + MEDIA_FILEPATH_DP, + DevPathFilePath, + MEDIA_DEVICE_PATH, + MEDIA_PROTOCOL_DP, + DevPathMediaProtocol, + MEDIA_DEVICE_PATH, + MEDIA_FV_FILEPATH_DP, + DevPathFvFilePath, + BBS_DEVICE_PATH, + BBS_BBS_DP, + DevPathBssBss, + END_DEVICE_PATH_TYPE, + END_INSTANCE_DEVICE_PATH_SUBTYPE, + DevPathEndInstance, + 0, + 0, + NULL + }; + +CHAR16 * +DevicePathToStr ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath +) +/*++ + + Turns the Device Path into a printable string. Allcoates + the string from pool. The caller must SafeFreePool the returned + string. + +--*/ +{ + POOL_PRINT Str; + EFI_DEVICE_PATH_PROTOCOL *DevPathNode; + VOID (*DumpNode) (POOL_PRINT *, VOID *); + + UINTN Index; + UINTN NewSize; + + EfiZeroMem (&Str, sizeof (Str)); + + if (DevPath == NULL) + { + goto Done; + } + // + // Unpacked the device path + // + DevPath = BdsLibUnpackDevicePath (DevPath); + ASSERT (DevPath); + + // + // Process each device path node + // + DevPathNode = DevPath; + while (!IsDevicePathEnd (DevPathNode)) + { + // + // Find the handler to dump this device path node + // + DumpNode = NULL; + for (Index = 0; DevPathTable[Index].Function; Index += 1) + { + + if (DevicePathType (DevPathNode) == DevPathTable[Index].Type && + DevicePathSubType (DevPathNode) == DevPathTable[Index].SubType + ) + { + DumpNode = DevPathTable[Index].Function; + break; + } + } + // + // If not found, use a generic function + // + if (!DumpNode) + { + DumpNode = DevPathNodeUnknown; + } + // + // Put a path seperator in if needed + // + if (Str.len && DumpNode != DevPathEndInstance) + { + CatPrint (&Str, L"/"); + } + // + // Print this node of the device path + // + DumpNode (&Str, DevPathNode); + + // + // Next device path node + // + DevPathNode = NextDevicePathNode (DevPathNode); + } + // + // Shrink pool used for string allocation + // + gBS->FreePool (DevPath); + +Done: + NewSize = (Str.len + 1) * sizeof (CHAR16); + Str.str = ReallocatePool (Str.str, NewSize, NewSize); + ASSERT (Str.str != NULL); + Str.str[Str.len] = 0; + return Str.str; +} + +EFI_DEVICE_PATH_PROTOCOL * +LibDuplicateDevicePathInstance ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath +) +/*++ + +Routine Description: + + Function creates a device path data structure that identically matches the + device path passed in. + +Arguments: + + DevPath - A pointer to a device path data structure. + +Returns: + + The new copy of DevPath is created to identically match the input. + Otherwise, NULL is returned. + +--*/ +{ + EFI_DEVICE_PATH_PROTOCOL *NewDevPath; + EFI_DEVICE_PATH_PROTOCOL *DevicePathInst; + EFI_DEVICE_PATH_PROTOCOL *Temp; + UINTN Size; + + // + // get the size of an instance from the input + // + Temp = DevPath; + DevicePathInst = EfiDevicePathInstance (&Temp, &Size); + + // + // Make a copy + // + NewDevPath = NULL; + if (Size) + { + NewDevPath = EfiLibAllocateZeroPool (Size); + ASSERT (NewDevPath != NULL); + } + + if (NewDevPath) + { + EfiCopyMem (NewDevPath, DevicePathInst, Size); + } + + return NewDevPath; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/DevicePath.h b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/DevicePath.h new file mode 100644 index 0000000..1f73827 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPetAlert/DevicePath.h @@ -0,0 +1,93 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/DevicePath.h 1 2/08/12 1:10a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:10a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPetAlert/DevicePath.h $ +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 1 2/25/11 1:45a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: DevicePath.c +// +// Description: DevicePath functions for AMT Pet Alert. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "Tiano.h" +#include "EfiPrintLib.h" +#include "EfiDriverLib.h" + +// +// Internal definitions +// +typedef struct { + CHAR16 *str; + UINTN len; + UINTN maxlen; +} POOL_PRINT; + +typedef struct { + UINT8 Type; + UINT8 SubType; + VOID (*Function) (POOL_PRINT *, VOID *); +} DEVICE_PATH_STRING_TABLE; + +// +// Define Maxmim characters that will be accepted +// +#define MAX_CHAR 480 +#define MAX_CHAR_SIZE (MAX_CHAR * 2) + +#define MIN_ALIGNMENT_SIZE 4 +#define ALIGN_SIZE(a) ((a % MIN_ALIGNMENT_SIZE) ? MIN_ALIGNMENT_SIZE - (a % MIN_ALIGNMENT_SIZE) : 0) + +CHAR16 * +DevicePathToStr ( + EFI_DEVICE_PATH_PROTOCOL *DevPath +); + +EFI_DEVICE_PATH_PROTOCOL * +BdsLibUnpackDevicePath ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath +); +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.c b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.c new file mode 100644 index 0000000..bdc8193 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.c @@ -0,0 +1,558 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.c 11 9/21/15 10:12p Tristinchou $ +// +// $Revision: 11 $ +// +// $Date: 9/21/15 10:12p $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.c $ +// +// 11 9/21/15 10:12p Tristinchou +// [TAG] EIP238392 +// [Category] Improvement +// [Description] Disable USB provision while Intel AMT is disabled in +// setup +// +// 10 5/14/14 9:45p Tristinchou +// [TAG] EIP160730 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 9 12/16/13 9:55p Tristinchou +// [TAG] EIPNone +// [Category] Improvement +// [Description] Free memory while error occur in InstallDiskInfo() +// +// 8 8/27/13 4:21a Tristinchou +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix system hangs while boot with ME 1.5MB firmware. +// [Files] AmtPlatformPolicy.c +// +// 7 8/22/13 8:51a Tristinchou +// [TAG] EIP131034 +// [Category] Improvement +// [Description] The system will hang after create/ reset/delete raid +// mode +// [Files] AmtPlatformPolicy.c +// +// 6 11/07/12 8:47a Klzhan +// Clear Cira request item after loaded. +// +// 5 9/19/12 6:56a Klzhan +// Fix Windows capsule update fail. +// +// 4 7/02/12 11:39p Klzhan +// [TAG] EIP94113 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC0.6 +// +// 3 5/14/12 4:50a Klzhan +// [TAG] EIP89952 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.56 +// [Files] AmtPlatformPolicy.c +// AmtPlatformPolicy.h +// AmtPlatformPolicy.sdl +// AmtPlatformPolicy.mak +// AmtPlatformPolicy.dxs +// AmtPlatformPolicy.cif +// +// 2 4/24/12 12:41a Klzhan +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 8 9/29/11 11:47p Klzhan +// Fill Amt Wrapper protocol with setup data. +// +// 7 9/26/11 6:19a Klzhan +// [TAG] EIP70516 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME 8.0 RC 0.8 +// [Files] AmtPlatformPolicy.c +// AmtPlatformPolicy.h +// AmtPlatformPolicy.sdl +// AmtPlatformPolicy.mak +// AmtPlatformPolicy.dxs +// AmtPlatformPolicy.cif +// +// 6 7/08/11 4:23a Klzhan +// [TAG] EIP64189 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC to 0.7 +// +// 5 5/24/11 5:01a Klzhan +// Add support ME RC 0.60 +// +// 4 4/18/11 9:45a Klzhan +// [TAG] EIP58005 +// [Category] Spec Update +// [Severity] Important +// [Description] Move ME FW downgrade related code to ME platform +// policy. +// +// 3 4/18/11 9:17a Klzhan +// Improvement : Update DXE_PLATFORM_AMT_POLICY_PROTOCOL_REVISION from 7 +// to A. +// +// 2 3/29/11 3:48a Klzhan +// A token to keep ME always in Disable Mode. +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AmtPlatformPolicy.c +// +// Description: +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> + +#include "AmtPlatformPolicy.h" +#include "token.h" +#include <SetupDataDefinition.h> +DXE_AMT_POLICY_PROTOCOL mDxePlatformAmtPolicy = { 0 }; +INSTALL_DISK_INFO_PROTOCOL mInstallDiskInfo = { InstallDiskInfo }; +UINT64 mPciDeviceFilterOutTable[] = { EFI_MAX_ADDRESS, }; +#define SETUP_GUID { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } + +#define AMT_READY_TO_BOOT_PROTOCOL_GUID \ + { \ + 0x40b09b5a, 0xf0ef, 0x4627, 0x93, 0xd5, 0x27, 0xf0, 0x4b, 0x75, 0x4d, 0x5 \ + } + +#define END_DEVICE_PATH 0x7F +#define END_DEVICE_PATH1 0xFF +#define NODE_LENGTH(pPath) (*(UINT16*)&(pPath)->Length[0]) +#define NEXT_NODE(pPath) ((EFI_DEVICE_PATH_PROTOCOL*)((UINT8*)(pPath)+NODE_LENGTH(pPath))) +#define isEndNode(pDp) ((pDp)->Type==END_DEVICE_PATH||(pDp)->Type==END_DEVICE_PATH1) +EFI_GUID gAmtReadyToBootProtocolGuid = AMT_READY_TO_BOOT_PROTOCOL_GUID; +EFI_GUID gEfiDiskInfoProtocolGuid = EFI_DISK_INFO_PROTOCOL_GUID; +EFI_GUID gDevicePathProtocolGuid = EFI_DEVICE_PATH_PROTOCOL_GUID; +UINT8 GetDevicePathSubtype(EFI_DEVICE_PATH_PROTOCOL *Dp, UINT8 Type); + +// +// Driver entry point +// +EFI_DRIVER_ENTRY_POINT (AmtPlatformPolicyEntryPoint) +EFI_STATUS +EFIAPI +InstallDiskInfo ( + VOID + ) +{ + EFI_STATUS Status; + UINTN BlockIoHandleCount = 0; + UINTN DiskInfoHandleCount = 0; + EFI_HANDLE *BlockIoHandleBuffer = NULL; + EFI_HANDLE *DiskInfoHandleBuffer = NULL; + UINTN UsedBlockIoHandle = 0; + UINTN UsedDiskInfoHandle = 0; + EFI_DISK_INFO_PROTOCOL *DiskInfoProtocol; + EFI_DISK_INFO_PROTOCOL *DiskInfoProtocolBuffer; + EFI_BLOCK_IO_PROTOCOL *BlockIoProtocol; + EFI_DEVICE_PATH_PROTOCOL *DevicePathProtocol; + UINT8 DevicePathSubtype = 0; + IDENTIFY_DATA *IdentifyData = NULL; + UINT32 BufferSize = sizeof (IDENTIFY_DATA); + UINT8 ThisDiskInfoHandleIsHdd = 0; // 1 is HDD, 0 is ODD + UINT8 ThisBlockIoHandleIsHdd = 0; // 1 is HDD, 0 is ODD + + //Locate all handle which have BlockIo + Status = gBS->LocateHandleBuffer( + ByProtocol, + &gEfiBlockIoProtocolGuid, + NULL, + &BlockIoHandleCount, + &BlockIoHandleBuffer ); + if(EFI_ERROR(Status)) + goto ErrorExit; + + //Locate all handle which have DiskInfo + Status = gBS->LocateHandleBuffer( + ByProtocol, + &gEfiDiskInfoProtocolGuid, + NULL, + &DiskInfoHandleCount, + &DiskInfoHandleBuffer ); + if(EFI_ERROR(Status)) + goto ErrorExit; + + if( DiskInfoHandleCount != 0 ) + { + for( UsedBlockIoHandle = 0 ; UsedBlockIoHandle < BlockIoHandleCount ; UsedBlockIoHandle++ ) + { + ThisBlockIoHandleIsHdd = 0; + //Block to install DiskInfoProtocol to USB + Status = gBS->HandleProtocol( + BlockIoHandleBuffer[UsedBlockIoHandle], + &gDevicePathProtocolGuid, + &DevicePathProtocol); + if( !EFI_ERROR(Status) ) + { + DevicePathSubtype = GetDevicePathSubtype( DevicePathProtocol, MESSAGING_DEVICE_PATH ); + } + if( DevicePathSubtype == MSG_USB_DP || + DevicePathSubtype == MSG_USB_CLASS_DP ) + { + continue; + } + //Block to install DiskInfoProtocol to Partition + Status = gBS->HandleProtocol( + BlockIoHandleBuffer[UsedBlockIoHandle], + &gEfiBlockIoProtocolGuid, + &BlockIoProtocol); + if(EFI_ERROR(Status)) + goto ErrorExit; + + if( BlockIoProtocol->Media->LogicalPartition ) + { + continue; + } + + //Handle is HDD or ODD + if( BlockIoProtocol->Media->RemovableMedia == 0 ) + { + ThisBlockIoHandleIsHdd = 1; + } + + for( UsedDiskInfoHandle = 0 ; UsedDiskInfoHandle < DiskInfoHandleCount ; UsedDiskInfoHandle++ ) + { + ThisDiskInfoHandleIsHdd = 0; + if( DiskInfoHandleBuffer[UsedDiskInfoHandle] == NULL ) + { + continue; + } + + //Handle is HDD or ODD + Status = gBS->HandleProtocol( + DiskInfoHandleBuffer[UsedDiskInfoHandle], + &gEfiDiskInfoProtocolGuid, + &DiskInfoProtocol); + if(EFI_ERROR(Status)) + goto ErrorExit; + + IdentifyData = AllocatePool(BufferSize); + if( IdentifyData == NULL ) + goto ErrorExit; + + Status = DiskInfoProtocol->Identify( DiskInfoProtocol, IdentifyData, &BufferSize ); + if(EFI_ERROR(Status)) + goto ErrorExit; + + if( IdentifyData->LBA_48 !=0 ) + { + ThisDiskInfoHandleIsHdd = 1; + } + + //If handles the same type( HDD or ODD) + if( ThisDiskInfoHandleIsHdd == ThisBlockIoHandleIsHdd ) + { + Status = gBS->HandleProtocol( + BlockIoHandleBuffer[UsedBlockIoHandle], + &gEfiDiskInfoProtocolGuid, + &DiskInfoProtocolBuffer ); + //If this BlockIoHandle isn't installed DiskInfoProtocol + if(EFI_ERROR(Status)) + { + Status = gBS->InstallMultipleProtocolInterfaces( + &BlockIoHandleBuffer[UsedBlockIoHandle], + &gEfiDiskInfoProtocolGuid, + DiskInfoProtocol, + NULL ); + if( !EFI_ERROR(Status) ) + { + FreePool(IdentifyData); + //Release used handle pointer + DiskInfoHandleBuffer[UsedDiskInfoHandle] = NULL; + break; + } + } + } + FreePool(IdentifyData); + } + } + } + FreePool(BlockIoHandleBuffer); + FreePool(DiskInfoHandleBuffer); + + return EFI_SUCCESS; + +ErrorExit: + if( BlockIoHandleBuffer != NULL ) + FreePool(BlockIoHandleBuffer); + if( DiskInfoHandleBuffer != NULL ) + FreePool(DiskInfoHandleBuffer); + if( IdentifyData != NULL ) + FreePool(IdentifyData); + + return EFI_NOT_FOUND; +} + +UINT8 GetDevicePathSubtype(EFI_DEVICE_PATH_PROTOCOL *Dp, UINT8 Type) +{ + UINT8 SubType; + + if (Dp == NULL) return 0; + SubType = 0; + + for( ; !(isEndNode(Dp)); Dp=NEXT_NODE(Dp)) + if (Dp->Type == Type) SubType = Dp->SubType; + return SubType; +} + +// +// Function implementations +// +EFI_STATUS +EFIAPI +AmtPlatformPolicyEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +/*++ + +Routine Description: + + Initilize Intel AMT DXE Platform Policy + +Arguments: + + ImageHandle Image handle of this driver. + SystemTable Global system service table. + +Returns: + + EFI_SUCCESS Initialization complete. + EFI_UNSUPPORTED The chipset is unsupported by this driver. + EFI_OUT_OF_RESOURCES Do not have enough resources to initialize the driver. + EFI_DEVICE_ERROR Device error, driver exits abnormally. + +--*/ +{ + EFI_STATUS Status; + UINT32 SetupVarAttr; + UINTN VariableSize; + UINT32 MebxVarAttr; + ME_BIOS_EXTENSION_SETUP MeBiosExtensionSetupData; + SETUP_DATA SetupData; + EFI_GUID gSetupGuid = SETUP_GUID; + DXE_MBP_DATA_PROTOCOL *mBIOSPayLoad; + EFI_HANDLE Handle; + + EfiInitializeDriverLib (ImageHandle, SystemTable); + + Handle = NULL; + + Status = gBS->LocateProtocol ( + &gMeBiosPayloadDataProtocolGuid, + NULL, + &mBIOSPayLoad + ); + if( EFI_ERROR(Status) ) { + // Install Dummy MeBios Payload Data Protocol for avoiding relating driver + // not run. (For EIP#96807 - EFI Capsule Update) + SetupVarAttr = 0; + VariableSize = sizeof(SETUP_DATA); + Status = gRT->GetVariable( L"Setup", &gSetupGuid, \ + &SetupVarAttr, &VariableSize, &SetupData ); + if( EFI_ERROR(Status) ) return Status; + { + DXE_MBP_DATA_PROTOCOL mMbpData; + ZeroMem (&mMbpData, sizeof (DXE_MBP_DATA_PROTOCOL)); + mMbpData.Revision = DXE_MBP_DATA_PROTOCOL_REVISION_2; + mMbpData.MeBiosPayload.FwPlatType.RuleData.Fields.IntelMeFwImageType = SetupData.MeImageType; + mMbpData.Handle = NULL; + Status = gBS->InstallMultipleProtocolInterfaces ( + &mMbpData.Handle, + &gMeBiosPayloadDataProtocolGuid, + &mMbpData, + NULL + ); + if (!EFI_ERROR(Status)) mBIOSPayLoad = &mMbpData; + } + } + if (mBIOSPayLoad->MeBiosPayload.FwPlatType.RuleData.Fields.IntelMeFwImageType != INTEL_ME_5MB_FW) { + return EFI_UNSUPPORTED; + } + + Status = gBS->InstallProtocolInterface ( + &Handle, + &gAmtReadyToBootProtocolGuid, + EFI_NATIVE_INTERFACE, + &mInstallDiskInfo + ); + + SetupVarAttr = 0; + VariableSize = sizeof(SETUP_DATA); + // + // Get iAMT configuration from Setup Data + // + Status = gRT->GetVariable( + L"Setup", + &gSetupGuid, + &SetupVarAttr, + &VariableSize, + &SetupData ); + + // + // AMT DXE Policy Init + // + mDxePlatformAmtPolicy.Revision = DXE_PLATFORM_AMT_POLICY_PROTOCOL_REVISION_1; +/////////////////////////////////////////////////////////////////////////// + if (EFI_ERROR(Status)) // Default Setting for AMT + { + // + // Initialzie the Me Configuration + // + mDxePlatformAmtPolicy.AmtConfig.AsfEnabled = 1; + mDxePlatformAmtPolicy.AmtConfig.iAmtEnabled = 1; + mDxePlatformAmtPolicy.AmtConfig.WatchDog = 0; + mDxePlatformAmtPolicy.AmtConfig.WatchDogTimerOs = 0; + mDxePlatformAmtPolicy.AmtConfig.WatchDogTimerBios = 0; + mDxePlatformAmtPolicy.AmtConfig.CiraRequest = 0; + mDxePlatformAmtPolicy.AmtConfig.CiraTimeout = 0; + mDxePlatformAmtPolicy.AmtConfig.UnConfigureMe = 0; + mDxePlatformAmtPolicy.AmtConfig.HideUnConfigureMeConfirm = 0; + mDxePlatformAmtPolicy.AmtConfig.MebxDebugMsg = 0; + mDxePlatformAmtPolicy.AmtConfig.USBProvision = 0; + mDxePlatformAmtPolicy.AmtConfig.FWProgress = 1; + mDxePlatformAmtPolicy.AmtConfig.iAmtbxSelectionScreen = 0; + mDxePlatformAmtPolicy.AmtConfig.iAmtbxHotkeyPressed = 0; + mDxePlatformAmtPolicy.AmtConfig.AtEnabled = 1; + mDxePlatformAmtPolicy.AmtConfig.ManageabilityMode = 1; + // + // Oem Resolution Settings + // + mDxePlatformAmtPolicy.AmtConfig.MebxNonUiTextMode = 0; // MEBX_TEXT_AUTO + mDxePlatformAmtPolicy.AmtConfig.MebxUiTextMode = 0; // MEBX_TEXT_AUTO + mDxePlatformAmtPolicy.AmtConfig.MebxGraphicsMode = 0; // MEBX_GRAPHICS_AUTO + + } else { + mDxePlatformAmtPolicy.AmtConfig.AsfEnabled = SetupData.Asf; + mDxePlatformAmtPolicy.AmtConfig.iAmtEnabled = SetupData.Amt; + mDxePlatformAmtPolicy.AmtConfig.WatchDog = SetupData.WatchDog; + mDxePlatformAmtPolicy.AmtConfig.WatchDogTimerOs = SetupData.WatchDogTimerOs; + mDxePlatformAmtPolicy.AmtConfig.WatchDogTimerBios = SetupData.WatchDogTimerBios; + mDxePlatformAmtPolicy.AmtConfig.CiraRequest = SetupData.AmtCiraRequest; + mDxePlatformAmtPolicy.AmtConfig.CiraTimeout = SetupData.AmtCiraTimeout; + mDxePlatformAmtPolicy.AmtConfig.UnConfigureMe = SetupData.UnConfigureMe; + mDxePlatformAmtPolicy.AmtConfig.HideUnConfigureMeConfirm = SetupData.HideUnConfigureMeConfirm; + mDxePlatformAmtPolicy.AmtConfig.MebxDebugMsg = SetupData.MebxDebugMsg; + mDxePlatformAmtPolicy.AmtConfig.USBProvision = SetupData.USBProvision; + mDxePlatformAmtPolicy.AmtConfig.FWProgress = SetupData.FWProgress; + mDxePlatformAmtPolicy.AmtConfig.iAmtbxSelectionScreen = SetupData.AmtbxSelectionScreen; + mDxePlatformAmtPolicy.AmtConfig.iAmtbxHotkeyPressed = SetupData.AmtbxHotKeyPressed; + mDxePlatformAmtPolicy.AmtConfig.AtEnabled = 1; + mDxePlatformAmtPolicy.AmtConfig.ManageabilityMode = 1; + // + // Oem Resolution Settings + // + mDxePlatformAmtPolicy.AmtConfig.MebxNonUiTextMode = 0; // MEBX_TEXT_AUTO + mDxePlatformAmtPolicy.AmtConfig.MebxUiTextMode = 0; // MEBX_TEXT_AUTO + mDxePlatformAmtPolicy.AmtConfig.MebxGraphicsMode = 0; // MEBX_GRAPHICS_AUTO + + if(SetupData.AmtbxHotKeyPressed == 1) + SetupData.AmtbxHotKeyPressed = 0; + + if(SetupData.AmtCiraRequest == 1) + SetupData.AmtCiraRequest = 0; + + if(SetupData.UnConfigureMe == 1) + SetupData.UnConfigureMe = 0; + + if(SetupData.Amt == 0) + mDxePlatformAmtPolicy.AmtConfig.USBProvision = USB_PROVISION_DEFAULT_WITHOUT_AMT; + } + +/////////////////////////////////////////////////////////////////////////// + mDxePlatformAmtPolicy.AmtConfig.PciDeviceFilterOutTable = (UINT32) (UINTN) mPciDeviceFilterOutTable; + // + // Please don't change the default value of ForcMebxSyncUp and + // This let customer to force MEBX execution if they need and + // + mDxePlatformAmtPolicy.AmtConfig.ForcMebxSyncUp = 0; + + // + // Get BIOS Sync-up data from MEBx to AMT platform policy + // + MebxVarAttr = 0; + VariableSize = sizeof (MeBiosExtensionSetupData); + Status = gRT->GetVariable ( + gEfiMeBiosExtensionSetupName, + &gEfiMeBiosExtensionSetupGuid, + &MebxVarAttr, + &VariableSize, + &MeBiosExtensionSetupData + ); + if (EFI_ERROR (Status)) { + mDxePlatformAmtPolicy.AmtConfig.ManageabilityMode = 0; + } else { + mDxePlatformAmtPolicy.AmtConfig.ManageabilityMode = MeBiosExtensionSetupData.PlatformMngSel; + } + // + // Install protocol to to allow access to this Policy. + // + Status = gBS->InstallMultipleProtocolInterfaces ( + &ImageHandle, + &gDxePlatformAmtPolicyGuid, + &mDxePlatformAmtPolicy, + NULL + ); + ASSERT_EFI_ERROR (Status); + + // + // Get iAMT configuration from Setup Data + // + VariableSize = sizeof(SETUP_DATA); + Status = gRT->SetVariable ( + L"Setup", + &gSetupGuid, + SetupVarAttr, + VariableSize, + &SetupData ); + + return Status; +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.cif b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.cif new file mode 100644 index 0000000..7cffe71 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.cif @@ -0,0 +1,14 @@ +<component> + name = "AmtPlatformPolicy" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\AmtPlatformPolicy" + RefName = "AmtPlatformPolicy" +[files] +"AmtPlatformPolicy.c" +"AmtPlatformPolicy.h" +"AmtPlatformPolicy.sdl" +"AmtPlatformPolicy.mak" +"AmtPlatformPolicy.dxs" +[parts] +"AmtPeiPolicyInit" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.dxs b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.dxs new file mode 100644 index 0000000..fe01967 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.dxs @@ -0,0 +1,54 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.dxs 1 2/08/12 1:09a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:09a $ +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AmtDPlatformPolicy.DXS +// +// Description: This file is the dependency file for the NB DXE +// driver +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> + +#include "EfiDepex.h" +#include EFI_PROTOCOL_DEFINITION (MePlatformPolicy) + +DEPENDENCY_START + DXE_PLATFORM_ME_POLICY_GUID +DEPENDENCY_END + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.h b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.h new file mode 100644 index 0000000..ea8f278 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.h @@ -0,0 +1,209 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.h 4 8/22/13 8:52a Tristinchou $ +// +// $Revision: 4 $ +// +// $Date: 8/22/13 8:52a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.h $ +// +// 4 8/22/13 8:52a Tristinchou +// [TAG] EIP131034 +// [Category] Improvement +// [Description] The system will hang after create/ reset/delete raid +// mode +// [Files] AmtPlatformPolicy.h +// +// 3 5/14/12 4:50a Klzhan +// [TAG] EIP89952 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.56 +// [Files] AmtPlatformPolicy.c +// AmtPlatformPolicy.h +// AmtPlatformPolicy.sdl +// AmtPlatformPolicy.mak +// AmtPlatformPolicy.dxs +// AmtPlatformPolicy.cif +// +// 2 4/24/12 12:41a Klzhan +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 2 9/26/11 6:19a Klzhan +// [TAG] EIP70516 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME 8.0 RC 0.8 +// [Files] AmtPlatformPolicy.c +// AmtPlatformPolicy.h +// AmtPlatformPolicy.sdl +// AmtPlatformPolicy.mak +// AmtPlatformPolicy.dxs +// AmtPlatformPolicy.cif +// +// 1 2/25/11 1:45a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +#ifndef _DXE_AMT_PLATFORM_POLICY_H_ +#define _DXE_AMT_PLATFORM_POLICY_H_ + +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGlueDxe.h" +#endif + +#include EFI_PROTOCOL_DEFINITION (MeBiosPayloadData) +#include EFI_PROTOCOL_PRODUCER (AmtPlatformPolicy) +#include EFI_GUID_DEFINITION (MeBiosExtensionSetup) +#include "MeLib.h" +#include "Include\Protocol\PDiskInfo.h" +#include "Include\Protocol\PIDEController.h" +// Debug #include "AmtPlatformPolicyUpdateDxeLib.h" + +typedef +struct _INSTALL_DISK_INFO_PROTOCOL INSTALL_DISK_INFO_PROTOCOL; + +// Based on ATA/ATAPI-6 +#pragma pack (1) +typedef struct _IDENTIFY_DATA{ + + UINT16 General_Config_0; + UINT16 Reserved_1; + UINT16 Special_Config_2; + UINT16 Reserved_3; + UINT16 Reserved_4; + UINT16 Reserved_5; + UINT16 Reserved_6; + UINT16 Reserved_7; + UINT16 Reserved_8; + UINT16 Reserved_9; + UINT8 Serial_Number_10[20]; + UINT16 Reserved_20; + UINT16 Reserved_21; + UINT16 Reserved_22; + UINT8 Firmware_Revision_23[8]; + UINT8 Model_Number_27[40]; + UINT16 Maximum_Sector_Multiple_Command_47; + UINT16 Reserved_48; + UINT16 Capabilities_49; + UINT16 Capabilities_50; + UINT16 PIO_Mode_51; + UINT16 Reserved_52; + UINT16 Valid_Bits_53; + UINT16 Reserved_54_58[5]; + UINT16 Valid_Bits_59; + UINT32 Addressable_Sector_60; + UINT16 SingleWord_DMA_62; + UINT16 MultiWord_DMA_63; + UINT16 PIO_Mode_64; + UINT16 Min_Multiword_DMA_timing_65; + UINT16 Manuf_Multiword_DMA_timing_66; + UINT16 Min_PIO_Mode_timing_67; + UINT16 Min_PIO_Mode_timing_68; + UINT16 Reserved_69_74[6]; + UINT16 Queue_Depth_75; + UINT16 Reserved_76_79[4]; + UINT16 Major_Revision_80; + UINT16 Minor_Revision_81; + UINT16 Command_Set_Supported_82; + UINT16 Command_Set_Supported_83; + UINT16 Command_Set_Supported_84; + UINT16 Command_Set_Enabled_85; + UINT16 Command_Set_Enabled_86; + UINT16 Command_Set_Enabled_87; + UINT16 UDMA_Mode_88; + UINT16 Time_security_Earse_89; + UINT16 Time_Esecurity_Earse_90; + UINT16 Current_Power_Level_91; + UINT16 Master_Password_Rev_92; + UINT16 Hard_Reset_Value_93; + UINT16 Acoustic_Level_94; + UINT16 Reserved_95_99[5]; + UINT64 LBA_48; + UINT16 Reserved_104_126[23]; + UINT16 Status_Notification_127; + UINT16 Security_Status_128; + UINT16 Reserved_129_159[31]; + UINT16 CFA_Power_Mode_160; + UINT16 Reserved_161_175[15]; + UINT16 Media_Serial_Number_176_205[30]; + UINT16 Reserved_206_254[49]; + UINT16 Checksum_255; +} IDENTIFY_DATA; +#pragma pack () + +EFI_STATUS +AmtDxePolicyInitEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN OUT EFI_SYSTEM_TABLE *SystemTable + ) +/*++ + +Routine Description: + + Initilize Intel AMT DXE Platform Policy + +Arguments: + + ImageHandle - Image handle of this driver. + SystemTable - Global system service table. + +Returns: + + EFI_SUCCESS Initialization complete. + EFI_UNSUPPORTED The chipset is unsupported by this driver. + EFI_OUT_OF_RESOURCES Do not have enough resources to initialize the driver. + EFI_DEVICE_ERROR Device error, driver exits abnormally. + +--*/ +; +EFI_STATUS +EFIAPI +InstallDiskInfo ( + VOID + ); + +typedef +EFI_STATUS +(EFIAPI *INSTALL_DISK_INFO) ( + VOID + ); + +typedef struct _INSTALL_DISK_INFO_PROTOCOL { + INSTALL_DISK_INFO Install; +}INSTALL_DISK_INFO_PROTOCOL; + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.mak b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.mak new file mode 100644 index 0000000..6cd33ff --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.mak @@ -0,0 +1,116 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* + +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.mak 3 4/24/12 12:41a Klzhan $ +# +# $Revision: 3 $ +# +# $Date: 4/24/12 12:41a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.mak $ +# +# 3 4/24/12 12:41a Klzhan +# +# 2 2/23/12 8:59a Klzhan +# Support New EDK +# +# 1 2/08/12 1:08a Klzhan +# Initial Check in +# +# 2 9/26/11 6:19a Klzhan +# [TAG] EIP70516 +# [Category] Spec Update +# [Severity] Important +# [Description] Update ME 8.0 RC 0.8 +# [Files] AmtPlatformPolicy.c +# AmtPlatformPolicy.h +# AmtPlatformPolicy.sdl +# AmtPlatformPolicy.mak +# AmtPlatformPolicy.dxs +# AmtPlatformPolicy.cif +# +# 1 2/25/11 1:45a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:11a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +#<AMI_FHDR_START> +# +# Name: AmtPlatformPolicy.mak +# +# Description: +# +#<AMI_FHDR_END> +#********************************************************************** +All : AmtPlatformPolicy + +AmtPlatformPolicy : $(BUILD_DIR)\AmtPlatformPolicy.mak AmtPlatformPolicyBin + +$(BUILD_DIR)\AmtPlatformPolicy.mak : $(AmtPlatformPolicy_DIR)\$(@B).cif $(AmtPlatformPolicy_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(AmtPlatformPolicy_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +AmtPlatformPolicy_INCLUDES=\ + $(EdkIIGlueLib_INCLUDES) \ + $(ME_INCLUDES) \ + $(MISCFRAMEWORK_INCLUDES) \ + $(NB_INCLUDES)\ + $(SB_INCLUDES)\ + /I$(PROJECT_DIR)\ + /IInclude\ + +AmtPlatformPolicy_LIBS=\ + $(EFIDRIVERLIB)\ + $(MeProtocolLib_LIB)\ + $(MeLibDxe_LIB)\ + $(MeGuidLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueBaseLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueUefiLib_LIB)\ + +AmtPlatformPolicyBin : $(AmtPlatformPolicy_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\AmtPlatformPolicy.mak all\ + GUID=1be65202-9318-492d-a551-08df2bd60aee\ + "MY_INCLUDES = $(AmtPlatformPolicy_INCLUDES)" \ + ENTRY_POINT=AmtPlatformPolicyEntryPoint\ + DEPEX1=$(AmtPlatformPolicy_DIR)\AmtPlatformPolicy.dxs\ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX\ + TYPE=BS_DRIVER\ + COMPRESS=1 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.sdl b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.sdl new file mode 100644 index 0000000..bb2e57d --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/AmtPlatformPolicy.sdl @@ -0,0 +1,42 @@ +TOKEN + Name = "AmtPlatformPolicy_SUPPORT" + Value = "1" + Help = "Main switch to enable AmtPlatformPolicy support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "AmtPlatformPolicy_DIR" +End + +MODULE + Help = "Includes AmtPlatformPolicy.mak to Project" + File = "AmtPlatformPolicy.mak" +End + +ELINK + Name = "$(BUILD_DIR)\AmtPlatformPolicy.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + +TOKEN + Name = "USB_PROVISION_DEFAULT_WITHOUT_AMT" + Value = "0" + Help = "If set to 1, usb provision is functional when AMT disable" + TokenType = Integer + TargetH = Yes +End + +TOKEN + Name = "SW_SMI_POST_COMPLETE" + Value = "0xBB" + Help = "Value to be written into SMI command register \to set POST Complete flag for indicating that the POST is complete" + TokenType = Integer + TargetH = Yes + Range = "0-0xff" +End + diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.c b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.c new file mode 100644 index 0000000..0a3ecc2 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.c @@ -0,0 +1,233 @@ +/*++ + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +--*/ + +/*++ + +Copyright (c) 1999 - 2010 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + AmtPeiPolicyInit.c + +Abstract: + + This file is SampleCode for Intel AMT PEI Platform Policy initialzation. + +--*/ +#include "AmtPeiPolicyInit.h" + +#if EFI_SPECIFICATION_VERSION>0x20000 +#define __UEFI_HII__H__ +#define __HII_CONFIG_ACCESS__H__ +#include EFI_PROTOCOL_DEFINITION (HiiConfigAccess) +#else +#ifndef GUID_VARIABLE_DECLARATION +#define GUID_VARIABLE_DECLARATION(Variable, Guid) extern EFI_GUID Variable +#endif +#define __UEFI_HII__H__ +#define __HII_PROTOCOL_H__ +#define _HII_H_ +#endif + +#include <Setup.h> + +#include EFI_PPI_DEFINITION (Variable) +#include EFI_GUID_DEFINITION (MeBiosExtensionSetup) +#include <ActiveManagement\AlertStandardFormat\Heci\Common\AlertStandardFormatCommon.h> +#include <Guid\AmtForcePushPetPolicy\AmtForcePushPetPolicy.h> + +EFI_GUID gSetupGuid = SETUP_GUID; +EFI_GUID gEfiMeBiosExtensionSetupGuid = EFI_ME_BIOS_EXTENSION_SETUP_GUID; +CHAR16 gEfiMeBiosExtensionSetupName[] = EFI_ME_BIOS_EXTENSION_SETUP_VARIABLE_NAME; +EFI_GUID gPeiReadOnlyVariablePpiGuid = PEI_READ_ONLY_VARIABLE_ACCESS_PPI_GUID; +EFI_GUID gAmtForcePushPetPolicyGuid = AMT_FORCE_PUSH_PET_POLICY_GUID; + +EFI_STATUS +CreateAmtForcePushPetPolicyHob( + IN EFI_PEI_SERVICES **PeiServices +); + +// +// Function implementations +// +EFI_STATUS +AmtPeiPolicyInitEntryPoint ( + IN EFI_FFS_FILE_HEADER *FfsHeader, + IN EFI_PEI_SERVICES **PeiServices + ) +/*++ + +Routine Description: + + Initilize Intel AMT PEI Platform Policy + +Arguments: + + FfsHeader Pointer to Firmware File System file header. + PeiServices General purpose services available to every PEIM. + +Returns: + + EFI_STATUS + +--*/ +{ + EFI_STATUS Status; + PEI_AMT_PLATFORM_POLICY_PPI *AmtPlatformPolicyPpi; + EFI_PEI_PPI_DESCRIPTOR *AmtPlatformPolicyPpiDesc; + EFI_PEI_READ_ONLY_VARIABLE_PPI *VariableServices; + UINTN VariableSize; + SETUP_DATA SetupData; + ME_BIOS_EXTENSION_SETUP MeBiosExtensionSetupData; + // + // Allocate descriptor and PPI structures + // + AmtPlatformPolicyPpi = (PEI_AMT_PLATFORM_POLICY_PPI *) AllocateZeroPool (sizeof (PEI_AMT_PLATFORM_POLICY_PPI)); + ASSERT (AmtPlatformPolicyPpi != NULL); + if (AmtPlatformPolicyPpi == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + AmtPlatformPolicyPpiDesc = (EFI_PEI_PPI_DESCRIPTOR *) AllocateZeroPool (sizeof (EFI_PEI_PPI_DESCRIPTOR)); + ASSERT (AmtPlatformPolicyPpiDesc != NULL); + if (AmtPlatformPolicyPpiDesc == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + // + // Initialize the PPI + // + AmtPlatformPolicyPpiDesc->Flags = EFI_PEI_PPI_DESCRIPTOR_PPI | EFI_PEI_PPI_DESCRIPTOR_TERMINATE_LIST; + AmtPlatformPolicyPpiDesc->Guid = &gPeiAmtPlatformPolicyPpiGuid; + + // Locate Variable Ppi + Status = (*PeiServices)->LocatePpi (PeiServices, &gPeiReadOnlyVariablePpiGuid, 0, NULL, &VariableServices); + + // + // Make sure we have a PPI, if not, just return. + // + if (!VariableServices) { + return EFI_SUCCESS; + } + // + // Get Setup Variable + // + + VariableSize = sizeof (SETUP_DATA); + Status = VariableServices->PeiGetVariable ( + PeiServices, + L"Setup", + &gSetupGuid, + NULL, + &VariableSize, + &SetupData + ); + // + // Update the REVISION number + // + AmtPlatformPolicyPpi->Revision = PEI_AMT_PLATFORM_POLICY_PPI_REVISION_5; + + // + // Initialize the Platform Configuration + // + if (Status != EFI_SUCCESS) { + AmtPlatformPolicyPpi->iAmtEnabled = 0; + AmtPlatformPolicyPpi->WatchDog = 0; + AmtPlatformPolicyPpi->WatchDogTimerBios = 0; + AmtPlatformPolicyPpi->WatchDogTimerOs = 0; + AmtPlatformPolicyPpi->AsfEnabled = 1; + AmtPlatformPolicyPpi->FWProgress = 1; + } else { + AmtPlatformPolicyPpi->iAmtEnabled = SetupData.Amt; + AmtPlatformPolicyPpi->WatchDog = SetupData.WatchDog; + AmtPlatformPolicyPpi->WatchDogTimerBios = SetupData.WatchDogTimerBios; + AmtPlatformPolicyPpi->WatchDogTimerOs = SetupData.WatchDogTimerOs; + AmtPlatformPolicyPpi->AsfEnabled = SetupData.Asf; + AmtPlatformPolicyPpi->FWProgress = SetupData.FWProgress; + } + + // + // Get BIOS Sync-up data from MEBx to AMT platform policy + // + VariableSize = sizeof (MeBiosExtensionSetupData); + Status = VariableServices->PeiGetVariable( + PeiServices, + gEfiMeBiosExtensionSetupName, + &gEfiMeBiosExtensionSetupGuid, + NULL, + &VariableSize, + &MeBiosExtensionSetupData + ); + if (Status != EFI_SUCCESS) { + AmtPlatformPolicyPpi->ManageabilityMode = 0; + } else { + AmtPlatformPolicyPpi->ManageabilityMode = MeBiosExtensionSetupData.PlatformMngSel; + } + +// Debug UpdatePeiAmtPlatformPolicy (PeiServices, AmtPlatformPolicyPpi); + + AmtPlatformPolicyPpiDesc->Ppi = AmtPlatformPolicyPpi; + // + // Install the ME PEI Platform Policy PPI + // + Status = (**PeiServices).InstallPpi (PeiServices, AmtPlatformPolicyPpiDesc); + ASSERT_PEI_ERROR (PeiServices, Status); + + CreateAmtForcePushPetPolicyHob(PeiServices); + + return Status; +} +EFI_FRAMEWORK_MESSAGE_TYPE mAmtForcePushPetPolicy[] = { + EfiAsfMessageChassisIntrusion, + EfiAsfMessageUserAuthenticationInvalid, + EfiAsfMessageHddAuthenticationInvalid, +}; + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// +// Procedure: CreateAmtForcePushPetPolicyHob +// +// Description: Create AMT force push pet policy HOB. +// +// Input: IN EFI_PEI_SERVICES **PeiServices, +// +// Output: EFI_STATUS +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +CreateAmtForcePushPetPolicyHob( +IN EFI_PEI_SERVICES **PeiServices +) +{ + EFI_STATUS Status; + EFI_HOB_GUID_TYPE *Hob; + + // Build the GUID'd HOB for DXE + Status = (*PeiServices)->CreateHob ( + PeiServices, + EFI_HOB_TYPE_GUID_EXTENSION, + (UINT16) (sizeof (EFI_HOB_GUID_TYPE) + sizeof(mAmtForcePushPetPolicy)), + &Hob + ); + if (EFI_ERROR (Status))return Status; + + ((EFI_HOB_GUID_TYPE *)(Hob))->Name = gAmtForcePushPetPolicyGuid; + + Hob++; + + GlueCopyMem (Hob, mAmtForcePushPetPolicy, sizeof(mAmtForcePushPetPolicy)); + + return EFI_SUCCESS; +} diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.cif b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.cif new file mode 100644 index 0000000..c6c717e --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.cif @@ -0,0 +1,13 @@ +<component> + name = "AmtPeiPolicyInit" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\AmtPlatformPolicy\Pei" + RefName = "AmtPeiPolicyInit" +[files] +"AmtPeiPolicyInit.c" +"AmtPeiPolicyInit.h" +"AmtPeiPolicyInit.sdl" +"AmtPeiPolicyInit.mak" +"AmtPeiPolicyInit.dxs" +"AmtPeiPolicyInit.inf" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.dxs b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.dxs new file mode 100644 index 0000000..abfebdd --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.dxs @@ -0,0 +1,35 @@ +/*++ + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +--*/ + +/*++ + +Copyright (c) 1999 - 2010 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePeiPolicyInit.dxs + +Abstract: + + Dependency expression source file. + +--*/ + +#include "EfiDepex.h" + +DEPENDENCY_START + TRUE +DEPENDENCY_END + + diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.h b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.h new file mode 100644 index 0000000..a4426bf --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.h @@ -0,0 +1,60 @@ +/*++ + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +--*/ + +/*++ + +Copyright (c) 1999 - 2010 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + AmtPeiPolicyInit.h + +Abstract: + + Header file for the AmtPeiPolicyInit PEIM. + +--*/ +#ifndef _AMT_PEI_PLATFORM_POLICY_H_ +#define _AMT_PEI_PLATFORM_POLICY_H_ + +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGluePeim.h" +#endif + +#include EFI_PPI_DEFINITION (AmtPlatformPolicyPei) +// Debug #include "AmtPlatformPolicyUpdatePeiLib.h" + +EFI_STATUS +AmtPeiPolicyInitEntryPoint ( + IN EFI_FFS_FILE_HEADER *FfsHeader, + IN EFI_PEI_SERVICES **PeiServices + ) +/*++ + +Routine Description: + + Initilize Intel AMT PEI Platform Policy + +Arguments: + + FfsHeader Pointer to Firmware File System file header. + PeiServices General purpose services available to every PEIM. + +Returns: + + EFI_STATUS + +--*/ +; +#endif diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.inf b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.inf new file mode 100644 index 0000000..f039471 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.inf @@ -0,0 +1,81 @@ +# +#/*++ +# This file contains a 'Sample Driver' and is licensed as such +# under the terms of your license agreement with Intel or your +# vendor. This file may be modified by the user, subject to +# the additional terms of the license agreement +#--*/ +# +#/*++ +# +# Copyright (c) 1999 - 2010 Intel Corporation. All rights reserved +# This software and associated documentation (if any) is furnished +# under a license and may only be used or copied in accordance +# with the terms of the license. Except as permitted by such +# license, no part of this software or documentation may be +# reproduced, stored in a retrieval system, or transmitted in any +# form or by any means without the express written consent of +# Intel Corporation. +# +# Module Name: +# +# AmtPeiPolicyInit.inf +# +# Abstract: +# +# Component description file for the AmtPeiPolicyInit PEIM. +# +#--*/ + + +[defines] +BASE_NAME = AmtPeiPolicyInit +FILE_GUID = A05ECE52-15A8-424e-BFD3-FCF3D566A09C +COMPONENT_TYPE = PE32_PEIM + +[sources.common] + AmtPeiPolicyInit.c + AmtPeiPolicyInit.h +# +# Edk II Glue Driver Entry Point +# + EdkIIGluePeimEntryPoint.c + +[includes.common] + $(EFI_SOURCE)\$(PROJECT_ME_ROOT) + +# +# EDK II Glue Library utilizes some standard headers from EDK +# + $(EDK_SOURCE)\Foundation + $(EDK_SOURCE)\Foundation\Core\Dxe + $(EDK_SOURCE)\Foundation\Efi + $(EDK_SOURCE)\Foundation\Efi\Include + $(EDK_SOURCE)\Foundation\Framework + $(EDK_SOURCE)\Foundation\Framework\Include + $(EDK_SOURCE)\Foundation\Include + $(EDK_SOURCE)\Foundation\Include\IndustryStandard + $(EDK_SOURCE)\Foundation\Include\Pei + $(EDK_SOURCE)\Foundation\Library\Dxe\Include + $(EDK_SOURCE)\Foundation\Library\EdkIIGlueLib\Include + +[libraries.common] + MeLibPpi + PeiLib + EdkIIGlueBaseLib + EdkIIGlueBaseMemoryLib + EdkIIGluePeiDebugLibReportStatusCode + EdkIIGluePeiReportStatusCodeLib + EdkIIGluePeiServicesLib + EdkIIGluePeiMemoryAllocationLib + +[nmake.common] + IMAGE_ENTRY_POINT= _ModuleEntryPoint + DPX_SOURCE=AmtPeiPolicyInit.dxs + C_FLAGS = $(C_FLAGS) /D "__EDKII_GLUE_MODULE_ENTRY_POINT__=AmtPeiPolicyInitEntryPoint" \ + /D __EDKII_GLUE_BASE_LIB__ \ + /D __EDKII_GLUE_BASE_MEMORY_LIB__ \ + /D __EDKII_GLUE_PEI_DEBUG_LIB_REPORT_STATUS_CODE__ \ + /D __EDKII_GLUE_PEI_REPORT_STATUS_CODE_LIB__ \ + /D __EDKII_GLUE_PEI_SERVICES_LIB__ \ + /D __EDKII_GLUE_PEI_MEMORY_ALLOCATION_LIB__ \ diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.mak b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.mak new file mode 100644 index 0000000..ee122c7 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.mak @@ -0,0 +1,113 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* + +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPeiPolicyInit/AmtPeiPolicyInit.mak 2 2/23/12 8:59a Klzhan $ +# +# $Revision: 2 $ +# +# $Date: 2/23/12 8:59a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtPlatformPolicy/AmtPeiPolicyInit/AmtPeiPolicyInit.mak $ +# +# 2 2/23/12 8:59a Klzhan +# Support New EDK +# +# 1 2/08/12 1:09a Klzhan +# +# 1 3/29/11 5:03a Klzhan +# +# 1 2/25/11 1:45a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:11a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +#<AMI_FHDR_START> +# +# Name: AmtPlatformPolicy.mak +# +# Description: +# +#<AMI_FHDR_END> +#********************************************************************** +All : AmtPeiPolicyInit + +AmtPeiPolicyInit : $(BUILD_DIR)\AmtPeiPolicyInit.mak AmtPeiPolicyInitBin + +$(BUILD_DIR)\AmtPeiPolicyInit.mak : $(AmtPeiPlatformPolicy_DIR)\$(@B).cif $(AmtPeiPlatformPolicy_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(AmtPeiPlatformPolicy_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +AmtPeiPlatformPolicy_INCLUDES=\ + $(EDK_INCLUDES) \ + $(ME_INCLUDES) \ + $(MISCFRAMEWORK_INCLUDES) \ + $(NB_INCLUDES)\ + $(SB_INCLUDES)\ + /I$(PROJECT_DIR)\ + /IInclude\ + + +AmtPeiPlatformPolicy_DEFINES=$(MY_DEFINES)\ + /D"__EDKII_GLUE_MODULE_ENTRY_POINT__=AmtPeiPolicyInitEntryPoint"\ + /D __EDKII_GLUE_BASE_IO_LIB_INTRINSIC__ \ + /D __EDKII_GLUE_PEI_DEBUG_LIB_REPORT_STATUS_CODE__ \ + /D __EDKII_GLUE_PEI_REPORT_STATUS_CODE_LIB__\ + /D __EDKII_GLUE_PEI_SERVICES_LIB__ \ + /D __EDKII_GLUE_BASE_PCI_LIB_PCI_EXPRESS__ \ + +AmtPeiPlatformPolicy_LIBS=\ + $(EDKPROTOCOLLIB)\ + $(MeLibPpi_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ + $(EdkIIGlueBaseLibIA32_LIB)\ + $(EdkIIGluePeiServicesLib_LIB)\ + $(EdkIIGluePeiHobLib_LIB)\ + $(EdkIIGluePeiMemoryAllocationLib_LIB)\ + $(EdkIIGlueBaseIoLibIntrinsic_LIB)\ + $(EdkIIGluePeiDebugLibReportStatusCode_LIB)\ + $(EdkIIGluePeiReportStatusCodeLib_LIB)\ + $(PEILIB) + + +AmtPeiPolicyInitBin : $(AmtPeiPlatformPolicy_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDKIIGLUE_DEFAULTS)\ + /f $(BUILD_DIR)\AmtPeiPolicyInit.mak all\ + GUID=A05ECE52-15A8-424e-BFD3-FCF3D566A09C\ + "MY_INCLUDES = $(AmtPeiPlatformPolicy_INCLUDES)" \ + "MY_DEFINES=$(AmtPeiPlatformPolicy_DEFINES)"\ + ENTRY_POINT=AmtPeiPolicyInitEntryPoint\ + TYPE=PEIM\ + EDKIIModule=PEIM\ + DEPEX1=$(AmtPeiPlatformPolicy_DIR)\AmtPeiPolicyInit.dxs\ + DEPEX1_TYPE=EFI_SECTION_PEI_DEPEX\ + COMPRESS=0 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.sdl b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.sdl new file mode 100644 index 0000000..15734dd --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtPlatformPolicy/Pei/AmtPeiPolicyInit.sdl @@ -0,0 +1,25 @@ +TOKEN + Name = "AmtPeiPlatformPolicy_SUPPORT" + Value = "1" + Help = "Main switch to enable AmtPlatformPolicy support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "AmtPeiPlatformPolicy_DIR" +End + +MODULE + Help = "Includes AmtPlatformPolicy.mak to Project" + File = "AmtPeiPolicyInit.mak" +End + +ELINK + Name = "$(BUILD_DIR)\AmtPeiPolicyInit.ffs" + Parent = "FV_BB" + InvokeOrder = AfterParent +End + diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSMIFlashElink.c b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSMIFlashElink.c new file mode 100644 index 0000000..0716540 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSMIFlashElink.c @@ -0,0 +1,128 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSMIFlashElink.c 3 5/14/14 9:48p Tristinchou $ +// +// $Revision: 3 $ +// +// $Date: 5/14/14 9:48p $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSMIFlashElink.c $ +// +// 3 5/14/14 9:48p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 2 9/19/12 6:38a Klzhan +// Check MebxVariable exist or not before restore. +// +// 1 4/24/12 12:38a Klzhan +// Update modulepart to latest +// +// 1 2/16/12 9:01a Klzhan +// [TAG] EIP83223 +// [Category] Improvement +// [Description] Restore MEBiosExtensionSetup when NVRam updated by AFU. +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTSMIFlashElink.c +// +// Description: AMT TSE Functions. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include <AmiDxeLib.h> +#include "MeBiosExtensionSetup\MeBiosExtensionSetup.h" + +ME_BIOS_EXTENSION_SETUP BiosExtensionSetup; +UINT32 mMebxSetupVariableDataAttr; +UINTN mMebxSetupVariableDataSize; +//<AMI_PHDR_START> +//---------------------------------------------------------------------- +// Procedure: PreserveMEBXSyncData +// +// Description: Restore the MEBiosExtensionSetup variable +// +// Input: NONE +// +// Output: NONE +// +// Returns: NONE +// +//---------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID PreserveMEBXSyncData (VOID) +{ + + EFI_STATUS Status; + + mMebxSetupVariableDataSize = sizeof(ME_BIOS_EXTENSION_SETUP); + Status = pRS->GetVariable ( gEfiMeBiosExtensionSetupName, + &gEfiMeBiosExtensionSetupGuid, + &mMebxSetupVariableDataAttr, + &mMebxSetupVariableDataSize, + &BiosExtensionSetup); + + if(EFI_ERROR(Status)) + mMebxSetupVariableDataSize = 0; +} + +//<AMI_PHDR_START> +//---------------------------------------------------------------------- +// Procedure: RestoreMEBXSyncData +// +// Description: Restore the MEBiosExtensionSetup variable +// +// Input: NONE +// +// Output: NONE +// +// Returns: NONE +// +//---------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID RestoreMEBXSyncData (VOID) +{ + EFI_STATUS Status; + + if(mMebxSetupVariableDataSize == 0) + return; + + Status = pRS->SetVariable ( gEfiMeBiosExtensionSetupName, + &gEfiMeBiosExtensionSetupGuid, + mMebxSetupVariableDataAttr, + mMebxSetupVariableDataSize, + &BiosExtensionSetup ); +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.c b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.c new file mode 100644 index 0000000..a643c62 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.c @@ -0,0 +1,236 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.c 5 5/14/14 9:48p Tristinchou $ +// +// $Revision: 5 $ +// +// $Date: 5/14/14 9:48p $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.c $ +// +// 5 5/14/14 9:48p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 4 9/19/12 6:37a Klzhan +// Fix entry point return type. +// +// 3 6/05/12 2:05a Klzhan +// [TAG] EIP91581 +// [Category] Improvement +// [Description] Avoid system crash when HECI reset +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 2 7/14/11 7:45a Klzhan +// Add "Disable ME" setup item. +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTSetup.c +// +// Description: AMT TSE Functions. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "Token.h" +#include "Efi.h" +#include "EfiDriverLib.h" +#include "EfiCommonLib.h" +#include "Amt.h" +#include "EfiScriptLib.h" +#include "AmtLib.h" +#include "Include\Protocol\LegacySredir.h" +#include "AmtSetup.h" +#include <SetupDataDefinition.h> +#include "MELib.h" +#include EFI_PROTOCOL_CONSUMER (AmtPlatformPolicy) +#include EFI_PROTOCOL_CONSUMER (AmtWrapper) +#include EFI_PROTOCOL_DEFINITION (MeBiosPayloadData) +#include "Protocol\AmtWrapper\AmtWrapper.h" + +EFI_GUID gEfiAmtWrapperProtocolGuid = EFI_AMT_WRAPPER_PROTOCOL_GUID; + +#define SETUP_GUID { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } +EFI_GUID gEfiSetupGuid = SETUP_GUID; + +VOID +SetMEDisable ( + IN UINT8 Grayout +) +{ +#if defined(iAMT_SUPPORT) && (iAMT_SUPPORT == 1) + SETUP_DATA gSetupData; + UINTN SetupDataSize; + EFI_STATUS Status; + EFI_HECI_PROTOCOL *Heci; + UINT32 MeMode; + DXE_MBP_DATA_PROTOCOL *mBIOSPayLoad; + + Status = gBS->LocateProtocol ( + &gEfiHeciProtocolGuid, + NULL, + &Heci + ); + + if (EFI_ERROR (Status)) { + return; + } + + Status = Heci->GetMeMode (&MeMode); + + if (EFI_ERROR (Status)) { + return; + } + + SetupDataSize = sizeof(SETUP_DATA); + Status = gRT->GetVariable ( L"Setup", \ + &gEfiSetupGuid, \ + NULL, \ + &SetupDataSize, \ + &gSetupData ); + + if (EFI_ERROR (Status)) { + return; + } + + Status = gBS->LocateProtocol(&gMeBiosPayloadDataProtocolGuid, + NULL, &mBIOSPayLoad); + + if (EFI_ERROR (Status)) { + return; + } + + if(gSetupData.MEDisabled) + { + // AT in Inactive mode, and no SOL or IDER or KVM session + // can't set ME to disabled + if((MeMode == ME_MODE_NORMAL) && + (mBIOSPayLoad->MeBiosPayload.AtState.State == 0) && + (Grayout == 0)) + { + Status = HeciSetMeDisableMsg(); + if(!EFI_ERROR(Status)) + { + Status = HeciSendCbmResetRequest (CBM_RR_REQ_ORIGIN_BIOS_POST, CBM_HRR_GLOBAL_RESET); + if(!EFI_ERROR(Status)) + EFI_DEADLOOP(); + } + } + }else + { + if(MeMode == ME_MODE_TEMP_DISABLED) + { + Status = HeciSetMeEnableMsg(); + if(!EFI_ERROR(Status)) + { + Status = HeciSendCbmResetRequest (CBM_RR_REQ_ORIGIN_BIOS_POST, CBM_HRR_GLOBAL_RESET); + if(!EFI_ERROR(Status)) + EFI_DEADLOOP(); + } + } + } +#endif +} + + +EFI_STATUS +InitializeAmtSetup ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + SETUP_AMT_FEATURES SetupAmtFeatures; + EFI_STATUS Status; + UINT32 VarAttr; + UINTN VariableSize; + UINTN Update = 0; + UINT8 GrayOut; + AMT_WRAPPER_PROTOCOL *pAmtWrapper = NULL; + + + EfiInitializeDriverLib (ImageHandle, SystemTable); + + Status = gBS->LocateProtocol( + &gEfiAmtWrapperProtocolGuid, + NULL, + &pAmtWrapper); + + ASSERT_EFI_ERROR(Status); + + VariableSize = sizeof(SETUP_AMT_FEATURES); + Status = gRT->GetVariable( + L"SetupAmtFeatures", + &gEfiSetupGuid, + &VarAttr, + &VariableSize, + &SetupAmtFeatures); + + if ( pAmtWrapper->ActiveManagementEnableIdeR() || + pAmtWrapper->ActiveManagementEnableSol() || + pAmtWrapper->ActiveManagementEnableKvm()) { + GrayOut = 1; + } else { + GrayOut = 0; + } + + if (SetupAmtFeatures.GrayOut != GrayOut) { + SetupAmtFeatures.GrayOut = GrayOut; + Update = 1; + } + + if (Update || EFI_ERROR(Status)) { + if( Status == EFI_NOT_FOUND ) + VarAttr = EFI_VARIABLE_NON_VOLATILE | EFI_VARIABLE_BOOTSERVICE_ACCESS; + Status = gRT->SetVariable( + L"SetupAmtFeatures", + &gEfiSetupGuid, + VarAttr, + sizeof(SETUP_AMT_FEATURES), + &SetupAmtFeatures); + ASSERT_EFI_ERROR(Status); + } + SetMEDisable(GrayOut); + + + return EFI_SUCCESS; +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.cif b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.cif new file mode 100644 index 0000000..58618a7 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.cif @@ -0,0 +1,16 @@ +<component> + name = "AmtSetup" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\AmtSetup" + RefName = "AmtSetup" +[files] +"AmtSetup.sdl" +"AmtSetup.mak" +"AmtSetup.c" +"AmtSetup.sd" +"AmtSetup.uni" +"AmtSetup.h" +"AmtSetup.dxs" +"AmtTseFunc.c" +"AmtSMIFlashElink.c" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.dxs b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.dxs new file mode 100644 index 0000000..057c0e5 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.dxs @@ -0,0 +1,70 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.dxs 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.dxs $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTSetup.dxs +// +// Description: AMT TSE dependency file. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> + +#include <Protocol\Variable.h> +#include "Protocol\AmtWrapper\AmtWrapper.h" + +#include EFI_PROTOCOL_DEFINITION (ActiveManagement) + +DEPENDENCY_START + EFI_VARIABLE_ARCH_PROTOCOL_GUID AND + EFI_VARIABLE_WRITE_ARCH_PROTOCOL_GUID AND + EFI_ACTIVE_MANAGEMENT_PROTOCOL_GUID AND + EFI_AMT_WRAPPER_PROTOCOL_GUID +DEPENDENCY_END + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.h b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.h new file mode 100644 index 0000000..00b842c --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.h @@ -0,0 +1,74 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.h 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.h $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTSetup.sd +// +// Description: AMT TSE makfile. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#ifndef __AMT_SETUP_H__ +#define __AMT_SETUP_H__ + +#ifdef __cplusplus +extern "C" { +#endif + +//This structure is used for setup. +typedef struct { + UINT8 GrayOut; +} SETUP_AMT_FEATURES; + + +/****** DO NOT WRITE BELOW THIS LINE *******/ +#ifdef __cplusplus +} +#endif +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.mak b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.mak new file mode 100644 index 0000000..e5cedb1 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.mak @@ -0,0 +1,166 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.mak 3 4/24/12 12:38a Klzhan $ +# +# $Revision: 3 $ +# +# $Date: 4/24/12 12:38a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.mak $ +# +# 3 4/24/12 12:38a Klzhan +# Update modulepart to latest +# +# 2 2/23/12 8:58a Klzhan +# Support New EDK +# +# 1 2/08/12 1:08a Klzhan +# Initial Check in +# +# 2 7/14/11 7:45a Klzhan +# Add "Disable ME" setup item. +# +# 1 2/25/11 1:44a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:11a Klzhan +# Initial Check-in. +# +#********************************************************************** +# +#<AMI_FHDR_START> +#--------------------------------------------------------------------------- +# Name: AMTSetup.sd +# +# Description: AMT TSE makfile. +# +#--------------------------------------------------------------------------- +#<AMI_FHDR_END> + +#--------------------------------------------------------------------------- +# Create AMT Setup Screens +#--------------------------------------------------------------------------- +All : AmtSetup + +AmtSetup : $(BUILD_DIR)\AmtSetup.mak AmtSetupBin +#AmtSetup : $(BUILD_DIR)\AmtSetup.mak AmtSetupBin +AmtTseFunc_lib : $(BUILD_DIR)\AmtSetup.mak AmtTseSetupBin + + +SetupSdbs : $(BUILD_DIR)\AmtSetup.sdb + +$(BUILD_DIR)\AmtSetup.sdb : $(AMT_SETUP_DIR)\$(@B).sd $(AMT_SETUP_DIR)\$(@B).uni + $(STRGATHER) -i INCLUDE -parse -newdb -db $(BUILD_DIR)\$(@B).sdb $(AMT_SETUP_DIR)\$(@B).uni + $(STRGATHER) -scan -db $(BUILD_DIR)\$(@B).sdb -od $(BUILD_DIR)\$(@B).sdb $(AMT_SETUP_DIR)\$(@B).sd + +$(BUILD_DIR)\AmtSetup.mak : $(AMT_SETUP_DIR)\$(@B).cif $(AMT_SETUP_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(AMT_SETUP_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +AmtSetup_INCLUDES= \ + $(EDK_INCLUDES) \ + $(MISCFRAMEWORK_INCLUDES) \ + $(ME_INCLUDES) \ + $(IndustryStandard_INCLUDES)\ + +AmtSetup_CFLAGS=$(CFLAGS) \ + -I $(TSEBIN_DIR)\Inc \ + -I $(TSEBIN_DIR)\ + -I ReferenceCode\ME\Protocol\ + -I Board\EM\MeWrapper\AmtWrapper\Protocol + +AmtTseSetup_INCLUDES= \ + /I$(PROJECT_DIR) \ + $(EDK_INCLUDES) \ + $(MISCFRAMEWORK_INCLUDES) \ + $(ME_INCLUDES) \ + /IInclude\Protocol\ + /IInclude\IndustryStandard\ + /IInclude\ + +SetupData : $(BUILD_DIR)\AmtTseFunc.obj + +$(BUILD_DIR)\AmtTseFunc.obj : $(AMT_SETUP_DIR)\AmtTseFunc.c + $(CC) $(AmtSetup_CFLAGS) /Fo$(BUILD_DIR)\ $(AMT_SETUP_DIR)\AmtTseFunc.c + +AMT_SETUPLIB_OBJECTS = $(BUILD_DIR)\$(AMT_SETUP_DIR)\AmtTseFunc.obj +AMT_SETUP_OBJECTS = $(BUILD_DIR)\$(AMT_SETUP_DIR)\AmtSetup.obj + +AMT_SETUP_LIBS=\ + $(EFIDRIVERLIB)\ + $(MeLibDxe_LIB)\ + $(EfiScriptLib_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ + $(EDKFRAMEWORKPROTOCOLLIB)\ + $(EFIPROTOCOLLIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueBaseLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueDxeMemoryAllocationLib_LIB)\ + $(EFIGUIDLIB)\ + $(EDKPROTOCOLLIB)\ + $(EdkIIGlueBaseIoLibIntrinsic_LIB)\ + $(EdkIIGlueBaseMemoryLib_LIB)\ + $(EdkIIGlueEdkDxeRuntimeDriverLib_LIB)\ + $(EdkIIGlueUefiLib_LIB)\ + $(EdkIIGlueDxeHobLib_LIB)\ + +AmtSetupBin : $(AMT_SETUP_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\AmtSetup.mak all \ + "MY_INCLUDES=$(AmtSetup_INCLUDES)"\ + GUID=773CB08B-511A-4bd5-85AD-41D4F4B64A52 \ + TYPE=BS_DRIVER \ + "OBJECTS=$(AMT_SETUP_OBJECTS)"\ + ENTRY_POINT=InitializeAmtSetup \ + DEPEX1=$(AMT_SETUP_DIR)\AmtSetup.dxs \ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + COMPRESS=1 + +#--------------------------------------------------------------------------- +# Create Restore BIOSExtesionSetup Restore Component +#--------------------------------------------------------------------------- +AmtSMIFlashElink : $(BUILD_DIR)\AmtSetup.mak AmtSMIFlashElinkBin + +AmtSMIFlashElinkObjs = $(BUILD_DIR)\$(AMT_SETUP_DIR)\AmtSMIFlashElink.obj + +AmtSMIFlashElinkBin : $(AMIDXELIB) $(MeGuidLib_LIB) + $(MAKE) /$(MAKEFLAGS) $(BUILD_DEFAULTS)\ + /f $(BUILD_DIR)\AmtSetup.mak all\ + "CFLAGS=$(CFLAGS:/W4=/W3) /I$(MeGuidLib_DIR)" \ + OBJECTS="$(AmtSMIFlashElinkObjs)" \ + NAME=AmtSetup \ + TYPE=LIBRARY LIBRARY_NAME=$(AMT_SMIFLASH_LIB) + +$(AMT_SMIFLASH_LIB) : AmtSMIFlashElink +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.sd b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.sd new file mode 100644 index 0000000..8f9bd1a --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.sd @@ -0,0 +1,382 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.sd 5 9/24/15 3:04a Tristinchou $ +// +// $Revision: 5 $ +// +// $Date: 9/24/15 3:04a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtSetup.sd $ +// +// 5 9/24/15 3:04a Tristinchou +// [TAG] EIP238392 +// [Category] Improvement +// [Description] Change USB Provisioning default to disable +// +// 4 8/02/13 5:02a Klzhan +// [TAG] EIP131372 +// [Category] Improvement +// [Description] Fix build error when disable AT_SUPPORT +// +// 3 11/06/12 7:13a Klzhan +// Pass SharkBay AT test. +// +// 2 4/24/12 12:38a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 3 7/14/11 7:45a Klzhan +// Add "Disable ME" setup item. +// +// 2 5/19/11 5:30a Klzhan +// Remove un-use AMT setup item. +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTSetup.sd +// +// Description: AMT TSE sd file. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#ifdef SETUP_DATA_DEFINITION +/***********************************************************/ +/* Put NVRAM data definitions here. +/* For example: UINT8 Data1; +/* These definitions will be converted by the build process +/* to a definitions of SETUP_DATA fields. +/***********************************************************/ + // + // Intel AMT + // + UINT8 Amt; + UINT8 AmtbxPrompt; + UINT8 AmtbxHotKeyPressed; + UINT8 AmtbxSelectionScreen; + UINT8 FWVerbose; + UINT8 HideUnConfigureMeConfirm; + UINT8 MebxDebugMsg; + UINT8 UnConfigureMe; + UINT8 AmtSpiLock; + UINT16 AmtWaitTimer; + UINT8 AmtCiraRequest; + UINT8 AmtCiraTimeout; + UINT8 USBProvision; + UINT8 FWProgress; + UINT8 MEDisabled; + // + // ASF + // + UINT8 Asf; + + // + // WatchDog + // + UINT8 WatchDog; + UINT16 WatchDogTimerOs; + UINT16 WatchDogTimerBios; + +#endif + +//--------------------------------------------------------------------------- +#if defined(VFRCOMPILE) && !defined(CONTROLS_ARE_DEFINED) +#define CONTROL_DEFINITION +#endif +//--------------------------------------------------------------------------- + +//--------------------------------------------------------------------------- +#ifdef CONTROL_DEFINITION + +#define AMT_ONEOF_AMT\ + oneof varid = SETUP_DATA.Amt,\ + prompt = STRING_TOKEN(STR_AMT_PROMPT),\ + help = STRING_TOKEN(STR_AMT_HELP),\ + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = RESET_REQUIRED, key = 0;\ + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0;\ + endoneof; + + +#define AMT_CHECKBOX_AMTBX_HOTKEYPRESSED\ + checkbox varid = SETUP_DATA.AmtbxHotKeyPressed,\ + prompt = STRING_TOKEN(STR_AMTBX_HOTKEY_PRESSED_PROMPT),\ + help = STRING_TOKEN(STR_AMTBX_HOTKEY_PRESSED_HELP),\ + flags = 0 | RESET_REQUIRED,\ + key = 0,\ + endcheckbox; + +#define AMT_CHECKBOX_AMTBX_SELECTSECTION\ + checkbox varid = SETUP_DATA.AmtbxSelectionScreen,\ + prompt = STRING_TOKEN(STR_AMTBX_SELECTION_SCREEN_PROMPT),\ + help = STRING_TOKEN(STR_AMTBX_SELECTION_SCREEN_HELP),\ + flags = 0 | RESET_REQUIRED,\ + key = 0,\ + endcheckbox; + + +#define AMT_CHECKBOX_HIDEUNCONFIGUREDMECONFIRM\ + checkbox varid = SETUP_DATA.HideUnConfigureMeConfirm,\ + prompt = STRING_TOKEN(STR_AMT_HIDE_CONFIRMATION_UNCONFIGURE_ME_PROMPT),\ + help = STRING_TOKEN(STR_AMT_HIDE_CONFIRMATION_UNCONFIGURE_ME_HELP),\ + flags = 0 | RESET_REQUIRED,\ + key = 0,\ + endcheckbox; + +#define AMT_CHECKBOX_MEBX_DEBUGMSG\ + checkbox varid = SETUP_DATA.MebxDebugMsg,\ + prompt = STRING_TOKEN(STR_AMT_MEBX_DEBUG_MSG_PROMPT),\ + help = STRING_TOKEN(STR_AMT_MEBX_DEBUG_MSG_HELP),\ + flags = 0 | RESET_REQUIRED,\ + key = 0,\ + endcheckbox; + +#define AMT_CHECKBOX_UNCONFIGUREME\ + checkbox varid = SETUP_DATA.UnConfigureMe,\ + prompt = STRING_TOKEN(STR_AMT_UNCONFIGURE_ME_PROMPT),\ + help = STRING_TOKEN(STR_AMT_UNCONFIGURE_ME_HELP),\ + flags = 0 | RESET_REQUIRED,\ + key = 0,\ + endcheckbox; + +#define AMT_NUMERIC_AMT_WAITTIMER\ + numeric varid = SETUP_DATA.AmtWaitTimer,\ + prompt = STRING_TOKEN (STR_AMT_WAIT_TIMER_PROMPT),\ + help = STRING_TOKEN (STR_AMT_WAIT_TIMER_HELP),\ + minimum = 0,\ + maximum = 65535,\ + step = 1,\ + default = 0,\ + endnumeric; + // Stepping of 0 equates to a manual entering + // of a value, otherwise it will auto-increment + // with a left/right arrow + +#define AMT_ONEOF_MEDISABLED\ + oneof varid = SETUP_DATA.MEDisabled,\ + prompt = STRING_TOKEN(STR_SET_ME_DISABLED_PROMPT),\ + help = STRING_TOKEN(STR_SET_ME_DISABLED_HELP),\ + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = DEFAULT | RESET_REQUIRED, key = 0;\ + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = MANUFACTURING | RESET_REQUIRED, key = 0;\ + endoneof; + +#define AMT_ONEOF_ASF\ + oneof varid = SETUP_DATA.Asf,\ + prompt = STRING_TOKEN(STR_ASF_PROMPT),\ + help = STRING_TOKEN(STR_ASF_HELP),\ + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = RESET_REQUIRED, key = 0;\ + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0;\ + endoneof; + +#define AMT_CHECKBOX_AMT_CIRAREQUEST\ + checkbox varid = SETUP_DATA.AmtCiraRequest,\ + prompt = STRING_TOKEN(STR_AMT_CIRA_REQUEST_PROMPT),\ + help = STRING_TOKEN(STR_AMT_CIRA_REQUEST_HELP),\ + flags = 0 | RESET_REQUIRED,\ + key = 0,\ + endcheckbox; + +#define AMT_ONEOF_USB_PROVISION\ + oneof varid = SETUP_DATA.USBProvision,\ + prompt = STRING_TOKEN(STR_AMT_USB_CONFIGURE_PROMPT),\ + help = STRING_TOKEN(STR_AMT_USB_CONFIGURE_HELP),\ + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0;\ + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = RESET_REQUIRED, key = 0;\ + endoneof; + +#define AMT_ONEOF_FW_PROGRESS\ + oneof varid = SETUP_DATA.FWProgress,\ + prompt = STRING_TOKEN(STR_AMT_PET_PROGRESS_PROMPT),\ + help = STRING_TOKEN(STR_AMT_PET_PROGRESS_HELP),\ + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = RESET_REQUIRED, key = 0;\ + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0;\ + endoneof; + + +#define AMT_NUMERIC_AMT_CIRATIMEOUT\ + numeric varid = SETUP_DATA.AmtCiraTimeout, \ + prompt = STRING_TOKEN (STR_AMT_CIRA_TIMEOUT_PROMPT),\ + help = STRING_TOKEN (STR_AMT_CIRA_TIMEOUT_HELP),\ + flags = RESET_REQUIRED,\ + minimum = 0,\ + maximum = 255,\ + step = 1,\ + default = 0, \ + endnumeric; + // Stepping of 0 equates to a manual entering + // of a value, otherwise it will auto-increment + // with a left/right arrow + +#define AMT_ONEOF_WATCHDOG\ + oneof varid = SETUP_DATA.WatchDog,\ + prompt = STRING_TOKEN(STR_WATCHDOG_PROMPT),\ + help = STRING_TOKEN(STR_WATCHDOG_HELP),\ + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0;\ + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = RESET_REQUIRED, key = 0;\ + endoneof; + +#define AMT_NUMERIC_WATCHDOG_TIMEROS\ + numeric varid = SETUP_DATA.WatchDogTimerOs,\ + prompt = STRING_TOKEN (STR_WATCHDOG_TIMER_OS_PROMPT),\ + help = STRING_TOKEN (STR_WATCHDOG_TIMER_OS_HELP),\ + minimum = 0,\ + maximum = 65535,\ + step = 1,\ + default = 0,\ + endnumeric; + +#define AMTSETUP_NUMERIC_WATCHDOG_TIMERBIOS\ + numeric varid = SETUP_DATA.WatchDogTimerBios,\ + prompt = STRING_TOKEN (STR_WATCHDOG_TIMER_BIOS_PROMPT),\ + help = STRING_TOKEN (STR_WATCHDOG_TIMER_BIOS_HELP),\ + minimum = 0,\ + maximum = 65535,\ + step = 1,\ + default = 0,\ + endnumeric; + +#endif // CONTROL_DEFINITION +//--------------------------------------------------------------------------- + +//--------------------------------------------------------------------------- +#ifdef CONTROLS_WITH_DEFAULTS + AMT_ONEOF_AMT + AMT_CHECKBOX_AMTBX_HOTKEYPRESSED + AMT_CHECKBOX_AMTBX_SELECTSECTION + AMT_CHECKBOX_HIDEUNCONFIGUREDMECONFIRM + AMT_CHECKBOX_MEBX_DEBUGMSG + AMT_CHECKBOX_UNCONFIGUREME + AMT_NUMERIC_AMT_WAITTIMER + AMT_ONEOF_MEDISABLED + AMT_ONEOF_ASF + AMT_CHECKBOX_AMT_CIRAREQUEST + AMT_ONEOF_USB_PROVISION + AMT_ONEOF_FW_PROGRESS + AMT_NUMERIC_AMT_CIRATIMEOUT + AMT_ONEOF_WATCHDOG + AMT_NUMERIC_WATCHDOG_TIMEROS + AMTSETUP_NUMERIC_WATCHDOG_TIMERBIOS +#endif // CONTROLS_WITH_DEFAULTS + +//********************************************************************** +// Advanced - ASF Configuration Form +//********************************************************************** + +#ifdef ADVANCED_FORM_SET + +#ifdef FORM_SET_TYPEDEF + #include "AmtSetup.h" + #include <MeSetup.h> +#endif + + #ifdef FORM_SET_ITEM + // Define controls to be added to the main page of the formset + + #endif + + #ifdef FORM_SET_VARSTORE + varstore SETUP_AMT_FEATURES, + key = AUTO_ID(AMT_FEATURES_ID), + name = SetupAmtFeatures, + guid = SETUP_GUID; + #endif + + #ifdef FORM_SET_GOTO + // Define goto commands for the forms defined in this file + suppressif NOT ideqval SETUP_DATA.MeFirmwareInfo == NORMAL_MODE + AND NOT ideqval SETUP_DATA.MeFirmwareInfo == TEMP_DISABLE_MODE; + grayoutif ideqval SETUP_AMT_FEATURES.GrayOut == 1; + goto AMT_FORM_ID, + prompt = STRING_TOKEN(STR_AMT_FORM), + help = STRING_TOKEN(STR_AMT_FORM_HELP); + SUPPRESS_GRAYOUT_ENDIF + #endif + + #ifdef FORM_SET_FORM + + // Define forms + #ifndef AMT_FORM_SETUP + #define AMT_FORM_SETUP + + form formid = AUTO_ID(AMT_FORM_ID), + title = STRING_TOKEN(STR_AMT_FORM); + + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + AMT_ONEOF_AMT + endif; + + + grayoutif ideqval SETUP_DATA.Amt == 0 OR ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + AMT_CHECKBOX_AMTBX_HOTKEYPRESSED + AMT_CHECKBOX_AMTBX_SELECTSECTION + AMT_CHECKBOX_HIDEUNCONFIGUREDMECONFIRM + AMT_CHECKBOX_MEBX_DEBUGMSG + AMT_CHECKBOX_UNCONFIGUREME + AMT_NUMERIC_AMT_WAITTIMER + +#if TdtWrapper_SUPPORT + grayoutif ideqval TDT_VOLATILE_SETUP_DATA.TdtEnroll == 1; + AMT_ONEOF_MEDISABLED + endif; +#else + AMT_ONEOF_MEDISABLED +#endif + AMT_ONEOF_ASF + AMT_CHECKBOX_AMT_CIRAREQUEST + AMT_ONEOF_USB_PROVISION + AMT_ONEOF_FW_PROGRESS + endif; + + grayoutif ideqval SETUP_DATA.AmtCiraRequest == 0 OR ideqval SETUP_DATA.Amt == 0 OR ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + AMT_NUMERIC_AMT_CIRATIMEOUT + endif; + + grayoutif ideqval SETUP_DATA.Asf == 0 OR ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + AMT_ONEOF_WATCHDOG + endif; + + grayoutif ideqval SETUP_DATA.Asf == 0 OR ideqval SETUP_DATA.WatchDog == 0 OR ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + AMT_NUMERIC_WATCHDOG_TIMEROS + AMTSETUP_NUMERIC_WATCHDOG_TIMERBIOS + endif; + + endform; + #endif // AMT_FORM_SETUP + #endif +#endif // ADVANCED_FORM_SET + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.sdl b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.sdl new file mode 100644 index 0000000..8840618 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.sdl @@ -0,0 +1,107 @@ +TOKEN + Name = "iAMT_Setup" + Value = "1" + Help = "Main switch to enable iAMT Setup support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "AMT_SETUP_DIR" +End + +MODULE + Help = "Includes AmtSetup.mak to Project" + File = "AmtSetup.mak" +End + +ELINK + Name = "$(BUILD_DIR)\AmtSetup.sdb" + Parent = "SETUP_SDBS" + Priority = 30 + Help = "Includes generic iAMT setup screens to the project" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(AMT_SETUP_DIR)\AmtSetup.sd" + Parent = "SETUP_DEFINITIONS" + Priority = 30 + InvokeOrder = AfterParent +End + +ELINK + Name = "iAMTProcessProceedToBootHook," + Parent = "ProcessProceedToBoot," + Help = "iAMT hook into TSE for TSE specific functions " + Token = "iAMT_SUPPORT" "=" "1" + InvokeOrder = BeforeParent +End + +ELINK + Name = "iAMTProcessEnterSetupHook," + Parent = "PostManagerHandShakeHook," + Help = "iAMT hook into TSE for TSE specific functions " + Token = "iAMT_SUPPORT" "=" "1" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\AmtSetup.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\AmtTseFunc.obj" + Parent = "AMITSE_Objects" + InvokeOrder = AfterParent +End + +ELINK + Name = "AMTSETUP_LIB" + InvokeOrder = ReplaceParent +End + +ELINK + Name = "iAMTProcessConInAvailabilityHook," + Parent = "ProcessConInAvailability," + Help = "iAMT hook into TSE for TSE specific functions " + Token = "iAMT_SUPPORT" "=" "1" + InvokeOrder = AfterParent +End + + +ELINK + Name = "AMTBypassPasswordCheck," + Parent = "ProcessConInAvailabilityHook," + Priority = 0 + InvokeOrder = AfterParent +End + +TOKEN + Name = "AMT_SMIFLASH_LIB" + Value = "$(BUILD_DIR)\AmtSetup.lib" + TokenType = Expression + TargetMAK = Yes +End + +ELINK + Name = "$(BUILD_DIR)\AmtSetup.lib" + Parent = "PRESERVE_LIB" + InvokeOrder = AfterParent +End + +ELINK + Name = "PreserveMEBXSyncData," + Parent = "SMIFlashPreUpdateList" + InvokeOrder = AfterParent +End + +ELINK + Name = "RestoreMEBXSyncData," + Parent = "SMIFlashEndUpdateList" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.uni b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.uni Binary files differnew file mode 100644 index 0000000..a0e84b7 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtSetup.uni diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtTseFunc.c b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtTseFunc.c new file mode 100644 index 0000000..ee41845 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSetup/AmtTseFunc.c @@ -0,0 +1,447 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtTseFunc.c 3 5/14/14 9:49p Tristinchou $ +// +// $Revision: 3 $ +// +// $Date: 5/14/14 9:49p $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSetup/AmtTseFunc.c $ +// +// 3 5/14/14 9:49p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 2 4/24/12 12:38a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTTseFunc.c +// +// Description: AMT TSE Functions. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +/* +#include <EFI.h> +#include "EfiDriverLib.h" +#include "EfiCommonLib.h" +#include "AmtSetup.h" +#include "token.h" +#include "EfiBootScript.h" +#include <AMIVfr.h> +#include <Core\EM\AMITSE\Inc\variable.h> + +#include EFI_PROTOCOL_CONSUMER (AmtPlatformPolicy) +#include EFI_PROTOCOL_CONSUMER (AmtWrapper) +#include EFI_PROTOCOL_CONSUMER (AlertStandardFormat) +#include EFI_PROTOCOL_DEFINITION (BootScriptSave) +#include EFI_GUID_DEFINITION (AcpiVariable) +*/ +#include <Setup.h> +#include <TseCommon.h> +//#include <ME.h> +//#include "Board\EM\AMT\Setup\AMT.h" +#include "variable.h" +#include "AmtWrapper\AmtWrapper.h" +#include "AlertStandardFormat\AlertStandardFormat.h" +#define SETUP_GUID \ + { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } + +#define BOOT_MANAGER_GUID \ + { 0xB4909CF3, 0x7B93, 0x4751, 0x9B, 0xD8, 0x5B, 0xA8, 0x22, 0x0B, 0x9B, 0xB2 } + +#define EFI_BOOT_SCRIPT_SAVE_PROTOCOL_GUID \ + { \ + 0x470e1529, 0xb79e, 0x4e32, 0xa0, 0xfe, 0x6a, 0x15, 0x6d, 0x29, 0xf9, 0xb2 \ + } + +#define AMI_EFI_SOL_POST_MESSAGE_GUID \ + { 0xf42f3752, 0x12e, 0x4812, 0x99, 0xe6, 0x49, 0xf9, 0x43, 0x4, 0x84, 0x54 } + +#define EFI_GLOBAL_VARIABLE \ + {0x8BE4DF61,0x93CA,0x11d2,0xAA,0xD,0x0,0xE0,0x98,0x03,0x2B,0x8C} + +//EFI_BOOT_SCRIPT_SAVE_PROTOCOL *gBootScriptSave; +EFI_GUID gEfiAmtWrapperProtocolGuidTse = EFI_AMT_WRAPPER_PROTOCOL_GUID; +EFI_GUID gEfiAlertStandardFormatProtocolGuid = EFI_ALERT_STANDARD_FORMAT_PROTOCOL_GUID; +static UINTN ScriptDone = 0; +extern BOOLEAN gEnterSetup; + +VOID CheckForKey( EFI_EVENT Event, VOID *Context ); +VOID AMTBypassPasswordRestore(VOID); + +extern EFI_BOOT_SERVICES *gBS; +extern EFI_SYSTEM_TABLE *gST; +extern EFI_RUNTIME_SERVICES *gRT; +//******************************************************************************* +//<AMI_PHDR_START> +// Procedure: iAMTCheckForKey +// +// Description: +// +// Input: Event: Timer event. +// Context: Event context; always NULL +// +// Output: VOID +// +//<AMI_PHDR_END> +//******************************************************************************* +VOID iAMTCheckForKey( EFI_EVENT Event, VOID *Context) +{ + // Console Lock by uninstall Protocol, + // So remove this. + //CheckForKey((EFI_EVENT)NULL, NULL ); + +} + + +//******************************************************************************* +//<AMI_PHDR_START> +// Procedure: iAMTProcessProceedToBootHook +// +// Description: +// +// Input: Event: Timer event. +// Context: Event context; always NULL +// +// Output: VOID +// +//<AMI_PHDR_END> +//******************************************************************************* +VOID iAMTProcessProceedToBootHook ( EFI_EVENT Event, VOID *Context) +{ + AMT_WRAPPER_PROTOCOL *pAmtWrapper = NULL; + EFI_STATUS Status; + EFI_ALERT_STANDARD_FORMAT_PROTOCOL *AsfCheck; + EFI_ASF_BOOT_OPTIONS *mInternalAsfBootOptions; + + if (pAmtWrapper == NULL) { + Status = gBS->LocateProtocol(&gEfiAmtWrapperProtocolGuidTse, NULL, &pAmtWrapper); + } + + //case IDER + if (pAmtWrapper != NULL) { + if (pAmtWrapper->ActiveManagementEnableIdeR()||pAmtWrapper->ActiveManagementEnableSol()){ + Status = pAmtWrapper->BdsBootViaAsf(); + return; + } + } + + //case ASF + //Get the ASF options + //if set then we have to do and Asfboot + Status = gBS->LocateProtocol ( + &gEfiAlertStandardFormatProtocolGuid, + NULL, + &AsfCheck + ); + + if (EFI_ERROR (Status)) { +// DEBUG ((EFI_D_ERROR, "Info : Error gettings ASF protocol -> %r\n", Status)); + return; + } + + Status = AsfCheck->GetBootOptions (AsfCheck, &mInternalAsfBootOptions); + + if (mInternalAsfBootOptions->SubCommand != ASF_BOOT_OPTIONS_PRESENT) { + return; + }else{ + Status = pAmtWrapper->BdsBootViaAsf(); + return; + } +} + + +//******************************************************************************* +//<AMI_PHDR_START> +// Procedure: iAMTProcessEnterSetupHook +// +// Description: +// +// Input: Event: Timer event. +// Context: Event context; always NULL +// +// Output: VOID +// +//<AMI_PHDR_END> +//******************************************************************************* +VOID iAMTProcessEnterSetupHook ( EFI_EVENT Event, VOID *Context) +{ + EFI_STATUS Status; + UINT16 count = 0; + EFI_GUID BootManGuid = BOOT_MANAGER_GUID; + AMT_WRAPPER_PROTOCOL *pAmtWrapper = NULL; + + if (pAmtWrapper == NULL) + Status = gBS->LocateProtocol(&gEfiAmtWrapperProtocolGuidTse, NULL, &pAmtWrapper); + if (pAmtWrapper != NULL) { + if (pAmtWrapper->ActiveManagementEnableIdeR()) { + count = 0xFFFF; + } + } + if (count == 0xFFFF){ + gRT->SetVariable( L"BootManager", &BootManGuid, EFI_VARIABLE_BOOTSERVICE_ACCESS,sizeof(count),&count );} +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: AMTBypassPasswordRestore +// +// Description: This function is a hook called when TSE determines +// that SETUP utility has to be displayed. This function +// is available as ELINK. In the generic implementation +// setup password is prompted in this function. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +BOOLEAN iAMTProcessConInAvailabilityHook (VOID) +{ + AMT_WRAPPER_PROTOCOL *pAmtWrapper = NULL; + EFI_HANDLE SolPostMessageHandle = NULL; + EFI_STATUS Status; + EFI_GUID gAmiEfiSolPostMessageGuid = AMI_EFI_SOL_POST_MESSAGE_GUID; + + // Handle EnterSetup Flag here !! + if (pAmtWrapper == NULL){ + Status = gBS->LocateProtocol(&gEfiAmtWrapperProtocolGuidTse, NULL, &pAmtWrapper); + } + if(EFI_ERROR(Status)) + return FALSE; + if(pAmtWrapper->ActiveManagementEnterSetup()) + gEnterSetup = TRUE; + + // Install Protocol here, Trig Callback event to show SOL message. + Status = gBS->InstallMultipleProtocolInterfaces( + &SolPostMessageHandle, + &gAmiEfiSolPostMessageGuid, + NULL, + NULL); + + + return FALSE; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: AMTBypassPasswordRestore +// +// Description: This function is a hook called when TSE determines +// that SETUP utility has to be displayed. This function +// is available as ELINK. In the generic implementation +// setup password is prompted in this function. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID AMTBypassPasswordRestore(VOID) +{ + + EFI_STATUS Status; + UINT32 VarAttr; + UINTN VariableSize; + EFI_GUID gAmiTseSetupGuid = AMITSESETUP_GUID; + AMITSESETUP AmiTseData; +#if defined(TSE_ADVANCED_BIN_SUPPORT) + AMITSESETUP *pSetupVariable; +#endif + VariableSize = sizeof(AMITSESETUP); + Status = gRT->GetVariable ( L"AMITSESetupBackup", \ + &gAmiTseSetupGuid, \ + &VarAttr, \ + &VariableSize, \ + &AmiTseData ); + + // If we get this variable, restore it back + if (!EFI_ERROR (Status)) { + + VariableSize = sizeof(AMITSESETUP); + Status = gRT->SetVariable ( L"AMITSESetup", \ + &gAmiTseSetupGuid, \ + VarAttr, \ + VariableSize, \ + &AmiTseData ); + + VariableSize = 0; + Status = gRT->SetVariable ( L"AMITSESetupBackup", \ + &gAmiTseSetupGuid, \ + VarAttr, \ + VariableSize, \ + &AmiTseData ); +#if defined(TSE_ADVANCED_BIN_SUPPORT) + VariableSize = sizeof(AMITSESETUP); + pSetupVariable = VarGetVariable( VARIABLE_ID_AMITSESETUP, &VariableSize ); + if ( ( pSetupVariable == NULL ) || ( VariableSize != sizeof(AMITSESETUP) ) ) + pSetupVariable = VarGetNvram( VARIABLE_ID_AMITSESETUP, &VariableSize ); + MemCopy(pSetupVariable->UserPassword, AmiTseData.UserPassword, + sizeof(pSetupVariable->UserPassword)); + MemCopy(pSetupVariable->AdminPassword, AmiTseData.AdminPassword, + sizeof(pSetupVariable->AdminPassword)); + VarSetNvram( VARIABLE_ID_AMITSESETUP, \ + pSetupVariable, sizeof(AMITSESETUP)); +#endif + } + +} + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: AMTBypassPasswordCheck +// +// Description: ELink to ProcessConInAvailabilityHook. +// If AMT Bypass user password, Delete AMITSESetup. +// +// Input: VOID +// +// Output: BOOLEAN. Should return TRUE if the screen was used to +// ask password; FALSE if the screen was not used to ask +// password. +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +BOOLEAN AMTBypassPasswordCheck(VOID) +{ + EFI_STATUS Status; + UINT32 VarAttr; + UINTN VariableSize; + EFI_GUID gAmiTseSetupGuid = AMITSESETUP_GUID; + AMITSESETUP AmiTseData; +#if defined(TSE_ADVANCED_BIN_SUPPORT) + AMITSESETUP *pSetupVariable; +#endif + UINTN VarSize=0; + EFI_ALERT_STANDARD_FORMAT_PROTOCOL *Asf; + EFI_ASF_BOOT_OPTIONS *mAsfBootOptions; + EFI_GUID gSetupGuid = SETUP_GUID; + mAsfBootOptions = NULL; + // + // Get Protocol for ASF + // + Status = gBS->LocateProtocol ( + &gEfiAlertStandardFormatProtocolGuid, + NULL, + &Asf + ); + if (EFI_ERROR (Status)) { +// DEBUG ((EFI_D_ERROR, "Info : Error gettings ASF protocol -> %r\n", Status)); + return FALSE; + } + + Status = Asf->GetBootOptions (Asf, &mAsfBootOptions); + // Configuration data resert. + if(mAsfBootOptions->BootOptions & 0x8000) + { + // Delete Variable. + VarAttr = 0; + VariableSize = 0; + Status = gRT->GetVariable( + L"Setup", + &gSetupGuid, + &VarAttr, + &VariableSize, + &VarSize ); + if( EFI_ERROR(Status) && (Status != EFI_BUFFER_TOO_SMALL) ) + VarAttr = EFI_VARIABLE_NON_VOLATILE | EFI_VARIABLE_BOOTSERVICE_ACCESS; + + VariableSize = 0; + gRT->SetVariable( + L"Setup", + &gSetupGuid, + VarAttr, + VariableSize, + &VarSize); + } + // ByPass Password + if(mAsfBootOptions->BootOptions & 0x0800) + { + VarAttr = 0; + VariableSize = sizeof(AMITSESETUP); + Status = gRT->GetVariable ( L"AMITSESetup", \ + &gAmiTseSetupGuid, \ + &VarAttr, \ + &VariableSize, \ + &AmiTseData ); + + // No Password installed just return + if (Status == EFI_NOT_FOUND) { + return 0; + } + // If exist , store a backup then delete AMITSESetup + + VariableSize = sizeof(AMITSESETUP); + Status = gRT->SetVariable ( L"AMITSESetupBackup", \ + &gAmiTseSetupGuid, \ + VarAttr, \ + VariableSize, \ + &AmiTseData ); + Status = gRT->SetVariable ( L"AMITSESetup", \ + &gAmiTseSetupGuid, \ + VarAttr, \ + 0, \ + &AmiTseData ); +#if defined(TSE_ADVANCED_BIN_SUPPORT) + pSetupVariable = VarGetVariable( VARIABLE_ID_AMITSESETUP, &VarSize ); + if ( ( pSetupVariable == NULL ) || ( VarSize != sizeof(AMITSESETUP) ) ) + pSetupVariable = VarGetNvram( VARIABLE_ID_AMITSESETUP, &VarSize ); + MemSet(pSetupVariable->UserPassword, \ + sizeof(pSetupVariable->UserPassword), 0); + MemSet(pSetupVariable->AdminPassword, \ + sizeof(pSetupVariable->AdminPassword), 0); + VarSetNvram( VARIABLE_ID_AMITSESETUP, \ + pSetupVariable, sizeof(AMITSESETUP)); +#endif + }else + { + // If not bypass password , check AMITSESetupBackup vairblae + AMTBypassPasswordRestore(); + } + + return 0; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.c b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.c new file mode 100644 index 0000000..123be0f --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.c @@ -0,0 +1,376 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSmbios/AmtSmbios.c 4 6/21/13 3:39a Klzhan $ +// +// $Revision: 4 $ +// +// $Date: 6/21/13 3:39a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSmbios/AmtSmbios.c $ +// +// 4 6/21/13 3:39a Klzhan +// [TAG] EIPNone +// [Category] Spec Update +// [Severity] Minor +// [Description] ME FW drop support of type 129 +// +// 3 9/19/12 6:57a Klzhan +// Update IDER secure boot flag. +// +// 2 4/24/12 12:43a Klzhan +// Update module to latest +// +// 1 2/08/12 1:09a Klzhan +// Initial Check in +// +// 3 7/11/11 5:32a Klzhan +// Close Event after SMBIOS 129 130 created. +// +// 2 5/03/11 6:19a Klzhan +// [TAG] EIP59457 +// [Category] Bug Fix +// [RootCause] Copy wrong size in SMBios type 129. +// [Files] AmtSmbios.c +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTSmbios.c +// +// Description: AMT Smbios Functions. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "AMTSmbios.h" +#include "Tiano.h" +#include "EfiDriverLib.h" +#include "SaAccess.h" +#include "PchAccess.h" +#include "EdkIIGluePcd.h" +#include "EdkIIGluePcdPciExpressLib.h" +#include "EdkIIGlueConfig.h" +#include "EdkIIGlueIoLib.h" +#include "EdkIIGluePciExpressLib.h" +#include "EdkIIGlueUefiLib.h" +#include "SbSetupData.h" +#include EFI_PROTOCOL_CONSUMER (MeBiosPayloadData) +EFI_GUID gEfiSmbiosProtocolGuid = EFI_SMBIOS_PROTOCOL_GUID; +EFI_GUID gEfiEventReadyToBootGuid = EFI_EVENT_GROUP_READY_TO_BOOT; +EFI_GUID gEfiMeBiosExtensionSetupGuid = EFI_ME_BIOS_EXTENSION_SETUP_GUID; +CHAR16 gEfiMeBiosExtensionSetupName[] = EFI_ME_BIOS_EXTENSION_SETUP_VARIABLE_NAME; +EFI_GUID gEfiGlobalVariableGuid = EFI_GLOBAL_VARIABLE_GUID; + +EFI_EVENT mLegacyBootEvent; + +#if VA_SUPPORT +EFI_GUID gEfiVaNVMVariableGuid = EFI_VA_NVM_VARIABLE_GUID; +#endif + +EFI_RUNTIME_SERVICES *gRT; +EFI_BOOT_SERVICES *gBS; +DXE_MBP_DATA_PROTOCOL MbpData; + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: GetMeFwInfoFromMBP +// +// Description: Get ME Fw Info From MBP data +// +// Referrals: +// +// Notes: +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +GetMeFwInfoFromMBP ( + IN OUT ME_CAP *MECapability + ) +{ + MEFWCAPS_SKU FwCapsSku; + + MECapability->MeEnabled = 1; + + FwCapsSku.Data = MbpData.MeBiosPayload.FwCapsSku.FwCapabilities.Data; + + if (FwCapsSku.Fields.IntelAT) { + MECapability->AtSupported = 1; + } + + if (FwCapsSku.Fields.KVM) { + MECapability->IntelKVM = 1; + } + + switch (MbpData.MeBiosPayload.FwPlatType.RuleData.Fields.PlatformBrand) { + case INTEL_AMT_BRAND: + MECapability->IntelAmtFw = 1; + MECapability->LocalWakeupTimer = 1; + break; + + case INTEL_STAND_MANAGEABILITY_BRAND: + MECapability->IntelAmtFwStandard = 1; + break; + + case INTEL_SMALL_BUSINESS_TECHNOLOGY_BRAND: + MECapability->IntelSmallBusiness = 1; + break; + } + + MECapability->MeMajorVer = MbpData.MeBiosPayload.FwVersionName.MajorVersion; + MECapability->MeMinorVer = MbpData.MeBiosPayload.FwVersionName.MinorVersion; + MECapability->MeBuildNo = MbpData.MeBiosPayload.FwVersionName.BuildVersion; + MECapability->MeHotFixNo = MbpData.MeBiosPayload.FwVersionName.HotfixVersion; + + return EFI_SUCCESS; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: UpdateAmtSmbiosTable +// +// Description: SMBIOS tables 81, 82 and 83 are filled here +// +// Input: EFI_EVENT Event, +// VOID *ParentImageHandle +// +// Output: EFI_STATUS +// +// Modified: +// +// Referrals: +// +// Notes: +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +UpdateAmtSmbiosTable( + EFI_EVENT Event, + VOID *ParentImageHandle +) +{ + EFI_STATUS Status; + EFI_MISC_OEM_TYPE_0x81 Data81; + EFI_MISC_OEM_TYPE_0x82 Data82; + EFI_SMBIOS_PROTOCOL *mSmbiosProtocol; + UINT32 Attributes; + UINTN DataSize; + ME_BIOS_EXTENSION_SETUP MeBiosExtensionSetup; + UINT32 MeEnabled; + ME_CAP MeCapabilities; +#if VA_SUPPORT + EFI_VA_NVM_VAR VaNVMVar; +#endif + + + Status = MePolicyLibInit(); + ASSERT_EFI_ERROR(Status); + + Status = AmtPolicyLibInit(); + ASSERT_EFI_ERROR(Status); + + mSmbiosProtocol = NULL; + Status = gBS->LocateProtocol( + &gEfiSmbiosProtocolGuid, + NULL, + &mSmbiosProtocol + ); + ASSERT_EFI_ERROR(Status); + + //Clear all data + gBS->SetMem (&Data81, sizeof(EFI_MISC_OEM_TYPE_0x81), 0); + gBS->SetMem (&Data82, sizeof(EFI_MISC_OEM_TYPE_0x82), 0); + gBS->SetMem (&MeCapabilities, sizeof(ME_CAP), 0); + + //fill + Data81.Header.Type = 0x81; + Data81.Header.Length = 8; + Data81.Header.Handle = 0; + Data81.DescString = 1; + Data81.StructureVersion = 1; + Data81.SystemId = 2; + if(AsfSupported()) + Data81.Attribute = 1; + else + Data81.Attribute = 0; + + gBS->CopyMem ( + Data81.DescStringAscii, + EFI_OEM_ASF_DESCRIPTIONSTRING, + sizeof (EFI_OEM_ASF_DESCRIPTIONSTRING) + ); + + gBS->CopyMem ( + Data81.SystemIdAscii, + EFI_OEM_ASF_SYSTEMIDSTRING, + (sizeof (EFI_OEM_ASF_SYSTEMIDSTRING) - 1) + ); + // + Data82.Header.Type = 0x82; + Data82.Header.Length = 0x14; + Data82.Header.Handle = 0; + gBS->CopyMem ( + Data82.AmtSignature, + AMT_Signature, + sizeof (UINT32) + ); + +// Data82 + + if(AmtSupported()){ + MeEnabled = *((volatile UINT32 *)(UINTN)((PciMeRegBase) + FW_STATUS_REGISTER)); + // + // Make sure Me is in normal mode & hasn't any error + // + if ((MeEnabled & 0xFF000) == 0) { + Status = GetMeFwInfoFromMBP(&MeCapabilities); + if (EFI_ERROR (Status)) { + return Status; + } + } + + if( MeCapabilities.IntelAmtFw ==1) { + Data82.AmtSupported = 1; + } + + Attributes = EFI_VARIABLE_NON_VOLATILE; + DataSize = sizeof (ME_BIOS_EXTENSION_SETUP); + Status = gRT->GetVariable ( + gEfiMeBiosExtensionSetupName, + &gEfiMeBiosExtensionSetupGuid, + &Attributes, + &DataSize, + &MeBiosExtensionSetup + ); + + if (!EFI_ERROR(Status)) { + if(MeCapabilities.IntelAmtFw == 1) { + if(MeBiosExtensionSetup.PlatformMngSel & MNT_ON) { + Data82.AmtEnabled = 1; + } else { + Data82.AmtEnabled = 0; + } + + if(MeBiosExtensionSetup.AmtSolIder & IDER_ENABLE) { + Data82.IderEnabled = 1; + } else { + Data82.IderEnabled = 0; + } + + if (MeBiosExtensionSetup.AmtSolIder & SOL_ENABLE) { + Data82.SolEnabled = 1; + } else { + Data82.SolEnabled = 0; + } + Data82.NetworkEnabled = 1; // If AMT enabled, LAN is always enabled + + } + + if(MeCapabilities.IntelKVM) { + if (MeBiosExtensionSetup.KvmEnable & KVM_ENABLE) { + Data82.KvmEnabled = 1; + } else { + Data82.KvmEnabled = 0; + } + } + } + } + else { + Data82.AmtEnabled = 0; + Data82.IderEnabled = 0; + Data82.SolEnabled = 0; + Data82.KvmEnabled = 0; + Data82.NetworkEnabled = 0; + } + + Data82.ExtendedData = 0xA5; + Data82.OemCapabilities1 = 0x2F; + Data82.OemCapabilities2 = 0x02; +#if defined(SecureBoot_SUPPORT) && (SecureBoot_SUPPORT == 1) + Data82.OemCapabilities3 = 1; +#else + Data82.OemCapabilities3 = 0; +#endif + Data82.OemCapabilities4 = 0; + + Status = mSmbiosProtocol->SmbiosAddStructure((UINT8 *)&Data82, sizeof(EFI_MISC_OEM_TYPE_0x82)); + gBS->CloseEvent(Event); + return Status; +} + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: iAMTSMBiosDriverEntryPoint +// +// Description: iAMT SMBIOS driver entry point +// +// Input: EFI_HANDLE ImageHandle, +// EFI_SYSTEM_TABLE *SystemTable +// +// Output: EFI_STATUS +// +// Modified: +// +// Referrals: +// +// Notes: +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +AmtSmbiosEntryPoint( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + EFI_STATUS Status; + DXE_MBP_DATA_PROTOCOL *MbpDataBuf; + EfiInitializeDriverLib (ImageHandle, SystemTable); + + Status = gBS->LocateProtocol (&gMeBiosPayloadDataProtocolGuid, NULL, &MbpDataBuf); + + gBS->CopyMem ( + &MbpData, + MbpDataBuf, + sizeof (DXE_MBP_DATA_PROTOCOL) + ); + Status = EfiCreateEventReadyToBootEx( + EFI_TPL_CALLBACK, + UpdateAmtSmbiosTable, + (VOID *)&ImageHandle, + &mLegacyBootEvent + ); + ASSERT_EFI_ERROR (Status); + + return Status; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.cif b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.cif new file mode 100644 index 0000000..b84bee9 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.cif @@ -0,0 +1,12 @@ +<component> + name = "AmtSmbios" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\AmtSmbios\" + RefName = "AmtSmbios" +[files] +"AmtSmbios.sdl" +"AmtSmbios.mak" +"AmtSmbios.c" +"AmtSmbios.dxs" +"AmtSmbios.h" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.dxs b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.dxs new file mode 100644 index 0000000..b95943c --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.dxs @@ -0,0 +1,70 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSmbios/AmtSmbios.dxs 1 2/08/12 1:09a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:09a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSmbios/AmtSmbios.dxs $ +// +// 1 2/08/12 1:09a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTSmbios.dxs +// +// Description: AMT Smbios dependency file. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "EfiDepex.h" + +#include "Protocol\SmbiosGetFlashDataProtocol.h" +#include EFI_PROTOCOL_DEFINITION (AmtPlatformPolicy) +#include EFI_PROTOCOL_DEFINITION (Heci) +#include EFI_PROTOCOL_DEFINITION (MePlatformPolicy) + +DEPENDENCY_START + EFI_SMBIOS_PROTOCOL_GUID AND + DXE_PLATFORM_AMT_POLICY_GUID AND + EFI_HECI_PROTOCOL_GUID AND + DXE_PLATFORM_ME_POLICY_GUID +DEPENDENCY_END + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.h b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.h new file mode 100644 index 0000000..7a7d30b --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.h @@ -0,0 +1,124 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSmbios/AmtSmbios.h 1 2/08/12 1:09a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:09a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSmbios/AmtSmbios.h $ +// +// 1 2/08/12 1:09a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 2 12/16/10 3:47a Klzhan +// Remove un-use structure. +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTSmbios.dxs +// +// Description: AMT Smbios include file. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "Token.h" +#include <Tiano.h> +#include <Include\Protocol\SMBios.h> +#include <Include\Protocol\SmbiosGetFlashDataProtocol.h> +#include <AmtLib.h> +#include <MeLib.h> +#include "CpuFuncs.h" + +#include EFI_GUID_DEFINITION (MeBiosExtensionSetup) +#include EFI_GUID_DEFINITION (GlobalVariable) +#include EFI_PROTOCOL_DEFINITION (PciIo) +#include EFI_PROTOCOL_CONSUMER (PciRootBridgeIo) +#include EFI_PROTOCOL_DEPENDENCY (SaPlatformPolicy) +#include EFI_PROTOCOL_CONSUMER (Heci) +#include EFI_PROTOCOL_CONSUMER (TcgService) + +#if VA_SUPPORT +#include EFI_PROTOCOL_DEFINITION(PlatformVaPolicy) +#endif + +#define EFI_OEM_ASF_DESCRIPTIONSTRING "Intel_ASF" +#define EFI_OEM_ASF_SYSTEMIDSTRING "Intel_ASF_001" +#define AMT_Signature "$AMT" + +#define PciMeRegBase PCIEX_BASE_ADDRESS + (UINT32) (22 << 15) +#define FW_STATUS_REGISTER 0x40 + +// +// This is definition for SMBIOS Oem data type 0x81 +// +#pragma pack (1) +typedef struct { + SMBIOS_STRUCTURE_HEADER Header; + UINT8 DescString;// String number + UINT8 StructureVersion; + UINT8 SystemId;// String number + UINT8 Attribute; + UINT8 DescStringAscii[sizeof(EFI_OEM_ASF_DESCRIPTIONSTRING)]; + UINT8 SystemIdAscii[sizeof(EFI_OEM_ASF_SYSTEMIDSTRING)-1]; + UINT16 Zero; //terminator +} EFI_MISC_OEM_TYPE_0x81; + +// +// This is definition for SMBIOS Oem data type 0x82 +// +typedef struct { + SMBIOS_STRUCTURE_HEADER Header; + UINT8 AmtSignature[4]; + UINT8 AmtSupported; + UINT8 AmtEnabled; + UINT8 IderEnabled; + UINT8 SolEnabled; + UINT8 NetworkEnabled; + UINT8 ExtendedData; + UINT8 OemCapabilities1; + UINT8 OemCapabilities2; + UINT8 OemCapabilities3; + UINT8 OemCapabilities4; + UINT8 KvmEnabled; + UINT8 Reserved; + UINT16 Zero; //terminator +} EFI_MISC_OEM_TYPE_0x82; + +#pragma pack () + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.mak b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.mak new file mode 100644 index 0000000..1a1f3eb --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.mak @@ -0,0 +1,108 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSmbios/AmtSmbios.mak 2 2/23/12 8:59a Klzhan $ +# +# $Revision: 2 $ +# +# $Date: 2/23/12 8:59a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtSmbios/AmtSmbios.mak $ +# +# 2 2/23/12 8:59a Klzhan +# Support New EDK +# +# 1 2/08/12 1:09a Klzhan +# Initial Check in +# +# 1 2/25/11 1:44a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:11a Klzhan +# Initial Check-in. +# +#********************************************************************** +# +#<AMI_FHDR_START> +#--------------------------------------------------------------------------- +# Name: AMTSmbios.dxs +# +# Description: AMT Smbios Makfile. +# +#--------------------------------------------------------------------------- +#<AMI_FHDR_END> +# MAK file for the ModulePart:AmtSmbios +all : AmtSmbios + +$(BUILD_DIR)\AmtSmbios.mak : $(AmtSmbios_DIR)\$(@B).cif $(AmtSmbios_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(AmtSmbios_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +AmtSmbios : $(BUILD_DIR)\AmtSmbios.mak AmtSmbiosBin + +AmtSmbios_INCLUDES=\ + $(ME_INCLUDES)\ + $(EDK_INCLUDES)\ + $(EdkIIGlueLib_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + $(INTEL_MCH_INCLUDES)\ + $(NB_INCLUDES)\ + /I$(BOARD_DIR) \ + $(MISCFRAMEWORK_INCLUDES)\ + + +AmtSmbios_LIBS=\ + $(AmtLibDxe_LIB)\ + $(MeLibDxe_LIB)\ + $(EDKPROTOCOLLIB)\ + $(EFIDRIVERLIB)\ + $(CPUIA32LIB)\ + $(VaProtocolLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueUefiLib_LIB)\ + +AmtSmbiosBin : $(AmtSmbios_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\AmtSmbios.mak all \ + NAME=AmtSmbios \ + MAKEFILE=$(BUILD_DIR)\AmtSmbios.mak \ + "MY_INCLUDES=$(AmtSmbios_INCLUDES)" \ + GUID=A8C67255-E029-4b1a-968E-ECA6E9C11C73 \ + ENTRY_POINT=AmtSmbiosEntryPoint \ + DEPEX1=$(AmtSmbios_DIR)\AmtSmbios.dxs \ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + TYPE=BS_DRIVER \ + COMPRESS=1 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.sdl b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.sdl new file mode 100644 index 0000000..d39f449 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtSmbios/AmtSmbios.sdl @@ -0,0 +1,25 @@ +TOKEN + Name = "AmtSmbios_SUPPORT" + Value = "1" + Help = "Main switch to enable iAmtSmbios support in Project" + TokenType = Boolean + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "AmtSmbios_DIR" + Help = "AMT Smbios file source directory" +End + +MODULE + Help = "Includes AmtSmbios.mak to Project" + File = "AmtSmbios.mak" +End + +ELINK + Name = "$(BUILD_DIR)\AmtSmbios.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.cif b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.cif new file mode 100644 index 0000000..dcc3413 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.cif @@ -0,0 +1,12 @@ +<component> + name = "AmtStatusCode" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\AmtStatusCode" + RefName = "AmtStatusCode" +[files] +"AmtStatusCode.sdl" +"AmtStatusCode.mak" +"AmtStatusCodePei.c" +"AmtStatusCodeDxe.c" +"AmtStatusCodeSmm.c" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.mak b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.mak new file mode 100644 index 0000000..d75f602 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.mak @@ -0,0 +1,81 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtStatusCode/AmtStatusCode.mak 1 2/08/12 1:10a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:10a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtStatusCode/AmtStatusCode.mak $ +# +# 1 2/08/12 1:10a Klzhan +# Initial Check in +# +# 1 2/25/11 1:44a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +#********************************************************************** +# +#<AMI_FHDR_START> +#--------------------------------------------------------------------------- +# Name: AMTStatusCode.mak +# +# Description: AMT Status Code Makfile. +# +#--------------------------------------------------------------------------- +#<AMI_FHDR_END> + +#--------------------------------------------------------------------------- +# AMT StatusCode for DXE +#--------------------------------------------------------------------------- +CORE_DXEBin : $(BUILD_DIR)\$(STATUS_CODE_DIR)\AmtStatusCodeDxe.obj + +$(BUILD_DIR)\$(STATUS_CODE_DIR)\AmtStatusCodeDxe.obj : $(AmtStatusCode_DIR)\AmtStatusCodeDxe.c + $(CC) $(CFLAGS:/W4=/W3) /DTIANO_RELEASE_VERSION=0x00080006 /DDXE_STATUS_CODE $(AlertStandardFormatDxe_INCLUDES) $(EDK_INCLUDES) $(STATUS_CODE_INCLUDES) /Fo$(BUILD_DIR)\$(STATUS_CODE_DIR)\AmtStatusCodeDxe.obj $(AmtStatusCode_DIR)\AmtStatusCodeDxe.c + +#--------------------------------------------------------------------------- +# AMT StatusCode for PEI +#--------------------------------------------------------------------------- +CORE_PEIBin : $(BUILD_DIR)\$(STATUS_CODE_DIR)\AmtStatusCodePei.obj + +$(BUILD_DIR)\$(STATUS_CODE_DIR)\AmtStatusCodePei.obj : $(AmtStatusCode_DIR)\AmtStatusCodePei.c + $(CCPEI) $(CFLAGS:/W4=/W3) /DTIANO_RELEASE_VERSION=0x00080006 /DPEI_STATUS_CODE /IEDK\Foundation\Include\IA32 $(AlertStandardFormatPei_INCLUDES) $(EDK_INCLUDES) $(ME_INCLUDES) $(STATUS_CODE_INCLUDES) /Fo$(BUILD_DIR)\$(STATUS_CODE_DIR)\AmtStatusCodePei.obj $(AmtStatusCode_DIR)\AmtStatusCodePei.c + +#--------------------------------------------------------------------------- +# AMT StatusCode for SMM +#--------------------------------------------------------------------------- +SmmStatusCodeBin : $(BUILD_DIR)\$(SmmStatusCode_DIR)\AmtStatusCodeSmm.obj + +$(BUILD_DIR)\$(SmmStatusCode_DIR)\AmtStatusCodeSmm.obj : $(AmtStatusCode_DIR)\AmtStatusCodeSmm.c + $(CC) $(CFLAGS:/W4=/W3) /DTIANO_RELEASE_VERSION=0x00080006 /DSMM_STATUS_CODE $(AlertStandardFormat_INCLUDES) $(ME_INCLUDES) $(STATUS_CODE_INCLUDES) $(CORE_INCLUDES) /Fo$(BUILD_DIR)\$(SmmStatusCode_DIR)\AmtStatusCodeSmm.obj $(AmtStatusCode_DIR)\AmtStatusCodeSmm.c + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.sdl b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.sdl new file mode 100644 index 0000000..f83c100 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCode.sdl @@ -0,0 +1,42 @@ +TOKEN + Name = "AmtStatusCode_SUPPORT" + Value = "0" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes + Help = "Main switch to enable AmtStatusCode support in Project" +End + +MODULE + Help = "Includes AmtStatusCode.mak to Project" + File = "AmtStatusCode.mak" +End + +PATH + Name = "AmtStatusCode_DIR" +End + +ELINK + Name = "AmtStatusCode," + Parent = "ReportMiscStatus" + InvokeOrder = AfterParent +End + +ELINK + Name = "AmtStatusInit," + Parent = "StatusCodeInitialize" + InvokeOrder = AfterParent +End + +#ELINK +# Name = "SmmAmtStatusCode," +# Parent = "SmmReportMiscStatus" +# InvokeOrder = AfterParent +#End + +#ELINK +# Name = "SmmAmtStatusInit," +# Parent = "SmmStatusCodeInitialize" +# InvokeOrder = AfterParent +#End diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodeDxe.c b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodeDxe.c new file mode 100644 index 0000000..7cae372 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodeDxe.c @@ -0,0 +1,151 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtStatusCode/AmtStatusCodeDxe.c 1 2/08/12 1:10a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:10a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtStatusCode/AmtStatusCodeDxe.c $ +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTStatusDxeCode.c +// +// Description: Processes ASF messages for DXE. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + + +Module Name: + + AmtStatusCodeDxe.c + +Abstract: + Processes ASF messages + +--*/ + +#include "Tiano.h" +#include "Pei.h" +#include EFI_PPI_DEFINITION (StatusCode) + +VOID AmtStatusCode( + IN EFI_PEI_SERVICES **PeiServices, + IN EFI_STATUS_CODE_TYPE Type, + IN EFI_STATUS_CODE_VALUE Value, + IN UINT32 Instance, + IN EFI_GUID *CallerId OPTIONAL, + IN EFI_STATUS_CODE_DATA *Data OPTIONAL +) +/*++ +Routine Description: + + Provides an interface that a software module can call to report an ASF DXE status code. + +Arguments: + + PeiServices - PeiServices pointer. + + Type - Indicates the type of status code being reported. + + Value - Describes the current status of a hardware or software entity. + This included information about the class and subclass that is + used to classify the entity as well as an operation. + + Instance - The enumeration of a hardware or software entity within + the system. Valid instance numbers start with 1. + + CallerId - This optional parameter may be used to identify the caller. + This parameter allows the status code driver to apply different + rules to different callers. + + Data - This optional parameter may be used to pass additional data. + +Returns: + + None + +--*/ +{ + // + // Do nothing, because AMT ASF driver will handle that. + // + return ; +} + +EFI_STATUS +AmtStatusInit( + IN EFI_FFS_FILE_HEADER *FfsHeader, + IN EFI_PEI_SERVICES **PeiServices +) +/*++ +Routine Description: + + Init routine for DXE ASF StatusCode. + +Arguments: + + FfsHeader - FfsHeader pointer. + PeiServices - PeiServices pointer. + +Returns: + + EFI_SUCCESS - The function completed successfully + +--*/ +{ + // + // Do nothing, because AMT ASF driver will handle that. + // + return EFI_SUCCESS; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodePei.c b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodePei.c new file mode 100644 index 0000000..8cf18ba --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodePei.c @@ -0,0 +1,224 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtStatusCode/AmtStatusCodePei.c 1 2/08/12 1:10a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:10a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtStatusCode/AmtStatusCodePei.c $ +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTStatusCodePei.c +// +// Description: Processes ASF messages for Pei. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + + +Module Name: + + AmtStatusCodePei.c + +Abstract: + Processes ASF messages + +--*/ + +#include "Tiano.h" +#include "Pei.h" +#include EFI_PPI_DEFINITION (StatusCode) + +#include EFI_PPI_DEFINITION (AmtStatusCode) + +EFI_GUID mPeiAmtStatusCodePpiGuid = PEI_AMT_STATUS_CODE_PPI_GUID; +EFI_GUID mAmtPETQueueHobGuid = AMT_PET_QUEUE_HOB_GUID; + +EFI_STATUS +AmtQueuePetMessage ( + IN EFI_PEI_SERVICES **PeiServices, + IN EFI_STATUS_CODE_TYPE Type, + IN EFI_STATUS_CODE_VALUE Value + ) +/*++ +Routine Description: + + This routine puts PET message to MessageQueue, which will be sent later. + +Arguments: + + PeiServices - PeiServices pointer. + Type - StatusCode message type. + Value - StatusCode message value. + +Returns: + + EFI_SUCCESS - The function completed successfully + +--*/ +{ + AMT_PET_QUEUE_HOB *PETQueueHob; + EFI_STATUS Status; + + // Create PET queue hob + Status = (**PeiServices).CreateHob ( PeiServices, \ + EFI_HOB_TYPE_GUID_EXTENSION, \ + sizeof(AMT_PET_QUEUE_HOB), \ + &PETQueueHob ); + if (EFI_ERROR (Status)) { + return Status; + } + PETQueueHob->EfiHobGuidType.Name = mAmtPETQueueHobGuid; + PETQueueHob->Type = Type; + PETQueueHob->Value = Value; + + return EFI_SUCCESS; +} + +VOID AmtStatusCode( + IN EFI_PEI_SERVICES **PeiServices, + IN EFI_STATUS_CODE_TYPE Type, + IN EFI_STATUS_CODE_VALUE Value, + IN UINT32 Instance, + IN EFI_GUID *CallerId OPTIONAL, + IN EFI_STATUS_CODE_DATA *Data OPTIONAL +) +/*++ +Routine Description: + + Provides an interface that a software module can call to report an ASF PEI status code. + +Arguments: + + PeiServices - PeiServices pointer. + + Type - Indicates the type of status code being reported. + + Value - Describes the current status of a hardware or software entity. + This included information about the class and subclass that is + used to classify the entity as well as an operation. + + Instance - The enumeration of a hardware or software entity within + the system. Valid instance numbers start with 1. + + CallerId - This optional parameter may be used to identify the caller. + This parameter allows the status code driver to apply different + rules to different callers. + + Data - This optional parameter may be used to pass additional data. + +Returns: + + None + +--*/ +{ + PEI_AMT_STATUS_CODE_PPI *AmtStatusCode; + EFI_STATUS Status; + + Status = (*PeiServices)->LocatePpi( PeiServices, \ + &mPeiAmtStatusCodePpiGuid, \ + 0, \ + NULL, \ + &AmtStatusCode ); + if ( EFI_ERROR (Status) ) { + if (((Type & EFI_STATUS_CODE_TYPE_MASK) != EFI_PROGRESS_CODE) && + ((Type & EFI_STATUS_CODE_TYPE_MASK) != EFI_ERROR_CODE)) { + return ; + } + + // Register to Hob + + // Create PET queue hob + AmtQueuePetMessage (PeiServices, Type, Value); + + return ; + } + + AmtStatusCode->ReportStatusCode ( + PeiServices, + AmtStatusCode, + Type, + Value, + Instance, + CallerId, + Data + ); + + return ; +} + +EFI_STATUS +AmtStatusInit( + IN EFI_FFS_FILE_HEADER *FfsHeader, + IN EFI_PEI_SERVICES **PeiServices +) +/*++ +Routine Description: + + Init routine for PEI ASF StatusCode. + +Arguments: + + FfsHeader - FfsHeader pointer. + PeiServices - PeiServices pointer. + +Returns: + + EFI_SUCCESS - The function completed successfully + +--*/ +{ + return EFI_SUCCESS; +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodeSmm.c b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodeSmm.c new file mode 100644 index 0000000..63b3919 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtStatusCode/AmtStatusCodeSmm.c @@ -0,0 +1,368 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtStatusCode/AmtStatusCodeSmm.c 1 2/08/12 1:10a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:10a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtStatusCode/AmtStatusCodeSmm.c $ +// +// 1 2/08/12 1:10a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:11a Klzhan +// Initial Check-in. +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: AMTStatusCodePei.c +// +// Description: Processes ASF messages for Pei. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + + +Module Name: + + AmtStatusCodeSmm.c + +Abstract: + Processes ASF messages + +--*/ + +#include "Tiano.h" +#include "Pei.h" +#include EFI_PROTOCOL_DEFINITION (SmmBase) +#include EFI_PROTOCOL_DEFINITION (SmmStatusCode) +#include "Protocol/AmtStatusCodeSmm/AmtStatusCodeSmm.h" +//#include EFI_PROTOCOL_DEFINITION (AmtStatusCodeSmm) + +EFI_GUID mAmtSmmStatusCodeProtocolGuid = AMT_SMM_STATUS_CODE_PROTOCOL_GUID; +EFI_GUID gAmtSmmPETQueueProtocolGuid = AMT_SMM_PET_QUEUE_PROTOCOL_GUID; + +AMT_SMM_PET_QUEUE_PROTOCOL gAmtSmmPETQueue; +AMT_SMM_PET_QUEUE_PROTOCOL *gAmtSmmPETQueueProtocol; + +AMT_SMM_STATUS_CODE_PROTOCOL *mAmtSmmStatusCode; + +EFI_SYSTEM_TABLE *pST; +EFI_BOOT_SERVICES *pBS; +EFI_RUNTIME_SERVICES *pRS; +EFI_SMM_BASE_PROTOCOL *pSmmBase; +EFI_SMM_SYSTEM_TABLE *pSmst; + +VOID +AmtInitializeListHead ( + EFI_LIST_ENTRY *List + ) +{ + List->ForwardLink = List; + List->BackLink = List; +} + +VOID +AmtInsertTailList ( + EFI_LIST_ENTRY *ListHead, + EFI_LIST_ENTRY *Entry + ) +{ + EFI_LIST_ENTRY *_ListHead; + EFI_LIST_ENTRY *_BackLink; + + _ListHead = ListHead; + _BackLink = _ListHead->BackLink; + Entry->ForwardLink = _ListHead; + Entry->BackLink = _BackLink; + _BackLink->ForwardLink = Entry; + _ListHead->BackLink = Entry; +} + +EFI_STATUS +AmtQueuePetMessage ( + IN EFI_PEI_SERVICES **PeiServices, + IN EFI_STATUS_CODE_TYPE Type, + IN EFI_STATUS_CODE_VALUE Value + ) +/*++ +Routine Description: + + This routine puts PET message to MessageQueue, which will be sent later. + +Arguments: + + PeiServices - PeiServices pointer. + Type - StatusCode message type. + Value - StatusCode message value. + +Returns: + + EFI_SUCCESS - The function completed successfully + +--*/ +{ + AMT_SMM_PET_QUEUE_NODE *NewNode; + EFI_STATUS Status; + + Status = pSmmBase->SmmAllocatePool ( + pSmmBase, + EfiRuntimeServicesData, + sizeof (AMT_SMM_PET_QUEUE_NODE), + &NewNode + ); + if (EFI_ERROR (Status)) { + return Status; + } + + NewNode->Signature = AMT_SMM_PET_QUEUE_NODE_SIGNATURE; + NewNode->Type = Type; + NewNode->Value = Value; + AmtInsertTailList (&gAmtSmmPETQueueProtocol->MessageList, &NewNode->Link); + + return EFI_SUCCESS; +} + +VOID SmmAmtStatusCode( + IN EFI_PEI_SERVICES **PeiServices, + IN EFI_STATUS_CODE_TYPE Type, + IN EFI_STATUS_CODE_VALUE Value, + IN UINT32 Instance, + IN EFI_GUID *CallerId OPTIONAL, + IN EFI_STATUS_CODE_DATA *Data OPTIONAL +) +/*++ +Routine Description: + + Provides an interface that a software module can call to report an ASF DXE status code. + +Arguments: + + PeiServices - PeiServices pointer. + + Type - Indicates the type of status code being reported. + + Value - Describes the current status of a hardware or software entity. + This included information about the class and subclass that is + used to classify the entity as well as an operation. + + Instance - The enumeration of a hardware or software entity within + the system. Valid instance numbers start with 1. + + CallerId - This optional parameter may be used to identify the caller. + This parameter allows the status code driver to apply different + rules to different callers. + + Data - This optional parameter may be used to pass additional data. + +Returns: + + None + +--*/ +{ + if (mAmtSmmStatusCode == NULL) { + if (((Type & EFI_STATUS_CODE_TYPE_MASK) != EFI_PROGRESS_CODE) && + ((Type & EFI_STATUS_CODE_TYPE_MASK) != EFI_ERROR_CODE)) { + return ; + } + + // Register to Queue + AmtQueuePetMessage (PeiServices, Type, Value); + + return ; + } + + mAmtSmmStatusCode->ReportStatusCode ( + mAmtSmmStatusCode, + Type, + Value, + Instance, + CallerId, + Data + ); + + return ; +} + +VOID +EFIAPI +AmtCallback ( + IN EFI_EVENT Event, + IN VOID *Context + ) +/*++ +Routine Description: + + ASF SMM StatusCode Callback. + +Arguments: + + Event - ASF StatusCode Callback Event. + + Context - ASF StatusCode Callback Context. + +Returns: + + None + +--*/ +{ + pBS->LocateProtocol ( &mAmtSmmStatusCodeProtocolGuid, NULL, &mAmtSmmStatusCode ); + + return; +} + +EFI_STATUS +AmtCreateMessageQueue ( + VOID + ) +/*++ +Routine Description: + + This routine creats PET MessageQueue. + +Arguments: + + None + +Returns: + + EFI_SUCCESS - The function completed successfully + +--*/ +{ + EFI_STATUS Status; + EFI_HANDLE Handle; + + Status = pBS->LocateProtocol ( + &gAmtSmmPETQueueProtocolGuid, + NULL, + &gAmtSmmPETQueueProtocol + ); + if (!EFI_ERROR (Status)) { + return EFI_SUCCESS; + } + + // + // Create Queue for later usage + // + gAmtSmmPETQueueProtocol = &gAmtSmmPETQueue; + + AmtInitializeListHead (&gAmtSmmPETQueueProtocol->MessageList); + Handle = NULL; + Status = pBS->InstallProtocolInterface ( + &Handle, + &gAmtSmmPETQueueProtocolGuid, + EFI_NATIVE_INTERFACE, + &gAmtSmmPETQueue + ); + + return EFI_SUCCESS; +} + +EFI_STATUS +SmmAmtStatusInit( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +/*++ +Routine Description: + + Init routine for SMM ASF StatusCode. + +Arguments: + + FfsHeader - FfsHeader pointer. + PeiServices - PeiServices pointer. + +Returns: + + EFI_SUCCESS - The function completed successfully + +--*/ +{ + EFI_STATUS Status; + VOID *AmtRegistration; + EFI_EVENT Event; + + pST=SystemTable; + pBS=SystemTable->BootServices; + pRS=SystemTable->RuntimeServices; + Status = pBS->LocateProtocol(&gEfiSmmBaseProtocolGuid, NULL, &pSmmBase); + Status = pSmmBase->GetSmstLocation(pSmmBase,&pSmst); + + AmtCreateMessageQueue (); + + Status = pBS->LocateProtocol ( &mAmtSmmStatusCodeProtocolGuid, NULL, &mAmtSmmStatusCode ); + if ( !EFI_ERROR (Status) ) return EFI_SUCCESS; + + // + // Create the event + // + Status = pBS->CreateEvent ( + EFI_EVENT_NOTIFY_SIGNAL, + EFI_TPL_CALLBACK, + AmtCallback, + NULL, + &Event + ); + if (EFI_ERROR (Status)) return Status; + + // + // Register for protocol notifactions on this event + // NOTE: Because this protocol will be installed in SMM, it is safety to + // register ProtocolNotify here. This event will be triggered in SMM later. + // + Status = pBS->RegisterProtocolNotify ( + &mAmtSmmStatusCodeProtocolGuid, + Event, + &AmtRegistration + ); + if (EFI_ERROR (Status)) return Status; + + return EFI_SUCCESS; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtWrapper.cif b/Board/EM/MeWrapper/AmtWrapper/AmtWrapper.cif new file mode 100644 index 0000000..7d6a54b --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtWrapper.cif @@ -0,0 +1,19 @@ +<component> + name = "AmtWrapper" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\" + RefName = "AmtWrapper" +[files] +"AmtWrapper.sdl" +[parts] +"AmtWrapperDxe" +"AmtSetup" +"AmtPlatformPolicy" +"AsfTable" +"AmtWrapperProtocolLib" +"AmtSmbios" +"AmtPetAlert" +"AmtStatusCode" +"AmtLockKBD" +"ASFVerbosity" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AmtWrapper.sdl b/Board/EM/MeWrapper/AmtWrapper/AmtWrapper.sdl new file mode 100644 index 0000000..1ccfb2b --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AmtWrapper.sdl @@ -0,0 +1,20 @@ +TOKEN + Name = "AmtWrapper_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes + Help = "Main switch to enable AMT Wrapper support in Project" + Token = "iAMT_SUPPORT" "=" "1" +End + +PATH + Name = "AmtWrapper_DIR" +End + +ELINK + Name = "/I$(AmtWrapper_DIR)" + Parent = "ME_INCLUDES" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.c b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.c new file mode 100644 index 0000000..4deedd4 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.c @@ -0,0 +1,300 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AsfTable/AsfTable.c 3 6/18/14 3:14a Larryliu $ +// +// $Revision: 3 $ +// +// $Date: 6/18/14 3:14a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AsfTable/AsfTable.c $ +// +// 3 6/18/14 3:14a Larryliu +// [TAG] EIP173999 +// [Category] Improvement +// [Description] [HWR]Remove useless comments from Intel ME +// component.(except RC) +// [Files] AsfTable.c +// +// 1 2/08/12 1:09a Klzhan +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AsfTable.c +// +// Description: Create ASF Acpi table +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "AsfTable.h" + +EFI_GUID gAcpiSupportGuid = EFI_ACPI_SUPPORT_GUID; + +EFI_STATUS +AsfBuildTbl( + IN EFI_EVENT Event, + IN VOID *Context + ); + +//---------------------------------------------------------------------------- +// Variable declaration +//---------------------------------------------------------------------------- +VOID *mAsfRegistration; + +// +// Driver entry point +// +EFI_DRIVER_ENTRY_POINT (AsfTableEntryPoint); + +// +// Function implementations +// +EFI_STATUS +EFIAPI +AsfTableEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + EFI_EVENT FilterEvent; + EFI_STATUS Status; + + // + // Initialize the EFI Driver Library + // + EfiInitializeDriverLib (ImageHandle, SystemTable); + + Status = gBS->CreateEvent ( EFI_EVENT_NOTIFY_SIGNAL, + EFI_TPL_CALLBACK, + AsfBuildTbl, + NULL, + &FilterEvent); + if (EFI_ERROR(Status)) { + return Status; + } + + // Register for protocol notifactions on this event + Status = gBS->RegisterProtocolNotify ( &gAcpiSupportGuid, + FilterEvent, + &mAsfRegistration); + + ASSERT_EFI_ERROR (Status); + + gBS->SignalEvent (FilterEvent); + + return Status; +} + +//----------------------------------------------------------------------------- +// ASF Table +//----------------------------------------------------------------------------- +//The table shound be runtime build like as ASFBSP +// +// ASF Definitions +// +#define EFI_ACPI_1_0_ASF_DESCRIPTION_TABLE_REVISION 0x20 + +// need to update to asl asf 2.0 table.... +EFI_ACPI_1_0_ASF_DESCRIPTION_TABLE ASF_TABLE = { + EFI_ACPI_1_0_ASF_DESCRIPTION_TABLE_SIGNATURE, + sizeof (EFI_ACPI_1_0_ASF_DESCRIPTION_TABLE), + EFI_ACPI_1_0_ASF_DESCRIPTION_TABLE_REVISION, + 0, // to make sum of entire table == 0 + + // OEM identification + 'I', 'N', 'T', 'E', 'L', ' ', + + // OEM table identification + ((((((((((((('D' << 8) + '8') << 8) + '6') << 8) + '5') << 8) + 'G') << 8) + 'C') << 8) + 'H') << 8) + ' ', // OEM table identification + + 1, // OEM revision number + ((((('M' << 8) + 'S') << 8) + 'F') << 8) + 'T', // ASL compiler vendor ID + 1000000, // ASL compiler revision number + + // + // ASF_INFO + // + 0x00, // Type "ASF_INFO" + 0x00, // Reserved + sizeof (EFI_ACPI_ASF_INFO), // Length + 0xFF, // Min Watchdog Reset Value + 0xFF, // Min ASF Sensor Inter-poll Wait Time + 0x0001, // System ID + 0x57010000, // IANA Manufacture ID for Intel + 0x00, // Feature Flag + 0x00, 0x00, 0x00, // Reserved + + // + // ASF_ALRT + // + + 0x01, // Type "ASF_ALRT" + 0x00, // Reserved + sizeof (EFI_ACPI_ASF_ALRT), // Length + 0x00, // Assertion Event Bit Mask + 0x00, // Deassertion Event Bit Mask + 0x03, // Number Of Alerts + 0x0C, // Array Element Length + // + // ICH Slave SMBUS Read devices + // + 0x89, 0x04, 0x01, 0x01, 0x05, 0x6F, 0x00, 0x68, 0x08, 0x88, 0x17, 0x00, // Device 0 + 0x89, 0x04, 0x04, 0x04, 0x07, 0x6F, 0x00, 0x68, 0x20, 0x88, 0x03, 0x00, // Device 1 + 0x89, 0x05, 0x01, 0x01, 0x19, 0x6F, 0x00, 0x68, 0x20, 0x88, 0x22, 0x00, // Device 2 + + // + // ASF_RCTL + // + 0x02, // Type "ASF_RCTL" + 0x00, // Reserved + sizeof (EFI_ACPI_ASF_RCTL), // Length + 0x04, // Number of Controls + 0x04, // Array Element Length + 0x0000, // Reserved + // + // ICH Slave SMBUS Write cmds + // + 0x00, 0x88, 0x00, 0x03, // Control 0 --> Reset system + 0x01, 0x88, 0x00, 0x02, // Control 1 --> Power Off system + 0x02, 0x88, 0x00, 0x01, // Control 2 --> Power On system + 0x03, 0x88, 0x00, 0x04, // Control 3 --> Power Cycle Reset (off then on) + + // + // ASF_RCMP + // + 0x03, // Type "ASF_RCMP" + 0x00, // Reserved + sizeof (EFI_ACPI_ASF_RMCP), // Length + + // Remote Control Capabilities supported Bit Masks + // ============================================= + // System Firmware Capabilities Bit Mask Started + // ============================================= + 0x21, // System Firmware Capabilities Bit Mask + // (two MSBytes are Rsvd, + + // Bit7 RSVD + // Bit6 Support Sleep Button LOCK + // Bit5 Support KBD LOCK + // Bit4-3 RSVD + // Bit2 Support Reset Button LOCK + // Bit1 Support Power Button LOCK + // Bit0 Support Verbosity/ Blank Screen + 0xF8, + // Bit7 Support Configration Data Reset + // Bit6 Support Verbosity/ Quiet + // Bit5 Support Verbosity/ Verbose + // Bit4 Support Force Progress Event + // Bit3 Support User Password Bypass + // Bit2:0 RSVD + 0x00, + 0x00, + // ============================================= + // Special Commands Bit Mask Started + // ============================================= + 0x00, // RSVD + 0x13, + // Bit7:5 RSVD + // Bit4 Support Force CD/DVD Boot Command + // Bit3 Support Force Diagnostic Boot Command + // Bit2 Support Force Hard Drive Safe-mode Boot Command + // Bit1 Support Force Hard Drive Boot Command + // Bit0 Support Force PXE Boot Command + // ============================================= + // System Capabilities Bit Mask Started + // ============================================= + 0xF0, // System Capabilities Bit Mask (Supports Reset, + // Power-Up,Power-Down, Power-Cycle Reset + // for compat and secure port. + 0x00, // Boot Option Complete Code + 0x57010000, // IANA ID for Intel Manufacturer + 0x00, // Special Command + 0x00, 0x00, // Special Command Parameter + 0x00, 0x01, // Boot Options + 0x00, 0x00, // OEM Parameters + + // + // ASF_ADDR + // + 0x84, // Type "ASF_ADDR", last record + 0x00, // Reserved + sizeof (EFI_ACPI_ASF_ADDR), // Length + 0x00, // SEEPROM Address + ASF_ADDR_DEVICE_ARRAY_LENGTH, // Number Of Devices + 0x5C, 0x68, 0x88, 0xC2, 0xD2, // Fixed SMBus Address (Heceta 6, 82573E device - static def (also an ARP addr), + 0xDC, 0xA0, 0xA2, 0xA4, 0xA6, // ICH Slave Device, SMB ARP, CK410, DB400/800, SDRAM SPD devices + 0xC8 // TEKOA Slave Device +}; + +EFI_STATUS +AsfBuildTbl( + IN EFI_EVENT Event, + IN VOID *Context +) +{ + EFI_STATUS Status; + UINTN AsfTableHandle=0; + EFI_ACPI_SUPPORT_PROTOCOL *AcpiSupport; + VOID *AsfStruc; + + AsfStruc = (VOID *)&ASF_TABLE; + + Status = gBS->LocateProtocol(&gAcpiSupportGuid, + NULL, + &AcpiSupport); + if (EFI_ERROR (Status)) + { + return EFI_ABORTED; + } + + Status = AcpiSupport->SetAcpiTable (AcpiSupport, + AsfStruc, + TRUE, + (EFI_ACPI_TABLE_VERSION_2_0|EFI_ACPI_TABLE_VERSION_1_0B), + &AsfTableHandle); + if (EFI_ERROR(Status)) + { + // Handle the error appropriately + return EFI_ABORTED; + } + + return Status; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.cif b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.cif new file mode 100644 index 0000000..bf83bbb --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.cif @@ -0,0 +1,12 @@ +<component> + name = "AsfTable" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\AsfTable" + RefName = "AsfTable" +[files] +"AsfTable.c" +"AsfTable.h" +"AsfTable.sdl" +"AsfTable.mak" +"AsfTable.dxs" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.dxs b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.dxs new file mode 100644 index 0000000..1d031bb --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.dxs @@ -0,0 +1,66 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AsfTable/AsfTable.dxs 1 2/08/12 1:09a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:09a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AsfTable/AsfTable.dxs $ +// +// 1 2/08/12 1:09a Klzhan +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AsfTable.DXS +// +// Description: This file is the dependency file for the AsfTable driver +// +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> + +DEPENDENCY_START + TRUE +DEPENDENCY_END + + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.h b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.h new file mode 100644 index 0000000..09cfc72 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.h @@ -0,0 +1,70 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AsfTable/AsfTable.h 1 2/08/12 1:09a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:09a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AsfTable/AsfTable.h $ +// +// 1 2/08/12 1:09a Klzhan +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AsfTable.h +// +// Description: Header file for ASF Acpi table +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#ifndef _ASF_TABLE_H_ +#define _ASF_TABLE_H_ + +#include "Efi.h" +#include "EfiDriverLib.h" +#include "EfiCommonLib.h" +#include "AlertStandardFormatTable.h" + +#include EFI_PROTOCOL_DEFINITION (AcpiSupport) + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.mak b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.mak new file mode 100644 index 0000000..65f6576 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.mak @@ -0,0 +1,79 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AsfTable/AsfTable.mak 1 2/08/12 1:09a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:09a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AsfTable/AsfTable.mak $ +# +# 1 2/08/12 1:09a Klzhan +# +# 1 2/25/11 1:44a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +#<AMI_FHDR_START> +# +# Name: AsfTable.mak +# +# Description: +# +#<AMI_FHDR_END> +#********************************************************************** +EDK : AsfTable + +AsfTable : $(BUILD_DIR)\AsfTable.mak AsfTableBin + +$(BUILD_DIR)\AsfTable.mak : $(AsfTable_DIR)\$(@B).cif $(AsfTable_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(AsfTable_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +ASF_TABLE_INCLUDES=\ + $(EDK_INCLUDES)\ + $(MISCFRAMEWORK_INCLUDES)\ + $(ME_INCLUDES)\ + $(IndustryStandard_INCLUDES)\ + +AsfTableBin : $(EFIDRIVERLIB) $(EFICOMMONLIB) $(PRINTLIB) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\AsfTable.mak all\ + GUID=E72527CF-505B-4b50-99CD-A32467FA4AA4\ + "MY_INCLUDES=$(ASF_TABLE_INCLUDES)" \ + ENTRY_POINT=AsfTableEntryPoint \ + TYPE=BS_DRIVER LIBRARIES= \ + DEPEX1=$(AsfTable_DIR)\AsfTable.dxs\ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX\ + COMPRESS=1\ + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.sdl b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.sdl new file mode 100644 index 0000000..b370431 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/AsfTable/AsfTable.sdl @@ -0,0 +1,24 @@ +TOKEN + Name = "AsfTable_SUPPORT" + Value = "1" + Help = "Main switch to enable AsfTable support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "AsfTable_DIR" +End + +MODULE + Help = "Includes AsfTable.mak to Project" + File = "AsfTable.mak" +End + +ELINK + Name = "$(BUILD_DIR)\AsfTable.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.c new file mode 100644 index 0000000..b5d4c0a --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.c @@ -0,0 +1,883 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AmtWrapperDxe.c 10 6/18/14 3:08a Larryliu $ +// +// $Revision: 10 $ +// +// $Date: 6/18/14 3:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AmtWrapperDxe.c $ +// +// 10 6/18/14 3:08a Larryliu +// [TAG] EIP173999 +// [Category] Improvement +// [Description] [HWR]Remove useless comments from Intel ME +// component.(except RC) +// [Files] AmtWrapperDxe.c +// +// 8 5/14/14 9:52p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 7 9/12/13 5:26a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Correct gSerialOverLanDevicePath +// +// 6 4/18/13 1:55a Klzhan +// [TAG] EIP119190 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] BIOS doesn't wait for KVM pass code input. +// [RootCause] The Con Out Start protocol GUID is different in AMI and +// ME RC. +// [Solution] Install ME RC ConOut Protocol when AMI ConOut Protocol +// installed. +// [Files] AmtWrapperDxe.c +// AmtWrapperDxe.h +// +// 5 4/08/13 3:06a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Support New Security protocol. +// +// 4 10/30/12 8:33a Klzhan +// Correct Secure IDER boot +// +// 3 8/14/12 7:24a Klzhan +// Support UEFI IDER boot. +// +// 2 4/24/12 12:36a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 3 6/21/11 3:42a Klzhan +// Fix comnpiler error if PCI COM is 0. +// +// 2 3/29/11 3:18a Klzhan +// Remove un-used code. +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 2 12/28/10 2:00a Klzhan +// Improvement : Enable/Disable Terminal item for SOL redirection. +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AmtWrapperDxe.c +// +// Description: Amt Wrapper Functions +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved. +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. +--*/ +#if EFI_SPECIFICATION_VERSION>0x20000 +#include "token.h" +#define _HII_H_ +#define _FORM_CALLBACK_H_ +#define _GLOBAL_VARIABLE_GUID_H_ +#ifndef GUID_VARIABLE_DECLARATION +#define GUID_VARIABLE_DECLARATION(Variable, Guid) extern EFI_GUID Variable +#endif +#include "AmtWrapperDxe.h" +#else +#include "AmtWrapperDxe.h" +#include "token.h" +#define __UEFI_HII__H__ +#define __HII_PROTOCOL_H__ +#define _HII_H_ +#endif +#if defined(Terminal_SUPPORT) && (Terminal_SUPPORT == 1) +#include "Core\Em\Terminal\TerminalSetupVar.h" +#endif +#include <SetupDataDefinition.h> +#if defined(CORE_COMBINED_VERSION) && CORE_COMBINED_VERSION >=0x4028e +#include <Protocol\Security2.h> +#else +#include <Protocol\Security.h> +#endif + +#include <Amt.h> +#include EFI_GUID_DEFINITION(ConsoleOutDevice) + +#define SETUP_GUID { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } + +AMT_WRAPPER_PROTOCOL AmtWrapperInstance = { + AmtWrapperInit, + AmtWrapperGet, + AmtWrapperSet, + AmtWrapperEnableSol, + AmtWrapperEnableIdeR, + AmtWrapperPauseBoot, + AmtWrapperEnterSetup, + //AsfSupportInit, + AmtWrapperBdsBootViaAsf, + BdsLibUpdateConsoleVariable, + ActiveManagementConsoleLocked, + AmtWrapperEnableKvm, + AmtWrapperInitializationKvm + }; + +extern EFI_ACTIVE_MANAGEMENT_PROTOCOL *mActiveManagement; +extern EFI_ASF_BOOT_OPTIONS *mAsfBootOptions; +#if defined(LEGACYSREDIR_SUPPORT) && (LEGACYSREDIR_SUPPORT == 1) +EFI_GUID gEfiLegacySredirProtocolGuid = EFI_LEGACY_SREDIR_PROTOCOL_GUID; +#endif +EFI_GUID gSetupGuid = SETUP_GUID; +EFI_GUID gEfiAmtWrapperProtocolGuid = EFI_AMT_WRAPPER_PROTOCOL_GUID; +EFI_GUID gEfiMeBiosExtensionSetupGuid = EFI_ME_BIOS_EXTENSION_SETUP_GUID; +CHAR16 gEfiMeBiosExtensionSetupName[] = EFI_ME_BIOS_EXTENSION_SETUP_VARIABLE_NAME; + +PLATFORM_PCI_SERIAL_OVER_LAN_DEVICE_PATH gSerialOverLanDevicePath = { + gPciRootBridge, + { + HARDWARE_DEVICE_PATH, + HW_PCI_DP, + (UINT8)(sizeof(PCI_DEVICE_PATH)), + (UINT8)((sizeof(PCI_DEVICE_PATH)) >> 8), + SOL_FUNCTION_NUMBER, + ME_DEVICE_NUMBER + }, + { + MESSAGING_DEVICE_PATH, + MSG_UART_DP, + (UINT8)(sizeof(UART_DEVICE_PATH)), + (UINT8)((sizeof(UART_DEVICE_PATH)) >> 8), + 0, + 115200, + 8, + 1, + 1 + }, + { + MESSAGING_DEVICE_PATH, + MSG_VENDOR_DP, + (UINT8)(sizeof(VENDOR_DEVICE_PATH)), + (UINT8)((sizeof(VENDOR_DEVICE_PATH)) >> 8), + DEVICE_PATH_MESSAGING_PC_ANSI + }, + gEndEntire + }; + + +EFI_HANDLE mBdsImageHandle; +UINT16 gPlatformBootTimeOutDefault = 1; + + +// +// Driver entry point +// +EFI_DRIVER_ENTRY_POINT (AmtWrapperDxeEntryPoint); + +// +// Function implementations +// +#if defined(CORE_COMBINED_VERSION) && CORE_COMBINED_VERSION >=0x4028e +EFI_STATUS EmptyFileAuthentication +( + IN CONST EFI_SECURITY2_ARCH_PROTOCOL *This, + IN CONST EFI_DEVICE_PATH_PROTOCOL *File, + IN VOID *FileBuffer, + IN UINTN FileSize, + IN BOOLEAN BootPolicy +) +#else +EFI_STATUS EmptyFileAuthentication +( + IN EFI_SECURITY_ARCH_PROTOCOL *This, + IN UINT32 AuthenticationStatus, + IN EFI_DEVICE_PATH_PROTOCOL *File +) +#endif +{ + if (File==NULL) return EFI_INVALID_PARAMETER; + return EFI_SUCCESS; +} + +VOID +EFIAPI +InstallEDKConOutStartProtocol ( + IN EFI_EVENT Event, + IN VOID *Context + ) +{ + + gBS->InstallProtocolInterface( + &mBdsImageHandle, &gEfiConsoleOutDeviceGuid, EFI_NATIVE_INTERFACE, NULL); + + gBS->CloseEvent (Event); +} + +EFI_STATUS +EFIAPI +AmtWrapperDxeEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +/*++ + +Routine Description: + + Entry point for the Active Management Driver. + +Arguments: + + ImageHandle Image handle of this driver. + SystemTable Global system service table. + +Returns: + + EFI_SUCCESS Initialization complete. + EFI_UNSUPPORTED The chipset is unsupported by this driver. + EFI_OUT_OF_RESOURCES Do not have enough resources to initialize the driver. + EFI_DEVICE_ERROR Device error, driver exits abnormally. + +--*/ +{ + EFI_STATUS Status; + EFI_EVENT ReadyToBootEvent; + EFI_GUID gSetupGuid = SETUP_GUID; + UINTN VariableSize = sizeof(SETUP_DATA); + SETUP_DATA SetupDataBuffer; + SETUP_DATA *SetupData = &SetupDataBuffer; + VOID *AfterConsolOutNotifyReg; + EFI_EVENT AfterConsolOutInstalledEvent; + EFI_GUID AmiConOutStartProtocolGuid = AMI_CONSOLE_OUT_DEVICES_STARTED_PROTOCOL_GUID; + + mBdsImageHandle = ImageHandle; + // + // Initialize the EFI Driver Library + // + EfiInitializeDriverLib (ImageHandle, SystemTable); + INITIALIZE_SCRIPT (ImageHandle, SystemTable); + + mAsfBootOptions = NULL; + mActiveManagement = NULL; + + InitAmtWrapperLib(); + // + // Install the EFI_ACTIVE_MANAGEMENT_PROTOCOL interface + // + Status = gBS->InstallMultipleProtocolInterfaces ( + &ImageHandle, + &gEfiAmtWrapperProtocolGuid, &AmtWrapperInstance, + NULL + ); + + // This event is for KVM function, because ConOut Start GUID is different from AMI to ME RC. + Status = gBS->CreateEvent ( + EFI_EVENT_NOTIFY_SIGNAL, + EFI_TPL_NOTIFY, + InstallEDKConOutStartProtocol, + NULL, + &AfterConsolOutInstalledEvent + ); + + Status = gBS->RegisterProtocolNotify ( + &AmiConOutStartProtocolGuid, + AfterConsolOutInstalledEvent, + &AfterConsolOutNotifyReg + ); + +#if defined(Terminal_SUPPORT) && (Terminal_SUPPORT == 1) + // Enable/Disable Sol redirection + SetSOLCOMEnable(AmtWrapperEnableSol()); +#endif + // + // Register Ready to Boot Event for AMT Wrapper + // +#if defined(EFI_EVENT_SIGNAL_READY_TO_BOOT) && EFI_SPECIFICATION_VERSION<0x20000 + Status = gBS->CreateEvent( + EFI_EVENT_SIGNAL_READY_TO_BOOT | EFI_EVENT_NOTIFY_SIGNAL_ALL, + EFI_TPL_CALLBACK, + AmtWrapperReadyToBoot, + (VOID *)&ImageHandle, + &ReadyToBootEvent + ); +#else + Status = EfiCreateEventReadyToBoot( + EFI_TPL_CALLBACK, + AmtWrapperReadyToBoot, + (VOID *)&ImageHandle, + &ReadyToBootEvent + ); +#endif + + return Status; +} + +#if defined(Terminal_SUPPORT) && (Terminal_SUPPORT == 1) +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: SetSOLCOMEnable +// +// Description: Enable/Disable SOL COM. +// +// Input: +// +// Output: +// +// Notes: +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +SetSOLCOMEnable( + IN BOOLEAN Enabled +) +{ + UINT32 ComPort; + UINT32 SetupVarAttr; + UINTN SetupDataSize; + SETUP_DATA gSetupData; + EFI_STATUS Status; +#if (TOTAL_PCI_SERIAL_PORTS > 0) + UINT32 i = 0; + EFI_GUID gTerminalVarGuid = TERMINAL_VAR_GUID; + UINTN PciSerialPortsLocationVarSize = + sizeof(PCI_SERIAL_PORTS_LOCATION_VAR); + UINT32 PciSerialPortsLocationVarAttributes=0; + PCI_SERIAL_PORTS_LOCATION_VAR PciSerialPortsLocationVar; + UINT32 gTotalSioSerialPorts = TOTAL_SIO_SERIAL_PORTS; + Status = gRT->GetVariable(L"PciSerialPortsLocationVar", + &gTerminalVarGuid, + &PciSerialPortsLocationVarAttributes, + &PciSerialPortsLocationVarSize, + &PciSerialPortsLocationVar); + + if(EFI_ERROR(Status)) { + ComPort = gTotalSioSerialPorts; + } + + ComPort = gTotalSioSerialPorts; + + for (i = 0; i < TOTAL_PCI_SERIAL_PORTS; i++) { + if ((PciSerialPortsLocationVar.Device[i] == SOL_DEVICE_NUMBER) && + (PciSerialPortsLocationVar.Function[i] == SOL_FUNCTION_NUMBER)) { + ComPort = gTotalSioSerialPorts+i; + break; + } + } +#else + return; +#endif + + SetupVarAttr = 0; + SetupDataSize = sizeof(SETUP_DATA); + Status = gRT->GetVariable( \ + L"Setup", \ + &gSetupGuid, \ + &SetupVarAttr, \ + &SetupDataSize, \ + &gSetupData ); + + if(Enabled) + gSetupData.ConsoleRedirectionEnable[ComPort] = 1; + else + gSetupData.ConsoleRedirectionEnable[ComPort] = 0; + + Status = gRT->SetVariable( \ + L"Setup", \ + &gSetupGuid, \ + SetupVarAttr, \ + SetupDataSize, \ + &gSetupData ); +} +#endif + +EFI_STATUS +BdsRefreshBbsTableForBoot ( + IN BDS_COMMON_OPTION *Entry +) +{ + return EFI_NOT_FOUND; +} + +VOID +PrintBbsTable ( + IN BBS_TABLE *LocalBbsTable +) +{ + UINT16 Idx; + + DEBUG ((EFI_D_ERROR, "\n")); + DEBUG ((EFI_D_ERROR, " NO Prio bb/dd/ff cl/sc Type Stat segm:offs\n")); + DEBUG ((EFI_D_ERROR, "=============================================\n")); + for (Idx = 0; Idx < MAX_BBS_ENTRIES; Idx++) + { + if (LocalBbsTable[Idx].BootPriority == BBS_IGNORE_ENTRY) + { + continue; + } + + DEBUG ( + (EFI_D_ERROR, + " %02x: %04x %02x/%02x/%02x %02x/02%x %04x %04x %04x:%04x\n", + (UINTN) Idx, + (UINTN) LocalBbsTable[Idx].BootPriority, + (UINTN) LocalBbsTable[Idx].Bus, + (UINTN) LocalBbsTable[Idx].Device, + (UINTN) LocalBbsTable[Idx].Function, + (UINTN) LocalBbsTable[Idx].Class, + (UINTN) LocalBbsTable[Idx].SubClass, + (UINTN) LocalBbsTable[Idx].DeviceType, + (UINTN) * (UINT16 *) &LocalBbsTable[Idx].StatusFlags, + (UINTN) LocalBbsTable[Idx].BootHandlerSegment, + (UINTN) LocalBbsTable[Idx].BootHandlerOffset, + (UINTN) ((LocalBbsTable[Idx].MfgStringSegment << 4) + LocalBbsTable[Idx].MfgStringOffset), + (UINTN) ((LocalBbsTable[Idx].DescStringSegment << 4) + LocalBbsTable[Idx].DescStringOffset)) + ); + } + + DEBUG ((EFI_D_ERROR, "\n")); +} + +BOOLEAN +AmtWrapperGet( + IN UINTN Index, + IN OUT VOID *pVar +) +{ + BOOLEAN st = FALSE; + + InitAmtWrapperLib(); + + if (Index == GET_SOL_DP) { + *((PLATFORM_PCI_SERIAL_OVER_LAN_DEVICE_PATH **)pVar) = &gSerialOverLanDevicePath; + st = TRUE; + } else if (Index == GET_TIME_OUT) { + *((UINT16 *)pVar) = BdsLibGetTimeout(); + st = TRUE; + } else if (Index == GET_BOOT_OPTION) { + *((UINT16 *)pVar) = mAsfBootOptions->BootOptions; + st = TRUE; + } else if (Index == GET_IS_SOL) { + *((UINTN *)pVar) = IsSOL(*((EFI_HANDLE *)pVar)); + st = TRUE; + } else if (Index == GET_IS_IDER) { + *((UINTN *)pVar) = IsIDER(*((EFI_HANDLE *)pVar)); + st = TRUE; + } + + return st; +} + +UINTN IsSOL( + IN EFI_HANDLE Controller +) +{ + EFI_STATUS Status; + EFI_PCI_IO_PROTOCOL *PciIo; + UINTN Segment=0; + UINTN Bus=0; + UINTN Device=0; + UINTN Function=0; + UINTN flag = FALSE; + + Status = gBS->HandleProtocol(Controller, + &gEfiPciIoProtocolGuid, + &PciIo); + if (!EFI_ERROR(Status)) { + Status = PciIo->GetLocation(PciIo, + &Segment, + &Bus, + &Device, + &Function); + if (!EFI_ERROR(Status)) { + if (Device == SOL_DEVICE_NUMBER && Function == SOL_FUNCTION_NUMBER) { + flag = TRUE; + } + } + } + + return flag; +} + +UINTN IsIDER( + IN EFI_HANDLE Controller +) +{ + EFI_STATUS Status; + EFI_PCI_IO_PROTOCOL *PciIo; + UINTN Segment=0; + UINTN Bus=0; + UINTN Device=0; + UINTN Function=0; + UINTN flag = FALSE; + + Status = gBS->HandleProtocol(Controller, + &gEfiPciIoProtocolGuid, + &PciIo); + if (!EFI_ERROR(Status)) { + Status = PciIo->GetLocation(PciIo, + &Segment, + &Bus, + &Device, + &Function); + if (!EFI_ERROR(Status)) { + if (Device == IDER_DEVICE_NUMBER && Function == IDER_FUNCTION_NUMBER) { + flag = TRUE; + } + } + } + + return flag; +} + +UINT16 ConvertSetupDataToUART( + UINT8 Parity, + UINT8 DataBits, + UINT8 StopBits +) +{ + UINT16 DataParityStopBit = 0; + + switch (Parity) { + case NoParity: + DataParityStopBit &= ~(PAREN | EVENPAR | STICPAR); + break; + case EvenParity: + DataParityStopBit |= (PAREN | EVENPAR); + DataParityStopBit &= ~STICPAR; + break; + case OddParity: + DataParityStopBit |= PAREN; + DataParityStopBit &= ~(EVENPAR | STICPAR); + break; + case SpaceParity: + DataParityStopBit |= (PAREN | EVENPAR | STICPAR); + break; + case MarkParity: + DataParityStopBit |= (PAREN | STICPAR); + DataParityStopBit &= ~EVENPAR; + break; + } + + // Set stop bits. + switch (StopBits) { + case OneStopBit : + DataParityStopBit &= ~STOPB; + break; + case OneFiveStopBits : + case TwoStopBits : + DataParityStopBit |= STOPB; + break; + } + + // Set data bits. + DataParityStopBit &= ~SERIALDB; + DataParityStopBit |= (UINT8)((DataBits - 5) & 0x03); + + return DataParityStopBit; +} + +BOOLEAN +AmtWrapperSet( + IN UINTN Index, + IN OUT VOID *pVar +) +{ +#if defined(LEGACYSREDIR_SUPPORT) && (LEGACYSREDIR_SUPPORT == 1) + EFI_LEGACY_SREDIR_PROTOCOL *pLegacySredir; + UINT64 PciAddress; + UINT32 SerialAddress; + UINT8 SerialIRQ; + EFI_STATUS Status; + EFI_PCI_ROOT_BRIDGE_IO_PROTOCOL *PciRootBridgeIo; + BOOLEAN st = FALSE; + + InitAmtWrapperLib(); + + if (Index == SET_BIOS_WDT_START) { + AsfStartWatchDog(ASF_START_BIOS_WDT); + st = TRUE; + } + else if (Index == SET_OS_WDT_START) { + AsfStartWatchDog(ASF_START_OS_WDT); + st = TRUE; + } + else if (Index == SET_WDT_STOP) { + AsfStopWatchDog(); + st = TRUE; + } + else if (Index == SET_OS_SOL) { + Status = gBS->LocateProtocol(&gEfiLegacySredirProtocolGuid, NULL, &pLegacySredir); + ASSERT_EFI_ERROR(Status); + + Status = gBS->LocateProtocol(&gEfiPciRootBridgeIoProtocolGuid, NULL, &PciRootBridgeIo); + ASSERT_EFI_ERROR(Status); + + PciAddress = EFI_PCI_ADDRESS (SOL_BUS_NUMBER, SOL_DEVICE_NUMBER, SOL_FUNCTION_NUMBER, 0x10); + PciRootBridgeIo->Pci.Read ( + PciRootBridgeIo, + EfiPciWidthUint32, + PciAddress, + 1, + &SerialAddress + ); + SerialAddress &= ~1; // mask IO/MEM bit + + PciAddress = EFI_PCI_ADDRESS (SOL_BUS_NUMBER, SOL_DEVICE_NUMBER, SOL_FUNCTION_NUMBER, 0x3C); + PciRootBridgeIo->Pci.Read ( + PciRootBridgeIo, + EfiPciWidthUint8, + PciAddress, + 1, + &SerialIRQ + ); +/* + UID = TOTAL_SIO_SERIAL_PORTS; + gEfiComParameters.BaseAddress = (UINT16)SerialAddress; + gEfiComParameters.SerialIRQ = (UINT8)SerialIRQ; + + VariableSize = sizeof(SETUP_DATA); + Status = gRT->GetVariable( + L"Setup", + &gSetupGuid, + NULL, + &VariableSize, + &SetupData); + ASSERT(!EFI_ERROR(Status)); + + gEfiComParameters.Baudrate = BaudRates[SetupData.BaudRate[UID]]; + gEfiComParameters.TerminalType = TerminalTypes[SetupData.TerminalType[UID]]; + gEfiComParameters.FlowControl = SetupData.FlowControl[UID]; + + gEfiComParameters.DataParityStop = ConvertSetupDataToUART( + SetupData.Parity[UID], + SetupData.DataBits[UID], + SetupData.StopBits[UID]); + + if (SREDIR_DISPLAY_MODE == DISPLAY_BY_80x24) + gEfiComParameters.LegacyOsResolution = 0; + else if (SREDIR_DISPLAY_MODE == DISPLAY_BY_80x25) + gEfiComParameters.LegacyOsResolution = 1; + else + gEfiComParameters.LegacyOsResolution = SetupData.LegacyOsResolution[UID]; +*/ + Status = pLegacySredir->EnableLegacySredir(pLegacySredir); + + ASSERT_EFI_ERROR (Status); + st = TRUE; + } + + return st; +#else + return FALSE; +#endif +} + +EFI_STATUS +AmtWrapperInit( + IN EFI_HANDLE ImageHandle, + IN OUT EFI_SYSTEM_TABLE *SystemTable +) +{ + mBdsImageHandle = ImageHandle; + InitAmtWrapperLib(); + + return EFI_SUCCESS; +} + + +VOID +InitAmtWrapperLib(VOID) +{ + if (mActiveManagement == NULL) + AmtLibInit(); + + if (mAsfBootOptions == NULL) { + BdsAsfInitialization(); + } +} + +BOOLEAN +AmtWrapperEnableSol( + IN VOID +) +{ + BOOLEAN st; + + InitAmtWrapperLib(); + st = ActiveManagementEnableSol(); + if(((mAsfBootOptions->OemParameters) & 0x01) && (mAsfBootOptions != NULL)) + st = TRUE; + else + st = FALSE; + return st; +} + +BOOLEAN +AmtWrapperEnableIdeR( + IN VOID +) +{ + BOOLEAN st; + EFI_STATUS Status; +#if defined(CORE_COMBINED_VERSION) && CORE_COMBINED_VERSION >=0x4028e + EFI_SECURITY2_ARCH_PROTOCOL *mSecurity; +#else + EFI_SECURITY_ARCH_PROTOCOL *mSecurity; +#endif + + InitAmtWrapperLib(); + st = ActiveManagementEnableIdeR(); + if(!st) + return st; + // IDER enabled and Enforce Secure Boot enabled + if((mAsfBootOptions->SpecialCommandParam & ENFORCE_SECURE_BOOT) + != ENFORCE_SECURE_BOOT) + { +#if defined(CORE_COMBINED_VERSION) && CORE_COMBINED_VERSION >=0x4028e + EFI_GUID gEfiSecurity2ArchProtocolGuid = EFI_SECURITY2_ARCH_PROTOCOL_GUID; + Status = gBS->LocateProtocol(&gEfiSecurity2ArchProtocolGuid, + +#else + Status = gBS->LocateProtocol(&gEfiSecurityArchProtocolGuid, +#endif + NULL, &mSecurity); + + if(EFI_ERROR(Status)) + return st; + // Set a empty File Authentication to skip Secure check. + // This will not been restore, because IDER boot fail system HALT + +#if defined(CORE_COMBINED_VERSION) && CORE_COMBINED_VERSION >=0x4028e + mSecurity->FileAuthentication = EmptyFileAuthentication; +#else + mSecurity->FileAuthenticationState = EmptyFileAuthentication; +#endif + } + + return st; +} + +BOOLEAN +AmtWrapperPauseBoot( + IN VOID +) +{ + BOOLEAN st; + + InitAmtWrapperLib(); + st = ActiveManagementPauseBoot(); + + return st; +} + +BOOLEAN +AmtWrapperEnterSetup( + IN VOID +) +{ + BOOLEAN st; + + InitAmtWrapperLib(); + st = ActiveManagementEnterSetup(); + + return st; +} + +EFI_STATUS +AmtWrapperBdsBootViaAsf( + IN VOID +) +{ + EFI_STATUS Status = EFI_NOT_FOUND; + + InitAmtWrapperLib(); + + if (mActiveManagement != NULL && mAsfBootOptions != NULL) { + Status = BdsBootViaAsf(); + } + + return Status; +} + + + +EFI_STATUS +AmtWrapperReadyToBoot( + EFI_EVENT Event, + VOID *ParentImageHandle +) +{ + EFI_STATUS Status = EFI_SUCCESS; + + + return Status; +} + +BOOLEAN +AmtWrapperEnableKvm( + IN VOID +) +{ + BOOLEAN Status; + + Status = ActiveManagementEnableKvm(); + + return Status; +} + +BOOLEAN +AmtWrapperInitializationKvm( + IN VOID +) +{ + BOOLEAN Status; + + Status = BdsKvmInitialization(); + + return Status; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.cif b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.cif new file mode 100644 index 0000000..91f7c3b --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.cif @@ -0,0 +1,25 @@ +<component> + name = "AmtWrapperDxe" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\Dxe" + RefName = "AmtWrapperDxe" +[files] +"AmtWrapperDxe.sdl" +"AmtWrapperDxe.c" +"AmtWrapperDxe.h" +"AmtWrapperDxe.mak" +"AmtWrapperDxe.dxs" +"AsfSupport.c" +"AsfSupport.h" +"DevicePath.c" +"Performance.c" +"Performance.h" +"BdsBoot.c" +"BdsConnect.c" +"BdsConsole.c" +"BdsLib.h" +"BdsMisc.c" +"BmMachine.h" +"KvmSupport.c" +"KvmSupport.h" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.dxs b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.dxs new file mode 100644 index 0000000..4e8ab21 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.dxs @@ -0,0 +1,75 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AmtWrapperDxe.dxs 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AmtWrapperDxe.dxs $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AmtWrapperDxe.dxs +// +// Description: Dependency file for AMTWrapperDxe module. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> + +#include "EfiDepex.h" + +#include EFI_PROTOCOL_DEFINITION (BootScriptSave) +#include EFI_PROTOCOL_DEPENDENCY (PciRootBridgeIo) +#include EFI_PROTOCOL_DEFINITION (AlertStandardFormat) +#include EFI_PROTOCOL_DEFINITION (ActiveManagement) + +DEPENDENCY_START + EFI_PCI_ROOT_BRIDGE_IO_PROTOCOL_GUID AND + EFI_ACTIVE_MANAGEMENT_PROTOCOL_GUID AND + EFI_ALERT_STANDARD_FORMAT_PROTOCOL_GUID AND + EFI_BOOT_SCRIPT_SAVE_PROTOCOL_GUID +DEPENDENCY_END + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.h b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.h new file mode 100644 index 0000000..2bc4540 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.h @@ -0,0 +1,268 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AmtWrapperDxe.h 3 4/18/13 1:55a Klzhan $ +// +// $Revision: 3 $ +// +// $Date: 4/18/13 1:55a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AmtWrapperDxe.h $ +// +// 3 4/18/13 1:55a Klzhan +// [TAG] EIP119190 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] BIOS doesn't wait for KVM pass code input. +// [RootCause] The Con Out Start protocol GUID is different in AMI and +// ME RC. +// [Solution] Install ME RC ConOut Protocol when AMI ConOut Protocol +// installed. +// [Files] AmtWrapperDxe.c +// AmtWrapperDxe.h +// +// 2 4/24/12 12:36a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 2 12/28/10 2:00a Klzhan +// Improvement : Enable/Disable Terminal item for SOL redirection. +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AmtWrapperDxe.h +// +// Description: Header file for Amt Wrapper Dxe module +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#ifndef _AMT_WRAPPER_DXE_H_ +#define _AMT_WRAPPER_DXE_H_ + +#include "Efi.h" +#include "EfiDriverLib.h" +#include "EfiCommonLib.h" +#include "BdsLib.h" +#include "EfiScriptLib.h" +#if defined(LEGACYSREDIR_SUPPORT) && (LEGACYSREDIR_SUPPORT == 1) +#include "Protocol\LegacySredir.h" +#endif +#include "AmtLib.h" +#include "MeAccess.h" + +#include EFI_PROTOCOL_CONSUMER (AmtPlatformPolicy) +#include EFI_PROTOCOL_CONSUMER (AmtWrapper) +#include EFI_PROTOCOL_CONSUMER (BootScriptSave) +#include EFI_PROTOCOL_CONSUMER (PciRootBridgeIo) +#include EFI_PROTOCOL_CONSUMER (ActiveManagement) +#include EFI_PROTOCOL_CONSUMER (PciIo) +#include EFI_PROTOCOL_CONSUMER (SerialIo) + +#include EFI_GUID_DEFINITION (MeBiosExtensionSetup) + +#define R_PCI_SVID 0x2C + +#define DISPLAY_SCREEN 0x01 // for LegacySredr CSM16 +#define SUPPORT8025 0x02 // for LegacySredr CSM16 + +// define for SREDIR_DISPLAY_MODE +#define DISPLAY_BY_SETUP 0x00 +#define DISPLAY_BY_80x24 0x01 +#define DISPLAY_BY_80x25 0x02 + +#define STOPB 0x4 // Bit2: Number of Stop Bits +#define PAREN 0x8 // Bit3: Parity Enable +#define EVENPAR 0x10 // Bit4: Even Parity Select +#define STICPAR 0x20 // Bit5: Sticky Parity +#define SERIALDB 0x3 // Bit0-1: Number of Serial + // + +#define EFI_WIN_NT_THUNK_PROTOCOL_GUID \ + { 0x58c518b1, 0x76f3, 0x11d4, 0xbc, 0xea, 0x0, 0x80, 0xc7, 0x3c, 0x88, 0x81 } + +#define EFI_WIN_NT_BUS_DRIVER_IO_PROTOCOL_GUID \ + { 0x96eb4ad6, 0xa32a, 0x11d4, 0xbc, 0xfd, 0x0, 0x80, 0xc7, 0x3c, 0x88, 0x81 } + +#define EFI_WIN_NT_SERIAL_PORT_GUID \ + { 0xc95a93d, 0xa006, 0x11d4, 0xbc, 0xfa, 0x0, 0x80, 0xc7, 0x3c, 0x88, 0x81 } + +#define AMI_CONSOLE_OUT_DEVICES_STARTED_PROTOCOL_GUID \ + { 0xef9a3971, 0xc1a0, 0x4a93, 0xbd, 0x40, 0x5a, 0xa1, 0x65, 0xf2, 0xdc, 0x3a } + +typedef struct { + ACPI_HID_DEVICE_PATH PciRootBridge; + PCI_DEVICE_PATH SerialOverLAN; + UART_DEVICE_PATH Uart; + VENDOR_DEVICE_PATH TerminalType; + EFI_DEVICE_PATH_PROTOCOL End; +} PLATFORM_PCI_SERIAL_OVER_LAN_DEVICE_PATH; + +#define gPciRootBridge \ + { \ + ACPI_DEVICE_PATH, \ + ACPI_DP, \ + (UINT8) (sizeof (ACPI_HID_DEVICE_PATH)), \ + (UINT8) ((sizeof (ACPI_HID_DEVICE_PATH)) >> 8), \ + EISA_PNP_ID (0x0A03), 0 \ + } + +#define gEndEntire \ + { \ + END_DEVICE_PATH_TYPE,\ + END_ENTIRE_DEVICE_PATH_SUBTYPE,\ + END_DEVICE_PATH_LENGTH,\ + 0\ + } + +VOID +SetSOLCOMEnable( + IN BOOLEAN Enabled +); + +EFI_STATUS +AmtWrapperInit( + IN EFI_HANDLE ImageHandle, + IN OUT EFI_SYSTEM_TABLE *SystemTable +); + +BOOLEAN +AmtWrapperGet( + UINTN Index, + VOID *pVar +); + +BOOLEAN +AmtWrapperSet( + UINTN Index, + VOID *pVar +); + +BOOLEAN +ActiveManagementPauseBoot ( + IN VOID +); + +BOOLEAN +ActiveManagementEnterSetup ( + IN VOID +); + +BOOLEAN +ActiveManagementEnableSol ( + IN VOID +); + +BOOLEAN +ActiveManagementEnableIdeR ( + IN VOID +); + +EFI_STATUS +BdsAsfInitialization ( + IN VOID +); + +EFI_STATUS +BdsBootViaAsf ( + IN VOID +); + +VOID +InitAmtWrapperLib( + IN VOID +); + +BOOLEAN +AmtWrapperEnableKvm( + IN VOID +); + +BOOLEAN +AmtWrapperInitializationKvm( + IN VOID +); + +BOOLEAN +AmtWrapperEnableSol( + IN VOID +); + +BOOLEAN +AmtWrapperEnableIdeR( + IN VOID +); + +BOOLEAN +AmtWrapperPauseBoot( + IN VOID +); + +BOOLEAN +AmtWrapperEnterSetup( + IN VOID +); + +EFI_STATUS +AmtWrapperBdsBootViaAsf( + IN VOID +); + +EFI_STATUS +AmtWrapperReadyToBoot( + EFI_EVENT Event, + VOID *ParentImageHandle +); + +BOOLEAN +BdsKvmInitialization ( + IN VOID +); + +UINTN IsSOL( + IN EFI_HANDLE Controller +); + +UINTN IsIDER( + IN EFI_HANDLE Controller +); +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.mak b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.mak new file mode 100644 index 0000000..21f25ce --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.mak @@ -0,0 +1,117 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AmtWrapperDxe.mak 2 2/23/12 8:58a Klzhan $ +# +# $Revision: 2 $ +# +# $Date: 2/23/12 8:58a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AmtWrapperDxe.mak $ +# +# 2 2/23/12 8:58a Klzhan +# Support New EDK +# +# 1 2/08/12 1:08a Klzhan +# Initial Check in +# +# 2 9/15/11 2:12a Klzhan +# Remove AMI Lib. +# +# 1 2/25/11 1:43a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: AmtWrapperDxe.mak +# +# Description: Makfile for Amt Wrapper Dxe module +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +EDK : AmtWrapperDxe + +AmtWrapperDxe : $(BUILD_DIR)\AmtWrapperDxe.mak AmtWrapperDxeBin + +$(BUILD_DIR)\AmtWrapperDxe.mak : $(AmtWrapperDxe_DIR)\$(@B).cif $(AmtWrapperDxe_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(AmtWrapperDxe_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +AmtWrapperDxe_INCLUDES=\ + $(EDK_INCLUDES)\ + $(MISCFRAMEWORK_INCLUDES)\ + $(ME_INCLUDES)\ + $(INTEL_MCH_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + $(IndustryStandard_INCLUDES)\ + $(EdkIIGlueLib_INCLUDES)\ + /IInclude\ + $(NB_INCLUDES) + + +AmtWrapperDxe_LIBS=\ + $(EFISCRIPTLIB)\ + $(EFIDRIVERLIB)\ + $(EFICOMMONLIB)\ + $(PRINTLIB)\ + $(EDKFRAMEWORKPROTOCOLLIB)\ + $(EFIGUIDLIB)\ + $(AmtProtocolLib_LIB)\ + $(AmtLibDxe_LIB)\ + $(MeLibDxe_LIB)\ + $(AmtGuidLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueDxeServicesTableLib_LIB)\ + +AmtWrapperDxeBin : $(AmtWrapperDxe_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\AmtWrapperDxe.mak all\ + GUID=D77C900D-A1C7-41c5-B989-0C3D37FCA432\ + "MY_INCLUDES=$(AmtWrapperDxe_INCLUDES)" \ + ENTRY_POINT=AmtWrapperDxeEntryPoint\ + DEPEX1=$(AmtWrapperDxe_DIR)\AmtWrapperDxe.dxs\ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX\ + TYPE=BS_DRIVER\ + COMPRESS=1 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.sdl b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.sdl new file mode 100644 index 0000000..cf027e3 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/AmtWrapperDxe.sdl @@ -0,0 +1,57 @@ +TOKEN + Name = "AmtWrapperDxe_SUPPORT" + Value = "1" + Help = "Main switch to enable AMT Wrapper DXE support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "AmtWrapperDxe_DIR" +End + +MODULE + Help = "Includes AmtWrapperDxe.mak to Project" + File = "AmtWrapperDxe.mak" +End + +ELINK + Name = "$(BUILD_DIR)\AmtWrapperDxe.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + +TOKEN + Name = "SREDIR_DISPLAY_MODE" + Value = "0" + Help = "0:Legacy Redirection by Setup Setting\1:Force Legacy Redirection to 80x24\2:Force Legacy Redirection to 80x25" + TokenType = Integer + TargetH = Yes + Range = "0 - 2" +End + +ELINK + Name = "{0x8086,0x1C3A}," + Parent = "InvalidPciComDeviceList" + InvokeOrder = AfterParent +End + +ELINK + Name = "{0x8086,0x1C3B}," + Parent = "InvalidPciComDeviceList" + InvokeOrder = AfterParent +End + +ELINK + Name = "{0x8086,0x1E3A}," + Parent = "InvalidPciComDeviceList" + InvokeOrder = AfterParent +End + +ELINK + Name = "{0x8086,0x1E3B}," + Parent = "InvalidPciComDeviceList" + InvokeOrder = AfterParent +End
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/AsfSupport.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/AsfSupport.c new file mode 100644 index 0000000..425a608 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/AsfSupport.c @@ -0,0 +1,1919 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AsfSupport.c 10 5/14/14 9:52p Tristinchou $ +// +// $Revision: 10 $ +// +// $Date: 5/14/14 9:52p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AsfSupport.c $ +// +// 10 5/14/14 9:52p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 9 1/08/14 10:23p Tristinchou +// [TAG] EIP144445 +// [Category] Bug Fix +// [Severity] Normal +// [Symptom] AMT IDER Floppy failed on HSW ULT +// [RootCause] IDER Device ID is different on HSW ULT +// [Solution] Determine the bus, device and function number directly +// +// 8 9/24/13 4:22a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Raise TPL is not needed +// +// 7 4/08/13 3:10a Klzhan +// [TAG] EIPNone +// [Category] Bug Fix +// [Severity] Important +// [Symptom] TC015 fail +// +// 6 3/01/13 4:38a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Boot to legacy when UEFI boot fail. +// Correct secure boot fail behavior +// +// 5 2/25/13 7:05a Klzhan +// [TAG] EIP113605 +// [Category] Improvement +// [Description] Support IDER Floppy BOOT. +// +// 4 10/30/12 8:30a Klzhan +// Improvement : Boot to Legacy when EFI boot fail. +// Improvement : Correct Secure IDER Boot. +// +// 3 8/14/12 7:26a Klzhan +// Support UEFI IDER boot. +// +// 2 4/24/12 12:36a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 3 7/08/11 4:20a Klzhan +// +// 2 6/16/11 4:56a Klzhan +// Update IDER related code. +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AsfSupport.c +// +// Description: +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + This file contains an 'Intel Peripheral Driver' and is + licensed for Intel CPUs and chipsets under the terms of your + license agreement with Intel or your vendor. This file may + be modified by the user, subject to additional terms of the + license agreement +--*/ + +/*++ + +Copyright (c) 2005-2008 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + + +Module Name: + + AsfSupport.c + +Abstract: + + Support routines for ASF boot options in the BDS + +--*/ + +#include "AsfSupport.h" + +#pragma pack(push,1) + +typedef struct { + UINT32 Attributes; + UINT16 FilePathListLength; +} EFI_LOAD_OPTION; +#pragma pack(pop) + +// +// Global variables +// +EFI_ASF_BOOT_OPTIONS *mAsfBootOptions; + +static EFI_DEVICE_PATH_PROTOCOL EndDevicePath[] = { + END_DEVICE_PATH_TYPE, + END_ENTIRE_DEVICE_PATH_SUBTYPE, + END_DEVICE_PATH_LENGTH, + 0 +}; + +// +// Legacy Device Order +// +typedef struct { + UINT32 Type; + UINT16 Length; + UINT16 Device[1]; +} LEGACY_DEVICE_ORDER; + +#define LEGACY_DEV_ORDER_GUID \ + { \ + 0xA56074DB, 0x65FE, 0x45F7, 0xBD, 0x21, 0x2D, 0x2B, 0xDD, 0x8E, 0x96, 0x52 \ + } + +EFI_GUID gLegacyDeviceOrderGuid = LEGACY_DEV_ORDER_GUID; + +EFI_STATUS +BdsAsfInitialization ( + IN VOID + ) +/*++ + +Routine Description: + + Retrieve the ASF boot options previously recorded by the ASF driver. + +Arguments: + + None. + +Returns: + + Initialize Boot Options global variable and AMT protocol + +--*/ +{ + EFI_STATUS Status; + EFI_ALERT_STANDARD_FORMAT_PROTOCOL *Asf; + + mAsfBootOptions = NULL; + + // + // Amt Library Init + // + Status = AmtLibInit (); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "Info : Error init AmtLibInit -> %r\n", Status)); + return Status; + } + // + // Get Protocol for ASF + // + Status = gBS->LocateProtocol ( + &gEfiAlertStandardFormatProtocolGuid, + NULL, + &Asf + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "Info : Error gettings ASF protocol -> %r\n", Status)); + return Status; + } + + Status = Asf->GetBootOptions (Asf, &mAsfBootOptions); + + return Status; +} + +BDS_COMMON_OPTION * +BdsCreateBootOption ( + IN EFI_DEVICE_PATH_PROTOCOL *DevicePath, + IN CHAR16 *Description + ) +/*++ + +Routine Description: + + This function will create a BootOption from the give device path and + description string. + +Arguments: + + DevicePath - The device path which the option represent + Description - The description of the boot option + +Returns: + + BDS_COMMON_OPTION - A BDS_COMMON_OPTION pointer + +--*/ +{ + BDS_COMMON_OPTION *Option; + + Option = EfiLibAllocateZeroPool (sizeof (BDS_COMMON_OPTION)); + if (Option == NULL) { + return NULL; + } + + Option->Signature = BDS_LOAD_OPTION_SIGNATURE; + Option->DevicePath = EfiLibAllocateZeroPool (EfiDevicePathSize (DevicePath)); + EfiCopyMem (Option->DevicePath, DevicePath, EfiDevicePathSize (DevicePath)); + + Option->Attribute = LOAD_OPTION_ACTIVE; + Option->Description = EfiLibAllocateZeroPool (EfiStrSize (Description)); + EfiCopyMem (Option->Description, Description, EfiStrSize (Description)); + + return Option; +} + +EFI_DEVICE_PATH_PROTOCOL * +BdsCreateShellDevicePath ( + VOID + ) +/*++ + +Routine Description: + + This function will create a SHELL BootOption to boot. + +Arguments: + + None. + +Returns: + + Shell Device path for booting. + +--*/ +{ + UINTN FvHandleCount; + EFI_HANDLE *FvHandleBuffer; + UINTN Index; + EFI_STATUS Status; +#if (PI_SPECIFICATION_VERSION < 0x00010000) + EFI_FIRMWARE_VOLUME_PROTOCOL *Fv; +#else + EFI_FIRMWARE_VOLUME2_PROTOCOL *Fv; +#endif + EFI_FV_FILETYPE Type; + UINTN Size; + EFI_FV_FILE_ATTRIBUTES Attributes; + UINT32 AuthenticationStatus; + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + MEDIA_FW_VOL_FILEPATH_DEVICE_PATH ShellNode; + + DevicePath = NULL; + Status = EFI_SUCCESS; + + gBS->LocateHandleBuffer ( + ByProtocol, + #if (PI_SPECIFICATION_VERSION < 0x00010000) + &gEfiFirmwareVolumeProtocolGuid, + #else + &gEfiFirmwareVolume2ProtocolGuid, + #endif + NULL, + &FvHandleCount, + &FvHandleBuffer + ); + + for (Index = 0; Index < FvHandleCount; Index++) { + gBS->HandleProtocol ( + FvHandleBuffer[Index], + #if (PI_SPECIFICATION_VERSION < 0x00010000) + &gEfiFirmwareVolumeProtocolGuid, + #else + &gEfiFirmwareVolume2ProtocolGuid, + #endif + (VOID **) &Fv + ); + + Status = Fv->ReadFile ( + Fv, + &gEfiShellFileGuid, + NULL, + &Size, + &Type, + &Attributes, + &AuthenticationStatus + ); + if (EFI_ERROR (Status)) { + // + // Skip if no shell file in the FV + // + continue; + } else { + // + // Found the shell + // + break; + } + } + + if (EFI_ERROR (Status)) { + // + // No shell present + // + if (FvHandleCount) { + gBS->FreePool (FvHandleBuffer); + } + + return NULL; + } + // + // Build the shell boot option + // + DevicePath = EfiDevicePathFromHandle (FvHandleBuffer[Index]); + + // + // Build the shell device path + // + ShellNode.Header.Type = MEDIA_DEVICE_PATH; + ShellNode.Header.SubType = MEDIA_FV_FILEPATH_DP; + SetDevicePathNodeLength (&ShellNode.Header, sizeof (MEDIA_FW_VOL_FILEPATH_DEVICE_PATH)); + EfiCopyMem (&ShellNode.NameGuid, &gEfiShellFileGuid, sizeof (EFI_GUID)); + DevicePath = EfiAppendDevicePathNode (DevicePath, (EFI_DEVICE_PATH_PROTOCOL *) &ShellNode); + + if (FvHandleCount) { + gBS->FreePool (FvHandleBuffer); + } + + return DevicePath; +} + +static +EFI_DEVICE_PATH_PROTOCOL * +BdsCreatePxeDevicePath ( + IN UINT16 DeviceIndex + ) +/*++ + +Routine Description: + + This function will create a PXE BootOption to boot. + +Arguments: + + DeviceIndex - PXE handle index + +Returns: + + PXE Device path for booting. + +--*/ +{ + UINTN Index; + EFI_STATUS Status; + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + UINTN NumberLoadFileHandles; + EFI_HANDLE *LoadFileHandles; + VOID *ProtocolInstance; + + DevicePath = NULL; + Status = EFI_SUCCESS; + + // + // We want everything connected up for PXE + // + BdsLibConnectAllDriversToAllControllers (); + + // + // Parse Network Boot Device + // + gBS->LocateHandleBuffer ( + ByProtocol, + &gEfiSimpleNetworkProtocolGuid, + NULL, + &NumberLoadFileHandles, + &LoadFileHandles + ); + for (Index = 0; Index < NumberLoadFileHandles; Index++) { + Status = gBS->HandleProtocol ( + LoadFileHandles[Index], + &gEfiLoadFileProtocolGuid, + (VOID **) &ProtocolInstance + ); + if (EFI_ERROR (Status)) { + // + // try next handle + // + continue; + } else { + if (Index == DeviceIndex) { + // + // Found a PXE handle + // + break; + } else { + Status = EFI_UNSUPPORTED; + } + } + } + + if (EFI_ERROR (Status)) { + // + // No PXE present + // + if (NumberLoadFileHandles) { + gBS->FreePool (LoadFileHandles); + } + + return NULL; + } + // + // Build the PXE device path + // + DevicePath = EfiDevicePathFromHandle (LoadFileHandles[Index]); + + if (NumberLoadFileHandles) { + gBS->FreePool (LoadFileHandles); + } + + return DevicePath; +} + +static +VOID +GetAmtBusDevFcnVal ( + OUT UINT32 *Bus, + OUT UINT32 *Device, + OUT UINT32 *Function + ) +/*++ + +Routine Description: + + This function will get Bus, Device and Function. + +Arguments: + + Bus - AMT Bus + Device - AMT Device + Function - AMT Function + +Returns: + + None. + +--*/ +{ + UINT32 Index; + EFI_PCI_ROOT_BRIDGE_IO_PROTOCOL *PciRootBridgeIo; + UINT64 Address; + DATA32_UNION Data32Union; + EFI_STATUS Status; + + *Bus = 0; + *Device = 0; + *Function = 0; + + // + // Locate root bridge IO protocol + // + Status = gBS->LocateProtocol (&gEfiPciRootBridgeIoProtocolGuid, NULL, &PciRootBridgeIo); + ASSERT_EFI_ERROR (Status); + + // + // Need to fill in IDER bus dev function so find this for Tekoa i82573E here. + // + for (Index = 0; Index < 0x255; Index++) { + Address = EFI_PCI_ADDRESS ( + Index, + ME_DEVICE_NUMBER, // + IDER_FUNCTION_NUMBER, // fun 2 IDER capability + PCI_VENDOR_ID_OFFSET + ); + Status = PciRootBridgeIo->Pci.Read ( + PciRootBridgeIo, + EfiPciWidthUint32, + Address, + 1, + &Data32Union + ); + if ((Data32Union.Data16[0] == V_ME_IDER_VENDOR_ID) && + (Data32Union.Data16[1] == V_ME_IDER_DEVICE_ID)) { + // + // LOM i82573E is always Device 0 and function 2 so or this 8 bit value of 0x02 + // into bus number discovered. Bus # upper byte and Dev-Fcn lower byte. + // + *Bus = Index; + *Device = ME_DEVICE_NUMBER; + *Function = IDER_FUNCTION_NUMBER; + break; + } + } +} + +UINTN +GetFirstIndexByType ( + UINT16 DevType + ) +/*++ + +Routine Description: + + Boot HDD by BIOS Default Priority + +Arguments: + + DevType - Boot device whose device type + +Returns: + + None + +--*/ +{ + EFI_STATUS Status; + UINTN LegacyDevOrderSize; + LEGACY_DEVICE_ORDER *LegacyDevOrder; + UINTN Index; + UINT8 *p; + UINTN o; + + Index = 0; + o = 0; + + LegacyDevOrderSize = 0; + LegacyDevOrder = NULL; + + Status = gRT->GetVariable ( + L"LegacyDevOrder", + &gLegacyDeviceOrderGuid, + NULL, + &LegacyDevOrderSize, + NULL + ); + + if (Status == EFI_BUFFER_TOO_SMALL) { + LegacyDevOrder = EfiLibAllocateZeroPool (LegacyDevOrderSize); + if (LegacyDevOrder != NULL) { + Status = gRT->GetVariable ( + L"LegacyDevOrder", + &gLegacyDeviceOrderGuid, + NULL, + &LegacyDevOrderSize, + LegacyDevOrder + ); + if (!EFI_ERROR (Status)) { + p = (UINT8 *) LegacyDevOrder; + o = 0; + for (o = 0; o < LegacyDevOrderSize; o += sizeof (LegacyDevOrder->Type) + LegacyDevOrder->Length) { + LegacyDevOrder = (LEGACY_DEVICE_ORDER *) (p + o); + if (LegacyDevOrder->Type == DevType) { + Index = LegacyDevOrder->Device[0]; + } + } + } + } + } + + return Index; +} + +static +EFI_STATUS +RefreshBbsTableForBoot ( + IN UINT16 DeviceIndex, + IN UINT16 DevType, + IN UINT16 BbsCount, + IN OUT BBS_TABLE *BbsTable + ) +/*++ + +Routine Description: + + Update the table with our required boot device + +Arguments: + + DeviceIndex - Boot device whose device index + DevType - Boot device whose device type + BbsCount - Number of BBS_TABLE structures + BbsTable - BBS entry + +Returns: + + EFI_STATUS + +--*/ +{ + EFI_STATUS Status; + UINTN Index; + UINT16 BootDeviceIndex; + UINT16 TempIndex; + + Status = EFI_NOT_FOUND; + TempIndex = 1; + + BootDeviceIndex = DeviceIndex; + + // + // Find the first present boot device whose device type + // matches the DevType, we use it to boot first. This is different + // from the other Bbs table refresh since we are looking for the device type + // index instead of the first device to match the device type. + // + // And set other present boot devices' priority to BBS_UNPRIORITIZED_ENTRY + // their priority will be set by LegacyBiosPlatform protocol by default + // + if (DeviceIndex > 0) { + for (Index = 0; Index < BbsCount; Index++) { + if (BbsTable[Index].BootPriority == BBS_IGNORE_ENTRY) { + continue; + } + + BbsTable[Index].BootPriority = BBS_DO_NOT_BOOT_FROM; + + if (BbsTable[Index].DeviceType == DevType) { + if (TempIndex++ == DeviceIndex) { + BbsTable[Index].BootPriority = 0; + Status = EFI_SUCCESS; + continue; + } + } + } + } else { + // + // Boot HDD by BIOS Default Priority + // + Index = GetFirstIndexByType (DevType); + BbsTable[Index].BootPriority = 0; + Status = EFI_SUCCESS; + } + + return Status; +} + +static +EFI_STATUS +RefreshBbsTableForIdeRBoot ( + IN UINT16 DeviceIndex, + IN UINT16 DevType, + IN UINT16 BbsCount, + IN OUT BBS_TABLE *BbsTable + ) +/*++ + +Routine Description: + + Update the table with IdeR boot device + +Arguments: + + DeviceIndex - Boot device whose device index + DevType - Boot device whose device type + BbsCount - Number of BBS_TABLE structures + BbsTable - BBS entry + +Returns: + + EFI_STATUS + +--*/ +{ + EFI_STATUS Status; + UINTN Index; + BOOLEAN IderDeviceFound; + + Status = EFI_NOT_FOUND; + + IderDeviceFound = FALSE; + + // + // Find the first present boot device whose device type + // matches the DevType, we use it to boot first. + // + // And set other present boot devices' priority to BBS_DO_NOT_BOOT_FROM + // their priority will be set by LegacyBiosPlatform protocol by default + // + for (Index = 0; Index < BbsCount; Index++) { + if (BBS_IGNORE_ENTRY == BbsTable[Index].BootPriority) { + continue; + } + + BbsTable[Index].BootPriority = BBS_DO_NOT_BOOT_FROM; + + if ( (BbsTable[Index].Bus == ME_BUS) && + (BbsTable[Index].Device == ME_DEVICE_NUMBER) && + (BbsTable[Index].Function == IDER_FUNCTION_NUMBER) ) { + if (DeviceIndex == 0 && IderDeviceFound != TRUE) { + BbsTable[Index].BootPriority = 0; + IderDeviceFound = TRUE; + Status = EFI_SUCCESS; + } else { + DeviceIndex--; + } + + continue; + } + } + + return Status; +} +static +EFI_DEVICE_PATH_PROTOCOL * +BuildDevicePathFromBootOrder +( + VOID +) +{ + UINT8 BootMediaType = 0; + UINT8 BootMediaSubType = 0; + BOOLEAN IDERBoot = FALSE, IDERFloppy = FALSE; + EFI_DEVICE_PATH_PROTOCOL *DevicePath = NULL; + UINT16 *BootOrder; + EFI_LOAD_OPTION *BootOption; + UINTN BootOrderSize; + UINTN BootOptionSize; + CHAR16 BootVarName[9]; + UINTN i; + EFI_STATUS Status; + EFI_DEVICE_PATH_PROTOCOL *Dp, *DevicePathNode; + EFI_DEVICE_PATH_PROTOCOL *DummyDp; + UINTN BufferSize = 0; + if (ActiveManagementEnableIdeR ()) { + // + // Check if any media exist in Ider device + // + if (BdsCheckIderMedia ()) { + + // IDER Floppy + if(mAsfBootOptions->SpecialCommandParam == 1) + { + IDERFloppy = TRUE; + } + + // IDER CD + if((mAsfBootOptions->SpecialCommandParam == 0x101) || + (mAsfBootOptions->SpecialCommandParam == 0x103)) + { + BootMediaType = MEDIA_DEVICE_PATH; + BootMediaSubType = MEDIA_CDROM_DP; + } + IDERBoot = TRUE; + } + }else + { + switch (mAsfBootOptions->SpecialCommand) { + case FORCE_PXE: + if (mAsfBootOptions->SpecialCommandParam != 0) { + // + // ASF spec says 0 currently only option + // + return NULL; + } + BootMediaType = MESSAGING_DEVICE_PATH; + BootMediaSubType = MSG_MAC_ADDR_DP; + break; + + case FORCE_HARDDRIVE: + case FORCE_SAFEMODE: + BootMediaType = MEDIA_DEVICE_PATH; + BootMediaSubType = MEDIA_HARDDRIVE_DP; + break; + + case FORCE_DIAGNOSTICS: + if (mAsfBootOptions->SpecialCommandParam != 0) { + // + // ASF spec says 0 currently only option + // + return NULL; + } + + DevicePath = BdsCreateShellDevicePath (); + + // + // We want everything connected up for shell + // + BdsLibConnectAllDriversToAllControllers (); + break; + + case FORCE_CDDVD: + BootMediaType = MEDIA_DEVICE_PATH; + BootMediaSubType = MEDIA_CDROM_DP; + break; + + default: + return NULL; + break; + } + }//else IDER check + // Get Device Path from BootXXXX + BootOrder = NULL; + BootOption = NULL; + BootOrderSize = 0; + + Status = gRT->GetVariable( + L"BootOrder", + &gEfiGlobalVariableGuid, + NULL, + &BootOrderSize, + NULL + ); + + if (Status == EFI_BUFFER_TOO_SMALL) + { + BootOrder = EfiLibAllocateZeroPool(BootOrderSize); + if (BootOrder != NULL) + { + Status = gRT->GetVariable( + L"BootOrder", + &gEfiGlobalVariableGuid, + NULL, + &BootOrderSize, + BootOrder + ); + if (!EFI_ERROR(Status)) + { + for (i=0; i<BootOrderSize/sizeof(UINT16); i++) + { + SPrint(BootVarName, sizeof(BootVarName), L"Boot%04x", BootOrder[i] ); + BootOptionSize = 0; + Status = gRT->GetVariable( + BootVarName, + &gEfiGlobalVariableGuid, + NULL, + &BootOptionSize, + NULL + ); + if (Status == EFI_BUFFER_TOO_SMALL) + { + BootOption = EfiLibAllocateZeroPool(BootOptionSize); + if (BootOption != NULL) + { + Status = gRT->GetVariable( + BootVarName, + &gEfiGlobalVariableGuid, + NULL, + &BootOptionSize, + BootOption); + if (!EFI_ERROR(Status)) + { + Dp = (EFI_DEVICE_PATH_PROTOCOL *) ( + // + // skip the header + // + (UINT8 *) (BootOption + 1) + // + // skip the string + // + + (EfiStrLen ((CHAR16 *) (BootOption + 1)) + 1) * sizeof (CHAR16)); + DevicePathNode = Dp; + while (!EfiIsDevicePathEnd (DevicePathNode)) + { + // Skip USB device + /* + if((DevicePathNode->Type == MESSAGING_DEVICE_PATH) && + (DevicePathNode->SubType == MSG_USB_DP)) + break; + */ + + if( IDERBoot && + (DevicePathNode->Type == MESSAGING_DEVICE_PATH) && + (DevicePathNode->SubType == MSG_SATA_DP)) + break; + + // Do something special for IDER Floppy, + // In AMT commander tool, If redirect to Floppy and CD image + // The device path are almost the same + if(IDERFloppy && + (DevicePathNode->Type == MESSAGING_DEVICE_PATH) && + (DevicePathNode->SubType == MSG_ATAPI_DP)) + { + EFI_DEVICE_PATH_PROTOCOL *tDP = + EfiNextDevicePathNode (DevicePathNode); + // IDER CD image has Next Device Path Node, but Floppy doesn't + if(EfiIsDevicePathEnd (tDP)) + { + // Correct Pointer of DP, Fix freepool hang issue + BufferSize = + (UINTN)((UINTN *)BootOptionSize - + ((UINTN *)Dp - + (UINTN *)BootOption))/sizeof(UINT8); + + Status = gBS->AllocatePool( + EfiBootServicesData, BufferSize, &DummyDp ); + + if(!EFI_ERROR(Status)) + { + gBS->CopyMem( + (VOID*)DummyDp, (VOID*)Dp, BufferSize ); + } + else + { + Status = gBS->FreePool(BootOption); + Status = gBS->FreePool(BootOrder); + return NULL; + } + Status = gBS->FreePool(BootOption); + Status = gBS->FreePool(BootOrder); + return DummyDp; + } + break; + } + if((DevicePathNode->Type == BootMediaType) && + (DevicePathNode->SubType == BootMediaSubType)) + { + // Correct Pointer of DP, Fix freepool hang issue + BufferSize = + (UINTN)((UINTN *)BootOptionSize - + ((UINTN *)Dp - + (UINTN *)BootOption))/sizeof(UINT8); + + Status = gBS->AllocatePool( + EfiBootServicesData, BufferSize, &DummyDp ); + + if(!EFI_ERROR(Status)) + { + gBS->CopyMem( + (VOID*)DummyDp, (VOID*)Dp, BufferSize ); + } + else + { + Status = gBS->FreePool(BootOption); + Status = gBS->FreePool(BootOrder); + return NULL; + + } + Status = gBS->FreePool(BootOption); + Status = gBS->FreePool(BootOrder); + return DummyDp; + } + + DevicePathNode = EfiNextDevicePathNode (DevicePathNode); + } + } + gBS->FreePool (BootOption); + } + } + } + } + gBS->FreePool (BootOrder); + } + } + + return DevicePath; +} +static +EFI_DEVICE_PATH_PROTOCOL * +BdsCreateLegacyBootDevicePath ( + IN UINT16 DeviceType, + IN UINT16 DeviceIndex, + IN BOOLEAN IdeRBoot + ) +/*++ + +Routine Description: + + Build the BBS Device Path for this boot selection + +Arguments: + + DeviceType - Boot device whose device type + DeviceIndex - Boot device whose device index + IdeRBoot - If IdeRBoot is TRUE then check Ider device + +Returns: + + EFI_STATUS + +--*/ +{ + EFI_LEGACY_BIOS_PROTOCOL *LegacyBios; + BBS_BBS_DEVICE_PATH BbsDevicePathNode; + BBS_TABLE *BbsTable; + UINT16 HddCount; + UINT16 BbsCount; + HDD_INFO *LocalHddInfo; + UINT16 Index; + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + EFI_STATUS Status; + + HddCount = 0; + BbsCount = 0; + LocalHddInfo = NULL; + + Index = DeviceIndex; + + // + // Make sure the Legacy Boot Protocol is available + // + Status = gBS->LocateProtocol (&gEfiLegacyBiosProtocolGuid, NULL, &LegacyBios); + if (EFI_ERROR (Status)) { + return NULL; + } + // + // Get BBS table instance + // + Status = LegacyBios->GetBbsInfo ( + LegacyBios, + &HddCount, + &LocalHddInfo, + &BbsCount, + &BbsTable + ); + if (EFI_ERROR (Status)) { + return NULL; + } + // + // For debug + // + PrintBbsTable (BbsTable); + + // + // Update the table with our required boot device + // + if (IdeRBoot) { + Status = RefreshBbsTableForIdeRBoot ( + Index, + DeviceType, + BbsCount, + BbsTable + ); + } else { + Status = RefreshBbsTableForBoot ( + Index, + DeviceType, + BbsCount, + BbsTable + ); + } + // + // For debug + // + PrintBbsTable (BbsTable); + + if (EFI_ERROR (Status)) { + // + // Device not found - do normal boot + // + gST->ConOut->OutputString ( + gST->ConOut, + L"Can't Find Boot Device by Boot Option !!\r\n" + ); + while(1); + return NULL; + } + // + // Build the BBS Device Path for this boot selection + // + DevicePath = EfiLibAllocateZeroPool (sizeof (EFI_DEVICE_PATH_PROTOCOL)); + if (DevicePath == NULL) { + return NULL; + } + + BbsDevicePathNode.Header.Type = BBS_DEVICE_PATH; + BbsDevicePathNode.Header.SubType = BBS_BBS_DP; + SetDevicePathNodeLength (&BbsDevicePathNode.Header, sizeof (BBS_BBS_DEVICE_PATH)); + BbsDevicePathNode.DeviceType = DeviceType; + BbsDevicePathNode.StatusFlag = 0; + BbsDevicePathNode.String[0] = 0; + + DevicePath = EfiAppendDevicePathNode ( + EndDevicePath, + (EFI_DEVICE_PATH_PROTOCOL *) &BbsDevicePathNode + ); + if (NULL == DevicePath) { + return NULL; + } + + return DevicePath; +} + +EFI_STATUS +AsfDoLegacyBoot ( + IN BDS_COMMON_OPTION *Option + ) +/*++ + +Routine Description: + + Boot the legacy system with the boot option + +Arguments: + + Option - The legacy boot option which have BBS device path + +Returns: + + EFI_UNSUPPORTED - There is no legacybios protocol, do not support + legacy boot. + + EFI_STATUS - Return the status of LegacyBios->LegacyBoot (). + +--*/ +{ + EFI_STATUS Status; + EFI_LEGACY_BIOS_PROTOCOL *LegacyBios; + + Status = gBS->LocateProtocol (&gEfiLegacyBiosProtocolGuid, NULL, &LegacyBios); + if (EFI_ERROR (Status)) { + // + // If no LegacyBios protocol we do not support legacy boot + // + return EFI_UNSUPPORTED; + } + // + // Write boot to OS performance data to a file + // + WRITE_BOOT_TO_OS_PERFORMANCE_DATA; + + DEBUG ((EFI_D_INFO | EFI_D_LOAD, "Legacy Boot: %S\n", Option->Description)); + return LegacyBios->LegacyBoot ( + LegacyBios, + (BBS_BBS_DEVICE_PATH *) Option->DevicePath, + Option->LoadOptionsSize, + Option->LoadOptions + ); +} + +BOOLEAN CompareDP( + EFI_DEVICE_PATH_PROTOCOL *dp1, + EFI_DEVICE_PATH_PROTOCOL *dp2 + ) +{ + UINTN s1,s2; + BOOLEAN st = FALSE; + + s1 = EfiDevicePathSize(dp1); + + s2 = EfiDevicePathSize(dp2); + + if (s1 == s2) { + if (EfiCompareMem(dp1, dp2, s1) == 0) + st = TRUE; + } + + return st; +} + + +UINT16 GetBootCurrent( + IN EFI_DEVICE_PATH_PROTOCOL *DevicePath +) +{ + UINT16 *BootOrder; + EFI_LOAD_OPTION *BootOption; + UINTN BootOrderSize; //size of BootOrder Variable + UINTN BootOptionSize; + CHAR16 BootVarName[9]; + UINTN i; + EFI_STATUS Status; + BOOLEAN st; + UINT16 BootCurrent; + EFI_DEVICE_PATH_PROTOCOL *Dp; + + BootOrder = NULL; + BootOption = NULL; + BootCurrent = 0; + BootOrderSize = 0; + + Status = gRT->GetVariable( + L"BootOrder", + &gEfiGlobalVariableGuid, + NULL, + &BootOrderSize, + NULL + ); + + if (Status == EFI_BUFFER_TOO_SMALL) { + BootOrder = EfiLibAllocateZeroPool(BootOrderSize); + if (BootOrder != NULL){ + Status = gRT->GetVariable( + L"BootOrder", + &gEfiGlobalVariableGuid, + NULL, + &BootOrderSize, + BootOrder + ); + if (!EFI_ERROR(Status)) { + for (i=0; i<BootOrderSize/sizeof(UINT16); i++){ + SPrint(BootVarName, sizeof(BootVarName), L"Boot%04x", BootOrder[i] ); + BootOptionSize = 0; + Status = gRT->GetVariable( + BootVarName, + &gEfiGlobalVariableGuid, + NULL, + &BootOptionSize, + NULL + ); + if (Status == EFI_BUFFER_TOO_SMALL) { + BootOption = EfiLibAllocateZeroPool(BootOptionSize); + if (BootOption != NULL){ + Status = gRT->GetVariable( + BootVarName, + &gEfiGlobalVariableGuid, + NULL, + &BootOptionSize, + BootOption + ); + if (!EFI_ERROR(Status)) { + Dp = (EFI_DEVICE_PATH_PROTOCOL*) + ( //skip the header + (UINT8*)(BootOption+1) + //skip the string + +(EfiStrLen((CHAR16*)(BootOption+1))+1)*sizeof(CHAR16) + ); + st = CompareDP(Dp, DevicePath); + if (st == TRUE) { + BootCurrent = BootOrder[i]; + } + } + gBS->FreePool(BootOption); + } + } + } + } + gBS->FreePool(BootOrder); + } + } + return BootCurrent; +} + +EFI_STATUS +AsfBootViaBootOption ( + IN BDS_COMMON_OPTION * Option, + IN EFI_DEVICE_PATH_PROTOCOL * DevicePath, + OUT UINTN *ExitDataSize, + OUT CHAR16 **ExitData OPTIONAL + ) +/*++ + +Routine Description: + + Process the boot option follow the EFI 1.1 specification and + special treat the legacy boot option with BBS_DEVICE_PATH. + +Arguments: + + Option - The boot option need to be processed + DevicePath - The device path which describe where to load + the boot image or the legcy BBS device path + to boot the legacy OS + ExitDataSize - Returned directly from gBS->StartImage () + ExitData - Returned directly from gBS->StartImage () + +Returns: + + EFI_SUCCESS - Status from gBS->StartImage (), + or BdsBootByDiskSignatureAndPartition () + EFI_NOT_FOUND - If the Device Path is not found in the system + +--*/ +{ + EFI_STATUS Status; + EFI_HANDLE Handle; + EFI_HANDLE ImageHandle; + EFI_DEVICE_PATH_PROTOCOL *TempDevicePath; + EFI_DEVICE_PATH_PROTOCOL *FilePath; + EFI_LOADED_IMAGE_PROTOCOL *ImageInfo; + EFI_EVENT ReadyToBootEvent; + EFI_ACPI_S3_SAVE_PROTOCOL *AcpiS3Save; + UINT32 VarAttr; + UINTN VarSize; + + *ExitDataSize = 0; + *ExitData = NULL; + + // + // Notes: put EFI64 ROM Shadow Solution + // + EFI64_SHADOW_ALL_LEGACY_ROM (); + + // + // Notes: this code can be remove after the s3 script table + // hook on the event EFI_EVENT_SIGNAL_READY_TO_BOOT or + // EFI_EVENT_SIGNAL_LEGACY_BOOT + // + Status = gBS->LocateProtocol (&gEfiAcpiS3SaveGuid, NULL, &AcpiS3Save); + if (!EFI_ERROR (Status)) { + AcpiS3Save->S3Save (AcpiS3Save, NULL); + } + // + // If it's Device Path that starts with a hard drive path, + // this routine will do the booting. + // + Status = BdsBootByDiskSignatureAndPartition ( + Option, + (HARDDRIVE_DEVICE_PATH *) DevicePath, + Option->LoadOptionsSize, + Option->LoadOptions, + ExitDataSize, + ExitData + ); + if (!EFI_ERROR (Status)) { + // + // If we found a disk signature and partition device path return success + // + return EFI_SUCCESS; + } + // + // Signal the EFI_EVENT_SIGNAL_READY_TO_BOOT event + // + + + Option->BootCurrent = GetBootCurrent(DevicePath); + + // + // Get Variable Attribute + // + VarAttr = 0; + VarSize = 0; + Status = gRT->GetVariable( + L"BootCurrent", + &gEfiGlobalVariableGuid, + &VarAttr, + &VarSize, + NULL ); + if( Status != EFI_BUFFER_TOO_SMALL ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS; + VarSize = sizeof(UINT16); + } + + // + // Set Boot Current + // + gRT->SetVariable( + L"BootCurrent", + &gEfiGlobalVariableGuid, + VarAttr, + VarSize, + &Option->BootCurrent ); + + // + // Abstract: Modified for EFI 2.0 required + // +#if defined(EFI_EVENT_SIGNAL_READY_TO_BOOT) && EFI_SPECIFICATION_VERSION < 0x20000 + Status = gBS->CreateEvent ( + EFI_EVENT_SIGNAL_READY_TO_BOOT | EFI_EVENT_NOTIFY_SIGNAL_ALL, + EFI_TPL_CALLBACK, + NULL, + NULL, + &ReadyToBootEvent + ); +#else + Status = EfiCreateEventReadyToBoot ( + EFI_TPL_CALLBACK, + NULL, + NULL, + &ReadyToBootEvent + ); +#endif + if (!EFI_ERROR (Status)) { + gBS->SignalEvent (ReadyToBootEvent); + gBS->CloseEvent (ReadyToBootEvent); + } + + if ((DevicePathType (Option->DevicePath) == BBS_DEVICE_PATH) && + (DevicePathSubType (Option->DevicePath) == BBS_BBS_DP) + ) { + // + // Check to see if we should legacy BOOT. If yes then do the legacy boot + // + return AsfDoLegacyBoot (Option); + } + + DEBUG ((EFI_D_INFO | EFI_D_LOAD, "Booting EFI 1.1 way %S\n", Option->Description)); + + Status = gBS->LoadImage ( + TRUE, + mBdsImageHandle, + DevicePath, + NULL, + 0, + &ImageHandle + ); + + // + // If we didn't find an image, we may need to load the default + // boot behavior for the device. + // + if (EFI_ERROR (Status)) { + // + // Find a Simple File System protocol on the device path. If the remaining + // device path is set to end then no Files are being specified, so try + // the removable media file name. + // + TempDevicePath = DevicePath; + Status = gBS->LocateDevicePath ( + &gEfiSimpleFileSystemProtocolGuid, + &TempDevicePath, + &Handle + ); + if (!EFI_ERROR (Status) && IsDevicePathEnd (TempDevicePath)) { + FilePath = EfiFileDevicePath (Handle, DEFAULT_REMOVABLE_FILE_NAME); + if (FilePath) { + Status = gBS->LoadImage ( + TRUE, + mBdsImageHandle, + FilePath, + NULL, + 0, + &ImageHandle + ); + if (EFI_ERROR (Status)) { + // System Halt when IDER boot fail !! + if(ActiveManagementEnableIdeR () && ((Status == EFI_SECURITY_VIOLATION) || (Status == EFI_ACCESS_DENIED))) + { + gST->ConOut->OutputString ( + gST->ConOut, + L"IDER Boot Fail, system halt !! \r\n"); + + while(1); + } + // + // The DevicePath failed, and it's not a valid + // removable media device. + // + goto Done; + } + } + } else { + Status = EFI_NOT_FOUND; + } + } + + if (EFI_ERROR (Status)) { + // + // It there is any error from the Boot attempt exit now. + // + goto Done; + } + // + // Provide the image with it's load options + // + Status = gBS->HandleProtocol (ImageHandle, &gEfiLoadedImageProtocolGuid, &ImageInfo); + ASSERT_EFI_ERROR (Status); + + if (Option->LoadOptionsSize != 0) { + ImageInfo->LoadOptionsSize = Option->LoadOptionsSize; + ImageInfo->LoadOptions = Option->LoadOptions; + } + // + // Before calling the image, enable the Watchdog Timer for + // the 5 Minute period + // + gBS->SetWatchdogTimer (5 * 60, 0x0000, 0x00, NULL); + + Status = gBS->StartImage (ImageHandle, ExitDataSize, ExitData); + DEBUG ((EFI_D_INFO | EFI_D_LOAD, "Image Return Status = %r\n", Status)); + // System Halt when IDER boot fail !! + if(ActiveManagementEnableIdeR ()) + { + gST->ConOut->OutputString ( + gST->ConOut, + L"IDER Boot Fail, system halt !! \r\n"); + + while(1); + } + + // + // Clear the Watchdog Timer after the image returns + // + gBS->SetWatchdogTimer (0x0000, 0x0000, 0x0000, NULL); + +Done: + // + // Clear Boot Current + // + gRT->SetVariable( + L"BootCurrent", + &gEfiGlobalVariableGuid, + VarAttr, + 0, + &Option->BootCurrent ); + + return Status; +} + +EFI_STATUS +BdsAsfBoot ( + OUT EFI_DEVICE_PATH_PROTOCOL **DevicePath + ) +/*++ + +Routine Description: + + Found out ASF boot options. + +Arguments: + + DevicePath - The device path which describe where to load + the boot image or the legcy BBS device path + to boot the legacy OS + +Returns: + + EFI_STATUS + +--*/ +{ + BOOLEAN EfiBoot; + + EfiBoot = FALSE; + + // + // First we check ASF boot options Special Command + // + switch (mAsfBootOptions->SpecialCommand) { + // + // No additional special command is included; the Special Command Parameter has no + // meaning. + // + case NOP: + break; + + // + // The Special Command Parameter can be used to specify a PXE + // parameter. When the parameter value is 0, the system default PXE device is booted. All + // other values for the PXE parameter are reserved for future definition by this specification. + // + case FORCE_PXE: + if (mAsfBootOptions->SpecialCommandParam != 0) { + // + // ASF spec says 0 currently only option + // + return EFI_UNSUPPORTED; + } + + if (EfiBoot == TRUE) { + *DevicePath = BdsCreatePxeDevicePath (mAsfBootOptions->SpecialCommandParam); + } else { + *DevicePath = BdsCreateLegacyBootDevicePath (BBS_EMBED_NETWORK, mAsfBootOptions->SpecialCommandParam, FALSE); + } + break; + + // + // The Special Command Parameter identifies the boot-media index for + // the managed client. When the parameter value is 0, the default hard-drive is booted, when the + // parameter value is 1, the primary hard-drive is booted; when the value is 2, the secondary + // hard-drive is booted ¡V and so on. + // + case FORCE_HARDDRIVE: + // + // The Special Command Parameter identifies the boot-media + // index for the managed client. When the parameter value is 0, the default hard-drive is + // booted, when the parameter value is 1, the primary hard-drive is booted; when the value is 2, + // the secondary hard-drive is booted ¡V and so on. + // + case FORCE_SAFEMODE: + *DevicePath = BdsCreateLegacyBootDevicePath (BBS_TYPE_HARDDRIVE, mAsfBootOptions->SpecialCommandParam, FALSE); + break; + + // + // The Special Command Parameter can be used to specify a + // diagnostic parameter. When the parameter value is 0, the default diagnostic media is booted. + // All other values for the diagnostic parameter are reserved for future definition by this + // specification. + // + case FORCE_DIAGNOSTICS: + if (mAsfBootOptions->SpecialCommandParam != 0) { + // + // ASF spec says 0 currently only option + // + return EFI_UNSUPPORTED; + } + + *DevicePath = BdsCreateShellDevicePath (); + + // + // We want everything connected up for shell + // + BdsLibConnectAllDriversToAllControllers (); + break; + + // + // The Special Command Parameter identifies the boot-media index for + // the managed client. When the parameter value is 0, the default CD/DVD is booted, when the + // parameter value is 1, the primary CD/DVD is booted; when the value is 2, the secondary + // CD/DVD is booted ¡V and so on. + // + case FORCE_CDDVD: + *DevicePath = BdsCreateLegacyBootDevicePath (BBS_TYPE_CDROM, mAsfBootOptions->SpecialCommandParam, FALSE); + break; + + default: + return EFI_UNSUPPORTED; + break; + } + + return EFI_SUCCESS; +} + +EFI_STATUS +BdsAmtBoot ( + OUT EFI_DEVICE_PATH_PROTOCOL **DevicePath + ) +/*++ + +Routine Description: + + Check IdeR boot device and Asf boot device + +Arguments: + + DevicePath - The device path which describe where to load + the boot image or the legcy BBS device path + to boot the legacy OS + +Returns: + + EFI_STATUS + +--*/ +{ + EFI_STATUS Status; + + // + // OEM command values; the interpretation of the Special Command and associated Special + // Command Parameters is defined by the entity associated with the Enterprise ID. + // + if (ActiveManagementEnableIdeR ()) { + // + // Check if any media exist in Ider device + // + if (BdsCheckIderMedia ()) { + *DevicePath = BdsCreateLegacyBootDevicePath ( + BBS_TYPE_CDROM, + (mAsfBootOptions->SpecialCommandParam & IDER_BOOT_DEVICE_MASK) >> IDER_BOOT_DEVICE_SHIFT, + TRUE + ); + } + + Status = EFI_SUCCESS; + } else { + Status = BdsAsfBoot (DevicePath); + } + + return Status; +} + +EFI_STATUS +BdsBootViaAsf ( + IN VOID + ) +/*++ + +Routine Description: + + Process ASF boot options and if available, attempt the boot + +Arguments: + + None. + +Returns: + + EFI_SUCCESS - The command completed successfully + Other - Error!! + +--*/ +{ + EFI_STATUS Status; + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + BDS_COMMON_OPTION *BootOption; + UINTN ExitDataSize; + CHAR16 *ExitData; + + Status = EFI_SUCCESS; + DevicePath = NULL; + + // + // Check if ASF Boot Options is present. + // + if (mAsfBootOptions->SubCommand != ASF_BOOT_OPTIONS_PRESENT) { + return EFI_NOT_FOUND; + } + + DevicePath = BuildDevicePathFromBootOrder(); + + if(DevicePath != NULL) + { + + BootOption = BdsCreateBootOption (DevicePath, L"ASF Boot"); + if (BootOption != NULL) { + Status = AsfBootViaBootOption (BootOption, BootOption->DevicePath, &ExitDataSize, &ExitData); + if (EFI_ERROR (Status)) { + gBS->FreePool (BootOption); + } + + gBS->FreePool (DevicePath); + } + } + // UEFI BOOT fail, try Legacy Boot + switch (mAsfBootOptions->IanaId) + { + case ASF_INTEL_CONVERTED_IANA: + Status = BdsAmtBoot (&DevicePath); + break; + + case ASF_INDUSTRY_CONVERTED_IANA: + Status = BdsAsfBoot (&DevicePath); + break; + } + // + // If device path was set, the we have a boot option to use + // + if (DevicePath == NULL) { + return EFI_UNSUPPORTED; + } + + BootOption = BdsCreateBootOption (DevicePath, L"ASF Boot"); + if (BootOption == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + Status = AsfBootViaBootOption (BootOption, BootOption->DevicePath, &ExitDataSize, &ExitData); + if (EFI_ERROR (Status)) { + gBS->FreePool (BootOption); + } + + gBS->FreePool (DevicePath); + + return Status; +} + +BOOLEAN +BdsCheckIderMedia ( + IN VOID + ) +/*++ + +Routine Description: + This will return if Media in IDE-R is present. + +Arguments: + None. + +Returns: + True Media is present. + False Media is not present. + +--*/ +{ + UINTN HandleNum; + EFI_HANDLE *HandleBuf; + EFI_HANDLE Handle; + EFI_STATUS Status; + EFI_DEVICE_PATH_PROTOCOL *DPath; + UINTN Index; + UINTN EventIndex; + EFI_INPUT_KEY Key; + EFI_BLOCK_IO_PROTOCOL *BlkIo; + EFI_DISK_INFO_PROTOCOL *DiskInfo; + EFI_BLOCK_IO_MEDIA *BlkMedia; + VOID *Buffer; + UINT8 IdeBootDevice; + UINT32 IdeChannel; + UINT32 IdeDevice; + + IdeBootDevice = ActiveManagementIderBootDeviceGet (); + + DEBUG ((EFI_D_INFO | EFI_D_LOAD, "Ide Channel Device Index = %d\n", IdeBootDevice)); + + // + // Make sure the Legacy Boot Protocol is available + // + Status = gBS->LocateHandleBuffer ( + ByProtocol, + &gEfiBlockIoProtocolGuid, + NULL, + &HandleNum, + &HandleBuf + ); + if (EFI_ERROR (Status)) { + return FALSE; + } + + for (Index = 0; Index < HandleNum; Index++) { + Status = gBS->HandleProtocol ( + HandleBuf[Index], + &gEfiDevicePathProtocolGuid, + &DPath + ); + if (!EFI_ERROR (Status)) { + Status = gBS->LocateDevicePath ( + &gEfiIderControllerDriverProtocolGuid, + &DPath, + &Handle + ); + if (!EFI_ERROR (Status)) { + Status = gBS->HandleProtocol ( + HandleBuf[Index], + &gEfiBlockIoProtocolGuid, + &BlkIo + ); + + Status = gBS->HandleProtocol ( + HandleBuf[Index], + &gEfiDiskInfoProtocolGuid, + &DiskInfo + ); + + DiskInfo->WhichIde (DiskInfo, &IdeChannel, &IdeDevice); + + if (IdeBootDevice != (UINT8) (IdeChannel * 2 + IdeDevice)) { + continue; + } + + if (BlkIo->Media->MediaPresent) { + if (HandleBuf != NULL) { + gBS->FreePool (HandleBuf); + } + return TRUE; + } else { + while (TRUE) { + BlkMedia = BlkIo->Media; + Buffer = EfiLibAllocatePool (BlkMedia->BlockSize); + if (Buffer) { + BlkIo->ReadBlocks ( + BlkIo, + BlkMedia->MediaId, + 0, + BlkMedia->BlockSize, + Buffer + ); + gBS->FreePool (Buffer); + } + + if (BlkMedia->MediaPresent) { + if (HandleBuf != NULL) { + gBS->FreePool (HandleBuf); + } + return TRUE; + } + + gST->ConOut->OutputString ( + gST->ConOut, + L"Boot disk missing, please insert boot disk and press ENTER\r\n" + ); + Key.ScanCode = 0; + Key.UnicodeChar = 0; + gBS->RestoreTPL (EFI_TPL_APPLICATION); + while (!(Key.ScanCode == 0 && Key.UnicodeChar == L'\r')) { + Status = gBS->WaitForEvent (1, &(gST->ConIn->WaitForKey), &EventIndex); + gST->ConIn->ReadKeyStroke (gST->ConIn, &Key); + } + + gBS->RaiseTPL (EFI_TPL_DRIVER); + } + + if (HandleBuf != NULL) { + gBS->FreePool (HandleBuf); + } + return FALSE; + } + } + } + } + + if (HandleBuf != NULL) { + gBS->FreePool (HandleBuf); + } + return FALSE; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/AsfSupport.h b/Board/EM/MeWrapper/AmtWrapper/Dxe/AsfSupport.h new file mode 100644 index 0000000..050724f --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/AsfSupport.h @@ -0,0 +1,270 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AsfSupport.h 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/AsfSupport.h $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AsfSupport.h +// +// Description: ASF BDS Support include file +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + This file contains an 'Intel Peripheral Driver' and is + licensed for Intel CPUs and chipsets under the terms of your + license agreement with Intel or your vendor. This file may + be modified by the user, subject to additional terms of the + license agreement +--*/ + +/*++ + +Copyright (c) 2005-2008 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + + +Module Name: + + AsfSupport.h + +Abstract: + + ASF BDS Support include file + +--*/ + +#ifndef _ASF_SUPPORT_H_ +#define _ASF_SUPPORT_H_ + +#include "Tiano.h" +#include "EfiDriverLib.h" +#include "BdsLib.h" +#include "Pci22.h" +#include "Amt.h" +#include "AmtLib.h" +#include "MeAccess.h" + +#include EFI_PROTOCOL_DEFINITION (LegacyBios) +#include EFI_PROTOCOL_DEFINITION (SimpleNetwork) +#include EFI_PROTOCOL_DEFINITION (FirmwareVolume) +#include EFI_PROTOCOL_DEFINITION (PciRootBridgeIo) +#include EFI_PROTOCOL_DEFINITION (FormBrowser) + +#include EFI_PROTOCOL_CONSUMER (AlertStandardformat) +#include EFI_PROTOCOL_CONSUMER (DiskInfo) + +#include EFI_PROTOCOL_DEFINITION (IderControllerDriver) + +typedef union { + UINT32 Data32; + UINT16 Data16[2]; +} DATA32_UNION; + +EFI_STATUS +BdsAsfInitialization ( + IN VOID + ) +/*++ + +Routine Description: + + Retrieve the ASF boot options previously recorded by the ASF driver. + +Arguments: + + None. + +Returns: + + Initialize Boot Options global variable and AMT protocol + +--*/ +; + +EFI_STATUS +BdsBootViaAsf ( + IN VOID + ) +/*++ + +Routine Description: + + Process ASF boot options and if available, attempt the boot + +Arguments: + + None. + +Returns: + + EFI_SUCCESS - The command completed successfully + Other - Error!! + +--*/ +; + +VOID +PrintBbsTable ( + IN BBS_TABLE *LocalBbsTable + ) +/*++ + +Routine Description: + + Dump all devices of BBS. + +Arguments: + + LocalBbsTable - BBS table entry. + +Returns: + + None. + +--*/ +; + +EFI_STATUS +BdsLibDoLegacyBoot ( + IN BDS_COMMON_OPTION *Option + ) +/*++ + +Routine Description: + + Boot the legacy system with the boot option + +Arguments: + + Option - The legacy boot option which have BBS device path + +Returns: + + EFI_UNSUPPORTED - There is no legacybios protocol, do not support + legacy boot. + + EFI_STATUS - Return the status of LegacyBios->LegacyBoot (). + +--*/ +; + +BOOLEAN +BdsCheckIderMedia ( + IN VOID + ) +/*++ + +Routine Description: + This will return if Media in IDE-R is present. + +Arguments: + None. + +Returns: + True Media is present. + False Media is not present. + +--*/ +; + +EFI_DEVICE_PATH_PROTOCOL * +BdsCreateShellDevicePath ( + IN VOID + ) +/*++ + +Routine Description: + + This function will create a SHELL BootOption to boot. + +Arguments: + + None. + +Returns: + + Shell Device path for booting. + +--*/ +; + +BDS_COMMON_OPTION * +BdsCreateBootOption ( + IN EFI_DEVICE_PATH_PROTOCOL *DevicePath, + IN CHAR16 *Description + ) +/*++ + +Routine Description: + + This function will create a BootOption from the give device path and + description string. + +Arguments: + + DevicePath - The device path which the option represent + Description - The description of the boot option + +Returns: + + BDS_COMMON_OPTION - A BDS_COMMON_OPTION pointer + +--*/ +; + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsBoot.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsBoot.c new file mode 100644 index 0000000..15a57b1 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsBoot.c @@ -0,0 +1,809 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsBoot.c 2 5/14/14 9:52p Tristinchou $ +// +// $Revision: 2 $ +// +// $Date: 5/14/14 9:52p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsBoot.c $ +// +// 2 5/14/14 9:52p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: BdsBoot.c +// +// Description: Create or Process Boot option by AMT. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + BdsBoot.c + +Abstract: + + BDS Lib functions which relate with create or process the boot + option. + +--*/ + +#include "BdsLib.h" + +BOOLEAN mEnumBootDevice = FALSE; + +EFI_STATUS +BdsLibDoLegacyBoot ( + IN BDS_COMMON_OPTION *Option + ) +/*++ + +Routine Description: + + Boot the legacy system with the boot option + +Arguments: + + Option - The legacy boot option which have BBS device path + +Returns: + + EFI_UNSUPPORTED - There is no legacybios protocol, do not support + legacy boot. + + EFI_STATUS - Return the status of LegacyBios->LegacyBoot (). + +--*/ +{ + EFI_STATUS Status; + EFI_LEGACY_BIOS_PROTOCOL *LegacyBios; + + Status = gBS->LocateProtocol (&gEfiLegacyBiosProtocolGuid, NULL, &LegacyBios); + if (EFI_ERROR (Status)) { + // + // If no LegacyBios protocol we do not support legacy boot + // + return EFI_UNSUPPORTED; + } + // + // Notes: if we seperate the int 19, then we don't need to refresh BBS + // + BdsRefreshBbsTableForBoot (Option); + + // + // Write boot to OS performance data to a file + // + WRITE_BOOT_TO_OS_PERFORMANCE_DATA; + + DEBUG ((EFI_D_INFO | EFI_D_LOAD, "Legacy Boot: %S\n", Option->Description)); + return LegacyBios->LegacyBoot ( + LegacyBios, + (BBS_BBS_DEVICE_PATH *) Option->DevicePath, + Option->LoadOptionsSize, + Option->LoadOptions + ); +} + +EFI_STATUS +BdsLibBootViaBootOption ( + IN BDS_COMMON_OPTION * Option, + IN EFI_DEVICE_PATH_PROTOCOL * DevicePath, + OUT UINTN *ExitDataSize, + OUT CHAR16 **ExitData OPTIONAL + ) +/*++ + +Routine Description: + + Process the boot option follow the EFI 1.1 specification and + special treat the legacy boot option with BBS_DEVICE_PATH. + +Arguments: + + Option - The boot option need to be processed + + DevicePath - The device path which describe where to load + the boot image or the legcy BBS device path + to boot the legacy OS + + ExitDataSize - Returned directly from gBS->StartImage () + + ExitData - Returned directly from gBS->StartImage () + +Returns: + + EFI_SUCCESS - Status from gBS->StartImage (), + or BdsBootByDiskSignatureAndPartition () + + EFI_NOT_FOUND - If the Device Path is not found in the system + +--*/ +{ + EFI_STATUS Status; + EFI_HANDLE Handle; + EFI_HANDLE ImageHandle; + EFI_DEVICE_PATH_PROTOCOL *TempDevicePath; + EFI_DEVICE_PATH_PROTOCOL *FilePath; + EFI_LOADED_IMAGE_PROTOCOL *ImageInfo; + EFI_EVENT ReadyToBootEvent; + EFI_ACPI_S3_SAVE_PROTOCOL *AcpiS3Save; + EFI_LIST_ENTRY TempBootLists; + UINT32 VarAttr; + UINTN VarSize; +//;;## EFI_TCG_PLATFORM_PROTOCOL *TcgPlatformProtocol; + + *ExitDataSize = 0; + *ExitData = NULL; + + // + // Notes: put EFI64 ROM Shadow Solution + // + EFI64_SHADOW_ALL_LEGACY_ROM (); + + // + // Notes: this code can be remove after the s3 script table + // hook on the event EFI_EVENT_SIGNAL_READY_TO_BOOT or + // EFI_EVENT_SIGNAL_LEGACY_BOOT + // + Status = gBS->LocateProtocol (&gEfiAcpiS3SaveGuid, NULL, &AcpiS3Save); + if (!EFI_ERROR (Status)) { + AcpiS3Save->S3Save (AcpiS3Save, NULL); + } + // + // If it's Device Path that starts with a hard drive path, + // this routine will do the booting. + // + Status = BdsBootByDiskSignatureAndPartition ( + Option, + (HARDDRIVE_DEVICE_PATH *) DevicePath, + Option->LoadOptionsSize, + Option->LoadOptions, + ExitDataSize, + ExitData + ); + if (!EFI_ERROR (Status)) { + // + // If we found a disk signature and partition device path return success + // + return EFI_SUCCESS; + } + // + // Signal the EFI_EVENT_SIGNAL_READY_TO_BOOT event + // + +// AMI Override: Replace +// Abstract: Modified for EFI 2.0 required +#if defined(EFI_EVENT_SIGNAL_READY_TO_BOOT) && EFI_SPECIFICATION_VERSION<0x20000 + Status = gBS->CreateEvent( + EFI_EVENT_SIGNAL_READY_TO_BOOT | EFI_EVENT_NOTIFY_SIGNAL_ALL, + EFI_TPL_CALLBACK, + NULL, + NULL, + &ReadyToBootEvent + ); +#else + Status = EfiCreateEventReadyToBoot( + EFI_TPL_CALLBACK, + NULL, + NULL, + &ReadyToBootEvent + ); +#endif +// AMI Override End + if (!EFI_ERROR (Status)) { + gBS->SignalEvent (ReadyToBootEvent); + gBS->CloseEvent (ReadyToBootEvent); + } + // + // Set Boot Current + // + VarAttr = 0; + VarSize = 0; + + Status = gRT->GetVariable( + L"BootCurrent", + &gEfiGlobalVariableGuid, + &VarAttr, + &VarSize, + NULL ); + if( EFI_ERROR(Status) && (Status != EFI_BUFFER_TOO_SMALL) ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS; + VarSize = sizeof(UINT16); + } + + gRT->SetVariable( + L"BootCurrent", + &gEfiGlobalVariableGuid, + VarAttr, + VarSize, + &Option->BootCurrent ); + + if ((DevicePathType (Option->DevicePath) == BBS_DEVICE_PATH) && + (DevicePathSubType (Option->DevicePath) == BBS_BBS_DP) + ) { + // + // Check to see if we should legacy BOOT. If yes then do the legacy boot + // + return BdsLibDoLegacyBoot (Option); + } + + // + // If the boot option point to Internal FV shell, make sure it is valid + // + Status = BdsLibUpdateFvFileDevicePath (&DevicePath, &gEfiShellFileGuid); + if (!EFI_ERROR(Status)) { + if (Option->DevicePath != NULL) { + gBS->FreePool(Option->DevicePath); + } + Option->DevicePath = EfiLibAllocateZeroPool (EfiDevicePathSize (DevicePath)); + EfiCopyMem (Option->DevicePath, DevicePath, EfiDevicePathSize (DevicePath)); + // + // Update the shell boot option + // + InitializeListHead (&TempBootLists); + BdsLibRegisterNewOption (&TempBootLists, DevicePath, L"EFI Internal Shell", L"BootOrder"); + // + // free the temporary device path created by BdsLibUpdateFvFileDevicePath() + // + gBS->FreePool (DevicePath); + DevicePath = Option->DevicePath; + } +/* //;;## + // + // Measure GPT Table + // + Status = gBS->LocateProtocol ( + &gEfiTcgPlatformProtocolGuid, + NULL, + &TcgPlatformProtocol + ); + if (!EFI_ERROR (Status)) { + Status = TcgPlatformProtocol->MeasureGptTable (DevicePath); + } +*/ //;;## + + // + // Drop the TPL level from EFI_TPL_DRIVER to EFI_TPL_APPLICATION + // + gBS->RestoreTPL (EFI_TPL_APPLICATION); + + DEBUG ((EFI_D_INFO | EFI_D_LOAD, "Booting EFI 1.1 way %S\n", Option->Description)); + + Status = gBS->LoadImage ( + TRUE, + mBdsImageHandle, + DevicePath, + NULL, + 0, + &ImageHandle + ); + + // + // If we didn't find an image, we may need to load the default + // boot behavior for the device. + // + if (EFI_ERROR (Status)) { + // + // Find a Simple File System protocol on the device path. If the remaining + // device path is set to end then no Files are being specified, so try + // the removable media file name. + // + TempDevicePath = DevicePath; + Status = gBS->LocateDevicePath ( + &gEfiSimpleFileSystemProtocolGuid, + &TempDevicePath, + &Handle + ); + if (!EFI_ERROR (Status) && IsDevicePathEnd (TempDevicePath)) { + FilePath = EfiFileDevicePath (Handle, DEFAULT_REMOVABLE_FILE_NAME); + if (FilePath) { + Status = gBS->LoadImage ( + TRUE, + mBdsImageHandle, + FilePath, + NULL, + 0, + &ImageHandle + ); + if (EFI_ERROR (Status)) { + // + // The DevicePath failed, and it's not a valid + // removable media device. + // + goto Done; + } + } + } else { + Status = EFI_NOT_FOUND; + } + } + + if (EFI_ERROR (Status)) { + // + // It there is any error from the Boot attempt exit now. + // + goto Done; + } + // + // Provide the image with it's load options + // + Status = gBS->HandleProtocol (ImageHandle, &gEfiLoadedImageProtocolGuid, &ImageInfo); + ASSERT_EFI_ERROR (Status); + + if (Option->LoadOptionsSize != 0) { + ImageInfo->LoadOptionsSize = Option->LoadOptionsSize; + ImageInfo->LoadOptions = Option->LoadOptions; + } + // + // Before calling the image, enable the Watchdog Timer for + // the 5 Minute period + // + gBS->SetWatchdogTimer (5 * 60, 0x0000, 0x00, NULL); + + Status = gBS->StartImage (ImageHandle, ExitDataSize, ExitData); + DEBUG ((EFI_D_INFO | EFI_D_LOAD, "Image Return Status = %r\n", Status)); + + // + // Clear the Watchdog Timer after the image returns + // + gBS->SetWatchdogTimer (0x0000, 0x0000, 0x0000, NULL); + +Done: + // + // Clear Boot Current + // + gRT->SetVariable( + L"BootCurrent", + &gEfiGlobalVariableGuid, + VarAttr, + 0, + &Option->BootCurrent ); + + // + // Raise the TPL level back to EFI_TPL_DRIVER + // + gBS->RaiseTPL (EFI_TPL_DRIVER); + + return Status; +} + +EFI_STATUS +BdsBootByDiskSignatureAndPartition ( + IN BDS_COMMON_OPTION * Option, + IN HARDDRIVE_DEVICE_PATH * HardDriveDevicePath, + IN UINT32 LoadOptionsSize, + IN VOID *LoadOptions, + OUT UINTN *ExitDataSize, + OUT CHAR16 **ExitData OPTIONAL + ) +/*++ + +Routine Description: + + Check to see if a hard ware device path was passed in. If it was then search + all the block IO devices for the passed in hard drive device path. + +Arguments: + + Option - The current processing boot option. + + HardDriveDevicePath - EFI Device Path to boot, if it starts with a hard + drive device path. + + LoadOptionsSize - Passed into gBS->StartImage () + via the loaded image protocol. + + LoadOptions - Passed into gBS->StartImage () + via the loaded image protocol. + + ExitDataSize - returned directly from gBS->StartImage () + + ExitData - returned directly from gBS->StartImage () + +Returns: + + EFI_SUCCESS - Status from gBS->StartImage (), + or BootByDiskSignatureAndPartition () + + EFI_NOT_FOUND - If the Device Path is not found in the system + +--*/ +{ + EFI_STATUS Status; + UINTN BlockIoHandleCount; + EFI_HANDLE *BlockIoBuffer; + EFI_DEVICE_PATH_PROTOCOL *BlockIoDevicePath; + EFI_DEVICE_PATH_PROTOCOL *BlockIoHdDevicePath; + HARDDRIVE_DEVICE_PATH *TmpHdPath; + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + EFI_DEVICE_PATH_PROTOCOL *NewDevicePath; + UINTN Index; + BOOLEAN DevicePathMatch; + HARDDRIVE_DEVICE_PATH *TempPath; + + *ExitDataSize = 0; + *ExitData = NULL; + + if ( !((DevicePathType (&HardDriveDevicePath->Header) == MEDIA_DEVICE_PATH) && + (DevicePathSubType (&HardDriveDevicePath->Header) == MEDIA_HARDDRIVE_DP)) + ) { + // + // If the HardDriveDevicePath does not start with a Hard Drive Device Path + // exit. + // + return EFI_NOT_FOUND; + } + // + // The boot device have already been connected + // + Status = gBS->LocateHandleBuffer (ByProtocol, &gEfiBlockIoProtocolGuid, NULL, &BlockIoHandleCount, &BlockIoBuffer); + if (EFI_ERROR (Status) || BlockIoHandleCount == 0) { + // + // If there was an error or there are no device handles that support + // the BLOCK_IO Protocol, then return. + // + return EFI_NOT_FOUND; + } + // + // Loop through all the device handles that support the BLOCK_IO Protocol + // + for (Index = 0; Index < BlockIoHandleCount; Index++) { + + Status = gBS->HandleProtocol (BlockIoBuffer[Index], &gEfiDevicePathProtocolGuid, (VOID *) &BlockIoDevicePath); + if (EFI_ERROR (Status) || BlockIoDevicePath == NULL) { + continue; + } + // + // Make PreviousDevicePath == the device path node before the end node + // + DevicePath = BlockIoDevicePath; + BlockIoHdDevicePath = NULL; + + // + // find HardDriver device path node + // + while (!IsDevicePathEnd (DevicePath)) { + if ((DevicePathType (DevicePath) == MEDIA_DEVICE_PATH) && + (DevicePathSubType (DevicePath) == MEDIA_HARDDRIVE_DP) + ) { + BlockIoHdDevicePath = DevicePath; + break; + } + + DevicePath = NextDevicePathNode (DevicePath); + } + + if (BlockIoHdDevicePath == NULL) { + continue; + } + // + // See if the harddrive device path in blockio matches the orig Hard Drive Node + // + DevicePathMatch = FALSE; + + TmpHdPath = (HARDDRIVE_DEVICE_PATH *) BlockIoHdDevicePath; + TempPath = (HARDDRIVE_DEVICE_PATH *) BdsLibUnpackDevicePath ((EFI_DEVICE_PATH_PROTOCOL *) HardDriveDevicePath); + + // + // Only several fields will be checked. NOT whole NODE + // + if ( TmpHdPath->PartitionNumber == TempPath->PartitionNumber && + TmpHdPath->MBRType == TempPath->MBRType && + TmpHdPath->SignatureType == TempPath->SignatureType && + EfiCompareGuid ((EFI_GUID *) TmpHdPath->Signature, (EFI_GUID *) TempPath->Signature)) { + // + // Get the matched device path + // + DevicePathMatch = TRUE; + } + // + // Only do the boot, when devicepath match + // + if (DevicePathMatch) { + // + // Combine the Block IO and Hard Drive Device path together and try + // to boot from it. + // + DevicePath = NextDevicePathNode ((EFI_DEVICE_PATH_PROTOCOL *) HardDriveDevicePath); + NewDevicePath = EfiAppendDevicePath (BlockIoDevicePath, DevicePath); + + // + // Recursive boot with new device path + // + Status = BdsLibBootViaBootOption (Option, NewDevicePath, ExitDataSize, ExitData); + if (!EFI_ERROR (Status)) { + break; + } + } + } + + gBS->FreePool (BlockIoBuffer); + return Status; +} + + +EFI_STATUS +EFIAPI +BdsLibUpdateFvFileDevicePath ( + IN OUT EFI_DEVICE_PATH_PROTOCOL ** DevicePath, + IN EFI_GUID *FileGuid + ) +/*++ + +Routine Description: + According to a file guild, check a Fv file device path is valid. If it is invalid, + try to return the valid device path. + FV address maybe changes for memory layout adjust from time to time, use this funciton + could promise the Fv file device path is right. + +Arguments: + DevicePath - on input, the Fv file device path need to check + on output, the updated valid Fv file device path + + FileGuid - the Fv file guild + +Returns: + EFI_INVALID_PARAMETER - the input DevicePath or FileGuid is invalid parameter + EFI_UNSUPPORTED - the input DevicePath does not contain Fv file guild at all + EFI_ALREADY_STARTED - the input DevicePath has pointed to Fv file, it is valid + EFI_SUCCESS - has successfully updated the invalid DevicePath, and return the updated + device path in DevicePath + +--*/ +{ + EFI_DEVICE_PATH_PROTOCOL *TempDevicePath; + EFI_DEVICE_PATH_PROTOCOL *LastDeviceNode; + EFI_STATUS Status; + EFI_GUID *GuidPoint; + UINTN Index; + UINTN FvHandleCount; + EFI_HANDLE *FvHandleBuffer; + EFI_FV_FILETYPE Type; + UINTN Size; + EFI_FV_FILE_ATTRIBUTES Attributes; + UINT32 AuthenticationStatus; + BOOLEAN FindFvFile; + EFI_LOADED_IMAGE_PROTOCOL *LoadedImage; +#if (PI_SPECIFICATION_VERSION < 0x00010000) + EFI_FIRMWARE_VOLUME_PROTOCOL *Fv; +#else + EFI_FIRMWARE_VOLUME2_PROTOCOL *Fv; +#endif + MEDIA_FW_VOL_FILEPATH_DEVICE_PATH FvFileNode; + EFI_HANDLE FoundFvHandle; + EFI_DEVICE_PATH_PROTOCOL *NewDevicePath; + + if ((DevicePath == NULL) || (*DevicePath == NULL)) { + return EFI_INVALID_PARAMETER; + } + if (FileGuid == NULL) { + return EFI_INVALID_PARAMETER; + } + // + // Check whether the device path point to the default the input Fv file + // + TempDevicePath = *DevicePath; + LastDeviceNode = TempDevicePath; + while (!EfiIsDevicePathEnd (TempDevicePath)) { + LastDeviceNode = TempDevicePath; + TempDevicePath = EfiNextDevicePathNode (TempDevicePath); + } + GuidPoint = EfiGetNameGuidFromFwVolDevicePathNode ( + (MEDIA_FW_VOL_FILEPATH_DEVICE_PATH *) LastDeviceNode + ); + if (GuidPoint == NULL) { + // + // if this option does not points to a Fv file, just return EFI_UNSUPPORTED + // + return EFI_UNSUPPORTED; + } + if (!EfiCompareGuid (GuidPoint, FileGuid)) { + // + // If the Fv file is not the input file guid, just return EFI_UNSUPPORTED + // + return EFI_UNSUPPORTED; + } + + // + // Check whether the input Fv file device path is valid + // + TempDevicePath = *DevicePath; + FoundFvHandle = NULL; + Status = gBS->LocateDevicePath ( + #if (PI_SPECIFICATION_VERSION < 0x00010000) + &gEfiFirmwareVolumeProtocolGuid, + #else + &gEfiFirmwareVolume2ProtocolGuid, + #endif + &TempDevicePath, + &FoundFvHandle + ); + if (!EFI_ERROR (Status)) { + Status = gBS->HandleProtocol ( + FoundFvHandle, + #if (PI_SPECIFICATION_VERSION < 0x00010000) + &gEfiFirmwareVolumeProtocolGuid, + #else + &gEfiFirmwareVolume2ProtocolGuid, + #endif + (VOID **) &Fv + ); + if (!EFI_ERROR (Status)) { + // + // Set FV ReadFile Buffer as NULL, only need to check whether input Fv file exist there + // + Status = Fv->ReadFile ( + Fv, + FileGuid, + NULL, + &Size, + &Type, + &Attributes, + &AuthenticationStatus + ); + if (!EFI_ERROR (Status)) { + return EFI_ALREADY_STARTED; + } + } + } + + // + // Look for the input wanted FV file in current FV + // First, try to look for in Bds own FV. Bds and input wanted FV file usually are in the same FV + // + FindFvFile = FALSE; + FoundFvHandle = NULL; + Status = gBS->HandleProtocol ( + mBdsImageHandle, + &gEfiLoadedImageProtocolGuid, + &LoadedImage + ); + if (!EFI_ERROR (Status)) { + Status = gBS->HandleProtocol ( + LoadedImage->DeviceHandle, + #if (PI_SPECIFICATION_VERSION < 0x00010000) + &gEfiFirmwareVolumeProtocolGuid, + #else + &gEfiFirmwareVolume2ProtocolGuid, + #endif + (VOID **) &Fv + ); + if (!EFI_ERROR (Status)) { + Status = Fv->ReadFile ( + Fv, + FileGuid, + NULL, + &Size, + &Type, + &Attributes, + &AuthenticationStatus + ); + if (!EFI_ERROR (Status)) { + FindFvFile = TRUE; + FoundFvHandle = LoadedImage->DeviceHandle; + } + } + } + // + // Second, if fail to find, try to enumerate all FV + // + if (!FindFvFile) { + FvHandleBuffer = NULL; + gBS->LocateHandleBuffer ( + ByProtocol, + #if (PI_SPECIFICATION_VERSION < 0x00010000) + &gEfiFirmwareVolumeProtocolGuid, + #else + &gEfiFirmwareVolume2ProtocolGuid, + #endif + NULL, + &FvHandleCount, + &FvHandleBuffer + ); + for (Index = 0; Index < FvHandleCount; Index++) { + gBS->HandleProtocol ( + FvHandleBuffer[Index], + #if (PI_SPECIFICATION_VERSION < 0x00010000) + &gEfiFirmwareVolumeProtocolGuid, + #else + &gEfiFirmwareVolume2ProtocolGuid, + #endif + (VOID **) &Fv + ); + + Status = Fv->ReadFile ( + Fv, + FileGuid, + NULL, + &Size, + &Type, + &Attributes, + &AuthenticationStatus + ); + if (EFI_ERROR (Status)) { + // + // Skip if input Fv file not in the FV + // + continue; + } + FindFvFile = TRUE; + FoundFvHandle = FvHandleBuffer[Index]; + break; + } + + if (FvHandleBuffer !=NULL ) { + gBS->FreePool (FvHandleBuffer); + } + } + + if (FindFvFile) { + // + // Build the shell device path + // + NewDevicePath = EfiDevicePathFromHandle (FoundFvHandle); + EfiInitializeFwVolDevicepathNode (&FvFileNode, FileGuid); + NewDevicePath = EfiAppendDevicePathNode (NewDevicePath, (EFI_DEVICE_PATH_PROTOCOL *) &FvFileNode); + *DevicePath = NewDevicePath; + return EFI_SUCCESS; + } + return EFI_NOT_FOUND; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsConnect.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsConnect.c new file mode 100644 index 0000000..597727f --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsConnect.c @@ -0,0 +1,175 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsConnect.c 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsConnect.c $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: BdsConnect.c +// +// Description: Connect the device for AMT Boot. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + BdsConnect.c + +Abstract: + + BDS Lib functions which relate with connect the device + +--*/ +#include "BdsLib.h" +#include "EdkIIGlueUefiLib.h" + +EFI_STATUS +BdsLibConnectAllEfi ( + VOID + ) +/*++ + +Routine Description: + + This function will connect all current system handles recursively. The + connection will finish until every handle's child handle created if it have. + +Arguments: + + None + +Returns: + + EFI_SUCCESS - All handles and it's child handle have been connected + + EFI_STATUS - Return the status of gBS->LocateHandleBuffer(). + +--*/ +{ + EFI_STATUS Status; + UINTN HandleCount; + EFI_HANDLE *HandleBuffer; + UINTN Index; + + Status = gBS->LocateHandleBuffer ( + AllHandles, + NULL, + NULL, + &HandleCount, + &HandleBuffer + ); + if (EFI_ERROR (Status)) { + return Status; + } + + for (Index = 0; Index < HandleCount; Index++) { + Status = gBS->ConnectController (HandleBuffer[Index], NULL, NULL, TRUE); + } + + gBS->FreePool (HandleBuffer); + + return EFI_SUCCESS; +} + +VOID +BdsLibConnectAllDriversToAllControllers ( + VOID + ) +/*++ + +Routine Description: + + Connects all drivers to all controllers. + This function make sure all the current system driver will manage + the correspoinding controllers if have. And at the same time, make + sure all the system controllers have driver to manage it if have. + +Arguments: + + None + +Returns: + + None + +--*/ +{ + EFI_STATUS Status; + + Status = EfiGetSystemConfigurationTable (&gEfiDxeServicesTableGuid, (VOID**) &gDS); + + do { + // + // Connect All EFI 1.10 drivers following EFI 1.10 algorithm + // + BdsLibConnectAllEfi (); + + // + // Check to see if it's possible to dispatch an more DXE drivers. + // The BdsLibConnectAllEfi () may have made new DXE drivers show up. + // If anything is Dispatched Status == EFI_SUCCESS and we will try + // the connect again. + // + Status = gDS->Dispatch (); + + } while (!EFI_ERROR (Status)); + +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsConsole.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsConsole.c new file mode 100644 index 0000000..b55a0a1 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsConsole.c @@ -0,0 +1,251 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsConsole.c 2 5/14/14 9:53p Tristinchou $ +// +// $Revision: 2 $ +// +// $Date: 5/14/14 9:53p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsConsole.c $ +// +// 2 5/14/14 9:53p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: BdsConsole.c +// +// Description: Connect the Console device for AMT. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + BdsConsole.c + +Abstract: + + BDS Lib functions which contain all the code to connect console device + +--*/ + +#include "BdsLib.h" +#include "EfiPrintLib.h" + +EFI_STATUS +BdsLibUpdateConsoleVariable ( + IN CHAR16 *ConVarName, + IN EFI_DEVICE_PATH_PROTOCOL *CustomizedConDevicePath, + IN EFI_DEVICE_PATH_PROTOCOL *ExclusiveDevicePath + ) +/*++ + +Routine Description: + + This function update console variable based on ConVarName, it can + add or remove one specific console device path from the variable + +Arguments: + + ConVarName - Console related variable name, ConIn, ConOut, ErrOut. + + CustomizedConDevicePath - The console device path which will be added to + the console variable ConVarName, this parameter + can not be multi-instance. + + ExclusiveDevicePath - The console device path which will be removed + from the console variable ConVarName, this + parameter can not be multi-instance. + +Returns: + + EFI_UNSUPPORTED - Add or remove the same device path. + + EFI_SUCCESS - Success add or remove the device path from + the console variable. + +--*/ +{ + EFI_STATUS Status; + EFI_DEVICE_PATH_PROTOCOL *VarConsole; + UINTN DevicePathSize; + EFI_DEVICE_PATH_PROTOCOL *Instance; + EFI_DEVICE_PATH_PROTOCOL *NewDevicePath; + UINT32 VarAttr; + UINTN VarSize; + + + VarConsole = NULL; + DevicePathSize = 0; + NewDevicePath = NULL; + Status = EFI_UNSUPPORTED; + + // + // Notes: check the device path point, here should check + // with compare memory + // + if (CustomizedConDevicePath == ExclusiveDevicePath) { + return EFI_UNSUPPORTED; + } + // + // Delete the ExclusiveDevicePath from current default console + // + VarConsole = BdsLibGetVariableAndSize ( + ConVarName, + &gEfiGlobalVariableGuid, + &DevicePathSize + ); + + if (ExclusiveDevicePath != NULL && VarConsole != NULL) { + if (BdsLibMatchDevicePaths (VarConsole, ExclusiveDevicePath)) { + + Instance = EfiDevicePathInstance (&VarConsole, &DevicePathSize); + + while (VarConsole != NULL) { + if (EfiCompareMem ( + Instance, + ExclusiveDevicePath, + DevicePathSize - sizeof (EFI_DEVICE_PATH_PROTOCOL) + ) == 0) { + // + // Remove the match part + // + NewDevicePath = EfiAppendDevicePathInstance (NewDevicePath, VarConsole); + break; + } else { + // + // Continue the next instance + // + NewDevicePath = EfiAppendDevicePathInstance (NewDevicePath, Instance); + } + + Instance = EfiDevicePathInstance (&VarConsole, &DevicePathSize); + } + // + // Reset the console variable with new device path + // + VarAttr = 0; + VarSize = 0; + + Status = gRT->GetVariable( + ConVarName, + &gEfiGlobalVariableGuid, + &VarAttr, + &VarSize, + NULL ); + if( EFI_ERROR(Status) && Status != EFI_BUFFER_TOO_SMALL ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS | EFI_VARIABLE_NON_VOLATILE; + VarSize = EfiDevicePathSize( NewDevicePath ); + } + + gRT->SetVariable( + ConVarName, + &gEfiGlobalVariableGuid, + VarAttr, + VarSize, + NewDevicePath ); + } + } + // + // Try to append customized device path + // + VarConsole = BdsLibGetVariableAndSize ( + ConVarName, + &gEfiGlobalVariableGuid, + &DevicePathSize + ); + + if (CustomizedConDevicePath != NULL) { + if (!BdsLibMatchDevicePaths (VarConsole, CustomizedConDevicePath)) { + // + // In the first check, the default console variable will be null, + // just append current customized device path + // + VarConsole = EfiAppendDevicePathInstance (VarConsole, CustomizedConDevicePath); + + // + // Update the variable of the default console + // + VarAttr = 0; + VarSize = 0; + + Status = gRT->GetVariable( + ConVarName, + &gEfiGlobalVariableGuid, + &VarAttr, + &VarSize, + NULL ); + if( EFI_ERROR(Status) && Status != EFI_BUFFER_TOO_SMALL ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS | EFI_VARIABLE_NON_VOLATILE; + VarSize = EfiDevicePathSize( NewDevicePath ); + } + + gRT->SetVariable( + ConVarName, + &gEfiGlobalVariableGuid, + VarAttr, + VarSize, + VarConsole ); + } + } + + return EFI_SUCCESS; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsLib.h b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsLib.h new file mode 100644 index 0000000..5a4e10a --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsLib.h @@ -0,0 +1,459 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsLib.h 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsLib.h $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 3 9/21/11 8:52a Klzhan +// [TAG] EIP69500 +// [Category] Bug Fix +// [Severity] Minor +// [Symptom] Compiler error when DXE_PERFORMANCE is on +// [RootCause] EDK Library doesn't support this function. +// [Files] BdsLib.h +// Performance.c +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: BdsConsole.h +// +// Description: BDS library definition, include the file and data structure +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + BdsLib.h + +Abstract: + + BDS library definition, include the file and data structure + +--*/ + +#ifndef _BDS_LIB_H_ +#define _BDS_LIB_H_ + +#include "Tiano.h" +#include "EfiDriverLib.h" +#include "EfiPrintLib.h" +#include "BmMachine.h" +#include "EfiHobLib.h" + +#include EFI_PROTOCOL_DEFINITION (SerialIo) +#include EFI_PROTOCOL_DEFINITION (BlockIo) +#include EFI_PROTOCOL_DEFINITION (LegacyBios) +#include EFI_PROTOCOL_DEFINITION (AcpiS3Save) +#include EFI_PROTOCOL_DEFINITION (LoadedImage) +#include EFI_PROTOCOL_DEFINITION (SimpleFileSystem) +#include EFI_PROTOCOL_DEFINITION (SimpleNetwork) +#include EFI_PROTOCOL_DEFINITION (LoadFile) +#include EFI_PROTOCOL_DEFINITION (PlatformDriverOverride) +#include EFI_PROTOCOL_DEFINITION (ConsoleControl) +#include EFI_PROTOCOL_DEFINITION (UgaDraw) +#include EFI_PROTOCOL_DEFINITION (Hii) +#include EFI_PROTOCOL_DEFINITION (FirmwareVolume) + +#include EFI_PROTOCOL_DEFINITION (TcgService) +#include EFI_GUID_DEFINITION (PcAnsi) +#include EFI_GUID_DEFINITION (Hob) +#include EFI_GUID_DEFINITION (HotPlugDevice) +#include EFI_GUID_DEFINITION (GlobalVariable) +#include EFI_GUID_DEFINITION (EfiShell) +#include EFI_GUID_DEFINITION (ConsoleInDevice) +#include EFI_GUID_DEFINITION (ConsoleOutDevice) +#include EFI_GUID_DEFINITION (StandardErrorDevice) + +// +// Include the performance head file and defind macro to add perf data +// +#ifdef EFI_DXE_PERFORMANCE +#include "Performance.h" +#define WRITE_BOOT_TO_OS_PERFORMANCE_DATA WriteBootToOsPerformanceData () +#else +#define WRITE_BOOT_TO_OS_PERFORMANCE_DATA +#endif + +extern EFI_HANDLE mBdsImageHandle; + +// +// Constants which are variable names used to access variables +// +#define VarLegacyDevOrder L"LegacyDevOrder" + +// +// Data structures and defines +// +#define FRONT_PAGE_QUESTION_ID 0x0000 +#define FRONT_PAGE_DATA_WIDTH 0x01 + +// +// ConnectType +// +#define CONSOLE_OUT 0x00000001 +#define STD_ERROR 0x00000002 +#define CONSOLE_IN 0x00000004 +#define CONSOLE_ALL (CONSOLE_OUT | CONSOLE_IN | STD_ERROR) + +// +// Load Option Attributes defined in EFI Specification +// +#define LOAD_OPTION_ACTIVE 0x00000001 +#define LOAD_OPTION_FORCE_RECONNECT 0x00000002 +#define IS_LOAD_OPTION_TYPE(_c, _Mask) (BOOLEAN) (((_c) & (_Mask)) != 0) + +// +// Define Maxmim characters that will be accepted +// +#define MAX_CHAR 480 +#define MAX_CHAR_SIZE (MAX_CHAR * 2) + +#define MIN_ALIGNMENT_SIZE 4 +#define ALIGN_SIZE(a) ((a % MIN_ALIGNMENT_SIZE) ? MIN_ALIGNMENT_SIZE - (a % MIN_ALIGNMENT_SIZE) : 0) + +// +// This data structure is the part of BDS_CONNECT_ENTRY that we can hard code. +// +#define BDS_LOAD_OPTION_SIGNATURE EFI_SIGNATURE_32 ('B', 'd', 'C', 'O') + +typedef struct { + + UINTN Signature; + EFI_LIST_ENTRY Link; + + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + + CHAR16 *OptionName; + UINTN OptionNumber; + UINT16 BootCurrent; + UINT32 Attribute; + CHAR16 *Description; + VOID *LoadOptions; + UINT32 LoadOptionsSize; + +} BDS_COMMON_OPTION; + +typedef struct { + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + UINTN ConnectType; +} BDS_CONSOLE_CONNECT_ENTRY; + +// +// Lib Functions +// + +// +// Bds boot relate lib functions +// +EFI_STATUS +BdsLibUpdateBootOrderList ( + IN EFI_LIST_ENTRY *BdsOptionList, + IN CHAR16 *VariableName + ); + +VOID +BdsLibBootNext ( + VOID + ); + +EFI_STATUS +BdsLibBootViaBootOption ( + IN BDS_COMMON_OPTION * Option, + IN EFI_DEVICE_PATH_PROTOCOL * DevicePath, + OUT UINTN *ExitDataSize, + OUT CHAR16 **ExitData OPTIONAL + ); + +EFI_STATUS +BdsLibEnumerateAllBootOption ( + IN OUT EFI_LIST_ENTRY *BdsBootOptionList + ); + +VOID +BdsLibBuildOptionFromHandle ( + IN EFI_HANDLE Handle, + IN EFI_LIST_ENTRY *BdsBootOptionList + ); + +VOID +BdsLibBuildOptionFromShell ( + IN EFI_HANDLE Handle, + IN EFI_LIST_ENTRY *BdsBootOptionList + ); + +// +// Bds misc lib functions +// +UINT16 +BdsLibGetTimeout ( + VOID + ); + +EFI_STATUS +BdsLibGetBootMode ( + OUT EFI_BOOT_MODE *BootMode + ); + +VOID +BdsLibLoadDrivers ( + IN EFI_LIST_ENTRY *BdsDriverLists + ); + +EFI_STATUS +BdsLibBuildOptionFromVar ( + IN EFI_LIST_ENTRY *BdsCommonOptionList, + IN CHAR16 *VariableName + ); + +VOID * +BdsLibGetVariableAndSize ( + IN CHAR16 *Name, + IN EFI_GUID *VendorGuid, + OUT UINTN *VariableSize + ); + +EFI_STATUS +BdsLibOutputStrings ( + IN EFI_SIMPLE_TEXT_OUT_PROTOCOL *ConOut, + ... + ); + +BDS_COMMON_OPTION * +BdsLibVariableToOption ( + IN OUT EFI_LIST_ENTRY *BdsCommonOptionList, + IN CHAR16 *VariableName + ); + +EFI_STATUS +BdsLibRegisterNewOption ( + IN EFI_LIST_ENTRY *BdsOptionList, + IN EFI_DEVICE_PATH_PROTOCOL *DevicePath, + IN CHAR16 *String, + IN CHAR16 *VariableName + ); + +// +// Bds connect or disconnect driver lib funcion +// +VOID +BdsLibConnectAllDriversToAllControllers ( + VOID + ); + +VOID +BdsLibConnectAll ( + VOID + ); + +EFI_STATUS +BdsLibConnectDevicePath ( + IN EFI_DEVICE_PATH_PROTOCOL *DevicePathToConnect + ); + +EFI_STATUS +BdsLibConnectAllEfi ( + VOID + ); + +EFI_STATUS +BdsLibDisconnectAllEfi ( + VOID + ); + +// +// Bds console relate lib functions +// +VOID +BdsLibConnectAllConsoles ( + VOID + ); + +EFI_STATUS +BdsLibConnectAllDefaultConsoles ( + VOID + ); + +EFI_STATUS +BdsLibUpdateConsoleVariable ( + IN CHAR16 *ConVarName, + IN EFI_DEVICE_PATH_PROTOCOL *CustomizedConDevicePath, + IN EFI_DEVICE_PATH_PROTOCOL *ExclusiveDevicePath + ); + +EFI_STATUS +BdsLibConnectConsoleVariable ( + IN CHAR16 *ConVarName + ); + +// +// Bds device path relate lib functions +// +EFI_DEVICE_PATH_PROTOCOL * +BdsLibUnpackDevicePath ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath + ); + +BOOLEAN +BdsLibMatchDevicePaths ( + IN EFI_DEVICE_PATH_PROTOCOL *Multi, + IN EFI_DEVICE_PATH_PROTOCOL *Single + ); + +CHAR16 * +DevicePathToStr ( + EFI_DEVICE_PATH_PROTOCOL *DevPath + ); + +VOID * +EfiLibGetVariable ( + IN CHAR16 *Name, + IN EFI_GUID *VendorGuid + ); + +// +// Internal definitions +// +typedef struct { + CHAR16 *str; + UINTN len; + UINTN maxlen; +} POOL_PRINT; + +typedef struct { + UINT8 Type; + UINT8 SubType; + VOID (*Function) (POOL_PRINT *, VOID *); +} DEVICE_PATH_STRING_TABLE; + +// +// Internal functions +// +EFI_STATUS +BdsBootByDiskSignatureAndPartition ( + IN BDS_COMMON_OPTION * Option, + IN HARDDRIVE_DEVICE_PATH * HardDriveDevicePath, + IN UINT32 LoadOptionsSize, + IN VOID *LoadOptions, + OUT UINTN *ExitDataSize, + OUT CHAR16 **ExitData OPTIONAL + ); + +// +// Notes: EFI 64 shadow all option rom +// +#ifdef EFI64 +#define EFI64_SHADOW_ALL_LEGACY_ROM() ShadowAllOptionRom (); +VOID +ShadowAllOptionRom(); +#else +#define EFI64_SHADOW_ALL_LEGACY_ROM() +#endif + +// +// BBS support macros and functions +// + +#if defined(EFI32) || defined(EFIX64) +#define REFRESH_LEGACY_BOOT_OPTIONS \ + BdsDeleteAllInvalidLegacyBootOptions ();\ + BdsAddNonExistingLegacyBootOptions (); \ + BdsUpdateLegacyDevOrder () +#else +#define REFRESH_LEGACY_BOOT_OPTIONS +#endif + +EFI_STATUS +BdsDeleteAllInvalidLegacyBootOptions ( + VOID + ); + +EFI_STATUS +BdsAddNonExistingLegacyBootOptions ( + VOID + ); + +EFI_STATUS +BdsUpdateLegacyDevOrder ( + VOID + ); + +EFI_STATUS +BdsRefreshBbsTableForBoot ( + IN BDS_COMMON_OPTION *Entry + ); + +extern VOID +WriteBootToOsPerformanceData ( + VOID + ); + +BOOLEAN +BdsLibIsValidEFIBootOptDevicePath ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath, + IN BOOLEAN CheckMedia + ); + +EFI_STATUS +EFIAPI +BdsLibUpdateFvFileDevicePath ( + IN OUT EFI_DEVICE_PATH_PROTOCOL ** DevicePath, + IN EFI_GUID *FileGuid + ); + +#endif // _BDS_LIB_H_ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsMisc.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsMisc.c new file mode 100644 index 0000000..2b23d21 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/BdsMisc.c @@ -0,0 +1,594 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsMisc.c 2 5/14/14 9:53p Tristinchou $ +// +// $Revision: 2 $ +// +// $Date: 5/14/14 9:53p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BdsMisc.c $ +// +// 2 5/14/14 9:53p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: BdsMisc.h +// +// Description: Misc BDS library function +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004 - 2005, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + BdsMisc.c + +Abstract: + + Misc BDS library function + +--*/ + +#include "BdsLib.h" + +extern UINT16 gPlatformBootTimeOutDefault; + +UINT16 +BdsLibGetTimeout ( + VOID + ) +/*++ + +Routine Description: + + Return the default value for system Timeout variable. + +Arguments: + + None + +Returns: + + Timeout value. + +--*/ +{ + UINT16 Timeout; + UINT32 VarAttr; + UINTN Size; + EFI_STATUS Status; + + // + // Return Timeout variable or 0xffff if no valid + // Timeout variable exists. + // + VarAttr = 0; + Size = sizeof(UINT16); + Status = gRT->GetVariable( + L"Timeout", + &gEfiGlobalVariableGuid, + &VarAttr, + &Size, + &Timeout ); + if (!EFI_ERROR (Status)) { + return Timeout; + } + + if( EFI_ERROR (Status) && (Status != EFI_BUFFER_TOO_SMALL) ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS | EFI_VARIABLE_NON_VOLATILE; + Size = sizeof(UINT16); + } + // + // To make the current EFI Automatic-Test activity possible, just add + // following code to make AutoBoot enabled when this variable is not + // present. + // This code should be removed later. + // + Timeout = gPlatformBootTimeOutDefault; + + // + // Notes: Platform should set default variable if non exists on all error cases!!! + // + Status = gRT->SetVariable( + L"Timeout", + &gEfiGlobalVariableGuid, + VarAttr, + Size, + &Timeout ); + + return Timeout; +} +UINT16 +BdsLibGetFreeOptionNumber ( + IN CHAR16 *VariableName + ) +/*++ + +Routine Description: + Get the Option Number that does not used + Try to locate the specific option variable one by one untile find a free number + +Arguments: + VariableName - Indicate if the boot#### or driver#### option + +Returns: + The Minimal Free Option Number + +--*/ +{ + UINT16 Number; + UINTN Index; + CHAR16 StrTemp[10]; + UINT16 *OptionBuffer; + UINTN OptionSize; + + // + // Try to find the minimum free number from 0, 1, 2, 3.... + // + Index = 0; + do { + if (*VariableName == 'B') { + SPrint (StrTemp, sizeof (StrTemp), L"Boot%04x", Index); + } else { + SPrint (StrTemp, sizeof (StrTemp), L"Driver%04x", Index); + } + // + // try if the option number is used + // + OptionBuffer = BdsLibGetVariableAndSize ( + StrTemp, + &gEfiGlobalVariableGuid, + &OptionSize + ); + if (OptionBuffer == NULL) { + break; + } + Index++; + } while (1); + + Number = (UINT16) Index; + return Number; +} + +EFI_STATUS +BdsLibRegisterNewOption ( + IN EFI_LIST_ENTRY *BdsOptionList, + IN EFI_DEVICE_PATH_PROTOCOL *DevicePath, + IN CHAR16 *String, + IN CHAR16 *VariableName + ) +/*++ + +Routine Description: + + This function will register the new boot#### or driver#### option base on + the VariableName. The new registered boot#### or driver#### will be linked + to BdsOptionList and also update to the VariableName. After the boot#### or + driver#### updated, the BootOrder or DriverOrder will also be updated. + +Arguments: + + BdsOptionList - The header of the boot#### or driver#### link list + + DevicePath - The device path which the boot#### + or driver#### option present + + String - The description of the boot#### or driver#### + + VariableName - Indicate if the boot#### or driver#### option + +Returns: + + EFI_SUCCESS - The boot#### or driver#### have been success registered + + EFI_STATUS - Return the status of gRT->SetVariable (). + +--*/ +{ + EFI_STATUS Status; + UINTN Index; + UINT16 MaxOptionNumber; + UINT16 RegisterOptionNumber; + UINT16 *TempOptionPtr; + UINTN TempOptionSize; + UINT16 *OptionOrderPtr; + VOID *OptionPtr; + UINTN OptionSize; + UINT8 *TempPtr; + EFI_DEVICE_PATH_PROTOCOL *OptionDevicePath; + CHAR16 *Description; + CHAR16 OptionName[10]; + BOOLEAN UpdateDescription; + UINT16 BootOrderEntry; + UINTN OrderItemNum; + UINT32 VarAttr; + UINTN VarSize; + + + OptionPtr = NULL; + OptionSize = 0; + TempPtr = NULL; + OptionDevicePath = NULL; + Description = NULL; + MaxOptionNumber = 0; + OptionOrderPtr = NULL; + UpdateDescription = FALSE; + EfiZeroMem (OptionName, sizeof (OptionName)); + + TempOptionSize = 0; + TempOptionPtr = BdsLibGetVariableAndSize ( + VariableName, + &gEfiGlobalVariableGuid, + &TempOptionSize + ); + + // + // Compare with current option variable + // + for (Index = 0; Index < TempOptionSize / sizeof (UINT16); Index++) { + + if (*VariableName == 'B') { + SPrint (OptionName, sizeof (OptionName), L"Boot%04x", TempOptionPtr[Index]); + } else { + SPrint (OptionName, sizeof (OptionName), L"Driver%04x", TempOptionPtr[Index]); + } + + OptionPtr = BdsLibGetVariableAndSize ( + OptionName, + &gEfiGlobalVariableGuid, + &OptionSize + ); + if (OptionPtr == NULL) { + continue; + } + TempPtr = OptionPtr; + TempPtr += sizeof (UINT32) + sizeof (UINT16); + Description = (CHAR16 *) TempPtr; + TempPtr += EfiStrSize ((CHAR16 *) TempPtr); + OptionDevicePath = (EFI_DEVICE_PATH_PROTOCOL *) TempPtr; + + // + // Notes: the description may will change base on the GetStringToken + // + if (EfiCompareMem (OptionDevicePath, DevicePath, EfiDevicePathSize (OptionDevicePath)) == 0) { + if (EfiCompareMem (Description, String, EfiStrSize (Description)) == 0) { + // + // Got the option, so just return + // + gBS->FreePool (OptionPtr); + gBS->FreePool (TempOptionPtr); + return EFI_SUCCESS; + } else { + // + // Option description changed, need update. + // + UpdateDescription = TRUE; + gBS->FreePool (OptionPtr); + break; + } + } + + gBS->FreePool (OptionPtr); + } + + OptionSize = sizeof (UINT32) + sizeof (UINT16) + EfiStrSize (String) + EfiDevicePathSize (DevicePath); + OptionPtr = EfiLibAllocateZeroPool (OptionSize); + TempPtr = OptionPtr; + *(UINT32 *) TempPtr = LOAD_OPTION_ACTIVE; + TempPtr += sizeof (UINT32); + *(UINT16 *) TempPtr = (UINT16) EfiDevicePathSize (DevicePath); + TempPtr += sizeof (UINT16); + EfiCopyMem (TempPtr, String, EfiStrSize (String)); + TempPtr += EfiStrSize (String); + EfiCopyMem (TempPtr, DevicePath, EfiDevicePathSize (DevicePath)); + + if (UpdateDescription) { + // + // The number in option#### to be updated + // + RegisterOptionNumber = TempOptionPtr[Index]; + } else { + // + // The new option#### number + // + RegisterOptionNumber = BdsLibGetFreeOptionNumber(VariableName); + } + + if (*VariableName == 'B') { + SPrint (OptionName, sizeof (OptionName), L"Boot%04x", RegisterOptionNumber); + } else { + SPrint (OptionName, sizeof (OptionName), L"Driver%04x", RegisterOptionNumber); + } + + VarAttr = 0; + VarSize = 0; + + Status = gRT->GetVariable( + OptionName, + &gEfiGlobalVariableGuid, + &VarAttr, + &VarSize, + NULL ); + if( EFI_ERROR (Status) && (Status != EFI_BUFFER_TOO_SMALL) ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS | EFI_VARIABLE_NON_VOLATILE; + VarSize = OptionSize; + } + + Status = gRT->SetVariable ( + OptionName, + &gEfiGlobalVariableGuid, + VarAttr, + VarSize, + OptionPtr ); + // + // Return if only need to update a changed description or fail to set option. + // + if (EFI_ERROR (Status) || UpdateDescription) { + gBS->FreePool (OptionPtr); + gBS->FreePool (TempOptionPtr); + return Status; + } + + gBS->FreePool (OptionPtr); + + // + // Update the option order variable + // + + // + // If no option order + // + if (TempOptionSize == 0) { + VarAttr = 0; + VarSize = 0; + + Status = gRT->GetVariable( + VariableName, + &gEfiGlobalVariableGuid, + &VarAttr, + &VarSize, + NULL ); + if( EFI_ERROR (Status) && (Status != EFI_BUFFER_TOO_SMALL) ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS | EFI_VARIABLE_NON_VOLATILE; + VarSize = sizeof(UINT16); + } + + BootOrderEntry = 0; + + Status = gRT->SetVariable( + VariableName, + &gEfiGlobalVariableGuid, + VarAttr, + VarSize, + &BootOrderEntry ); + if (EFI_ERROR (Status)) { + gBS->FreePool (TempOptionPtr); + return Status; + } + return EFI_SUCCESS; + } + // + // Append the new option number to the original option order + // + OrderItemNum = (TempOptionSize / sizeof (UINT16)) + 1 ; + OptionOrderPtr = EfiLibAllocateZeroPool ( OrderItemNum * sizeof (UINT16)); + EfiCopyMem (OptionOrderPtr, TempOptionPtr, (OrderItemNum - 1) * sizeof (UINT16)); + + OptionOrderPtr[Index] = RegisterOptionNumber; + + VarAttr = 0; + VarSize = 0; + + Status = gRT->GetVariable( + VariableName, + &gEfiGlobalVariableGuid, + &VarAttr, + &VarSize, + NULL ); + if( EFI_ERROR (Status) && (Status != EFI_BUFFER_TOO_SMALL) ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS | EFI_VARIABLE_NON_VOLATILE; + VarSize = OrderItemNum * sizeof(UINT16); + } + + Status = gRT->SetVariable( + VariableName, + &gEfiGlobalVariableGuid, + VarAttr, + VarSize, + OptionOrderPtr ); + if (EFI_ERROR (Status)) { + gBS->FreePool (TempOptionPtr); + gBS->FreePool (OptionOrderPtr); + return Status; + } + + gBS->FreePool (TempOptionPtr); + gBS->FreePool (OptionOrderPtr); + + return EFI_SUCCESS; +} + + +VOID * +BdsLibGetVariableAndSize ( + IN CHAR16 *Name, + IN EFI_GUID *VendorGuid, + OUT UINTN *VariableSize + ) +/*++ + +Routine Description: + + Read the EFI variable (VendorGuid/Name) and return a dynamically allocated + buffer, and the size of the buffer. If failure return NULL. + +Arguments: + + Name - String part of EFI variable name + + VendorGuid - GUID part of EFI variable name + + VariableSize - Returns the size of the EFI variable that was read + +Returns: + + Dynamically allocated memory that contains a copy of the EFI variable. + Caller is responsible freeing the buffer. + + NULL - Variable was not read + +--*/ +{ + EFI_STATUS Status; + UINTN BufferSize; + VOID *Buffer; + + Buffer = NULL; + + // + // Pass in a zero size buffer to find the required buffer size. + // + BufferSize = 0; + Status = gRT->GetVariable (Name, VendorGuid, NULL, &BufferSize, Buffer); + if (Status == EFI_BUFFER_TOO_SMALL) { + // + // Allocate the buffer to return + // + Buffer = EfiLibAllocateZeroPool (BufferSize); + if (Buffer == NULL) { + return NULL; + } + // + // Read variable into the allocated buffer. + // + Status = gRT->GetVariable (Name, VendorGuid, NULL, &BufferSize, Buffer); + if (EFI_ERROR (Status)) { + BufferSize = 0; + } + } + + *VariableSize = BufferSize; + return Buffer; +} + +BOOLEAN +BdsLibMatchDevicePaths ( + IN EFI_DEVICE_PATH_PROTOCOL *Multi, + IN EFI_DEVICE_PATH_PROTOCOL *Single + ) +/*++ + +Routine Description: + + Function compares a device path data structure to that of all the nodes of a + second device path instance. + +Arguments: + + Multi - A pointer to a multi-instance device path data structure. + + Single - A pointer to a single-instance device path data structure. + +Returns: + + TRUE - If the Single is contained within Multi + + FALSE - The Single is not match within Multi + + +--*/ +{ + EFI_DEVICE_PATH_PROTOCOL *DevicePath; + EFI_DEVICE_PATH_PROTOCOL *DevicePathInst; + UINTN Size; + + if (!Multi || !Single) { + return FALSE; + } + + DevicePath = Multi; + DevicePathInst = EfiDevicePathInstance (&DevicePath, &Size); + Size -= sizeof (EFI_DEVICE_PATH_PROTOCOL); + + // + // Search for the match of 'Single' in 'Multi' + // + while (DevicePathInst != NULL) { + // + // If the single device path is found in multiple device paths, + // return success + // + if (Size == 0) { + return FALSE; + } + + if (EfiCompareMem (Single, DevicePathInst, Size) == 0) { + return TRUE; + } + + gBS->FreePool (DevicePathInst); + DevicePathInst = EfiDevicePathInstance (&DevicePath, &Size); + Size -= sizeof (EFI_DEVICE_PATH_PROTOCOL); + } + + return FALSE; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/BmMachine.h b/Board/EM/MeWrapper/AmtWrapper/Dxe/BmMachine.h new file mode 100644 index 0000000..4ba1760 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/BmMachine.h @@ -0,0 +1,102 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BmMachine.h 2 10/30/12 8:23a Klzhan $ +// +// $Revision: 2 $ +// +// $Date: 10/30/12 8:23a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/BmMachine.h $ +// +// 2 10/30/12 8:23a Klzhan +// [TAG] EIP92074 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] AMT EFI Boot fail +// [RootCause] File path incorrect. +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: BmMachine.h +// +// Description: Boot Manager Machine type +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + BmMachine.h + +Abstract: + + Boot Manager Machine type + + + +Revision History + +--*/ + +#ifndef _BM_MACHINE_H +#define _BM_MACHINE_H +#include "Token.h" + +#if x64_BUILD +#define DEFAULT_REMOVABLE_FILE_NAME L"\\EFI\\BOOT\\BOOTX64.EFI" +#else +#define DEFAULT_REMOVABLE_FILE_NAME L"\\EFI\\BOOT\\BOOTIA32.EFI" +#endif + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/DevicePath.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/DevicePath.c new file mode 100644 index 0000000..7fa871e --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/DevicePath.c @@ -0,0 +1,1078 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/DevicePath.c 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/DevicePath.c $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: DevicePath.h +// +// Description: +// BDS internal function define the default device path string, it can be +// replaced by platform device path. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + DevicePath.c + +Abstract: + + BDS internal function define the default device path string, it can be + replaced by platform device path. + +--*/ + +#include "Tiano.h" +#include "EfiPrintLib.h" +#include "bdslib.h" + +EFI_GUID UnknownDeviceGuid = UNKNOWN_DEVICE_GUID; + +EFI_GUID mEfiMsgPcAnsiGuid = DEVICE_PATH_MESSAGING_PC_ANSI; +EFI_GUID mEfiMsgVt100Guid = DEVICE_PATH_MESSAGING_VT_100; +EFI_GUID mEfiMsgVt100PlusGuid = DEVICE_PATH_MESSAGING_VT_100_PLUS; +EFI_GUID mEfiMsgVt100Utf8Guid = DEVICE_PATH_MESSAGING_VT_UTF8; + +VOID * +ReallocatePool ( + IN VOID *OldPool, + IN UINTN OldSize, + IN UINTN NewSize +) +/*++ + +Routine Description: + + Adjusts the size of a previously allocated buffer. + +Arguments: + + OldPool - A pointer to the buffer whose size is being adjusted. + + OldSize - The size of the current buffer. + + NewSize - The size of the new buffer. + +Returns: + + EFI_SUCEESS - The requested number of bytes were allocated. + + EFI_OUT_OF_RESOURCES - The pool requested could not be allocated. + + EFI_INVALID_PARAMETER - The buffer was invalid. + +--*/ +{ + VOID *NewPool; + + NewPool = NULL; + if (NewSize) + { + NewPool = EfiLibAllocateZeroPool (NewSize); + } + + if (OldPool) + { + if (NewPool) + { + EfiCopyMem (NewPool, OldPool, OldSize < NewSize ? OldSize : NewSize); + } + + gBS->FreePool (OldPool); + } + + return NewPool; +} + +CHAR16 * +CatPrint ( + IN OUT POOL_PRINT *Str, + IN CHAR16 *fmt, + ... +) +/*++ + +Routine Description: + + Concatenates a formatted unicode string to allocated pool. + The caller must free the resulting buffer. + +Arguments: + + Str - Tracks the allocated pool, size in use, and + amount of pool allocated. + + fmt - The format string + +Returns: + + Allocated buffer with the formatted string printed in it. + The caller must free the allocated buffer. The buffer + allocation is not packed. + +--*/ +{ + UINT16 *AppendStr; + VA_LIST args; + UINTN strsize; + + AppendStr = EfiLibAllocateZeroPool (0x1000); + if (AppendStr == NULL) + { + return Str->str; + } + + VA_START (args, fmt); + VSPrint (AppendStr, 0x1000, fmt, args); + VA_END (args); + if (NULL == Str->str) + { + strsize = EfiStrSize (AppendStr); + Str->str = EfiLibAllocateZeroPool (strsize); + ASSERT (Str->str != NULL); + } + else + { + strsize = EfiStrSize (AppendStr) + EfiStrSize (Str->str) - sizeof (UINT16); + Str->str = ReallocatePool ( + Str->str, + EfiStrSize (Str->str), + strsize + ); + ASSERT (Str->str != NULL); + } + + Str->maxlen = MAX_CHAR * sizeof (UINT16); + if (strsize < Str->maxlen) + { + EfiStrCat (Str->str, AppendStr); + Str->len = strsize - sizeof (UINT16); + } + + gBS->FreePool (AppendStr); + return Str->str; +} + +EFI_DEVICE_PATH_PROTOCOL * +BdsLibUnpackDevicePath ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath +) +/*++ + +Routine Description: + + Function unpacks a device path data structure so that all the nodes + of a device path are naturally aligned. + +Arguments: + + DevPath - A pointer to a device path data structure + +Returns: + + If the memory for the device path is successfully allocated, then a + pointer to the new device path is returned. Otherwise, NULL is returned. + +--*/ +{ + EFI_DEVICE_PATH_PROTOCOL *Src; + EFI_DEVICE_PATH_PROTOCOL *Dest; + EFI_DEVICE_PATH_PROTOCOL *NewPath; + UINTN Size; + + // + // Walk device path and round sizes to valid boundries + // + Src = DevPath; + Size = 0; + for (;;) + { + Size += DevicePathNodeLength (Src); + Size += ALIGN_SIZE (Size); + + if (IsDevicePathEnd (Src)) + { + break; + } + + Src = NextDevicePathNode (Src); + } + // + // Allocate space for the unpacked path + // + NewPath = EfiLibAllocateZeroPool (Size); + if (NewPath) + { + + ASSERT (((UINTN) NewPath) % MIN_ALIGNMENT_SIZE == 0); + + // + // Copy each node + // + Src = DevPath; + Dest = NewPath; + for (;;) + { + Size = DevicePathNodeLength (Src); + EfiCopyMem (Dest, Src, Size); + Size += ALIGN_SIZE (Size); + SetDevicePathNodeLength (Dest, Size); + Dest->Type |= EFI_DP_TYPE_UNPACKED; + Dest = (EFI_DEVICE_PATH_PROTOCOL *) (((UINT8 *) Dest) + Size); + + if (IsDevicePathEnd (Src)) + { + break; + } + + Src = NextDevicePathNode (Src); + } + } + + return NewPath; +} + +VOID +DevPathPci ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + PCI_DEVICE_PATH *Pci; + + Pci = DevPath; + CatPrint (Str, L"Pci(%x|%x)", Pci->Device, Pci->Function); +} + +VOID +DevPathPccard ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + PCCARD_DEVICE_PATH *Pccard; + + Pccard = DevPath; + CatPrint (Str, L"Pcmcia(Function%x)", Pccard->FunctionNumber); +} + +VOID +DevPathMemMap ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + MEMMAP_DEVICE_PATH *MemMap; + + MemMap = DevPath; + CatPrint ( + Str, + L"MemMap(%d:%.lx-%.lx)", + MemMap->MemoryType, + MemMap->StartingAddress, + MemMap->EndingAddress + ); +} + +VOID +DevPathController ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + CONTROLLER_DEVICE_PATH *Controller; + + Controller = DevPath; + CatPrint (Str, L"Ctrl(%d)", Controller->Controller); +} + +VOID +DevPathVendor ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +/*++ + +Routine Description: + + Convert Vendor device path to device name + +Arguments: + + Str - The buffer store device name + DevPath - Pointer to vendor device path + +Returns: + + When it return, the device name have been stored in *Str. + +--*/ +{ + VENDOR_DEVICE_PATH *Vendor; + CHAR16 *Type; + INT32 *Temp; + + Vendor = DevPath; + Temp = (INT32 *) (&Vendor->Guid); + + switch (DevicePathType (&Vendor->Header)) + { + case HARDWARE_DEVICE_PATH: + // + // If the device is a winntbus device, we will give it a readable device name. + // + Type = L"Hw"; + break; + + case MESSAGING_DEVICE_PATH: + // + // If the device is a winntbus device, we will give it a readable device name. + // + if (EfiCompareGuid (&Vendor->Guid, &mEfiMsgPcAnsiGuid)) + { + CatPrint (Str, L"%s", L"PC-ANSI"); + return ; + } + else if (EfiCompareGuid (&Vendor->Guid, &mEfiMsgVt100Guid)) + { + CatPrint (Str, L"%s", L"VT100"); + return ; + } + else if (EfiCompareGuid (&Vendor->Guid, &mEfiMsgVt100PlusGuid)) + { + CatPrint (Str, L"%s", L"VT100+"); + return ; + } + else if (EfiCompareGuid (&Vendor->Guid, &mEfiMsgVt100Utf8Guid)) + { + CatPrint (Str, L"%s", L"VT100-UTF8"); + return ; + } + else + { + Type = L"Msg"; + break; + } + + case MEDIA_DEVICE_PATH: + Type = L"Media"; + break; + + default: + Type = L"?"; + break; + } + + CatPrint (Str, L"Ven%s(%g)", Type, &Vendor->Guid); +} + +VOID +DevPathAcpi ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + ACPI_HID_DEVICE_PATH *Acpi; + + Acpi = DevPath; + if ((Acpi->HID & PNP_EISA_ID_MASK) == PNP_EISA_ID_CONST) + { + CatPrint (Str, L"Acpi(PNP%04x,%x)", EISA_ID_TO_NUM (Acpi->HID), Acpi->UID); + } + else + { + CatPrint (Str, L"Acpi(%08x,%x)", Acpi->HID, Acpi->UID); + } +} + +VOID +DevPathAtapi ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + ATAPI_DEVICE_PATH *Atapi; + + Atapi = DevPath; + CatPrint ( + Str, + L"Ata(%s,%s)", + Atapi->PrimarySecondary ? L"Secondary" : L"Primary", + Atapi->SlaveMaster ? L"Slave" : L"Master" + ); +} + +VOID +DevPathScsi ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + SCSI_DEVICE_PATH *Scsi; + + Scsi = DevPath; + CatPrint (Str, L"Scsi(Pun%x,Lun%x)", Scsi->Pun, Scsi->Lun); +} + +VOID +DevPathFibre ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + FIBRECHANNEL_DEVICE_PATH *Fibre; + + Fibre = DevPath; + CatPrint (Str, L"Fibre(Wwn%lx,Lun%x)", Fibre->WWN, Fibre->Lun); +} + +VOID +DevPath1394 ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + F1394_DEVICE_PATH *F1394; + + F1394 = DevPath; + CatPrint (Str, L"1394(%g)", &F1394->Guid); +} + +VOID +DevPathUsb ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + USB_DEVICE_PATH *Usb; + + Usb = DevPath; + CatPrint (Str, L"Usb(%x, %x)", Usb->ParentPortNumber, Usb->InterfaceNumber); +} + +VOID +DevPathUsbClass ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + USB_CLASS_DEVICE_PATH *UsbClass; + + UsbClass = DevPath; + CatPrint ( + Str, + L"Usb Class(%x, %x, %x, %x, %x)", + UsbClass->VendorId, + UsbClass->ProductId, + UsbClass->DeviceClass, + UsbClass->DeviceSubClass, + UsbClass->DeviceProtocol + ); +} + +VOID +DevPathI2O ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + I2O_DEVICE_PATH *I2O; + + I2O = DevPath; + CatPrint (Str, L"I2O(%x)", I2O->Tid); +} + +VOID +DevPathMacAddr ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + MAC_ADDR_DEVICE_PATH *MAC; + UINTN HwAddressSize; + UINTN Index; + + MAC = DevPath; + + HwAddressSize = sizeof (EFI_MAC_ADDRESS); + if (MAC->IfType == 0x01 || MAC->IfType == 0x00) + { + HwAddressSize = 6; + } + + CatPrint (Str, L"Mac("); + + for (Index = 0; Index < HwAddressSize; Index++) + { + CatPrint (Str, L"%02x", MAC->MacAddress.Addr[Index]); + } + + CatPrint (Str, L")"); +} + +VOID +DevPathIPv4 ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + IPv4_DEVICE_PATH *IP; + + IP = DevPath; + CatPrint ( + Str, + L"IPv4(%d.%d.%d.%d:%d)", + IP->RemoteIpAddress.Addr[0], + IP->RemoteIpAddress.Addr[1], + IP->RemoteIpAddress.Addr[2], + IP->RemoteIpAddress.Addr[3], + IP->RemotePort + ); +} + +VOID +DevPathIPv6 ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + IPv6_DEVICE_PATH *IP; + + IP = DevPath; + CatPrint (Str, L"IP-v6(not-done)"); +} + +VOID +DevPathInfiniBand ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + INFINIBAND_DEVICE_PATH *InfiniBand; + + InfiniBand = DevPath; + CatPrint (Str, L"InfiniBand(not-done)"); +} + +VOID +DevPathUart ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + UART_DEVICE_PATH *Uart; + CHAR8 Parity; + + Uart = DevPath; + switch (Uart->Parity) + { + case 0: + Parity = 'D'; + break; + + case 1: + Parity = 'N'; + break; + + case 2: + Parity = 'E'; + break; + + case 3: + Parity = 'O'; + break; + + case 4: + Parity = 'M'; + break; + + case 5: + Parity = 'S'; + break; + + default: + Parity = 'x'; + break; + } + + if (Uart->BaudRate == 0) + { + CatPrint (Str, L"Uart(DEFAULT %c", Parity); + } + else + { + CatPrint (Str, L"Uart(%d %c", Uart->BaudRate, Parity); + } + + if (Uart->DataBits == 0) + { + CatPrint (Str, L"D"); + } + else + { + CatPrint (Str, L"%d", Uart->DataBits); + } + + switch (Uart->StopBits) + { + case 0: + CatPrint (Str, L"D)"); + break; + + case 1: + CatPrint (Str, L"1)"); + break; + + case 2: + CatPrint (Str, L"1.5)"); + break; + + case 3: + CatPrint (Str, L"2)"); + break; + + default: + CatPrint (Str, L"x)"); + break; + } +} + +VOID +DevPathHardDrive ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + HARDDRIVE_DEVICE_PATH *Hd; + + Hd = DevPath; + switch (Hd->SignatureType) + { + case SIGNATURE_TYPE_MBR: + CatPrint ( + Str, + L"HD(Part%d,Sig%08x)", + Hd->PartitionNumber, + *((UINT32 *) (&(Hd->Signature[0]))) + ); + break; + + case SIGNATURE_TYPE_GUID: + CatPrint ( + Str, + L"HD(Part%d,Sig%g)", + Hd->PartitionNumber, + (EFI_GUID *) &(Hd->Signature[0]) + ); + break; + + default: + CatPrint ( + Str, + L"HD(Part%d,MBRType=%02x,SigType=%02x)", + Hd->PartitionNumber, + Hd->MBRType, + Hd->SignatureType + ); + break; + } +} + +VOID +DevPathCDROM ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + CDROM_DEVICE_PATH *Cd; + + Cd = DevPath; + CatPrint (Str, L"CDROM(Entry%x)", Cd->BootEntry); +} + +VOID +DevPathFilePath ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + FILEPATH_DEVICE_PATH *Fp; + + Fp = DevPath; + CatPrint (Str, L"%s", Fp->PathName); +} + +VOID +DevPathMediaProtocol ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + MEDIA_PROTOCOL_DEVICE_PATH *MediaProt; + + MediaProt = DevPath; + CatPrint (Str, L"%g", &MediaProt->Protocol); +} + +VOID +DevPathFvFilePath ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + MEDIA_FW_VOL_FILEPATH_DEVICE_PATH *FvFilePath; + + FvFilePath = DevPath; + CatPrint (Str, L"%g", &FvFilePath->NameGuid); +} + +VOID +DevPathBssBss ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + BBS_BBS_DEVICE_PATH *Bbs; + CHAR16 *Type; + + Bbs = DevPath; + switch (Bbs->DeviceType) + { + case BBS_TYPE_FLOPPY: + Type = L"Floppy"; + break; + + case BBS_TYPE_HARDDRIVE: + Type = L"Harddrive"; + break; + + case BBS_TYPE_CDROM: + Type = L"CDROM"; + break; + + case BBS_TYPE_PCMCIA: + Type = L"PCMCIA"; + break; + + case BBS_TYPE_USB: + Type = L"Usb"; + break; + + case BBS_TYPE_EMBEDDED_NETWORK: + Type = L"Net"; + break; + + default: + Type = L"?"; + break; + } + // + // Since current Print function hasn't implemented %a (for ansi string) + // we will only print Unicode strings. + // + CatPrint (Str, L"Legacy-%s", Type); +} + +VOID +DevPathEndInstance ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + CatPrint (Str, L","); +} + +VOID +DevPathNodeUnknown ( + IN OUT POOL_PRINT *Str, + IN VOID *DevPath +) +{ + CatPrint (Str, L"?"); +} + +DEVICE_PATH_STRING_TABLE DevPathTable[] = { + HARDWARE_DEVICE_PATH, + HW_PCI_DP, + DevPathPci, + HARDWARE_DEVICE_PATH, + HW_PCCARD_DP, + DevPathPccard, + HARDWARE_DEVICE_PATH, + HW_MEMMAP_DP, + DevPathMemMap, + HARDWARE_DEVICE_PATH, + HW_VENDOR_DP, + DevPathVendor, + HARDWARE_DEVICE_PATH, + HW_CONTROLLER_DP, + DevPathController, + ACPI_DEVICE_PATH, + ACPI_DP, + DevPathAcpi, + MESSAGING_DEVICE_PATH, + MSG_ATAPI_DP, + DevPathAtapi, + MESSAGING_DEVICE_PATH, + MSG_SCSI_DP, + DevPathScsi, + MESSAGING_DEVICE_PATH, + MSG_FIBRECHANNEL_DP, + DevPathFibre, + MESSAGING_DEVICE_PATH, + MSG_1394_DP, + DevPath1394, + MESSAGING_DEVICE_PATH, + MSG_USB_DP, + DevPathUsb, + MESSAGING_DEVICE_PATH, + MSG_USB_CLASS_DP, + DevPathUsbClass, + MESSAGING_DEVICE_PATH, + MSG_I2O_DP, + DevPathI2O, + MESSAGING_DEVICE_PATH, + MSG_MAC_ADDR_DP, + DevPathMacAddr, + MESSAGING_DEVICE_PATH, + MSG_IPv4_DP, + DevPathIPv4, + MESSAGING_DEVICE_PATH, + MSG_IPv6_DP, + DevPathIPv6, + MESSAGING_DEVICE_PATH, + MSG_INFINIBAND_DP, + DevPathInfiniBand, + MESSAGING_DEVICE_PATH, + MSG_UART_DP, + DevPathUart, + MESSAGING_DEVICE_PATH, + MSG_VENDOR_DP, + DevPathVendor, + MEDIA_DEVICE_PATH, + MEDIA_HARDDRIVE_DP, + DevPathHardDrive, + MEDIA_DEVICE_PATH, + MEDIA_CDROM_DP, + DevPathCDROM, + MEDIA_DEVICE_PATH, + MEDIA_VENDOR_DP, + DevPathVendor, + MEDIA_DEVICE_PATH, + MEDIA_FILEPATH_DP, + DevPathFilePath, + MEDIA_DEVICE_PATH, + MEDIA_PROTOCOL_DP, + DevPathMediaProtocol, + MEDIA_DEVICE_PATH, + MEDIA_FV_FILEPATH_DP, + DevPathFvFilePath, + BBS_DEVICE_PATH, + BBS_BBS_DP, + DevPathBssBss, + END_DEVICE_PATH_TYPE, + END_INSTANCE_DEVICE_PATH_SUBTYPE, + DevPathEndInstance, + 0, + 0, + NULL + }; + +CHAR16 * +DevicePathToStr ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath +) +/*++ + + Turns the Device Path into a printable string. Allcoates + the string from pool. The caller must SafeFreePool the returned + string. + +--*/ +{ + POOL_PRINT Str; + EFI_DEVICE_PATH_PROTOCOL *DevPathNode; + VOID (*DumpNode) (POOL_PRINT *, VOID *); + + UINTN Index; + UINTN NewSize; + + EfiZeroMem (&Str, sizeof (Str)); + + if (DevPath == NULL) + { + goto Done; + } + // + // Unpacked the device path + // + DevPath = BdsLibUnpackDevicePath (DevPath); + ASSERT (DevPath); + + // + // Process each device path node + // + DevPathNode = DevPath; + while (!IsDevicePathEnd (DevPathNode)) + { + // + // Find the handler to dump this device path node + // + DumpNode = NULL; + for (Index = 0; DevPathTable[Index].Function; Index += 1) + { + + if (DevicePathType (DevPathNode) == DevPathTable[Index].Type && + DevicePathSubType (DevPathNode) == DevPathTable[Index].SubType + ) + { + DumpNode = DevPathTable[Index].Function; + break; + } + } + // + // If not found, use a generic function + // + if (!DumpNode) + { + DumpNode = DevPathNodeUnknown; + } + // + // Put a path seperator in if needed + // + if (Str.len && DumpNode != DevPathEndInstance) + { + CatPrint (&Str, L"/"); + } + // + // Print this node of the device path + // + DumpNode (&Str, DevPathNode); + + // + // Next device path node + // + DevPathNode = NextDevicePathNode (DevPathNode); + } + // + // Shrink pool used for string allocation + // + gBS->FreePool (DevPath); + +Done: + NewSize = (Str.len + 1) * sizeof (CHAR16); + Str.str = ReallocatePool (Str.str, NewSize, NewSize); + ASSERT (Str.str != NULL); + Str.str[Str.len] = 0; + return Str.str; +} + +EFI_DEVICE_PATH_PROTOCOL * +LibDuplicateDevicePathInstance ( + IN EFI_DEVICE_PATH_PROTOCOL *DevPath +) +/*++ + +Routine Description: + + Function creates a device path data structure that identically matches the + device path passed in. + +Arguments: + + DevPath - A pointer to a device path data structure. + +Returns: + + The new copy of DevPath is created to identically match the input. + Otherwise, NULL is returned. + +--*/ +{ + EFI_DEVICE_PATH_PROTOCOL *NewDevPath; + EFI_DEVICE_PATH_PROTOCOL *DevicePathInst; + EFI_DEVICE_PATH_PROTOCOL *Temp; + UINTN Size; + + // + // get the size of an instance from the input + // + Temp = DevPath; + DevicePathInst = EfiDevicePathInstance (&Temp, &Size); + + // + // Make a copy + // + NewDevPath = NULL; + if (Size) + { + NewDevPath = EfiLibAllocateZeroPool (Size); + ASSERT (NewDevPath != NULL); + } + + if (NewDevPath) + { + EfiCopyMem (NewDevPath, DevicePathInst, Size); + } + + return NewDevPath; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/KvmSupport.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/KvmSupport.c new file mode 100644 index 0000000..dab3fe4 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/KvmSupport.c @@ -0,0 +1,135 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/KvmSupport.c 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/KvmSupport.c $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: KvmSupport.c +// +// Description: Support routines for KVM init in the BDS +// +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + This file contains an 'Intel Peripheral Driver' and is + licensed for Intel CPUs and chipsets under the terms of your + license agreement with Intel or your vendor. This file may + be modified by the user, subject to additional terms of the + license agreement +--*/ + +/*++ + +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + + +Module Name: + + KvmSupport.c + +Abstract: + + Support routines for KVM init in the BDS + +--*/ +// Remove for RC 0.8 +/* +#include "KvmSupport.h" + +BOOLEAN +BdsKvmInitialization ( + IN VOID + ) +*/ +/*++ + +Routine Description: + + Request KVM message. + +Arguments: + + None. + +Returns: + + True KVM Boot Option is an active. + +--*/ +/* +{ + EFI_STATUS Status; + UINT32 ResponseCode; + + if(ActiveManagementEnableKvm() == TRUE) { + Status = HeciQueryKvmRequest(QUERY_REQUEST, &ResponseCode); + if (EFI_ERROR (Status)) { + gST->ConOut->ClearScreen (gST->ConOut); + gST->ConOut->OutputString (gST->ConOut, L"Error!! Times up and the KVM session was cancelled!!"); + Status = HeciQueryKvmRequest(CANCEL_REQUEST, &ResponseCode); + } else if (ResponseCode == KVM_SESSION_CANCELLED) { + gST->ConOut->ClearScreen (gST->ConOut); + gST->ConOut->OutputString (gST->ConOut, L"Error!! The request has rejected and the KVM session was cancelled!!"); + } else { + return TRUE; + } + } + + return FALSE; +} +*/ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/KvmSupport.h b/Board/EM/MeWrapper/AmtWrapper/Dxe/KvmSupport.h new file mode 100644 index 0000000..2058d6b --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/KvmSupport.h @@ -0,0 +1,119 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/KvmSupport.h 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/KvmSupport.h $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: KvmSupport.h +// +// Description: KVM BDS Support include file +// +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + This file contains an 'Intel Peripheral Driver' and is + licensed for Intel CPUs and chipsets under the terms of your + license agreement with Intel or your vendor. This file may + be modified by the user, subject to additional terms of the + license agreement +--*/ + +/*++ + +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + + +Module Name: + + KvmSupport.h + +Abstract: + + KVM BDS Support include file + +--*/ +#ifndef _KVM_SUPPORT_H_ +#define _KVM_SUPPORT_H_ + +#include "Tiano.h" +#include "EfiDriverLib.h" +#include "BdsLib.h" +#include "AmtLib.h" +#include "MeLib.h" + +BOOLEAN +BdsKvmInitialization ( + IN VOID + ) +/*++ + +Routine Description: + + Request KVM message. + +Arguments: + + None. + +Returns: + + True KVM Boot Option is an active. + +--*/ +; +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/Performance.c b/Board/EM/MeWrapper/AmtWrapper/Dxe/Performance.c new file mode 100644 index 0000000..deb51a4 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/Performance.c @@ -0,0 +1,431 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/Performance.c 3 5/14/14 9:53p Tristinchou $ +// +// $Revision: 3 $ +// +// $Date: 5/14/14 9:53p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/Performance.c $ +// +// 3 5/14/14 9:53p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 2 9/19/12 6:35a Klzhan +// Fix Build error when Performance is enabled. +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 2 9/21/11 9:00a Klzhan +// [TAG] EIP69500 +// [Category] Bug Fix +// [Severity] Minor +// [Symptom] Compiler Error when DXE_PERFORMANCE is on +// [RootCause] EDK Library doesn't support this function. +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: Performance.c +// +// Description: help to get the system performance +// +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004 - 2005, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + Performance.c + +Abstract: + + This file include the file which can help to get the system + performance, all the function will only include if the performance + switch is set. + +--*/ + +#include "Tiano.h" +#include "EfiDriverLib.h" +#include "EfiPrintLib.h" + +#ifndef GUID_VARIABLE_DECLARATION +#define GUID_VARIABLE_DECLARATION(Variable, Guid) extern EFI_GUID Variable +#endif + +//#define EFI_DXE_PERFORMANCE + +#ifdef EFI_DXE_PERFORMANCE +#include "EfiImage.h" +#include "Include\Protocol\Performance.h" + +VOID +ConvertChar16ToChar8 ( + IN CHAR8 *Dest, + IN CHAR16 *Src + ) +{ + while (*Src) { + *Dest++ = (UINT8) (*Src++); + } + + *Dest = 0; +} +#include <token.h> +#include EFI_ARCH_PROTOCOL_CONSUMER (Cpu) +#include EFI_GUID_DEFINITION (GlobalVariable) + + +extern EFI_STATUS GetTimerValue ( UINT64 *TimerValue );//extern UINT64 GetCpuTimer (); +extern UINT64 DivU64x32 (UINT64 Dividend,UINTN Divisor,UINTN *Remainder); +extern CHAR8 *EfiAsciiStrCpy (CHAR8 *Destination,CHAR8 *Source ); + +#define Div64(a,b,c) DivU64x32(a,b,c) +#define Strcpy(a,b) EfiAsciiStrCpy(a,b) +//********************************************************************** +// PERFORMANCE FUNCTIONS AND STRUCTURES +//********************************************************************** + +#define EFI_PERF_PEI_ENTRY_MAX_NUM 50 + +typedef struct { + CHAR8 Token[EFI_PERF_PDBFILENAME_LENGTH]; + UINT32 Duration; +} EFI_PERF_DATA; + +typedef struct { + UINT64 BootToOs; + UINT64 S3Resume; + UINT32 S3EntryNum; + EFI_PERF_DATA S3Entry[EFI_PERF_PEI_ENTRY_MAX_NUM]; + UINT64 CpuFreq; + UINT64 BDSRaw; + UINT32 Count; + UINT32 Signiture; +} EFI_PERF_HEADER; +//************************************************************************* +//<AMI_PHDR_START> +// +// Name: WriteBootToOsPerformanceData +// +// Description: +// VOID WriteBootToOsPerformanceData() allocates a block of memory and +// writes performance data into it. +// +// Input: +// VOID. +// +// Output: +// VOID. +// +// Modified: +// +// Referrals: +// GetCpuTimer +// Div64 +// Strcpy +// +// Notes: +// This function must only be called once; by default, it is called by BDS. +// +//<AMI_PHDR_END> +//************************************************************************* +VOID WriteBootToOsPerformanceData (){ + static EFI_PHYSICAL_ADDRESS AcpiLowMemoryBase = 0; + static BOOLEAN FirstCall = TRUE; + + EFI_STATUS Status; + EFI_CPU_ARCH_PROTOCOL *Cpu; + EFI_PERFORMANCE_PROTOCOL *DrvPerf; + UINT32 AcpiLowMemoryLength; + UINT32 LimitCount; + EFI_PERF_HEADER PerfHeader; + EFI_PERF_DATA PerfData; + EFI_GAUGE_DATA *DumpData; + EFI_HANDLE *Handles; + UINTN NoHandles; + UINT8 *Ptr; + UINT8 *PdbFileName; + UINT32 Index; + UINT64 Ticker; + UINT64 Freq; + UINT32 Duration; + UINT64 CurrentTicker; + UINT64 TimerPeriod; + EFI_GUID gEfiGlobalVariableGuid = EFI_GLOBAL_VARIABLE_GUID; + IN CHAR8 *Dest; + IN CHAR16 *Src; + UINT32 VarAttr; + UINTN VarSize; + + + + // Retrive time stamp count as early as possilbe + GetTimerValue(&Ticker);//Ticker = GetCpuTimer (); //Bruce[c] + + // Allocate a block of memory that contain performance data to OS for the first call + if(FirstCall) + { + Status = gBS->AllocatePages ( + AllocateAnyPages, + EfiRuntimeServicesData, + 4, + &AcpiLowMemoryBase + ); + if (EFI_ERROR (Status)) { + return ; + } + } + + AcpiLowMemoryLength = EFI_PAGES_TO_SIZE(4); + + Ptr = (UINT8 *) ((UINT32) AcpiLowMemoryBase + sizeof (EFI_PERF_HEADER)); + LimitCount = (AcpiLowMemoryLength - sizeof (EFI_PERF_HEADER)) / sizeof (EFI_PERF_DATA); + + // Get performance architecture protocol + Status = gBS->LocateProtocol ( + &gEfiPerformanceProtocolGuid, + NULL, + &DrvPerf + ); + if (EFI_ERROR (Status)) { + gBS->FreePages (AcpiLowMemoryBase, 4); + return ; + } + // Initialize performance data structure + gBS->SetMem (&PerfHeader, sizeof (EFI_PERF_HEADER), 0); + + // Get CPU frequency + Status = gBS->LocateProtocol ( + &gEfiCpuArchProtocolGuid, + NULL, + &Cpu + ); + if (EFI_ERROR (Status)) { + gBS->FreePages (AcpiLowMemoryBase, 4); + return ; + } + // Get Cpu Frequency + Status = Cpu->GetTimerValue (Cpu, 0, &(CurrentTicker), &TimerPeriod); + if (EFI_ERROR (Status)) { + gBS->FreePages (AcpiLowMemoryBase, 4); + return ; + } + + Freq = Div64(1000000000000, (UINTN) TimerPeriod, NULL); + PerfHeader.CpuFreq = Freq; + + // Record current raw performance data + PerfHeader.BDSRaw = Ticker; + + // Put Detailed performance data into memory + Handles = NULL; + Status = gBS->LocateHandleBuffer ( + AllHandles, + NULL, + NULL, + &NoHandles, + &Handles + ); + if (EFI_ERROR (Status)) { + gBS->FreePages (AcpiLowMemoryBase, 1); + return ; + } + + // Get DXE drivers performance + for (Index = 0; Index < NoHandles; Index++) { + Ticker = 0; + PdbFileName = NULL; + DumpData = DrvPerf->GetGauge ( + DrvPerf, // Context + NULL, // Handle + NULL, // Token + NULL, // Host + NULL // PrecGauge + ); + while (DumpData) { + if (DumpData->Handle == Handles[Index]) { + PdbFileName = &(DumpData->PdbFileName[0]); + if (DumpData->StartTick < DumpData->EndTick) { + Ticker += (DumpData->EndTick - DumpData->StartTick); + } + } + + DumpData = DrvPerf->GetGauge ( + DrvPerf, // Context + NULL, // Handle + NULL, // Token + NULL, // Host + DumpData // PrecGauge + ); + } + + Duration = (UINT32) Div64 ( + Ticker, + (UINT32) Freq, + NULL + ); + + if (Duration > 0) { + gBS->SetMem (&PerfData, sizeof (EFI_PERF_DATA), 0); + + if (PdbFileName != NULL) { + Strcpy (PerfData.Token, PdbFileName); + } + + PerfData.Duration = Duration; + + gBS->CopyMem (Ptr, &PerfData, sizeof (EFI_PERF_DATA)); + Ptr += sizeof (EFI_PERF_DATA); + + PerfHeader.Count++; + if (PerfHeader.Count == LimitCount) { + goto Done; + } + } + } + + gBS->FreePool (Handles); + + // Get inserted performance data + DumpData = DrvPerf->GetGauge ( + DrvPerf, // Context + NULL, // Handle + NULL, // Token + NULL, // Host + NULL // PrecGauge + ); + while (DumpData) { + if ((DumpData->Handle) || (DumpData->StartTick > DumpData->EndTick)) { + DumpData = DrvPerf->GetGauge ( + DrvPerf, // Context + NULL, // Handle + NULL, // Token + NULL, // Host + DumpData // PrecGauge + ); + continue; + } + + gBS->SetMem (&PerfData, sizeof (EFI_PERF_DATA), 0); + + //convert CHAR16 string to CHAR8 string + Src = DumpData->Token; + Dest = (UINT8 *) PerfData.Token; + while (*Src) *Dest++ = (UINT8) (*Src++); + *Dest = 0; + + PerfData.Duration = (UINT32) Div64 ( + DumpData->EndTick - DumpData->StartTick, + (UINT32) Freq, + NULL + ); + + gBS->CopyMem(Ptr, &PerfData, sizeof (EFI_PERF_DATA)); + Ptr += sizeof (EFI_PERF_DATA); + + PerfHeader.Count++; + if (PerfHeader.Count == LimitCount) { + goto Done; + } + + DumpData = DrvPerf->GetGauge ( + DrvPerf, // Context + NULL, // Handle + NULL, // Token + NULL, // Host + DumpData // PrecGauge + ); + } + +Done: + PerfHeader.Signiture = 0x66726550; + + // Put performance data to memory + gBS->CopyMem ( + (UINTN *) (UINTN) AcpiLowMemoryBase, + &PerfHeader, + sizeof (EFI_PERF_HEADER) + ); + + if(FirstCall) + { + VarAttr = 0; + VarSize = 0; + + Status = gRT->GetVariable( + L"PerfDataMemAddr", + &gEfiGlobalVariableGuid, + &VarAttr, + &VarSize, + NULL ); + if( EFI_ERROR(Status) && Status != EFI_BUFFER_TOO_SMALL ) + { + VarAttr = EFI_VARIABLE_NON_VOLATILE | EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_RUNTIME_ACCESS; + VarSize = sizeof(UINT32); + } + + gRT->SetVariable ( + L"PerfDataMemAddr", + &gEfiGlobalVariableGuid, + VarAttr, + VarSize, + (VOID *) &AcpiLowMemoryBase ); + + FirstCall = FALSE; + } +} + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/AmtWrapper/Dxe/Performance.h b/Board/EM/MeWrapper/AmtWrapper/Dxe/Performance.h new file mode 100644 index 0000000..4fffd9e --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Dxe/Performance.h @@ -0,0 +1,87 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/Performance.h 1 2/08/12 1:08a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:08a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperDxe/Performance.h $ +// +// 1 2/08/12 1:08a Klzhan +// Initial Check in +// +// 1 2/25/11 1:44a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: Performance.h +// +// Description: This file included the performance relete function header +// and definition. +// +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004, Intel Corporation +All rights reserved. This program and the accompanying materials +are licensed and made available under the terms and conditions of the BSD License +which accompanies this distribution. The full text of the license may be found at +http://opensource.org/licenses/bsd-license.php + +THE PROGRAM IS DISTRIBUTED UNDER THE BSD LICENSE ON AN "AS IS" BASIS, +WITHOUT WARRANTIES OR REPRESENTATIONS OF ANY KIND, EITHER EXPRESS OR IMPLIED. + +Module Name: + + Performance.h + +Abstract: + + This file included the performance relete function header and + definition. + +--*/ + +#ifndef _PERF_H_ +#define _PERF_H_ + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapper/AmtWrapper.c b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapper/AmtWrapper.c new file mode 100644 index 0000000..d6fc5c3 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapper/AmtWrapper.c @@ -0,0 +1,68 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperProtocolLib/AmtWrapper/AmtWrapper.c 1 2/08/12 1:09a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:09a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperProtocolLib/AmtWrapper/AmtWrapper.c $ +// +// 1 2/08/12 1:09a Klzhan +// Initial Check in +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AmtWrapper.c +// +// Description: Amt Wrapper Define file +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "Efi.h" + +#include EFI_PROTOCOL_DEFINITION(AmtWrapper) + +EFI_GUID gEfiAmtWrapperProtocolGuid = EFI_AMT_WRAPPER_PROTOCOL_GUID; + +EFI_GUID_STRING(&gEfiAmtWrapperProtocolGuid, "AMT Wrapper Protocol", "AMT Wrapper Protocol"); + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapper/AmtWrapper.h b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapper/AmtWrapper.h new file mode 100644 index 0000000..57ef64c --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapper/AmtWrapper.h @@ -0,0 +1,180 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperProtocolLib/AmtWrapper/AmtWrapper.h 1 2/08/12 1:09a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:09a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperProtocolLib/AmtWrapper/AmtWrapper.h $ +// +// 1 2/08/12 1:09a Klzhan +// Initial Check in +// +// 1 2/25/11 1:43a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: AmtWrapper.c +// +// Description: Amt Wrapper Define file +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#ifndef _EFI_BDS_ASF_H +#define _EFI_BDS_ASF_H + +#define EFI_AMT_WRAPPER_PROTOCOL_GUID \ + { 0xd54f49f6, 0xdd4, 0x4276, 0xb0, 0x9c, 0xdf, 0xe1, 0xfd, 0x80, 0x85, 0xf0 } + +EFI_FORWARD_DECLARATION (AMT_WRAPPER_PROTOCOL); + +typedef +EFI_STATUS +(EFIAPI *AMT_WRAPPER_INIT) ( + EFI_HANDLE ImageHandle, + EFI_SYSTEM_TABLE *SystemTable +); + +typedef +BOOLEAN +(EFIAPI *AMT_WRAPPER_GET) ( + UINTN Index, + VOID *pVar +); + +typedef +BOOLEAN +(EFIAPI *AMT_WRAPPER_SET) ( + UINTN Index, + VOID *pVar +); + +typedef +BOOLEAN +(EFIAPI *ACTIVE_MANAGEMENT_ENABLE_KVM) ( + IN VOID +); + +typedef +BOOLEAN +(EFIAPI *AMT_INITIALIZATION_KVM) ( + IN VOID +); + +typedef +BOOLEAN +(EFIAPI *ACTIVE_MANAGEMENT_ENABLE_SOL) ( + IN VOID +); + +typedef +BOOLEAN +(EFIAPI *ACTIVE_MANAGEMENT_ENABLE_IDER) ( + IN VOID +); + +/* +typedef +EFI_STATUS +(EFIAPI *AMT_WRAPPER_INITIALIZATION) ( + IN VOID +); +*/ + +typedef +EFI_STATUS +(EFIAPI *BDS_BOOT_VIA_ASF) ( + IN VOID +); + +typedef +BOOLEAN +(EFIAPI *ACTIVE_MANAGEMENT_PAUSE_BOOT) ( + IN VOID +); + +typedef +BOOLEAN +(EFIAPI *ACTIVE_MANAGEMENT_ENTER_SETUP) ( + IN VOID +); + +typedef +BOOLEAN +(EFIAPI *ACTIVE_MANAGEMENT_CONSOLE_LOCKED) ( + IN VOID +); +typedef +EFI_STATUS +(EFIAPI *BDSLIB_UPDATE_CONSOLE_VARIABLE) ( + IN CHAR16 *ConVarName, + IN EFI_DEVICE_PATH_PROTOCOL *CustomizedConDevicePath, + IN EFI_DEVICE_PATH_PROTOCOL *ExclusiveDevicePath +); + +typedef struct _AMT_WRAPPER_PROTOCOL { + AMT_WRAPPER_INIT AmtWrapperInit; + AMT_WRAPPER_GET AmtWrapperGet; + AMT_WRAPPER_SET AmtWrapperSet; + ACTIVE_MANAGEMENT_ENABLE_SOL ActiveManagementEnableSol; + ACTIVE_MANAGEMENT_ENABLE_IDER ActiveManagementEnableIdeR; + ACTIVE_MANAGEMENT_PAUSE_BOOT ActiveManagementPauseBoot; + ACTIVE_MANAGEMENT_ENTER_SETUP ActiveManagementEnterSetup; + //AMT_WRAPPER_INITIALIZATION AsfSupportInit; + BDS_BOOT_VIA_ASF BdsBootViaAsf; + BDSLIB_UPDATE_CONSOLE_VARIABLE BdsLibUpdateConsoleVariable; + ACTIVE_MANAGEMENT_CONSOLE_LOCKED ActiveManagementConsoleLocked; + ACTIVE_MANAGEMENT_ENABLE_KVM ActiveManagementEnableKvm; + AMT_INITIALIZATION_KVM AmtInitializationKvm; +} AMT_WRAPPER_PROTOCOL; + +#define GET_SOL_DP 1 +#define GET_TIME_OUT 2 // return UINT16 +#define GET_BOOT_OPTION 3 // return UINT16 +#define GET_IS_SOL 4 // return UINT16 +#define GET_IS_IDER 5 // return UINT16 + +#define SET_BIOS_WDT_START 1 +#define SET_WDT_STOP 2 +#define SET_OS_SOL 3 +#define SET_OS_WDT_START 4 + +#endif //_EFI_HECI_H +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.cif b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.cif new file mode 100644 index 0000000..403d469 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.cif @@ -0,0 +1,11 @@ +<component> + name = "AmtWrapperProtocolLib" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AmtWrapper\Protocol" + RefName = "AmtWrapperProtocolLib" +[files] +"AmtWrapperProtocolLib.sdl" +"AmtWrapperProtocolLib.mak" +"AmtWrapper\AmtWrapper.h" +"AmtWrapper\AmtWrapper.c" +<endComponent> diff --git a/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.mak b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.mak new file mode 100644 index 0000000..551df9d --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.mak @@ -0,0 +1,65 @@ +#********************************************************************** +#********************************************************************** +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 6145-F Northbelt Pkwy, Norcross, GA 30071 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#********************************************************************** +#********************************************************************** +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/AmtWrapper/AmtWrapperProtocolLib/AmtWrapperProtocolLib.mak 1 2/08/12 1:09a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:09a $ +#********************************************************************** +# Revision History +# ---------------- +# +#********************************************************************** +#<AMI_FHDR_START> +# +# Name: AmtWrapperProtocolLib.mak +# +# Description: +# +#<AMI_FHDR_END> +#********************************************************************** +all : AmtWrapperProtocolLib + +$(BUILD_DIR)\AmtWrapperProtocolLib.lib : AmtWrapperProtocolLib + +AmtWrapperProtocolLib : $(BUILD_DIR)\AmtWrapperProtocolLib.mak AmtWrapperProtocolLibBin + +$(BUILD_DIR)\AmtWrapperProtocolLib.mak : $(AmtWrapperProtocolLib_DIR)\$(@B).cif $(AmtWrapperProtocolLib_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(AmtWrapperProtocolLib_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +AmtWrapperProtocolLib_INCLUDES=\ + $(EDK_INCLUDES) \ + $(ME_INCLUDES) \ + $(MISCFRAMEWORK_INCLUDES) + +AmtWrapperProtocolLibBin : + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\AmtWrapperProtocolLib.mak all\ + "MY_INCLUDES=$(AmtWrapperProtocolLib_INCLUDES)" \ + TYPE=LIBRARY \ + +#********************************************************************** +#********************************************************************** +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 6145-F Northbelt Pkwy, Norcross, GA 30071 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#********************************************************************** +#**********************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.sdl b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.sdl new file mode 100644 index 0000000..bc00d62 --- /dev/null +++ b/Board/EM/MeWrapper/AmtWrapper/Protocol/AmtWrapperProtocolLib.sdl @@ -0,0 +1,34 @@ +TOKEN + Name = "AmtWrapperProtocolLib_SUPPORT" + Value = "1" + Help = "Main switch to enable AmtWrapperProtocolLib support in Project" + TokenType = Boolean + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "AmtWrapperProtocolLib_DIR" +End + +ELINK + Name = "/I$(AmtWrapperProtocolLib_DIR)\AmtWrapper" + Parent = "ME_INCLUDES" + InvokeOrder = AfterParent +End + +MODULE + Help = "Includes AmtWrapperProtocolLib.mak to Project" + File = "AmtWrapperProtocolLib.mak" +End + +ELINK + Name = "AmtWrapperProtocolLib_LIB" + InvokeOrder = ReplaceParent +End + +ELINK + Name = "$(BUILD_DIR)\AmtWrapperProtocolLib.lib" + Parent = "AmtWrapperProtocolLib_LIB" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/AtAmUi/AtAmUi.c b/Board/EM/MeWrapper/AtAmUi/AtAmUi.c new file mode 100644 index 0000000..8a2cffe --- /dev/null +++ b/Board/EM/MeWrapper/AtAmUi/AtAmUi.c @@ -0,0 +1,1120 @@ +/** @file + This file contines rouines responsible for handling the UI. + +@copyright + Copyright (c) 2012 - 2013 Intel Corporation. All rights reserved + This software and associated documentation (if any) is furnished + under a license and may only be used or copied in accordance + with the terms of the license. Except as permitted by such + license, no part of this software or documentation may be + reproduced, stored in a retrieval system, or transmitted in any + form or by any means without the express written consent of + Intel Corporation. + + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement + +**/ +#include "AtAmUi.h" +#include EFI_PROTOCOL_CONSUMER (ConsoleControl) +#include EFI_PROTOCOL_CONSUMER (GraphicsOutput) +DXE_AT_POLICY_PROTOCOL *mDxePlatformAtPolicy; +EFI_GUID gAlertAtHandlerGuid = ME_ALERT_AT_HANDLER_GUID; +EFI_GUID gEfiAtAmProtocolGuid = EFI_ATAM_PROTOCOL_GUID; +EFI_EVENT gAlertAtHandlerEvent; +EFI_ATAM_PROTOCOL *mAtAm = NULL; + +// +// Driver entry point +// +EFI_DRIVER_ENTRY_POINT (AtAmUiEntryPoint); + +/** + ATAM UI driver entry point. + + @param[in] ImageHandle Handle for this drivers loaded image protocol. + @param[in] SystemTable EFI system table. + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_UNSUPPORTED The function is unsupported by this driver +**/ +EFI_STATUS +AtAmUiEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable + ) +{ + EFI_STATUS Status; + + EfiInitializeDriverLib (ImageHandle, SystemTable); + Status = gBS->LocateProtocol ( + &gDxePlatformAtPolicyGuid, + NULL, + &mDxePlatformAtPolicy + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: No AT Platform Policy Protocol available")); + return Status; + } + ASSERT_EFI_ERROR (Status); + + if (mDxePlatformAtPolicy->At.AtAmBypass == 1) { + return EFI_SUCCESS; + } + + if (mAtAm == NULL) { + Status = gBS->LocateProtocol ( + &gEfiAtAmProtocolGuid, + NULL, + (VOID **) &mAtAm + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM Protocol failed, Status = %r\n", Status)); + return Status; + } else { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM Protocol success, Status = %r\n", Status)); + } + } + + Status = gBS->CreateEventEx ( + EFI_EVENT_NOTIFY_SIGNAL, + EFI_TPL_CALLBACK, + AtAmUiCallback, + NULL, + &gAlertAtHandlerGuid, + &gAlertAtHandlerEvent + ); + + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AT - Error Creating Event to Process Suspend Mode\n")); + } + + return Status; +} +EFI_CONSOLE_CONTROL_PROTOCOL *ConsoleControl; +EFI_GRAPHICS_OUTPUT_PROTOCOL *GraphicsOutput; +EFI_CONSOLE_CONTROL_SCREEN_MODE ScreenMode; +EFI_GRAPHICS_OUTPUT_MODE_INFORMATION *GraphicsModeInfo; +UINTN UgaBltSize = 0; +EFI_UGA_PIXEL *UgaBlt = NULL; +INT32 TextMode; +UINTN StyleGetTextMode(); + +VOID +GraphicsSave +( + VOID +) +{ + UINTN SizeOfGraphicsModeInfo; + + EFI_STATUS + Status = gBS->LocateProtocol( &gEfiConsoleControlProtocolGuid, NULL, &ConsoleControl); + + if(EFI_ERROR(Status)) + { + ConsoleControl = NULL; + return; + } + + Status = ConsoleControl->GetMode(ConsoleControl, &ScreenMode, NULL, NULL); + if(ScreenMode == EfiConsoleControlScreenText) + { + ConsoleControl = NULL; + return; + } + + Status = gBS->LocateProtocol( &gEfiGraphicsOutputProtocolGuid, NULL, &GraphicsOutput); + if(EFI_ERROR(Status)) + { + GraphicsOutput = NULL; + return; + } + + Status = GraphicsOutput->QueryMode( GraphicsOutput, GraphicsOutput->Mode->Mode, + &SizeOfGraphicsModeInfo ,&GraphicsModeInfo); + if(EFI_ERROR(Status)) + { + GraphicsModeInfo = NULL; + return; + } + + UgaBltSize = GraphicsModeInfo->HorizontalResolution * + GraphicsModeInfo->VerticalResolution * + sizeof(EFI_UGA_PIXEL); + + UgaBlt = AllocateZeroPool (UgaBltSize); + if( UgaBlt == NULL ) + return; + + Status = GraphicsOutput->Blt( + GraphicsOutput, + UgaBlt, + EfiBltVideoToBltBuffer, + 0, 0, + 0, 0, + GraphicsModeInfo->HorizontalResolution, + GraphicsModeInfo->VerticalResolution, + 0); + + Status = ConsoleControl->SetMode( ConsoleControl, EfiConsoleControlScreenText ); + TextMode = gST->ConOut->Mode->Mode; + gST->ConOut->SetMode(gST->ConOut, StyleGetTextMode()); +} + +VOID +GraphicsRestore +( + VOID +) +{ + if(!ConsoleControl) + return; + + gST->ConOut->SetMode(gST->ConOut, TextMode); + ConsoleControl->SetMode( ConsoleControl, EfiConsoleControlScreenGraphics ); + + if(!GraphicsOutput) + return; + + if(!UgaBlt || !GraphicsModeInfo) + return; + + GraphicsOutput->Blt( + GraphicsOutput, + UgaBlt, + EfiBltBufferToVideo, + 0, 0, + 0, 0, + GraphicsModeInfo->HorizontalResolution, + GraphicsModeInfo->VerticalResolution, + 0); + + ZeroMem(UgaBlt, UgaBltSize); + FreePool(UgaBlt); +} +/** + ATAM UI callback. + + @param[in] Event The event registered + @param[in] Context Event context. Not used in this event handler. + + @retval None +**/ +VOID +EFIAPI +AtAmUiCallback ( + IN EFI_EVENT Event, + IN VOID *Context + ) +{ + EFI_STATUS Status; + DXE_AT_POLICY_PROTOCOL *pAtPlatformPolicy; + AT_STATE_INFO AtStateInfo; + EFI_TPL TplBackup; + + pAtPlatformPolicy = NULL; + + DEBUG ((EFI_D_ERROR, "ATAM: AtAmUiCallback \n")); + // + // change TPL to APPLICATION as required by ConIn to function + // + TplBackup = gBS->RaiseTPL (TPL_HIGH_LEVEL); + gBS->RestoreTPL (TplBackup); + if (TplBackup != TPL_APPLICATION) { + gBS->RestoreTPL(TPL_APPLICATION); + } + + Status = gBS->LocateProtocol ( + &gDxePlatformAtPolicyGuid, + NULL, + (VOID **) &pAtPlatformPolicy + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM LocateProtocol failed. \n")); + } + + if (mAtAm == NULL) { + Status = gBS->LocateProtocol ( + &gEfiAtAmProtocolGuid, + NULL, + (VOID **) &mAtAm + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM Protocol failed, Status = %r\n", Status)); + } + } + + mAtAm->AtAmGetAtStateInfo (mAtAm, &AtStateInfo); + + if (AtStateInfo.State == AT_STATE_STOLEN && pAtPlatformPolicy->At.AtPba == 1 && pAtPlatformPolicy->At.AtSupported == 0) { + AtAmUiTheftNotification (); + + } else if (AtStateInfo.State == AT_STATE_STOLEN && AtStateInfo.flags.LockState == 1 && AtStateInfo.flags.AuthenticateModule == AT_AM_SELECTION_ATAM) { + GraphicsSave(); + AtAmUiRecovery (); + GraphicsRestore(); + } else if (AtStateInfo.State == AT_STATE_SUSPEND) { + GraphicsSave(); + AtAmUiExitSuspendState (); + GraphicsRestore(); + } else if (AtStateInfo.State == AT_STATE_ACTIVE) { + if (pAtPlatformPolicy->At.AtEnterSuspendState) { + GraphicsSave(); + AtAmUiEnterSuspendState (); + GraphicsRestore(); + } + } + + // + // Restore TPL + // + if (TplBackup != TPL_APPLICATION) { + gBS->RaiseTPL(TplBackup); + } + + + return; +} + +/** + Function handling entering suspend mode. + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiEnterSuspendState ( + VOID + ) +{ + EFI_STATUS Status; + UINT8 *PasswordASCII; + CHAR16 *PasswordUNICODE; + CHAR16 *UniCodeNonceStr; + UINT32 NumOfAttempts; + UINT8 NonceStr[STR_NONCE_LENGTH]; + UINT32 CRow; + UINT32 CCol; + UINT8 *IsvString; + UINT32 IsvId; + AT_BIOS_RECOVERY_CONFIG RecoveryConfig; + + Status = EFI_SUCCESS; + NumOfAttempts = ATAMUI_SUSPEND_ATTEMPTS; + + UniCodeNonceStr = AllocateZeroPool ((STR_NONCE_LENGTH + 1) * sizeof (CHAR16)); + PasswordASCII = AllocateZeroPool ((ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (UINT8)); + PasswordUNICODE = AllocateZeroPool ((ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (CHAR16)); + IsvString = AllocateZeroPool ((RECOVERY_STRING_LENGTH + 1) * sizeof (UINT8)); + + if (PasswordASCII == NULL || PasswordUNICODE == NULL || UniCodeNonceStr == NULL || IsvString == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + if (mAtAm == NULL) { + Status = gBS->LocateProtocol ( + &gEfiAtAmProtocolGuid, + NULL, + (VOID **) &mAtAm + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM Protocol failed, Status = %r\n", Status)); + } + } + + AtAmUiStrGetCursor (&CRow, &CCol); + + do { + AtAmUiStrClearScreen (); + + RecoveryConfig.IsvPlatformId[0] = L'\0'; + Status = mAtAm->AtAmGetRecoveryConfig (mAtAm, &RecoveryConfig); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetRecoveryConfig command failed, Status = %r\n", Status)); + } + if (RecoveryConfig.IsvPlatformId[0] != L'\0') { + AtAmUiStrSetCursor(4, 13); + AtAmUiStrDisplayFix (STR_ATAMUI_PLATFORM_ID, FALSE); + AtAmUiStrDisplay ((CHAR16 *) RecoveryConfig.IsvPlatformId); + } + + AtAmUiStrSetCursor(4, 14); + Status = mAtAm->AtAmGetIsvId (mAtAm, IsvString, &IsvId); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetIsvId command failed, Status = %r\n", Status)); + } + AtAmUiStrDisplay ((CHAR16 *) IsvString); + + AtAmUiStrEnableCursor (FALSE); + + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_ENTER_INFO, TRUE); + + AtAmUiStrSetCursor (4, 2); + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_REFER, FALSE); + Status = mAtAm->AtAmGetNonce (mAtAm, NonceStr); + if (Status == EFI_SUCCESS) { + Uint8ToUnicode (NonceStr, UniCodeNonceStr); + AtAmUiStrDisplay ((UINT16 *) UniCodeNonceStr); + } else { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_NONCE_FAILED, FALSE); + DEBUG ((EFI_D_ERROR, "ATAM: Get Nonce failed, Status = %r\n", Status)); + } + + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_ENTER_TOKEN, TRUE); + AtAmUiStrEnableCursor (TRUE); + AtAmUiGetPassword (PasswordASCII, ATAM_SETUP_PASSWORD_LENGTH, PasswordUNICODE, 1); + AtAmUiStrEnableCursor (FALSE); + + Status = mAtAm->AtAmSetSuspendState (mAtAm, ATAM_ENTER_SUSPEND_STATE, PasswordASCII); + if (Status != EFI_SUCCESS) { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_ENTER_FAILED, TRUE); + AtAmUiDelay (2 * AT_AM_UI_1_SECOND); + } + + } while (--NumOfAttempts && (Status != EFI_SUCCESS)); + + if (Status == EFI_SUCCESS) { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_ENTER_SUCCESS, TRUE); + } else { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_ATTEMPT_EXC, TRUE); + } + + ZeroMem (UniCodeNonceStr, (STR_NONCE_LENGTH + 1) * sizeof (UINT16)); + ZeroMem (PasswordASCII, (ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (CHAR8)); + ZeroMem (PasswordUNICODE, (ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (CHAR16)); + + FreePool (UniCodeNonceStr); + FreePool (PasswordASCII); + FreePool (PasswordUNICODE); + + AtAmUiDelay (AT_AM_UI_1_SECOND); + + AtAmUiStrClearScreen (); + AtAmUiStrSetCursor (CCol, CRow); + + return Status; +} + +/** + Function handling exiting suspend mode. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiExitSuspendState ( + VOID + ) +{ + EFI_STATUS Status; + UINT8 *PasswordASCII; + CHAR16 *PasswordUNICODE; + CHAR16 *UniCodeNonceStr; + UINT32 NumOfAttempts; + UINT8 NonceStr[STR_NONCE_LENGTH]; + EFI_INPUT_KEY Key; + UINT32 CRow; + UINT32 CCol; + UINT8 *IsvString; + UINT32 IsvId; + AT_BIOS_RECOVERY_CONFIG RecoveryConfig; + + Status = EFI_SUCCESS; + NumOfAttempts = 3; + + UniCodeNonceStr = AllocateZeroPool ((STR_NONCE_LENGTH + 1) * sizeof (CHAR16)); + PasswordASCII = AllocateZeroPool ((ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (UINT8)); + PasswordUNICODE = AllocateZeroPool ((ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (CHAR16)); + IsvString = AllocateZeroPool ((RECOVERY_STRING_LENGTH + 1) * sizeof (UINT8)); + + if (PasswordASCII == NULL || PasswordUNICODE == NULL || UniCodeNonceStr == NULL || IsvString == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + if (mAtAm == NULL) { + Status = gBS->LocateProtocol ( + &gEfiAtAmProtocolGuid, + NULL, + (VOID **) &mAtAm + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM Protocol failed, Status = %r\n", Status)); + } + } + + AtAmUiStrGetCursor (&CRow, &CCol); + + do { + AtAmUiStrClearScreen (); + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_EXIT_QUESTION, TRUE); + + AtAmUiStrGetChar (&Key); + if (Key.UnicodeChar == L'y' || Key.UnicodeChar == L'Y' || Key.UnicodeChar == L'n' || Key.UnicodeChar == L'N') { + AtAmUiStrEnableCursor(FALSE); + break; + } + } while (1); + + if (Key.UnicodeChar == L'y' || Key.UnicodeChar == L'Y') { + do { + AtAmUiStrClearScreen (); + + RecoveryConfig.IsvPlatformId[0] = L'\0'; + Status = mAtAm->AtAmGetRecoveryConfig (mAtAm, &RecoveryConfig); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetRecoveryConfig command failed, Status = %r\n", Status)); + } + if (RecoveryConfig.IsvPlatformId[0] != L'\0') { + AtAmUiStrSetCursor(4, 13); + AtAmUiStrDisplayFix (STR_ATAMUI_PLATFORM_ID, FALSE); + AtAmUiStrDisplay ((CHAR16 *) RecoveryConfig.IsvPlatformId); + } + + AtAmUiStrSetCursor(4, 14); + Status = mAtAm->AtAmGetIsvId (mAtAm, IsvString, &IsvId); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetIsvId command failed, Status = %r\n", Status)); + } + AtAmUiStrDisplay ((CHAR16 *) IsvString); + + AtAmUiStrEnableCursor (FALSE); + + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_EXIT_INFO, TRUE); + + AtAmUiStrSetCursor (4, 3); + AtAmUiStrDisplayFix (STR_ATAMUI_RES_REFER, FALSE); + mAtAm->AtAmGetNonce (mAtAm, NonceStr); + Uint8ToUnicode (NonceStr, UniCodeNonceStr); + AtAmUiStrDisplay ((UINT16 *) UniCodeNonceStr); + + AtAmUiStrSetCursor (4, 4); + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_ENTER_TOKEN, FALSE); + + AtAmUiStrEnableCursor (TRUE); + AtAmUiGetPassword (PasswordASCII, ATAM_SETUP_PASSWORD_LENGTH, PasswordUNICODE, 1); + AtAmUiStrEnableCursor (FALSE); + + AtAmUiStrDisplayFix (STR_ATAMUI_CHECKING_AUTHENT, TRUE); + + Status = mAtAm->AtAmSetSuspendState (mAtAm, ATAM_EXIT_SUSPEND_STATE, PasswordASCII); + if (Status != EFI_SUCCESS) { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_AUTH_FAILED, FALSE); + AtAmUiDelay (AT_AM_UI_1_SECOND); + } + + AtAmUiDelay (AT_AM_UI_1_SECOND); + } while (--NumOfAttempts && (Status != EFI_SUCCESS)); + + if (Status == EFI_SUCCESS) { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_EXIT_SUCCESS, TRUE); + + } else { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_ATTEMPT_EXC, TRUE); + AtAmUiDelay (AT_AM_UI_1_SECOND); + } + } else if (Key.UnicodeChar == L'n' || Key.UnicodeChar == L'N') { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_STAY, TRUE); + AtAmUiDelay (2 *AT_AM_UI_1_SECOND); + } + + ZeroMem (UniCodeNonceStr, (STR_NONCE_LENGTH + 1) * sizeof (UINT16)); + ZeroMem (PasswordASCII, (ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (CHAR8)); + ZeroMem (PasswordUNICODE, (ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (CHAR16)); + + FreePool (UniCodeNonceStr); + FreePool (PasswordASCII); + FreePool (PasswordUNICODE); + + AtAmUiDelay (AT_AM_UI_1_SECOND); + + AtAmUiStrClearScreen (); + AtAmUiStrSetCursor (CCol, CRow); + + return Status; +} + +VOID +EFIAPI +ShowAtTimerCallback ( + IN EFI_EVENT Event, + IN VOID *Context + ) +{ + UINT32 TimerLeft; + UINT32 TimerInterval; + static CHAR16 *TimeLeftStr = NULL; + EFI_STATUS Status; + UINT32 CRow; + UINT32 CCol; + + if(!TimeLeftStr) + TimeLeftStr = AllocateZeroPool ((ATAM_TIMER_STRING_LENGTH + 1) * sizeof (CHAR16)); + + AtAmUiStrGetCursor (&CRow, &CCol); + Status = mAtAm->AtAmGetTimer (mAtAm, &TimerLeft, &TimerInterval); + + if(EFI_ERROR(Status)) + return; + + UnicodeValueToString (TimeLeftStr, 0, TimerLeft, 0); + AtAmUiStrDisplayFix (STR_ATAMUI_TIME_LEFT, TRUE); + AtAmUiStrDisplay ((CHAR16 *) TimeLeftStr); + AtAmUiStrDisplayFix (STR_ATAMUI_TIME_LEFT_SEC,FALSE); + + AtAmUiStrSetCursor(CCol,CRow); +} +// Set the default TEXT MODE resolution the same with TSE +#define MAX_ROWS (UINT8)(31) +#define MAX_COLS (UINT8)(100) +UINTN StyleGetTextMode() +{ + EFI_STATUS Status; + INT32 i; + UINTN ModeRows, ModeCols; + + + // Default Implementation + for ( i = 0; i < gST->ConOut->Mode->MaxMode; i++ ) + { + Status = gST->ConOut->QueryMode( gST->ConOut, i, &ModeCols, &ModeRows ); + + if ( EFI_ERROR( Status ) ) + continue; + + if ( ( MAX_COLS <= ModeCols ) && ( MAX_ROWS <= ModeRows ) ) + return i; + } + + // return MaxMode if the mode wasn't found + return i; +} +/** + Function handling recovery proccess. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiRecovery ( + VOID + ) +{ + EFI_STATUS Status; + EFI_INPUT_KEY Key; + UINT32 PassType; + UINT8 IsAuthenticated; + AT_STATE_INFO StateInfo; + UINT32 TimerLeft; + UINT32 TimerInterval; + UINT8 *PasswordASCII; + CHAR16 *PasswordUNICODE; + CHAR16 *TimeLeftStr; + UINT8 *IsvString; + UINT32 CRow; + UINT32 CCol; + UINT32 NumberOfAttempts; + UINT32 IsvId; + CHAR16 *UniCodeNonceStr; + UINT8 NonceStr[STR_NONCE_LENGTH]; + + IsAuthenticated = 0; + + PasswordASCII = AllocateZeroPool ((ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (UINT8)); + PasswordUNICODE = AllocateZeroPool ((ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (CHAR16)); + TimeLeftStr = AllocateZeroPool ((ATAM_TIMER_STRING_LENGTH + 1) * sizeof (CHAR16)); + IsvString = AllocateZeroPool ((RECOVERY_STRING_LENGTH + 1) * sizeof (UINT8)); + UniCodeNonceStr = AllocateZeroPool ((STR_NONCE_LENGTH + 1) * sizeof (CHAR16)); + + if (PasswordASCII == NULL || PasswordUNICODE == NULL || TimeLeftStr == NULL || IsvString == NULL || UniCodeNonceStr == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + if (mAtAm == NULL) { + Status = gBS->LocateProtocol ( + &gEfiAtAmProtocolGuid, + NULL, + (VOID **) &mAtAm + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM Protocol failed, Status = %r\n", Status)); + } + } + + AtAmUiStrGetCursor (&CRow, &CCol); + + NumberOfAttempts = 3; + + do { + AtAmUiStrClearScreen (); + AtAmUiDisplayIsvStrings (); + + do { + AtAmUiStrEnableCursor (FALSE); + + AtAmUiStrSetCursor(4, 20); + Status = mAtAm->AtAmGetIsvId (mAtAm, IsvString, &IsvId); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetIsvId command failed, Status = %r\n", Status)); + } + AtAmUiStrDisplay ((CHAR16 *) IsvString); + + mAtAm->AtAmGetAtStateInfo (mAtAm, &StateInfo); + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_DUE_TO, TRUE); + switch (StateInfo.LastTheftTrigger) { + case 1: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_TIME, FALSE); + break; + + case 2: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_STOLEN, FALSE); + break; + + case 3: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_THRESHOLD, FALSE); + break; + + case 4: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_ATTACK, FALSE); + + default: + break; + } + + mAtAm->AtAmGetTimer (mAtAm, &TimerLeft, &TimerInterval); + UnicodeValueToString (TimeLeftStr, 0, TimerLeft, 0); + + AtAmUiStrDisplayFix (STR_ATAMUI_TIME_LEFT, TRUE); + AtAmUiStrDisplay ((CHAR16 *) TimeLeftStr); + AtAmUiStrDisplayFix (STR_ATAMUI_TIME_LEFT_SEC,FALSE); + + AtAmUiStrDisplayFix (STR_ATAMUI_SELECT_PASS, TRUE); + + AtAmUiStrDisplayFix (STR_ATAMUI_SELECT_OPTION, TRUE); + + AtAmUiStrGetChar (&Key); + if (Key.UnicodeChar == L'1' || Key.UnicodeChar == L'2') { + break; + } + + AtAmUiStrDisplayFix (STR_ATAMUI_INVALID_SELECT, TRUE); + } while (1); + + AtAmUiStrClearScreen (); + AtAmUiDisplayIsvStrings (); + AtAmUiStrSetCursor(4, 20); + AtAmUiStrDisplay ((CHAR16 *) IsvString); + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_DUE_TO, TRUE); + switch (StateInfo.LastTheftTrigger) { + case 1: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_TIME, FALSE); + break; + + case 2: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_STOLEN, FALSE); + break; + + case 3: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_THRESHOLD, FALSE); + break; + + case 4: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_ATTACK, FALSE); + + default: + break; + } + mAtAm->AtAmGetTimer (mAtAm, &TimerLeft, &TimerInterval); + UnicodeValueToString (TimeLeftStr, 0, TimerLeft, 0); + AtAmUiStrDisplayFix (STR_ATAMUI_TIME_LEFT, TRUE); + AtAmUiStrDisplay ((CHAR16 *) TimeLeftStr); + AtAmUiStrDisplayFix (STR_ATAMUI_TIME_LEFT_SEC,FALSE); + + switch (Key.UnicodeChar) { + case L'1': + PassType = AT_CREDENTIAL_TYPE_USER_PASSPHRASE; + AtAmUiStrDisplayFix (STR_ATAMUI_USER_PASS, TRUE); + AtAmUiStrDisplayFix (STR_ATAMUI_RECO_ENTER_PASS, TRUE); + AtAmUiStrEnableCursor (TRUE); + AtAmUiGetPassword (PasswordASCII, ATAM_SETUP_PASSWORD_LENGTH, PasswordUNICODE, 0); + AtAmUiStrEnableCursor (FALSE); + AtAmUiStrDisplayFix (STR_ATAMUI_CHECKING_PASS, TRUE); + AtAmUiDelay (AT_AM_UI_1_SECOND); + Status = mAtAm->AtAmVerifyPassword (mAtAm, PasswordASCII, PassType, &IsAuthenticated); + DEBUG ((EFI_D_ERROR, "ATAM: IsAuthenticated %x\n", IsAuthenticated)); + + break; + + case L'2': + AtAmUiStrDisplayFix (STR_ATAMUI_RECO_REFER, TRUE); + Status = mAtAm->AtAmGetNonce (mAtAm, NonceStr); + if (Status == EFI_SUCCESS) { + Uint8ToUnicode (NonceStr, UniCodeNonceStr); + AtAmUiStrDisplay ((UINT16 *) UniCodeNonceStr); + } else { + AtAmUiStrDisplayFix (STR_ATAMUI_SUS_NONCE_FAILED, FALSE); + DEBUG ((EFI_D_ERROR, "ATAM: Get Nonce failed, Status = %r\n", Status)); + } + AtAmUiStrDisplayFix (STR_ATAMUI_SERV_BASED_RECOV, TRUE); + AtAmUiStrSetCursor(4, 6); + AtAmUiStrDisplayFix (STR_ATAMUI_RECO_SEC_TOKEN, FALSE); + + PassType = AT_CREDENTIAL_TYPE_SRTK; + + AtAmUiStrEnableCursor (TRUE); + AtAmUiGetPassword (PasswordASCII, ATAM_SETUP_PASSWORD_LENGTH, PasswordUNICODE, 1); + AtAmUiStrEnableCursor (FALSE); + + AtAmUiStrDisplayFix (STR_ATAMUI_CHECKING_PASS, TRUE); + AtAmUiDelay (AT_AM_UI_1_SECOND); + Status = mAtAm->AtAmVerifyPassword (mAtAm, PasswordASCII, PassType, &IsAuthenticated); + DEBUG ((EFI_D_ERROR, "ATAM: IsAuthenticated %x\n", IsAuthenticated)); + + break; + + default: + DEBUG ((EFI_D_ERROR, "ATAM: Option not supported. \n")); + + break; + } + + ZeroMem (PasswordASCII, (ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (UINT8)); + ZeroMem (PasswordUNICODE, (ATAM_SETUP_PASSWORD_LENGTH + 1) * sizeof (CHAR16)); + + NumberOfAttempts--; + + if (NumberOfAttempts && IsAuthenticated == 0) { + AtAmUiStrDisplayFix (STR_ATAMUI_RECO_TRY_AGAIN, TRUE); + AtAmUiDelay (AT_AM_UI_1_SECOND); + } + + } while (NumberOfAttempts && (IsAuthenticated == 0)); + + FreePool (TimeLeftStr); + FreePool (PasswordASCII); + FreePool (PasswordUNICODE); + FreePool (IsvString); + FreePool (UniCodeNonceStr); + + if (IsAuthenticated == 1) { + AtAmUiStrDisplayFix (STR_ATAMUI_RECO_SUCCESS, TRUE); + AtAmUiDelay (2 * AT_AM_UI_1_SECOND); + } else { + AtAmUiStrDisplayFix (STR_ATAMUI_RECO_FAILED, TRUE); + AtAmUiDelay (2 * AT_AM_UI_1_SECOND); + gRT->ResetSystem (EfiResetShutdown, EFI_SUCCESS, 0, NULL); + } + + AtAmUiDelay (AT_AM_UI_1_SECOND); + AtAmUiStrClearScreen (); + AtAmUiStrSetCursor(CCol, CRow); + + return Status; +} + +/** + Function displaing Ivs strings. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiDisplayIsvStrings ( + VOID + ) +{ + EFI_STATUS Status; + CHAR16 *IsvIdString; + AT_BIOS_RECOVERY_CONFIG RecoveryConfig; + UINT8 *IsvString; + UINT32 IsvId; + UINT32 CRow; + UINT32 CCol; + + IsvId = 0; + + DEBUG ((EFI_D_ERROR, "ATAM: AtAmUiDisplayIsvStrings. \n")); + + IsvIdString = AllocateZeroPool (ISV_PLATFORM_ID_LENGTH * sizeof (CHAR16)); + IsvString = AllocateZeroPool ((RECOVERY_STRING_LENGTH + 1) * sizeof (UINT8)); + if (IsvIdString == NULL || IsvString == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + if (mAtAm == NULL) { + Status = gBS->LocateProtocol ( + &gEfiAtAmProtocolGuid, + NULL, + (VOID **) &mAtAm + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM Protocol failed, Status = %r\n", Status)); + } + } + + AtAmUiStrGetCursor (&CRow, &CCol); + + Status = mAtAm->AtAmGetIsvId (mAtAm, IsvString, &IsvId); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetIsvId command failed, Status = %r\n", Status)); + } + + RecoveryConfig.IsvPlatformId[0] = L'\0'; + Status = mAtAm->AtAmGetRecoveryConfig (mAtAm, &RecoveryConfig); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetRecoveryConfig command failed, Status = %r\n", Status)); + } + + if (RecoveryConfig.IsvPlatformId[0] != L'\0') { + AtAmUiStrDisplayFix (STR_ATAMUI_PLATFORM_ID, TRUE); + AtAmUiStrDisplay ((CHAR16 *) RecoveryConfig.IsvPlatformId); + } + + if (IsvId != 0) { + UnicodeValueToString (IsvIdString, 0, (UINT32) IsvId, 0); + AtAmUiStrDisplayFix (STR_ATAMUI_PROVIDER_ID, TRUE); + AtAmUiStrDisplay (IsvIdString); + } + + FreePool (IsvString); + FreePool (IsvIdString); + + return Status; +} + +/** + This GetRecoveryPassword() process the AT recovery password user input. + + @param[out] PasswordASCII Pointer to an array of ASCII user input + @param[in] MaxPasswordLength Integer value for max password length + @param[out] PasswordUNICODE Pointer to an array of UNICODE user input + @param[in] ShowPassword TRUE - password is shown, FALSE - pasword is hidden by * + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Do not have enough resources to allocate memory or password too long. +**/ +EFI_STATUS +AtAmUiGetPassword ( + OUT UINT8 *PasswordASCII, + IN INTN MaxPasswordLength, + OUT CHAR16 *PasswordUNICODE, + IN UINT8 ShowPassword + ) +{ + INTN StrIndex; + EFI_INPUT_KEY Key = { 0, 0 }; + CHAR16 StarChar[2] = { L' ', L'\0' }; + + DEBUG ((EFI_D_ERROR, "ATAM: AtAmUiGetRecoveryPassword \n")); + + PasswordASCII[0] = L'\0'; + PasswordUNICODE[0] = L'\0'; + + Key.UnicodeChar = 0; + Key.ScanCode = 0; + StrIndex = 0; + + DEBUG ((EFI_D_ERROR, "ATAM: Wait for Key \n")); + + AtAmUiStrEnableCursor (TRUE); + do { + Key.ScanCode = 0; + Key.UnicodeChar = 0; + AtAmUiStrGetChar (&Key); + DEBUG ((EFI_D_ERROR, "ATAM: PasswordUNICODE: %s\n", PasswordUNICODE)); + + switch (Key.UnicodeChar) { + case CHAR_NULL: + /// + /// Non-printable characters handling: do not print caps/numlock, pgup/dn, Fx, cursors etc. + /// When escape pressed, return with empty password and ask for password again + /// + if (Key.ScanCode == SCAN_ESC) { + PasswordASCII[0] = L'\0'; + PasswordUNICODE[0] = L'\0'; + StrIndex = 0; + return EFI_SUCCESS; + } + break; + + case CHAR_CARRIAGE_RETURN: + /// + /// Enter handling: when enter pressed, return with the password + /// + StrIndex = 0; + + DEBUG ((EFI_D_ERROR, "ATAM: Passphrase Entered: %s\n", PasswordUNICODE)); + return EFI_SUCCESS; + + case CHAR_BACKSPACE: + /// + /// Backspace handling + /// + if (StrIndex > 0) { + StrIndex--; + PasswordASCII[StrIndex] = L'\0'; + PasswordUNICODE[StrIndex] = L'\0'; + /// + /// Backspace printing on screen + /// + AtAmUiStrDisplay (L"\b \b"); + } + break; + + default: + /// + /// Normal (printable) characters handling + /// Do not hide password on screen for Server Token Password recovery (usrRsp=2) + /// Hide password with '*' for User Password recovery (usrRsp=1) + /// + StarChar[0] = (ShowPassword == 1) ? Key.UnicodeChar : L'*'; + + if (StrIndex >= 0 && StrIndex < MaxPasswordLength) { + /// + /// Index in range + /// + PasswordASCII[StrIndex] = (UINT8) Key.UnicodeChar; + PasswordUNICODE[StrIndex] = Key.UnicodeChar; + StrIndex++; + /// + /// Print hidden (*) or unhidden password character + /// + AtAmUiStrDisplay (StarChar); + } else if (StrIndex < 0) { + /// + /// Index out of range: StrIndex < 0 - should never go here + /// + AtAmUiStrEnableCursor (FALSE); + StrIndex = 0; + } else { + /// + /// Index out of range: StrIndex >= ATAM_SETUP_PASSWORD_LENGTH - max password length (49 chars) exceeded, + /// only backspace, enter or escape will be accepted + /// + DEBUG ((EFI_D_ERROR, "ATAM: Password Length Exceeded\n")); + } + break; + } + + } while (1); + + AtAmUiStrEnableCursor (FALSE); + + return EFI_TIMEOUT; +} + +/** + Function displaing Ivs strings. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiTheftNotification ( + VOID + ) +{ + EFI_STATUS Status; + AT_STATE_INFO StateInfo; + UINT32 TimerLeft; + UINT32 TimerInterval; + UINT8 *IsvString; + UINT32 IsvId; + CHAR16 *TimeLeftStr; + UINT8 PbaFailedExceeded; + UINT16 PbaFailedAttempts; + UINT16 PbaFailedThreshold; + + DEBUG ((EFI_D_ERROR, "ATAM: AtAmUiTheftNotification\n")); + + Status = EFI_SUCCESS; + PbaFailedExceeded = FALSE; + + Status = gBS->LocateProtocol ( + &gEfiAtAmProtocolGuid, + NULL, + (VOID **) &mAtAm + ); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: ATAM failed = %r\n", Status)); + return Status; + } + + Status = mAtAm->AtAmGetPbaCounter(&PbaFailedExceeded, &PbaFailedAttempts, &PbaFailedThreshold); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetIsvId = %r\n", Status)); + return Status; + } + + if (PbaFailedThreshold >= PbaFailedAttempts) { + return EFI_SUCCESS; + } else { + + IsvString = AllocateZeroPool ((RECOVERY_STRING_LENGTH + 1) * sizeof (UINT8)); + TimeLeftStr = AllocateZeroPool ((ATAM_TIMER_STRING_LENGTH + 1) * sizeof (CHAR16)); + + if (IsvString == NULL || TimeLeftStr == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + AtAmUiStrClearScreen (); + + AtAmUiDisplayIsvStrings (); + + AtAmUiStrEnableCursor (FALSE); + + AtAmUiStrSetCursor(4, 20); + Status = mAtAm->AtAmGetIsvId (mAtAm, IsvString, &IsvId); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "ATAM: AtAmGetIsvId, Status = %r\n", Status)); + } + + AtAmUiStrDisplay ((CHAR16 *) IsvString); + + mAtAm->AtAmGetAtStateInfo (mAtAm, &StateInfo); + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_DUE_TO, TRUE); + switch (StateInfo.LastTheftTrigger) { + case 1: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_TIME, FALSE); + break; + + case 2: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_STOLEN, FALSE); + break; + + case 3: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_THRESHOLD, FALSE); + break; + + case 4: + AtAmUiStrDisplayFix (STR_ATAMUI_LOCK_ATTACK, FALSE); + + default: + break; + } + + mAtAm->AtAmGetTimer (mAtAm, &TimerLeft, &TimerInterval); + UnicodeValueToString (TimeLeftStr, 0, TimerLeft, 0); + + AtAmUiStrDisplayFix (STR_ATAMUI_TIME_LEFT, TRUE); + AtAmUiStrDisplay ((CHAR16 *) TimeLeftStr); + AtAmUiStrDisplayFix (STR_ATAMUI_TIME_LEFT_SEC,FALSE); + + AtAmUiDelay ((PbaFailedAttempts - PbaFailedThreshold) * 10 * AT_AM_UI_1_SECOND); + + AtAmUiStrClearScreen (); + + return Status; + } +} + diff --git a/Board/EM/MeWrapper/AtAmUi/AtAmUi.cif b/Board/EM/MeWrapper/AtAmUi/AtAmUi.cif new file mode 100644 index 0000000..f59551d --- /dev/null +++ b/Board/EM/MeWrapper/AtAmUi/AtAmUi.cif @@ -0,0 +1,14 @@ +<component> + name = "AtAmUi" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\AtAmUi\" + RefName = "AtAmUi" +[files] +"AtAmUi.dxs" +"AtAmUi.mak" +"AtAmUi.sdl" +"AtAmUi.c" +"AtAmUi.h" +"AtAmUiString.c" +"AtAmUiString.h" +<endComponent> diff --git a/Board/EM/MeWrapper/AtAmUi/AtAmUi.dxs b/Board/EM/MeWrapper/AtAmUi/AtAmUi.dxs new file mode 100644 index 0000000..7a69567 --- /dev/null +++ b/Board/EM/MeWrapper/AtAmUi/AtAmUi.dxs @@ -0,0 +1,42 @@ +/** @file + Dependency expression file for AtAmUi Invocation Driver. + +@copyright + Copyright (c) 2012 Intel Corporation. All rights reserved + This software and associated documentation (if any) is furnished + under a license and may only be used or copied in accordance + with the terms of the license. Except as permitted by such + license, no part of this software or documentation may be + reproduced, stored in a retrieval system, or transmitted in any + form or by any means without the express written consent of + Intel Corporation. + + This file contains an 'Intel Peripheral Driver' and uniquely + identified as "Intel Reference Module" and is + licensed for Intel CPUs and chipsets under the terms of your + license agreement with Intel or your vendor. This file may + be modified by the user, subject to additional terms of the + license agreement + +**/ + + +#include "AutoGen.h" +#include "DxeDepex.h" + +#if defined (BUILD_WITH_GLUELIB) || defined (BUILD_WITH_EDKII_GLUE_LIB) +#include "EfiDepex.h" +#include EFI_PROTOCOL_DEPENDENCY (MeBiosPayloadData) +#include EFI_PROTOCOL_DEFINITION (Heci) +#include EFI_PROTOCOL_DEFINITION (At) +#include EFI_PROTOCOL_DEFINITION (AtAm) +#include EFI_PROTOCOL_DEFINITION (AtPlatformPolicy) +#endif + +DEPENDENCY_START + EFI_AT_PROTOCOL_GUID AND + DXE_PLATFORM_AT_POLICY_GUID AND + EFI_HECI_PROTOCOL_GUID AND + ME_BIOS_PAYLOAD_DATA_PROTOCOL_GUID AND + EFI_ATAM_PROTOCOL_GUID +DEPENDENCY_END diff --git a/Board/EM/MeWrapper/AtAmUi/AtAmUi.h b/Board/EM/MeWrapper/AtAmUi/AtAmUi.h new file mode 100644 index 0000000..04e356f --- /dev/null +++ b/Board/EM/MeWrapper/AtAmUi/AtAmUi.h @@ -0,0 +1,150 @@ +/** @file + Header file. + +@copyright + Copyright (c) 2013 Intel Corporation. All rights reserved + This software and associated documentation (if any) is furnished + under a license and may only be used or copied in accordance + with the terms of the license. Except as permitted by such + license, no part of this software or documentation may be + reproduced, stored in a retrieval system, or transmitted in any + form or by any means without the express written consent of + Intel Corporation. + + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +**/ +#ifndef _ATAMUI_H_ +#define _ATAMUI_H_ + +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGlueDxe.h" +#include "AtAmUiString.h" +#include "AtAm.h" +#include "AtHi.h" +#include "AtAmHelper.h" +#endif + +#include EFI_PROTOCOL_CONSUMER (AtAm) +#include EFI_PROTOCOL_CONSUMER (AtPlatformPolicy) + +/// +/// Intel ME Alert AT Handler Event GUID +/// The event is used to execute AtAmUiCallback () when the system is ready to launch ATAM UI +/// The event is signaled after consoles are ready in BDS phase. +/// +#define ME_ALERT_AT_HANDLER_GUID \ + { \ + 0xb441df87, 0x8d94, 0x4811, 0x85, 0xf7, 0xf, 0x9a, 0x7b, 0xf8, 0x9d, 0x2a \ + } + +#define ATAMUI_SUSPEND_ATTEMPTS 3 + +/** + ATAM UI callback. + + @param[in] Event The event registered + @param[in] Context Event context. Not used in this event handler. + + @retval None +**/ +VOID +EFIAPI +AtAmUiCallback ( + IN EFI_EVENT Event, + IN VOID *Context + ) +; + +/** + Function handling entering suspend mode. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiTheftNotification ( + VOID + ) +; + +/** + Function handling displaing theft notification. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiEnterSuspendState ( + VOID + ) +; + +/** + Function handling exiting suspend mode. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiExitSuspendState ( + VOID + ) +; + +/** + Function handling recovery proccess. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiRecovery ( + VOID + ) +; + +/** + Function displaing Ivs strings. + + @param[in] None + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Unable to allocate necessary data structures. +**/ +EFI_STATUS +AtAmUiDisplayIsvStrings ( + VOID + ) +; + +/** + This GetRecoveryPassword() process the AT recovery password user input. + + @param[out] PasswordASCII Pointer to an array of ASCII user input + @param[in] MaxPasswordLength Integer value for max password length + @param[out] PasswordUNICODE Pointer to an array of UNICODE user input + @param[in] ShowPassword TRUE - password is shown, FALSE - pasword is hidden by * + + @retval EFI_SUCCESS The function completed successfully. + @retval EFI_OUT_OF_RESOURCES Do not have enough resources to allocate memory or password too long. +**/ +EFI_STATUS +AtAmUiGetPassword ( + OUT UINT8 *PasswordASCII, + IN INTN MaxPasswordLength, + OUT CHAR16 *PasswordUNICODE, + IN UINT8 ShowPassword + ) +; +#endif diff --git a/Board/EM/MeWrapper/AtAmUi/AtAmUi.mak b/Board/EM/MeWrapper/AtAmUi/AtAmUi.mak new file mode 100644 index 0000000..958ee72 --- /dev/null +++ b/Board/EM/MeWrapper/AtAmUi/AtAmUi.mak @@ -0,0 +1,148 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/ATAMUI/AtAmUi.mak 1 8/29/12 3:02a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 8/29/12 3:02a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/ATAMUI/AtAmUi.mak $ +# +# 1 8/29/12 3:02a Klzhan +# [TAG] EIPNone +# [Category] Spec Update +# [Severity] Important +# [Description] Support AT5 +# [Files] AtAmUi.cif +# AtAmUi.dxs +# AtAmUi.mak +# AtAmUi.sdl +# AtAmUi.c +# AtAmUi.h +# AtAmUiString.c +# AtAmUiString.h +# +# 2 2/23/12 8:58a Klzhan +# Support New EDK +# +# 1 2/08/12 1:08a Klzhan +# Initial Check in +# +# 2 9/15/11 2:12a Klzhan +# Remove AMI Lib. +# +# 1 2/25/11 1:43a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: AmtWrapperDxe.mak +# +# Description: Makfile for Amt Wrapper Dxe module +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +EDK : AtAmUi + +AtAmUi : $(BUILD_DIR)\AtAmUi.mak AtAmUiBin + +$(BUILD_DIR)\AtAmUi.mak : $(AtAmUi_DIR)\AtAmUi.mak $(BUILD_RULES) + $(CIF2MAK) $(AtAmUi_DIR)\AtAmUi.cif $(CIF2MAK_DEFAULTS) + +AtAmUi_INCLUDES=\ + $(EDK_INCLUDES)\ + $(MISCFRAMEWORK_INCLUDES)\ + $(ME_INCLUDES)\ + $(INTEL_MCH_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + $(IndustryStandard_INCLUDES)\ + $(EdkIIGlueLib_INCLUDES)\ + /IInclude\ + $(NB_INCLUDES)\ + /I$(AtAmDxe_DIR)\ + /I$(AtDxeLib_DIR)\ + +AtAmUi_LIBS=\ + $(EFISCRIPTLIB)\ + $(EFIDRIVERLIB)\ + $(EFICOMMONLIB)\ + $(PRINTLIB)\ + $(EDKFRAMEWORKPROTOCOLLIB)\ + $(EFIGUIDLIB)\ + $(AmtProtocolLib_LIB)\ + $(AmtLibDxe_LIB)\ + $(MeLibDxe_LIB)\ + $(AmtGuidLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueDxeServicesTableLib_LIB)\ + $(EdkIIGlueBasePrintLib_LIB) \ + $(AtDxeLib_LIB)\ + +AtAmUi_DEFINES = $(MY_DEFINES)\ + /D"__EDKII_GLUE_MODULE_ENTRY_POINT__=AtAmUiEntryPoint"\ + /D __EDKII_GLUE_DXE_REPORT_STATUS_CODE_LIB__ \ + /D __EDKII_GLUE_DXE_DEBUG_LIB_REPORT_STATUS_CODE__ \ + /D __EDKII_GLUE_UEFI_BOOT_SERVICES_TABLE_LIB__\ + /D __EDKII_GLUE_BASE_PCI_LIB_PCI_EXPRESS__ \ + /D __EDKII_GLUE_BASE_LIB__ \ + /D __EDKII_GLUE_BASE_MEMORY_LIB__ \ + /D __EDKII_GLUE_UEFI_DEVICE_PATH_LIB__ \ + /D __EDKII_GLUE_UEFI_LIB__\ + /D __EDKII_GLUE_DXE_MEMORY_ALLOCATION_LIB__ \ + + +AtAmUiBin : $(AtAmUi_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\AtAmUi.mak all\ + GUID=D2BC3092-92BB-4B21-A26B-CE6f7C3E9857\ + "MY_INCLUDES=$(AtAmUi_INCLUDES)" \ + "MY_DEFINES=$(AtAmUi_DEFINES)"\ + ENTRY_POINT=AtAmUiEntryPoint\ + DEPEX1=$(AtAmUi_DIR)\AtAmUi.dxs\ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX\ + TYPE=BS_DRIVER\ + COMPRESS=1 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/AtAmUi/AtAmUi.sdl b/Board/EM/MeWrapper/AtAmUi/AtAmUi.sdl new file mode 100644 index 0000000..ce0ff64 --- /dev/null +++ b/Board/EM/MeWrapper/AtAmUi/AtAmUi.sdl @@ -0,0 +1,27 @@ +TOKEN + Name = "AtAMUI_SUPPORT" + Value = "1" + Help = "Main switch to enable TdtWrapper support in Project" + TokenType = Boolean + TargetMAK = Yes + TargetH = Yes + Master = Yes + Token = "AT_SUPPORT" "=" "1" +End + + +PATH + Name = "AtAmUi_DIR" +End + +MODULE + Help = "Includes TdtWrapper.mak to Project" + File = "AtAmUi.mak" +End + +ELINK + Name = "$(BUILD_DIR)\AtAmUi.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + diff --git a/Board/EM/MeWrapper/AtAmUi/AtAmUiString.c b/Board/EM/MeWrapper/AtAmUi/AtAmUiString.c new file mode 100644 index 0000000..021844b --- /dev/null +++ b/Board/EM/MeWrapper/AtAmUi/AtAmUiString.c @@ -0,0 +1,242 @@ +/** @file + This file contines function used for handling strings. + +@copyright + Copyright (c) 2012 - 2013 Intel Corporation. All rights reserved + This software and associated documentation (if any) is furnished + under a license and may only be used or copied in accordance + with the terms of the license. Except as permitted by such + license, no part of this software or documentation may be + reproduced, stored in a retrieval system, or transmitted in any + form or by any means without the express written consent of + Intel Corporation. + + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +**/ + +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGlueDxe.h" +#include "AtAmUiString.h" +#endif + +AT_AM_UI_STRING AtAmUiUSStringIDTab[] = { + {STR_ATAMUI_LOCKED_TEXT, 4, 20, L"This device has been locked and may have been lost.\r\n If found, Please use the following information to return the device\r\n "}, + {STR_ATAMUI_PLATFORM_ID, 4, 23, L"Platform ID: "}, + {STR_ATAMUI_PROVIDER_ID, 4, 24, L"Intel(R) Anti-Theft Technology service provider Id: "}, + {STR_ATAMUI_LOCK_DUE_TO, 4, 2, L"This computer has been disabled using Intel(R) Anti-Theft Technology due to: "}, + {STR_ATAMUI_SELECT_PASS, 4, 5, L"Please select one of the following for platform recovery:\r\n 1 - Passphrase\r\n 2 - Server Recovery Token"}, + {STR_ATAMUI_TIME_LEFT, 4, 4, L"Time Left to enter Passphrase: "}, + {STR_ATAMUI_USER_PASS, 4, 5, L"System Recovery"}, + {STR_ATAMUI_RECO_ENTER_PASS, 4, 6, L"Enter Passphrase: "}, + {STR_ATAMUI_SERV_BASED_RECOV, 4, 6, L"Server Based Recovery"}, + {STR_ATAMUI_INVALID_SELECT, 4, 10, L"Invalid Selection, Press 1 or 2 "}, + {STR_ATAMUI_LOCK_TIME, 4, 0, L"Disable Timer expired"}, + {STR_ATAMUI_LOCK_STOLEN, 4, 0, L"Stolen Message received"}, + {STR_ATAMUI_LOCK_THRESHOLD, 4, 0, L"Logon Threshold exceeded"}, + {STR_ATAMUI_LOCK_ATTACK, 4, 0, L"Platform Attack detected"}, + {STR_ATAMUI_CHECKING_PASS, 4, 8, L"Checking Recovery Password..."}, + {STR_ATAMUI_RECO_TRY_AGAIN, 4, 10, L"Recovery Failed. Please try again ..."}, + {STR_ATAMUI_RECO_FAILED, 4, 11, L"Intel(R) Anti-Theft Technology Recovery Failed.\r\n System will shutdown..."}, + {STR_ATAMUI_RECO_SUCCESS, 4, 11, L"Intel(R) Anti-Theft Technology Recovery Successful.\r\n System Boot Continue ....."}, + {STR_ATAMUI_SUS_ENTER_INFO, 4, 1, L"User Has Requested To Enter Intel(R) Anti-Theft Technology Suspend Mode....."}, + {STR_ATAMUI_RES_REFER, 4, 5, L"Refer the following Platform Resume ID to IT: "}, + {STR_ATAMUI_RECO_REFER, 4, 5, L"Refer the following Platform Recovery ID to IT: "}, + {STR_ATAMUI_SUS_REFER, 4, 5, L"Refer the following Platform Suspend ID to IT: "}, + {STR_ATAMUI_SUS_ENTER_TOKEN, 4, 4, L"Enter Suspend Token: "}, + {STR_ATAMUI_SUS_ATTEMPT_EXC, 4, 9, L"Exceeded Max Attempts - Exiting .... "}, + {STR_ATAMUI_SUS_ENTER_SUCCESS,4, 5, L"Successfully Put Platform in Suspended Mode"}, + {STR_ATAMUI_SUS_ENTER_FAILED, 4, 5, L"Failed to Put Platform into Suspended Mode"}, + {STR_ATAMUI_SUS_AUTH_FAILED, 4, 5, L"Failed to Authenticate "}, + {STR_ATAMUI_SUS_EXIT_QUESTION,4, 1, L"Intel(R) Anti-Theft Technology in Suspended State: Exit? (y/n)?"}, + {STR_ATAMUI_SUS_EXIT_INFO, 4, 2, L"Exit Intel(R) Anti-Theft Technology Suspend Mode....."}, + {STR_ATAMUI_SUS_EXIT_SUCCESS, 4, 7, L"Successfully Exited Suspend Mode"}, + {STR_ATAMUI_SUS_STAY, 4, 7, L"Stay in Suspend Mode...."}, + {STR_ATAMUI_SUS_NONCE_FAILED, 0, 0, L"NONCE unknown"}, + {STR_ATAMUI_TIME_LEFT_SEC, 0, 0, L" seconds "}, + {STR_ATAMUI_SELECT_OPTION, 4, 9, L"Select one of the above options to proceed ..."}, + {STR_ATAMUI_CHECKING_AUTHENT, 4, 6, L"Checking Authentication .."}, + {STR_ATAMUI_RECO_SEC_TOKEN, 4, 6, L"Server Recovery Token: "} +}; + +UINTN AtAmUiUSStringIDTabEntries = sizeof (AtAmUiUSStringIDTab) / sizeof (AT_AM_UI_STRING); + +/** + This function gets character inputted. + + @param[out] Key Pointer to buffer for keystroke. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrGetChar ( + OUT EFI_INPUT_KEY *Key + ) +{ + EFI_STATUS Status; + UINTN Delay = 300000; + Status = EFI_SUCCESS; + + Key->UnicodeChar = L'\0'; + Key->ScanCode = 0; + while (Delay) { + Status = gST->ConIn->ReadKeyStroke (gST->ConIn, Key); + if (!(EFI_ERROR (Status))) { + break; + } + Delay --; + } + + return Status; +} + +/** + This routine displays the string out to the screen based on defined strings. + It uses X and Y to calculate the start location of string where it will be displayed. Function + uses string ID to indicate which strings are going to be shown by AtAmUiDisplay(). There will + be UseXY flag to indicate if there will be used coordinates from Strings library or not. If + not, the cursor will be moved behind last printed sign. It will be used to print e.g. '*' sign + during password entering. In graphic mode it is overridden by requirement. In graphic mode, X + and Y can be calculated the start location of string. + + @param[in] StringID Unique string ID crated as enum type of AT_AM_UI_STRING_ID + @param[in] UseXY Set the current cursor position for the displayed string if it is TRUE + FALSE - don't use coordinates from String library. Cursor is moved behind + last printed sign. + TRUE - Use coordinates from String library. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrDisplayFix ( + IN UINT32 StringID, + IN BOOLEAN UseXY + ) +{ + EFI_STATUS Status; + UINTN i; + + for (i = 0; i < AtAmUiUSStringIDTabEntries; i++) { + if (AtAmUiUSStringIDTab[i].StrID == StringID) { + if (UseXY) { + Status = AtAmUiStrSetCursor (AtAmUiUSStringIDTab[i].X, AtAmUiUSStringIDTab[i].Y); + } + + Status = AtAmUiStrDisplay (AtAmUiUSStringIDTab[i].String); + return Status; + } + } + + return EFI_NOT_FOUND; +} + +/** + This routine displays the string out to the screen. + For multi-language support, a language table is expected to be selected by customization here. For example, + the default language table is US-English in AtAmUiUSStringTab[], a second language table is created by + customization in AtAmUiSECStringTab[]. + + @param[in] String The NULL-terminated Unicode string to be displayed on the output device(s) + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrDisplay ( + IN CHAR16 *String + ) +{ + + return gST->ConOut->OutputString (gST->ConOut, String); +} + +/** + This routine clears the screen. + In graphic mode it is overridden by requirement. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrClearScreen ( + VOID + ) +{ + + return gST->ConOut->ClearScreen (gST->ConOut); +} + +/** + In text mode it is used to set the place of cursor row and cursor column. + In graphic mode it is overridden by requirement. + + @param[in] CCol The column position to set the cursor to + @param[in] CRow The row position to set the cursor to + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrSetCursor ( + IN UINT32 CCol, + IN UINT32 CRow + ) +{ + + return gST->ConOut->SetCursorPosition (gST->ConOut, CCol, CRow); +} + +/** + This function enables or disables cursor. + In graphic mode it is overridden by requirement. + + @param[in] Enabled If TRUE, the cursor is set to be visible. If FALSE, the cursor is set to be invisible. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrEnableCursor ( + IN BOOLEAN Enabled + ) +{ + + return gST->ConOut->EnableCursor (gST->ConOut, Enabled); +} + +/** + In text mode it returns the place of cursor row and cursor column. + In graphic mode it is overridden by requirement. + + @param[out] CRow The pointer to return current cursor row + @param[out] CCol The pointer to return current cursor column + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrGetCursor ( + OUT UINT32 *CRow, + OUT UINT32 *CCol + ) +{ + *CRow = gST->ConOut->Mode->CursorRow; + *CCol = gST->ConOut->Mode->CursorColumn; + + return EFI_SUCCESS; +} + +/** + Function handling delay code. + In graphic mode it is overridden by requirement. + + @param[in] delay The number of microseconds to stall execution. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiDelay ( + IN UINT32 delay + ) +{ + + return gBS->Stall (delay);; +} + diff --git a/Board/EM/MeWrapper/AtAmUi/AtAmUiString.h b/Board/EM/MeWrapper/AtAmUi/AtAmUiString.h new file mode 100644 index 0000000..0331127 --- /dev/null +++ b/Board/EM/MeWrapper/AtAmUi/AtAmUiString.h @@ -0,0 +1,208 @@ +/** @file + Heder file. + +@copyright + Copyright (c) 2012 Intel Corporation. All rights reserved + This software and associated documentation (if any) is furnished + under a license and may only be used or copied in accordance + with the terms of the license. Except as permitted by such + license, no part of this software or documentation may be + reproduced, stored in a retrieval system, or transmitted in any + form or by any means without the express written consent of + Intel Corporation. + + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +**/ + +#ifndef _ATAMUISTRING_H_ +#define _ATAMUISTRING_H_ + +typedef enum _AT_AM_UI_STRING_ID { + STR_ATAMUI_LOCKED_TEXT, + STR_ATAMUI_PLATFORM_ID, + STR_ATAMUI_PROVIDER_ID, + STR_ATAMUI_LOCK_DUE_TO, + STR_ATAMUI_SELECT_PASS, + STR_ATAMUI_TIME_LEFT, + STR_ATAMUI_USER_PASS, + STR_ATAMUI_SERV_BASED_RECOV, + STR_ATAMUI_INVALID_SELECT, + STR_ATAMUI_LOCK_TIME, + STR_ATAMUI_LOCK_STOLEN, + STR_ATAMUI_LOCK_THRESHOLD, + STR_ATAMUI_LOCK_ATTACK, + STR_ATAMUI_CHECKING_PASS, + STR_ATAMUI_RECO_TRY_AGAIN, + STR_ATAMUI_RECO_FAILED, + STR_ATAMUI_RECO_SUCCESS, + STR_ATAMUI_SUS_ENTER_INFO, + STR_ATAMUI_RES_REFER, + STR_ATAMUI_RECO_REFER, + STR_ATAMUI_SUS_REFER, + STR_ATAMUI_SUS_ENTER_TOKEN, + STR_ATAMUI_SUS_ATTEMPT_EXC, + STR_ATAMUI_SUS_ENTER_SUCCESS, + STR_ATAMUI_SUS_ENTER_FAILED, + STR_ATAMUI_SUS_AUTH_FAILED, + STR_ATAMUI_SUS_EXIT_QUESTION, + STR_ATAMUI_SUS_EXIT_INFO, + STR_ATAMUI_SUS_EXIT_SUCCESS, + STR_ATAMUI_SUS_STAY, + STR_ATAMUI_SUS_NONCE_FAILED, + STR_ATAMUI_RECO_ENTER_PASS, + STR_ATAMUI_TIME_LEFT_SEC, + STR_ATAMUI_SELECT_OPTION, + STR_ATAMUI_CHECKING_AUTHENT, + STR_ATAMUI_FAILED_TO_AUTHENT, + STR_ATAMUI_RECO_SEC_TOKEN, + + // + // this has to be a last element of this enum + // + STR_ATAMUI_END_OF_TAB +} AT_AM_UI_STRING_ID; + +/// +/// Strings will be kept in array. There can be created many tables with strings in various +/// languages. A language table can be selected within AtAmUiStrDisplay () to display string in +/// targeted language with the unique string ID. The same unique string ID is applied to all +/// language tables +/// +typedef struct _AT_AM_UI_STRING { + UINTN StrID; ///< Unique string ID crated as enum type AT_AM_UI_STRING_ID + UINT8 X; ///< The place of cursor row to be display + UINT8 Y; ///< The place of cursor column to be display + CHAR16 *String; ///< Pointer to the string +} AT_AM_UI_STRING; + +#define AT_AM_UI_1_SECOND 1000000 + +/** + This function gets character inputted. + + @param[out] Key Pointer to buffer for keystroke. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrGetChar ( + OUT EFI_INPUT_KEY *Key + ) +; + +/** + This routine displays the string out to the screen based on defined strings. + It uses X and Y to calculate the start location of string where it will be displayed. Function + uses string ID to indicate which strings are going to be shown by AtAmUiDisplay(). There will + be UseXY flag to indicate if there will be used coordinates from Strings library or not. If + not, the cursor will be moved behind last printed sign. It will be used to print e.g. '*' sign + during password entering. In graphic mode it is overridden by requirement. In graphic mode, X + and Y can be calculated the start location of string. + + @param[in] StringID Unique string ID crated as enum type of AT_AM_UI_STRING_ID + @param[in] UseXY Set the current cursor position for the displayed string if it is TRUE + FALSE - don't use coordinates from String library. Cursor is moved behind + last printed sign. + TRUE - Use coordinates from String library. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrDisplayFix ( + IN UINT32 StringID, + IN BOOLEAN UseXY + ) +; + +/** + This routine displays the string out to the screen. + For multi-language support, a language table is expected to be selected by customization here. For example, + the default language table is US-English in AtAmUiUSStringTab[], a second language table is created by + customization in AtAmUiSECStringTab[]. + + @param[in] String The NULL-terminated Unicode string to be displayed on the output device(s) + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrDisplay ( + IN CHAR16 *String + ) +; + +/** + This routine clears the screen. + In graphic mode it is overridden by requirement. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrClearScreen ( + VOID + ) +; + +/** + In text mode it is used to set the place of cursor row and cursor column. + In graphic mode it is overridden by requirement. + + @param[in] CCol The column position to set the cursor to be displayed + @param[in] CRow The row position to set the cursor to be displayed + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrSetCursor ( + IN UINT32 CCol, + IN UINT32 CRow + ) +; + +/** + This function enables or disables cursor. + In graphic mode it is overridden by requirement. + + @param[in] Enabled If TRUE, the cursor is set to be visible. If FALSE, the cursor is set to be invisible. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrEnableCursor ( + IN BOOLEAN Enabled + ) +; + +/** + In text mode it returns the place of cursor row and cursor column. + In graphic mode it is overridden by requirement. + + @param[out] CRow The pointer to return current cursor row + @param[out] CCol The pointer to return current cursor column + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiStrGetCursor ( + OUT UINT32 *CRow, + OUT UINT32 *CCol + ) +; + +/** + Function handling delay code. + In graphic mode it is overridden by requirement. + + @param[in] delay The number of microseconds to stall execution. + + @retval EFI_SUCCESS The function completed successfully. +**/ +EFI_STATUS +AtAmUiDelay ( + IN UINT32 delay + ) +; + +#endif diff --git a/Board/EM/MeWrapper/Icc/Icc.cif b/Board/EM/MeWrapper/Icc/Icc.cif new file mode 100644 index 0000000..43ca476 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/Icc.cif @@ -0,0 +1,13 @@ +<component> + name = "Icc" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\Icc\" + RefName = "Icc" +[files] +"Icc.sdl" +[parts] +"IccProtocolLib" +"IccPlatform" +"IccSetup" +"IccOverClocking" +<endComponent> diff --git a/Board/EM/MeWrapper/Icc/Icc.sdl b/Board/EM/MeWrapper/Icc/Icc.sdl new file mode 100644 index 0000000..5fef879 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/Icc.sdl @@ -0,0 +1,25 @@ +TOKEN + Name = "ICC_SUPPORT" + Value = "1" + Help = "Main switch to enable ICC support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + TargetH = Yes + Master = Yes +End + +PATH + Name = "Icc_DIR" +End + +ELINK + Name = "ICC_INCLUDES" + InvokeOrder = ReplaceParent +End + +ELINK + Name = "/I$(Icc_DIR)" + Parent = "ICC_INCLUDES" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.c b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.c new file mode 100644 index 0000000..4098481 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.c @@ -0,0 +1,1187 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccPlatform/IccPlatform.c 9 5/14/14 9:56p Tristinchou $ +// +// $Revision: 9 $ +// +// $Date: 5/14/14 9:56p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccPlatform/IccPlatform.c $ +// +// 9 5/14/14 9:56p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 8 4/19/13 4:08a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Check DIMM Changed, and update WDT Protocol for XTU +// +// 7 1/28/13 5:01a Klzhan +// Improvement : System might not power on after changing CPU when +// Overclocking. +// +// 6 1/14/13 3:15a Klzhan +// +// 5 12/24/12 6:34a Klzhan +// [TAG] EIP109624 +// [Category] New Feature +// [Description] Support Lock Icc registers. +// +// 4 12/19/12 2:34a Klzhan +// Update for overclocking. +// +// 3 9/19/12 5:54a Klzhan +// 1. Fix Build Error when Performance is on(IccPlatform.mak). +// 2. Avoid time-out in ICC setup Page when return from Shell. +// 3. Remove un-used wait for Fw Init Done. +// +// 2 4/24/12 12:28a Klzhan +// +// 1 2/08/12 1:06a Klzhan +// Initial Check in +// +// 5 7/27/11 3:21a Klzhan +// Add Elinks for PCIE and PCI config. +// Note: Don't List GBE port on this Elink. +// +// 4 7/15/11 12:45a Klzhan +// +// 3 7/08/11 4:22a Klzhan +// [TAG] EIP64189 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC to 0.7 +// +// 2 6/27/11 8:39a Klzhan +// Support new ICC control library +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccPlatform.c +// +// Description: Platform-specific ICC code +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009-2010 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccPlatform.c + +Abstract: + + Platform-specific ICC code + +--*/ +#define __EDKII_GLUE_MEMORY_ALLOCATION_LIB_H__ +#define __EDKII_GLUE_BASE_MEMORY_LIB_H__ +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGlueDxe.h" +#endif +#include EFI_PROTOCOL_PRODUCER(IccOverClocking) +#include EFI_PROTOCOL_PRODUCER(MeBiosPayLoadData) +#ifdef CougarPoint_SUPPORT +#include EFI_PROTOCOL_PRODUCER (Wdt) +#endif +#if EFI_SPECIFICATION_VERSION>0x20000 +#define __HII_CONFIG_ACCESS__H__ +#else +#include EFI_PROTOCOL_DEFINITION (Hii) +#endif +#include "MeLib.h" +#include "PchAccess.h" +#include "IccSetup.h" +#include "EfiPerf.h" +// +// without these include guards, setup.h would include AMI EFI definitions conflicting with those from EDK +// +#define __UEFI_HII__H__ +#define __HII_PROTOCOL_H__ +#define _HII_H_ +#define __FORM_CALLBACK_PROTOCOL_H__ +#include "Setup.h" +#include "IccPlatform.h" +#include "Board\EM\Platform\PlatformSetup.h" +#if WdtPei_SUPPORT +#include "ppi\Wdt\Wdt.h" +#endif +UINT64 mNonce; +EFI_EVENT mFeedEvent; +ICC_CONFIG mIccConfig; + +ICC_OVERCLOCKING_PROTOCOL* gIccOverClockingProtocol; + +typedef VOID (ICC_CLOCK_UPDATE) (PLATFORM_PCIE_SLOTS* PCIE_SLOT, PLATFORM_PCI_SLOTS* PCI_SLOT); +extern ICC_CLOCK_UPDATE OEM_CLOCK_UPDATE_FUNC EndOfOemClockUpdateFunc; +ICC_CLOCK_UPDATE* OemClockUpdate[] = {OEM_CLOCK_UPDATE_FUNC NULL}; +DXE_MBP_DATA_PROTOCOL *mBIOSPayLoad; +#if defined PERF_TUNE_SUPPORT && PERF_TUNE_SUPPORT == 1 + +#define __EFI__H__ +#define __HOB__H__ +#include <Protocol\PerfTuneProtocol.h> +EFI_GUID gPerfTune3xProtocolGuid = PERF_TUNE_ASL_PROTOCOL_GUID; +EFI_GUID gPerfTuneDataHobGuid = AMI_PERF_TUNE_DATA_HOB_GUID; +EFI_GUID gHobListGuid = EFI_HOB_LIST_GUID; +BOOLEAN gFound = FALSE; +BOOLEAN gBootCurrent = FALSE; +UINT16 gCurrentFrequency; +UINT16 gPEGDMIRatio; +ICC_CLOCK_SETTINGS gClocksetting; + +//----------------------------CPU Ratio GACI DATA---------------------------- +// GACI_DATA DevNameGaciData { ControlID,NumberOfValues,Precision,Flags,DefaultDataValue,MinDataValue,MaxDataValue,MinDisplayValue,MaxDisplayValue} +static GACI_DATA IccFreqGaciData = {BIOS_HOST_CLOCK_IMPLEMENTATION, 8001, 2, 0, 10000, 10000, 18000, 10000, 18000}; + +static GACI_DATA IccPegDmiGaciData = {BIOS_PEG_DMI_RATIO_IMPLEMENTATION, 0xFFFF, 2, 0, 0, 0, 0, 0, 0}; +#endif + +#define ICC_CLOCK_COUNT 8 +UINT8 ClockID; +#define MAX(a, b) ((a) > (b) ? (a) : (b)) +#define MIN(a, b) ((a) > (b) ? (b) : (a)) +#ifndef TRACE_ALWAYS +#define TRACE_ALWAYS -1 +#endif +typedef struct _CLOCK_DISPLAY_VALUES { + UINT16 ClkFreqMax; + UINT16 ClkFreqMin; + UINT16 ClkFreqCurrent; + UINT16 SscPercentMax; + UINT16 SscPercentCurrent; + UINT16 ClockUsage; + UINT8 SscChangeAllowed; + UINT8 SscModeUpAvailable; + UINT8 SscModeCenterAvailable; + UINT8 SscModeDownAvailable; + UINT8 SscModeCurrent; +} CLOCK_DISPLAY_VALUES; + +typedef struct _ICC_CLK_REQUEST { + UINT16 Frequency; + UINT16 SscPercent; + UINT8 SscAllowed; + UINT8 SscMode; + UINT8 EveryBoot; +} ICC_CLK_REQUEST; + +#define IMMEDIATE 0 +#define TEMPORARY 1 +#define PERMANENT 2 + +#define SSC_MODE_UP 2 +#define SSC_MODE_CENTER 1 +#define SSC_MODE_DOWN 0 + +#if defined PERF_TUNE_SUPPORT && PERF_TUNE_SUPPORT == 1 +VOID PerfTuneIcc( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable) +{ + VOID *pPerfTuneDataHobList = NULL; + PERF_TUNE_DATA_HOB *pBiosSettingData; + BIOS_SETTING_DATA BiosSettingData; + UINT16 RequestFrequency,PEGDMIRatio,bPEGDMIRatio; + ICC_CLOCK_SETTINGS RequestSetting; + EFI_GUID SetupGuid = SETUP_GUID; + EFI_STATUS Status; + BOOLEAN freqConsolidationBypass = TRUE; + ICC_LIB_STATUS IccStatus; + EFI_PEI_HOB_POINTERS GuidHob; + WDT_PROTOCOL *InternalWdtProtocol; + UINTN VarSize = sizeof(BIOS_SETTING_DATA); + BIOS_SETTING_DATA DefaultData; + EFI_GUID EfiSetupGuid = SETUP_GUID; + + // + // Get Hob list + // + Status = EfiLibGetSystemConfigurationTable (&gEfiHobListGuid, &GuidHob.Raw); + if (EFI_ERROR (Status)) { + return; + } + + for (Status = EFI_NOT_FOUND; EFI_ERROR (Status);) { + if (END_OF_HOB_LIST (GuidHob)) { + Status = EFI_NOT_FOUND; + break; + } + if (GET_HOB_TYPE (GuidHob) == EFI_HOB_TYPE_GUID_EXTENSION) { + if (EfiCompareGuid (&gPerfTuneDataHobGuid, &GuidHob.Guid->Name)) { + Status = EFI_SUCCESS; + pBiosSettingData = (PERF_TUNE_DATA_HOB *)(GuidHob.Raw); + break; + } + } + GuidHob.Raw = GET_NEXT_HOB (GuidHob); + } + + if (EFI_ERROR(Status)) return; + + if(pBiosSettingData->IsCpuChanged || pBiosSettingData->IsDimmChanged){ + Status = gRT->GetVariable( + L"OcDefault", + &EfiSetupGuid, + NULL, + &VarSize, + &DefaultData + ); + + BiosSettingData = pBiosSettingData->PerfTuneDataHob; + RequestFrequency = DefaultData.HostClockFreq; + PEGDMIRatio = DefaultData.PEGDMIRatio; + }else{ + BiosSettingData = pBiosSettingData->PerfTuneDataHob; + RequestFrequency = BiosSettingData.HostClockFreq; + PEGDMIRatio = BiosSettingData.PEGDMIRatio; + } + + if ( (PEGDMIRatio == 100) || (PEGDMIRatio == 0) || (PEGDMIRatio == 0xFFFF)){ + bPEGDMIRatio = 0; + }else if ( (PEGDMIRatio == 125) || (PEGDMIRatio == 1)){ + bPEGDMIRatio = 1; + }else if ( (PEGDMIRatio == 167) || (PEGDMIRatio == 2) ){ + bPEGDMIRatio = 2; + }else if ( (PEGDMIRatio == 250) || (PEGDMIRatio == 3) ){ + bPEGDMIRatio = 3; + }else{ + bPEGDMIRatio = 0; + } + + // Return if Overclocking Bclk not found + if((!gFound) || ((RequestFrequency == gCurrentFrequency) && + (bPEGDMIRatio == gPEGDMIRatio) && !(pBiosSettingData->IsCpuChanged || pBiosSettingData->IsDimmChanged)) ) return; + + if (bPEGDMIRatio == gPEGDMIRatio){ + gBootCurrent = FALSE; + RequestSetting.Frequency = RequestFrequency * 10000; + RequestSetting.SscMode = gClocksetting.SscMode; + if (bPEGDMIRatio==0){ + RequestSetting.SscPercent = 0x32; + }else{ + RequestSetting.SscPercent = 0; + } + RequestSetting.DmiPegRatio = bPEGDMIRatio; + gIccOverClockingProtocol->SetCurrentClockSettings(ClockID, + RequestSetting, + &IccStatus); + gIccOverClockingProtocol->GetCurrentClockSettings + (ClockID, &RequestSetting, &IccStatus); + + + RequestFrequency = RequestSetting.Frequency/10000; + PEGDMIRatio = RequestSetting.DmiPegRatio; + }else{ + gBootCurrent = TRUE; + RequestSetting.Frequency = RequestFrequency * 10000; + RequestSetting.SscMode = gClocksetting.SscMode; + if (bPEGDMIRatio==0){ + RequestSetting.SscPercent = 0x32; + }else{ + RequestSetting.SscPercent = 0; + } + RequestSetting.DmiPegRatio = bPEGDMIRatio; + gIccOverClockingProtocol->SetBootClockSettings(ClockID, + RequestSetting, + &IccStatus); + + gIccOverClockingProtocol->GetBootClockSettings + (ClockID, &RequestSetting, &IccStatus); + + + RequestFrequency = RequestSetting.Frequency/10000; + PEGDMIRatio = RequestSetting.DmiPegRatio; + } + + if(IccStatus == ICC_LIB_STATUS_SUCCESS) + { + // OverClocking Success + // ReStore back to OcCurrent + BiosSettingData.HostClockFreq = RequestFrequency; + IccFreqGaciData.DefaultDataValue = RequestFrequency; + if ( PEGDMIRatio == 0 ){ + BiosSettingData.PEGDMIRatio = 100; + IccPegDmiGaciData.DefaultDataValue = 100; + }else if ( PEGDMIRatio == 1 ){ + BiosSettingData.PEGDMIRatio = 125; + IccPegDmiGaciData.DefaultDataValue = 125; + }else if ( PEGDMIRatio == 2 ){ + BiosSettingData.PEGDMIRatio = 167; + IccPegDmiGaciData.DefaultDataValue = 167; + }else if ( PEGDMIRatio == 3 ){ + BiosSettingData.PEGDMIRatio = 250; + IccPegDmiGaciData.DefaultDataValue = 250; + } + + Status = gRT->SetVariable( + L"OcCurrent", + &SetupGuid, + EFI_VARIABLE_NON_VOLATILE | + EFI_VARIABLE_BOOTSERVICE_ACCESS, + sizeof(BIOS_SETTING_DATA), + &BiosSettingData ); + ASSERT_EFI_ERROR (Status); + } + + if (gBootCurrent == TRUE){ + Status = gBS->LocateProtocol(&gWdtProtocolGuid, NULL, &InternalWdtProtocol); + if(!EFI_ERROR(Status)) + { + InternalWdtProtocol->AllowKnownReset(); + } + IoWrite8 (0xCF9,0x06);//Setting REG/DMI ratio have to reset. + EFI_DEADLOOP(); + } + + return; +} + +VOID +IccXtuHandler( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable + ) +{ + UINT8 i; + EFI_STATUS Status; + PERF_TUNE_ASL_PROTOCOL *PerfTune3xProtocol; + UINTN Len = 0; + UINT8 *Buffer = NULL; + EFI_GUID IccOverClockingProtocolGuid = ICC_OVERCLOCKING_PROTOCOL_GUID; + + Status = gBS->LocateProtocol(&IccOverClockingProtocolGuid, NULL, &gIccOverClockingProtocol); + if(EFI_ERROR(Status)) return; + Status = gBS->LocateProtocol(&gPerfTune3xProtocolGuid, NULL, &PerfTune3xProtocol); + if(EFI_ERROR(Status)) return; + + for(i = 0; i < ICC_CLOCK_COUNT ; i++) + { + ICC_LIB_STATUS IccStatus; + ICC_CLOCK_RANGES ClockRange; + + gIccOverClockingProtocol->GetClockRanges(i, &ClockRange, &IccStatus); + + if ( (ClockRange.UsageMask & (1<<ICC_CLOCK_USAGE_BCLK) ) && + (ClockRange.UsageMask & (1<<ICC_CLOCK_USAGE_DMI) ) && + (ClockRange.UsageMask & (1<<ICC_CLOCK_USAGE_PEG) ) && + (IccStatus == ICC_LIB_STATUS_SUCCESS) + ) { + if (ClockRange.FrequencyMax != ClockRange.FrequencyMin) + gIccOverClockingProtocol->GetCurrentClockSettings + (i, &gClocksetting, &IccStatus); + if(IccStatus != ICC_LIB_STATUS_SUCCESS) + break; + + + gCurrentFrequency = gClocksetting.Frequency/10000; + + // Init GACI Data + IccFreqGaciData.MinDataValue = ClockRange.FrequencyMin/10000; + IccFreqGaciData.MinDisplayValue = ClockRange.FrequencyMin/10000; + + IccFreqGaciData.MaxDataValue = ClockRange.FrequencyMax/10000; + IccFreqGaciData.MaxDisplayValue = ClockRange.FrequencyMax/10000; + + IccFreqGaciData.DefaultDataValue = gCurrentFrequency;//ClockRange.FrequencyMin/10000; + IccFreqGaciData.NumberOfValues = IccFreqGaciData.MaxDataValue - IccFreqGaciData.MinDataValue + 1; + gFound = TRUE; + ClockID = i; + + gPEGDMIRatio = gClocksetting.DmiPegRatio; + + if ( gPEGDMIRatio == 0 ){ + IccPegDmiGaciData.DefaultDataValue = 100; + }else if ( gPEGDMIRatio == 1 ){ + IccPegDmiGaciData.DefaultDataValue = 125; + }else if ( gPEGDMIRatio == 2 ){ + IccPegDmiGaciData.DefaultDataValue = 167; + }else if ( gPEGDMIRatio == 3 ){ + IccPegDmiGaciData.DefaultDataValue = 250; + } + break; + } + } + PerfTuneIcc(ImageHandle,SystemTable); + // reference clock frequency + Len = sizeof(IccFreqGaciData); + Status = gBS->AllocatePool(EfiBootServicesData, Len, &Buffer); + gBS->SetMem(Buffer, Len, 0 ); + + gBS->CopyMem(Buffer, &IccFreqGaciData, sizeof(IccFreqGaciData)); + gBS->CopyMem(Buffer + sizeof(IccFreqGaciData), &IccFreqGaciData, sizeof(IccFreqGaciData)); + Status = PerfTune3xProtocol->SetGaciData(Buffer, Len); + //PEG/DMI Ratio + Len = sizeof(IccPegDmiGaciData); + Status = gBS->AllocatePool(EfiBootServicesData, Len, &Buffer); + gBS->SetMem(Buffer, Len, 0 ); + + gBS->CopyMem(Buffer, &IccPegDmiGaciData, sizeof(IccPegDmiGaciData)); + Status = PerfTune3xProtocol->SetGaciData(Buffer, Len); + return; +} +#endif + +EFI_STATUS +IccPlatformEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable + ) +{ + EFI_STATUS Status; + UINT8 OldProfile; +#ifdef CougarPoint_SUPPORT + UINT8 WdtStatus = V_PCH_OC_WDT_CTL_STATUS_OK; + WDT_PROTOCOL *WdtProtocol; +#endif + + + DEBUG ((EFI_D_INFO, "(ICC) Entry Point to ICC_Platform\n")); + + Status = ReadMainSetupData (&mIccConfig); + + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "(ICC) Failed to read setup data! Status = %r\n", Status)); + return Status; + } + Status = HeciGetIccProfile (&OldProfile); + Status = gBS->LocateProtocol(&gMeBiosPayloadDataProtocolGuid, NULL, &mBIOSPayLoad); + if(EFI_ERROR(Status)) + { + DEBUG ((EFI_D_ERROR, "(ICC) Get BIOS PayLoad Data Protocol fail !! Status = %r \n", Status)); + mBIOSPayLoad = NULL; + } +#ifdef CougarPoint_SUPPORT + Status = gBS->LocateProtocol(&gWdtProtocolGuid, NULL, &WdtProtocol); + if ( EFI_ERROR(Status) ) { + DEBUG ((EFI_D_ERROR, "(ICC) Failed to locate Wdt protocol, Status = %r\n",Status)); + return EFI_SUCCESS; + } + WdtStatus = WdtProtocol->CheckStatus(); + + if (mIccConfig.ClocksModified != ICC_SETTINGS_NOT_MODIFIED && WdtStatus == V_PCH_OC_WDT_CTL_STATUS_FAILURE) { + IccFailureNotification(); + } +#endif + + ASSERT_EFI_ERROR (Status); + + if (mIccConfig.ProfileSelection != OPTION_DISABLED) { + ProfileSelection(mIccConfig.SelectedIccProfile); + }; + + IccMessages(); + +#if defined PERF_TUNE_SUPPORT && PERF_TUNE_SUPPORT == 1 + IccXtuHandler(ImageHandle,SystemTable); +#endif + return EFI_SUCCESS; +} + +EFI_STATUS +ClockFailureReport ( + IN EFI_EVENT Event, + IN VOID *Context + ) +/*++ +Routine Description: + Displays error message just below the "press DEL to enter setup" message + and forces user to enter setup. This is used when BIOS-initiated changes + to ICC registers caused platform instability and need to be cancelled +Arguments: + Event - not used + Context - not used +Returns: + EFI_SUCCESS if everything's OK +--*/ +{ + EFI_STATUS Status; + EFI_INPUT_KEY Key; + UINT32 VarAttr; + UINTN VarSize; + UINT32 BootFlow; + EFI_GUID guidBootFlow = BOOT_FLOW_VARIABLE_GUID; + + Status = EFI_SUCCESS; + + DEBUG ((EFI_D_INFO, "(ICC) ClockFailureReport\n")); + + gST->ConOut->OutputString ( + gST->ConOut, + L"Boot attempt failed after platform clock settings were modified by BIOS!\r\n" + ); + gST->ConOut->OutputString (gST->ConOut, L"Press any key to enter SETUP.\r\n"); + do { + Status = gBS->CheckEvent (gST->ConIn->WaitForKey); + } while (Status == EFI_NOT_READY); + Status = gST->ConIn->ReadKeyStroke (gST->ConIn, &Key); + + VarAttr = 0; + VarSize = sizeof(BootFlow); + Status = gRT->GetVariable( + L"BootFlow", + &guidBootFlow, + &VarAttr, + &VarSize, + &BootFlow ); + if( EFI_ERROR(Status) ) + { + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS; + VarSize = sizeof(BootFlow); + } + + BootFlow = BOOT_FLOW_CONDITION_FIRST_BOOT; + gRT->SetVariable( + L"BootFlow", + &guidBootFlow, + VarAttr, + VarSize, + &BootFlow ); + + return Status; +} + +EFI_STATUS +DetectUsedClocks ( + OUT UINT32*UsedClocks, + OUT UINT32*AllClocks + ) +/*++ +Routine Description: + Detects which PCI/PCIE clocks are not needed and can be turned off. + For PCIE, PCIE bridge is accessed, one of its registers knows if there are cards + present in slots + For PCI, this function tries to access PCI devices that would exist if PCI + cards were put into slots. If such access fails, then slot must be empty and + its clock can be turned off +Arguments: + UsedClocks: bitmask for Clock Enable: 1 = enable, 0 = disable + AllClocks: bitmask for Clock Enable Mask: 1 = Clock Enable bit is valid, 0 = ignore Clock Enable bit +Returns: + EFI_SUCCESS in all circumstances except when required protocols can't be located +--*/ +{ + UINT32 i; + UINT8 PciQnt; + UINT8 PciExpressQnt; +// UINT32 BusNumberRegister; + UINT8 BusNumber = 0; + UINT8 FunctionNumber; + UINT16 VendorID; + UINT16 SlotStatus; + UINT32 Rcba; + UINT32 RootPortFunctionNumber = 0; + UINT8 SkipPciDetection = 0; + EFI_STATUS Status; + EFI_GUID SetupGuid = SETUP_GUID; + SETUP_DATA SetupData; + UINTN VariableSize; + PLATFORM_PCIE_SLOTS PciExpressSlots[] = {PCIE_CLOCK_CONFIG{0,0,0}}; + PLATFORM_PCI_SLOTS PciSlots[] = {PCI_CLOCK_CONFIG{0,0,0}}; + // + // all PCI/PCIE-related clocks are turned off by default and only turned on when needed + // such negative logic covers situation where two or more slots share one clock + // + for (i = 0; OemClockUpdate[i] != NULL; i++) + OemClockUpdate[i](PciExpressSlots, PciSlots); + + + *UsedClocks = 0xFFFFFFFF; + *AllClocks = 0x0; + + PciQnt = (sizeof (PciSlots) / sizeof (PLATFORM_PCI_SLOTS)) - 1; + PciExpressQnt = (sizeof (PciExpressSlots) / sizeof (PLATFORM_PCIE_SLOTS)) - 1; + + for (i = 0; i < PciQnt; i++) { + *UsedClocks &= ~(PciSlots[i].Clock); + *AllClocks |= PciSlots[i].Clock; + } + + for (i = 0; i < PciExpressQnt; i++) { + *UsedClocks &= ~(PciExpressSlots[i].Clock); + *AllClocks |= PciExpressSlots[i].Clock; + } + + // PCI Express + // + // + // read RootPortFunctionNumber register, it knows (pcie bridge's function number) - to - (physical slot) mapping + // + if (PciExpressQnt > 0) { + + Rcba = MmioRead32 ( + MmPciAddress ( + 0, + DEFAULT_PCI_BUS_NUMBER_PCH, + PCI_DEVICE_NUMBER_PCH_LPC, + PCI_FUNCTION_NUMBER_PCH_LPC, + R_PCH_LPC_RCBA + ) + ); + + Rcba &= B_PCH_LPC_RCBA_BAR; + RootPortFunctionNumber = MmioRead32 ((UINTN) (Rcba + R_PCH_RCRB_RPFN)); + } + // + // detect cards in PCIE slots + // + for (i = 0; i < PciExpressQnt; i++) { + FunctionNumber = + ( + RootPortFunctionNumber >> + (S_PCH_RCRB_PRFN_RP_FIELD * PciExpressSlots[i].RootPortNumber) + ) & 0x00000007; + + + VendorID = MmioRead16 ( + MmPciAddress ( + 0, + DEFAULT_PCI_BUS_NUMBER_PCH, + PCI_DEVICE_NUMBER_PCH_PCIE_ROOT_PORTS, + FunctionNumber, + R_PCH_PCIE_VENDOR_ID + ) + ); + + SlotStatus = MmioRead16 ( + MmPciAddress ( + 0, + DEFAULT_PCI_BUS_NUMBER_PCH, + PCI_DEVICE_NUMBER_PCH_PCIE_ROOT_PORTS, + FunctionNumber, + R_PCH_PCIE_SLSTS + ) + ); +//******************************************************************************** + VariableSize = sizeof (SETUP_DATA); + Status = gRT->GetVariable ( + L"Setup", + &SetupGuid, + NULL, + &VariableSize, + &SetupData + ); + ASSERT_EFI_ERROR (Status); + + PciExpressSlots[i].HotPlugSupport = SetupData.PcieRootPortHPE[i]; +//********************************************************************************* + if (PciExpressSlots[i].HotPlugSupport == 1 || + (VendorID != 0xFFFF && ((SlotStatus & B_PCH_PCIE_SLSTS_PDS) != 0)) + ) { + *UsedClocks |= PciExpressSlots[i].Clock; + } + } + + DEBUG ((EFI_D_INFO, "(ICC) PCI(E) Clocks Disabled: 0x%08x\n", (*AllClocks & ~(*UsedClocks)) )); + DEBUG ((EFI_D_INFO, "(ICC) PCI(E) Clocks Enabled: 0x%08x\n", (*AllClocks & *UsedClocks ) )); + DEBUG ((EFI_D_INFO, "(ICC) Clocks left alone: 0x%08x\n", ~(*AllClocks) )); + + return EFI_SUCCESS; + +} + +EFI_STATUS +EFIAPI +IccFailureNotification ( + VOID + ) +/*++ +Routine Description: + This function should only be called if Watchdog timer expiration was detected + after BIOS changes ICC settings. Error message is displayed and BIOS setup is entered. +Arguments: + none +Returns: + EFI_SUCCESS if everything's OK +--*/ +{ + EFI_EVENT Event; + VOID *EventPointer; + EFI_GUID AllDriversConnectedProtocolGuid = BDS_ALL_DRIVERS_CONNECTED_PROTOCOL_GUID; + EFI_STATUS Status; + + Status = gBS->CreateEvent ( + EFI_EVENT_NOTIFY_SIGNAL, + EFI_TPL_CALLBACK, + ClockFailureReport, + NULL, + &Event + ); + if (!EFI_ERROR (Status)) { + Status = gBS->RegisterProtocolNotify ( + &AllDriversConnectedProtocolGuid, + Event, + &EventPointer + ); + } + + DEBUG ((EFI_D_INFO, "(ICC) ClockFailureReport event registration; Status = 0x%02x\n", Status)); + return Status; +} + +EFI_STATUS +OnReadyToBoot ( +IN EFI_EVENT Event, +IN VOID *Context +) +{ + EFI_GUID IccSetupDataGuid = ICC_VOLATILE_SETUP_DATA_GUID; + UINT8 ReadyToBoot = 1; + EFI_STATUS Status; + + Status = gRT->SetVariable ( + L"AfterReadyToBoot", + &IccSetupDataGuid, + EFI_VARIABLE_BOOTSERVICE_ACCESS, + sizeof(UINT8), + &ReadyToBoot + ); + + return EFI_SUCCESS; +} +EFI_STATUS +IccMessages ( + VOID + ) +/*++ +Routine Description: + Schedules SetClockEnables and LockRegisters Icc heci messages to be executed after PCI enumeration is done +Arguments: + none +Returns: + EFI_SUCCESS if everything's OK +--*/ +{ + EFI_EVENT Event; + VOID *EventPointer; + EFI_GUID AllDriversConnectedProtocolGuid = BDS_ALL_DRIVERS_CONNECTED_PROTOCOL_GUID; + EFI_STATUS Status; + EFI_EVENT ReadytoBootEvent; + EFI_GUID EfiEventReadyToBootGuid = EFI_EVENT_GROUP_READY_TO_BOOT; + + Status = gBS->CreateEvent ( + EFI_EVENT_NOTIFY_SIGNAL, + EFI_TPL_CALLBACK, + SendIccMessages, + NULL, + &Event + ); + if (!EFI_ERROR (Status)) { + Status = gBS->RegisterProtocolNotify ( + &AllDriversConnectedProtocolGuid, + Event, + &EventPointer + ); + } + + DEBUG ((EFI_D_INFO, "(ICC) IccMessages event registration; Status = 0x%02x\n", Status)); +#if (EFI_SPECIFICATION_VERSION < 0x00020000) + gBS->CreateEvent ( + EFI_EVENT_SIGNAL_READY_TO_BOOT | EFI_EVENT_NOTIFY_SIGNAL_ALL, + TPL_CALLBACK, + OnReadyToBoot, + NULL, + &ReadytoBootEvent + ); +#else + gBS->CreateEventEx ( + EFI_EVENT_NOTIFY_SIGNAL, + TPL_CALLBACK, + OnReadyToBoot, + NULL, + &EfiEventReadyToBootGuid, + &ReadytoBootEvent + ); +#endif + return Status; +} + + +UINT8 +ReadIccSoftStraps ( + VOID + ) +/*++ +Routine Description: + Reads soft straps from flash to check who is responsible for selecting ICC clock profile. +Arguments: +Returns: + PROFILE_SELECTED_BY_BIOS + PROFILE_SELECTED_BY_ME +--*/ +{ + UINT32 PchRootComplexBar; + UINT32 Softstrap10; + + PchRootComplexBar = MmioRead32 ( + MmPciAddress ( + 0, + DEFAULT_PCI_BUS_NUMBER_PCH, + PCI_DEVICE_NUMBER_PCH_LPC, + PCI_FUNCTION_NUMBER_PCH_LPC, + R_PCH_LPC_RCBA + ) + ); + + PchRootComplexBar &= ~BIT0; + + MmioAndThenOr32 ( + PchRootComplexBar + R_PCH_SPI_FDOC, + (UINT32) (~(B_PCH_SPI_FDOC_FDSS_MASK | B_PCH_SPI_FDOC_FDSI_MASK)), + (UINT32) (V_PCH_SPI_FDOC_FDSS_PCHS | SOFTSTRAP10) + ); + + Softstrap10 = MmioRead32 (PchRootComplexBar + R_PCH_SPI_FDOD); + + if (Softstrap10 & CLOCK_PROFILE_SELECTOR) { + return PROFILE_SELECTED_BY_ME; + } + return PROFILE_SELECTED_BY_BIOS; +} + +EFI_STATUS +ReadMainSetupData ( + OUT ICC_CONFIG* IccConfig + ) +/*++ +Routine Description: + reads SETUP_DATA and creates IccConfig with all Icc-related setup informations +Arguments: +Returns: + filled SETUP_DATA struct +--*/ +{ + EFI_STATUS Status; + UINT32 SetupVarAttr; + UINTN VariableSize; + UINT32 Attributes; + EFI_GUID SetupGuid = SETUP_GUID; + EFI_GUID IccPersistentDataGuid = ICC_PERSISTENT_DATA_GUID; + SETUP_DATA SetupData; + ICC_PERSISTENT_DATA IccPersistentData; + + DEBUG ((EFI_D_ERROR, "(ICC) ReadMainSetupData\n")); + + SetupVarAttr = 0; + VariableSize = sizeof (SETUP_DATA); + + Status = gRT->GetVariable( + L"Setup", + &SetupGuid, + &SetupVarAttr, + &VariableSize, + &SetupData ); + if( EFI_ERROR(Status) ) { + DEBUG ((EFI_D_ERROR, "Failed to read SETUP_DATA! Status = %r\n", Status)); + return Status; + } + + VariableSize = sizeof (ICC_PERSISTENT_DATA); + + Status = gRT->GetVariable ( + L"IccPersistentData", + &IccPersistentDataGuid, + &Attributes, + &VariableSize, + &IccPersistentData + ); + if (EFI_ERROR (Status)) { + IccPersistentData.ClocksModified = ICC_SETTINGS_NOT_MODIFIED; + } + + IccConfig->ClocksModified = IccPersistentData.ClocksModified; + + IccConfig->SelectedIccProfile = SetupData.IccSelectedProfile; + + if ( ReadIccSoftStraps () != PROFILE_SELECTED_BY_BIOS ) { + IccConfig->ProfileSelection = OPTION_DISABLED; + } else { + IccConfig->ProfileSelection = OPTION_ENABLED; + } + + IccConfig->LockIccRegisters = OPTION_ENABLED; + + // + // in LockMask, 0 means lock and 1 means don't lock this particular register + // + if (SetupData.IccLockRegisters == OPTION_LOCK_STATIC) { + IccConfig->LockMask[2] = STATIC_REGISTERS_MASK2; + IccConfig->LockMask[1] = STATIC_REGISTERS_MASK1; + IccConfig->LockMask[0] = STATIC_REGISTERS_MASK0; + } else { + IccConfig->LockMask[2] = 0; + IccConfig->LockMask[1] = 0; + IccConfig->LockMask[0] = 0; + } + + if (SetupData.IccSetClockEnables == OPTION_ENABLED) { + IccConfig->SetClkEnables = OPTION_ENABLED; + } else { + IccConfig->SetClkEnables = OPTION_DISABLED; + } + + if (IccConfig->ProfileSelection != SetupData.IccDisplayProfile) { + SetupData.IccDisplayProfile = IccConfig->ProfileSelection; + Status = gRT->SetVariable( + L"Setup", + &SetupGuid, + SetupVarAttr, + sizeof(SETUP_DATA), + &SetupData ); + } + + return EFI_SUCCESS; +} + +EFI_STATUS +ProfileSelection ( + IN UINT8 NewProfile + ) +/*++ +Routine Description: + Chooses ICC clock profile to be used by platform for future boots. +Arguments: + NewProfile - requested clock profile +Returns: + nothing (and the platform reboots) if profile was changed + EFI_SUCCESS if there was no need to change profile + other result if HECI communication failed +--*/ +{ + EFI_STATUS Status; + UINT8 OldProfile; + + Status = HeciGetIccProfile (&OldProfile); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "(ICC) Failed to read clock profile, status = %r.\n", Status)); + return Status; + } + + if (NewProfile != OldProfile) { + Status = HeciSetIccProfile (NewProfile); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "(ICC) Failed to change clock profile, status = %r.\n", Status)); + return Status; + } + + DEBUG ((EFI_D_INFO, "(ICC) Clock Profile was changed, rebooting platform.\n")); + Status = HeciSendCbmResetRequest(CBM_RR_REQ_ORIGIN_BIOS_POST, CBM_HRR_GLOBAL_RESET); + if (EFI_ERROR (Status)) { + DEBUG ((EFI_D_ERROR, "(ICC) Failed to trigger reset, status = %r.\n", Status)); + return Status; + } + + EFI_DEADLOOP(); + } + + return EFI_SUCCESS; +} + +EFI_STATUS +WaitForFwInitComplete ( + UINT32 mSeconds +) +/*++ +Routine Description: + waits for Fw init complete - safety measure to prevent sending Heci messages + while FW can't receive them. +Arguments: + mSeconds - limit for wait time, in miliseconds +Returns: + EFI_SUCCESS if Fw init is complete + EFI_TIMEOUT if init is still not complete after allocated time + other errors when something's wrong with Heci protocol +--*/ +{ + EFI_HECI_PROTOCOL *Heci; + UINT32 MeStatus; + UINT32 MeMode; + UINT32 RetryCount; + EFI_STATUS Status; + + RetryCount = 0; + + Status = gBS->LocateProtocol ( + &gEfiHeciProtocolGuid, + NULL, + &Heci + ); + + if (EFI_ERROR(Status)) { + DEBUG ((EFI_D_ERROR, "(ICC) Failed to locate Heci protocol! Status = %r\n", Status)); + return Status; + } + + Status = Heci->GetMeMode (&MeMode); + if (EFI_ERROR (Status) || (MeMode != ME_MODE_NORMAL)) { + return EFI_UNSUPPORTED; + } + + PERF_START (0, L"Icc waiting for FwInitComplete", NULL, 0) ; + while (1) { + Heci->GetMeStatus (&MeStatus); + if (ME_STATUS_IS_ME_FW_INIT_COMPLETE (MeStatus)) { + PERF_END (0, L"Icc waiting for FwInitComplete", NULL, 0) ; + DEBUG ((EFI_D_INFO, "(ICC) Waited %d ms for FwInitComplete.\n", RetryCount)); + return EFI_SUCCESS; + } + if (RetryCount > mSeconds) { + PERF_END (0, L"Icc waiting for FwInitComplete", NULL, 0) ; + DEBUG ((EFI_D_ERROR, "(ICC) Time out! Waited %d ms for FwInitComplete.\n", RetryCount)); + return EFI_TIMEOUT; + } + RetryCount++; + gBS->Stall (1000);//1ms + } +} + +EFI_STATUS +SendIccMessages ( +IN EFI_EVENT Event, +IN VOID *Context +) +/*++ +Routine Description: + Sends SetClockEnables and LockRegisters Icc Heci messages +Arguments: + none +Returns: + nothing +--*/ +{ + EFI_STATUS Status; + UINT8 ResponseMode = 1, AccessMode = 0;/*0 - set, 1 - get*/ + ICC_LOCK_REGS_INFO IccLockRegs; + EFI_GUID SetupGuid = SETUP_GUID; + SETUP_DATA SetupData; + UINTN VariableSize; + + DEBUG ((EFI_D_INFO, "(ICC) Send Icc Heci Messages\n")); + + if (mIccConfig.ProfileSelection != OPTION_DISABLED) { + ProfileSelection(mIccConfig.SelectedIccProfile); + }; + + VariableSize = sizeof (SETUP_DATA); + Status = gRT->GetVariable ( + L"Setup", + &SetupGuid, + NULL, + &VariableSize, + &SetupData); + + ASSERT_EFI_ERROR (Status); + + if (mIccConfig.SetClkEnables == OPTION_ENABLED) { + DetectUsedClocks (&mIccConfig.ClkEnables, + &mIccConfig.ClkEnablesMask + ); + + Status = HeciSetIccClockEnables (mIccConfig.ClkEnables, + mIccConfig.ClkEnablesMask, + ResponseMode + ); + } + + if(mBIOSPayLoad) + { + gBS->CopyMem(&(IccLockRegs.RegBundles), + &(mBIOSPayLoad->MeBiosPayload.IccProfile.IccLockRegInfo.RegBundles), + sizeof(ICC_REG_BUNDLES)); + + gBS->CopyMem((IccLockRegs.RegMask), + (mBIOSPayLoad->MeBiosPayload.IccProfile.IccLockRegInfo.RegMask), + sizeof(UINT32) * IccLockRegs.RegBundles.BundlesCnt); + + VariableSize = sizeof(UINT32) * 3; + Status = gRT->GetVariable( + L"IccLockDefault", + &SetupGuid, + NULL, + &VariableSize, + IccLockRegs.RegMask ); + if( Status == EFI_NOT_FOUND ) + { + Status = gRT->SetVariable( + L"IccLockDefault", + &SetupGuid, + EFI_VARIABLE_NON_VOLATILE | + EFI_VARIABLE_BOOTSERVICE_ACCESS, + VariableSize, + IccLockRegs.RegMask ); + } + if(SetupData.IccLockRegisters == 3) + { + IccLockRegs.RegBundles.AU = 0; + IccLockRegs.RegBundles.BundlesCnt = 3; + } + + if(SetupData.IccLockRegisters == 4) + { + IccLockRegs.RegBundles.BundlesCnt = 0; + IccLockRegs.RegBundles.AU = 0; + } + + if(SetupData.IccLockRegisters == 5) + { + IccLockRegs.RegBundles.BundlesCnt = 0; + IccLockRegs.RegBundles.AU = 1; + } + + Status = HeciLockIccRegisters (AccessMode, ResponseMode, &IccLockRegs); + + } + + return EFI_SUCCESS; +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.cif b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.cif new file mode 100644 index 0000000..7677f59 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.cif @@ -0,0 +1,12 @@ +<component> + name = "IccPlatform" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\Icc\IccPlatform" + RefName = "IccPlatform" +[files] +"IccPlatform.sdl" +"IccPlatform.dxs" +"IccPlatform.mak" +"IccPlatform.c" +"IccPlatform.h" +<endComponent>
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.dxs b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.dxs new file mode 100644 index 0000000..a2912b9 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.dxs @@ -0,0 +1,116 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccPlatform/IccPlatform.dxs 2 5/13/13 2:41a Klzhan $ +// +// $Revision: 2 $ +// +// $Date: 5/13/13 2:41a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccPlatform/IccPlatform.dxs $ +// +// 2 5/13/13 2:41a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix build error when Icc_OverClocking_support is +// disabled +// +// 1 2/08/12 1:06a Klzhan +// Initial Check in +// +// 2 6/27/11 8:39a Klzhan +// Support New XTU protocol. +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccPlatform.dxs +// +// Description: Platform-specific ICC code +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccPlatform.dxs + +Abstract: + + Platform-specific ICC code + +--*/ +#include "Token.h" +#include "AutoGen.h" +#include "DxeDepex.h" +#if defined (BUILD_WITH_GLUELIB) || defined (BUILD_WITH_EDKII_GLUE_LIB) +#include "EfiDepex.h" +#endif +#include EFI_PROTOCOL_DEPENDENCY (PciRootBridgeIo) +#include EFI_PROTOCOL_DEPENDENCY (Wdt) +#include EFI_PROTOCOL_DEPENDENCY (PchInfo) +#include "Protocol\IccOverClocking\IccOverClocking.h" +#if defined PERF_TUNE_SUPPORT && PERF_TUNE_SUPPORT == 1 + +#define PERF_TUNE_ASL_PROTOCOL_GUID \ + {0x32519f22, 0x3eb, 0x47b6, 0xb3, 0xef, 0xdb, 0x93, 0x98, 0xd6, 0x4e, 0x45} +#endif + +DEPENDENCY_START +#if defined PERF_TUNE_SUPPORT && PERF_TUNE_SUPPORT == 1 + PERF_TUNE_ASL_PROTOCOL_GUID AND +#endif +#if IccOverClocking_SUPPORT + ICC_OVERCLOCKING_PROTOCOL_GUID AND +#endif + EFI_PCI_ROOT_BRIDGE_IO_PROTOCOL_GUID AND + WDT_PROTOCOL_GUID AND + EFI_PCH_INFO_PROTOCOL_GUID +DEPENDENCY_END + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.h b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.h new file mode 100644 index 0000000..fb4bda4 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.h @@ -0,0 +1,260 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccPlatform/IccPlatform.h 1 2/08/12 1:06a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:06a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccPlatform/IccPlatform.h $ +// +// 1 2/08/12 1:06a Klzhan +// Initial Check in +// +// 4 7/27/11 3:21a Klzhan +// Add Elinks for PCIE and PCI config. +// Note: Don't List GBE port on this Elink. +// +// 3 7/15/11 12:45a Klzhan +// +// 2 6/27/11 8:38a Klzhan +// Remove un-use define. +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccPlatform.h +// +// Description: Platform-specific ICC code +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> + +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccPlatform.h + +Abstract: + + Platform-specific ICC code + +--*/ + +#ifdef CougarPoint_SUPPORT +#define SOFTSTRAP10 R_PCH_SPI_STRP10 +#else +#define SOFTSTRAP10 R_PCH_SPI_PCHSTRP10 +#endif + +#define ICC_INIT_TIMEOUT 5000 // ms + +#define RETAIN_CLOCK_ENABLES_AT_RESUME_FROM_S3 0x1 +#define CLOCK_PROFILE_SELECTOR BIT22 + +#define PROFILE_SELECTED_BY_BIOS 0 +#define PROFILE_SELECTED_BY_ME 1 + +// +// 96-bit mask of registers to be locked by LockIccRegister heci message +// 0 = lock, 1 = don't +// see CPT c-spec for register names +// +#define STATIC_REGISTERS_MASK2 0x00000000 +#define STATIC_REGISTERS_MASK1 0x0F0f0013 +#define STATIC_REGISTERS_MASK0 0x00000000 + +#define OPTION_DISABLED 0 +#define OPTION_ENABLED 1 +#define OPTION_MANUAL 2 +#define OPTION_AUTO 3 +#define OPTION_LOCK_STATIC 4 +#define OPTION_LOCK_ALL 5 +#define OPTION_USE_OEM 6 +#define OPTION_OVERRIDE 7 +// +// OCLKEN (ICC clock enables) register bit definitions +// +#define CLOCK_Flex0 BIT0 +#define CLOCK_Flex1 BIT1 +#define CLOCK_Flex2 BIT2 +#define CLOCK_Flex3 BIT3 +#define CLOCK_PCI_Clock0 BIT7 +#define CLOCK_PCI_Clock1 BIT8 +#define CLOCK_PCI_Clock2 BIT9 +#define CLOCK_PCI_Clock3 BIT10 +#define CLOCK_PCI_Clock4 BIT11 +#define CLOCK_SRC0 BIT16 +#define CLOCK_SRC1 BIT17 +#define CLOCK_SRC2 BIT18 +#define CLOCK_SRC3 BIT19 +#define CLOCK_SRC4 BIT20 +#define CLOCK_SRC5 BIT21 +#define CLOCK_SRC6 BIT22 +#define CLOCK_SRC7 BIT23 +#define CLOCK_CSI_SRC8 BIT24 +#define CLOCK_CSI_DP BIT25 +#define CLOCK_PEG_A BIT26 +#define CLOCK_PEG_B BIT27 +#define CLOCK_DMI BIT28 + +#define BDS_ALL_DRIVERS_CONNECTED_PROTOCOL_GUID \ + {0xdbc9fd21, 0xfad8, 0x45b0, 0x9e, 0x78, 0x27, 0x15, 0x88, 0x67, 0xcc, 0x93} + +typedef struct { + UINT32 Clock; + UINT8 DeviceNumber; + BOOLEAN HotPlugSupport; +} PLATFORM_PCI_SLOTS; + +typedef struct { + UINT32 Clock; + UINT8 RootPortNumber; + BOOLEAN HotPlugSupport; +} PLATFORM_PCIE_SLOTS; + +typedef struct _ICC_CONFIG { + UINT8 LockIccRegisters; + UINT8 SetClkEnables; + UINT8 ProfileSelection; + UINT8 SelectedIccProfile; + UINT32 LockMask[3]; + UINT32 ClkEnables; + UINT32 ClkEnablesMask; + UINT8 ClocksModified; +} ICC_CONFIG; + +VOID +DisableProfileSelection ( + VOID + ); + +EFI_STATUS +ProfileSelection ( + IN UINT8 NewProfile + ); + +EFI_STATUS +DetectUsedClocks ( + OUT UINT32 *UsedClocks, + OUT UINT32 *AllClocks + ); + +EFI_STATUS +CallSetClockEnables ( + IN EFI_EVENT Event, + IN VOID *Context + ); + +EFI_STATUS +ReadMainSetupData ( + ICC_CONFIG* IccConfig + ); + +UINT8 +ReadIccSoftStraps ( + VOID + ); + +EFI_STATUS +WaitForFwInitComplete ( + UINT32 uSeconds + ); + +EFI_STATUS +IccFailureNotification ( + VOID + ); + +EFI_STATUS +SendIccMessages ( + IN EFI_EVENT Event, + IN VOID *Context + ); + +EFI_STATUS +IccMessages ( + VOID + ); + +#ifdef CougarPoint_SUPPORT + +EFI_STATUS +WdtSupport ( + VOID + ); + +EFI_STATUS +FeedWatchdog ( + IN EFI_EVENT Event, + IN VOID *Context + ); + +EFI_STATUS +StopFeedingWatchdog ( + IN EFI_EVENT Event, + IN VOID *Context + ); + +#endif; + +#if defined PERF_TUNE_SUPPORT && PERF_TUNE_SUPPORT == 1 +typedef struct _ACPI_HDR { + UINT32 Signature; + UINT32 Length; + UINT8 Revision; + UINT8 Checksum; + UINT8 OemId[6]; + UINT8 OemTblId[8]; + UINT32 OemRev; + UINT32 CreatorId; + UINT32 CreatorRev; +} ACPI_HDR,*PACPI_HDR; +#endif; +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.mak b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.mak new file mode 100644 index 0000000..71bca92 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.mak @@ -0,0 +1,171 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccPlatform/IccPlatform.mak 5 9/27/12 6:23a Klzhan $ +# +# $Revision: 5 $ +# +# $Date: 9/27/12 6:23a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccPlatform/IccPlatform.mak $ +# +# 5 9/27/12 6:23a Klzhan +# Fix build error +# +# 4 9/19/12 5:54a Klzhan +# 1. Fix Build Error when Performance is on(IccPlatform.mak). +# 2. Avoid time-out in ICC setup Page when return from Shell. +# 3. Remove un-used wait for Fw Init Done. +# +# 3 4/24/12 12:28a Klzhan +# +# 2 2/23/12 8:57a Klzhan +# Support New EDK +# +# 1 2/08/12 1:06a Klzhan +# Initial Check in +# +# 4 9/06/11 6:38a Klzhan +# Remove __EDKII_GLUE_EDK_DXE_RUNTIME_DRIVER_LIB__ +# +# 3 7/27/11 3:21a Klzhan +# Add Elinks for PCIE and PCI config. +# Note: Don't List GBE port on this Elink. +# +# 2 7/15/11 12:45a Klzhan +# +# 1 2/25/11 1:42a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: IccPlatform.mak +# +# Description: MakFile for Platform-specific ICC code +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +all : IccPlatform + +$(BUILD_DIR)\IccPlatform.mak : $(IccPlatform_DIR)\$(@B).cif $(BUILD_RULES) + $(CIF2MAK) $(IccPlatform_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +IccPlatform : $(BUILD_DIR)\IccPlatform.mak IccPlatform_Bin + +IccPlatform_INCLUDES=\ + $(EDK_INCLUDES)\ + $(EdkIIGlueLib_INCLUDES)\ + $(ME_INCLUDES)\ + $(MISCFRAMEWORK_INCLUDES)\ + $(INTEL_MCH_INCLUDES)\ + $(NB_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + $(ICC_INCLUDES)\ + /I$(PROJECT_DIR)\ + /IInclude\ + +IccPlatform_LIBS=\ + $(EDKPROTOCOLLIB)\ + $(EDKFRAMEWORKPROTOCOLLIB)\ + $(EFISCRIPTLIB)\ + $(EFIGUIDLIB)\ + $(MeProtocolLib_LIB)\ + $(MeLibDxe_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ + $(EdkIIGlueBasePrintLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueBaseMemoryLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueEdkDxeRuntimeDriverLib_LIB)\ + $(EdkIIGluePeiDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueUefiBootServicesTableLib_LIB)\ + $(EdkIIGlueUefiLib_LIB)\ + $(EdkIIGlueDxeMemoryAllocationLib_LIB)\ + $(EdkIIGlueDxeServicesTableLib_LIB)\ + $(EdkIIGlueBasePciCf8Lib_LIB)\ + $(EFIDRIVERLIB)\ + $(INTEL_PCH_PROTOCOL_LIB)\ + +DxeCpuBuildDefine = \ +!IF "$(x64_BUILD)"=="1" + /DMDE_CPU_X64\ +!ELSE + /DMDE_CPU_IA32\ +!ENDIF + +IccPlatform_DEFINES=\ + $(MY_DEFINES)\ + $(DxeCpuBuildDefine)\ + /D"__EDKII_GLUE_MODULE_ENTRY_POINT__=IccPlatformEntryPoint"\ + /D __EDKII_GLUE_BASE_MEMORY_LIB__ \ + /D __EDKII_GLUE_DXE_REPORT_STATUS_CODE_LIB__ \ + /D __EDKII_GLUE_PEI_DXE_DEBUG_LIB_REPORT_STATUS_CODE__ \ + /D __EDKII_GLUE_UEFI_BOOT_SERVICES_TABLE_LIB__\ + +ICC_ELINKS = \ +/D\"OEM_CLOCK_UPDATE_FUNC=$(OEMClockUpdateFunc)\"\ +!IF "$(OEMPCIEClockConfig)" == "" +/D\"PCIE_CLOCK_CONFIG=$(PCIEClockConfig)\"\ +!ELSE +/D\"PCIE_CLOCK_CONFIG=$(OEMPCIEClockConfig)\"\ +!ENDIF +!IF "$(OEMPCIClockConfig)" == "" +/D\"PCI_CLOCK_CONFIG=$(PCIClockConfig)\" +!ELSE +/D\"PCI_CLOCK_CONFIG=$(OEMPCIClockConfig)\" +!ENDIF + + +IccPlatform_Bin : $(IccPlatform_LIBS) $(OemClock_LIB) + $(MAKE) /$(MAKEFLAGS) $(EDKIIGLUE_DEFAULTS)\ + /f $(BUILD_DIR)\IccPlatform.mak all\ + "MY_INCLUDES=$(IccPlatform_INCLUDES)"\ + "MY_DEFINES=$(IccPlatform_DEFINES)"\ + "CFLAGS=$(CFLAGS) $(ICC_ELINKS)" \ + GUID=14257B56-BDA2-4faf-8E4F-C885DF75583C\ + ENTRY_POINT=_ModuleEntryPoint \ + EDKIIModule=DXEDRIVER\ + TYPE=BS_DRIVER \ + DEPEX1=$(IccPlatform_DIR)\IccPlatform.dxs \ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + COMPRESS=1\ + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.sdl b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.sdl new file mode 100644 index 0000000..0bb0e9a --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccPlatform/IccPlatform.sdl @@ -0,0 +1,67 @@ +TOKEN + Name = "IccPlatform_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + TargetH = Yes + Master = Yes + Help = "Main switch to enable ICC support in Project in DXE Phase" +End + +MODULE + Help = "Includes IccPlatform.mak to Project" + File = "IccPlatform.mak" +End + +PATH + Name = "IccPlatform_DIR" + Help = "Icc platform dir" +End + +ELINK + Name = "/I$(IccPlatform_DIR)" + Parent = "ICC_INCLUDES" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\IccPlatform.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + +ELINK + Name = "PCIEClockConfig" + InvokeOrder = ReplaceParent + Help = "This Elink for Disable un-used PCIE port. Format is {Clock, PCIE_PORT_NUMBER, HotPlug)" +End + +ELINK + Name = "PCIClockConfig" + InvokeOrder = ReplaceParent + Help = "This Elink for Disable un-used PCI port. Format is {Clock, PCIE_PORT_NUMBER, HotPlug)" +End + +ELINK + Name = "OEMPCIEClockConfig" + InvokeOrder = ReplaceParent + Help = "This Elink for Disable un-used PCIE port. Format is {Clock, PCIE_PORT_NUMBER, HotPlug)" +End + +ELINK + Name = "OEMPCIClockConfig" + InvokeOrder = ReplaceParent + Help = "This Elink for Disable un-used PCI port. Format is {Clock, PCIE_PORT_NUMBER, HotPlug)" +End + +ELINK + Name = "OEMClockUpdateFunc" + InvokeOrder = ReplaceParent + Help = "This Elink for Disable un-used PCI port. Format is {Clock, PCIE_PORT_NUMBER, HotPlug)" +End + +ELINK + Name = "OemClock_LIB" + InvokeOrder = ReplaceParent +End diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccCallbacks.c b/Board/EM/MeWrapper/Icc/IccSetup/IccCallbacks.c new file mode 100644 index 0000000..8dcd104 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccCallbacks.c @@ -0,0 +1,1272 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccCallbacks.c 11 5/14/14 9:57p Tristinchou $ +// +// $Revision: 11 $ +// +// $Date: 5/14/14 9:57p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccCallbacks.c $ +// +// 11 5/14/14 9:57p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 10 8/09/13 2:17a Klzhan +// [TAG] EIP131037 +// [Category] Improvement +// [Description] Skip Using Icc Protocol after End of Post. +// +// 9 5/13/13 2:42a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] FIx build error when Icc_OverClocking_Support is +// disabled. +// +// 8 12/27/12 6:36a Klzhan +// [TAG] EIP104882 +// [Category] Improvement +// [Description] Avoid running ICC callbacks when Load Default. +// +// 7 10/30/12 8:37a Klzhan +// Support DMI Ratio for new ICC. +// +// 6 9/19/12 5:58a Klzhan +// Avoid time-out in ICC setup Page when return from Shell. +// +// 5 7/02/12 11:43p Klzhan +// [TAG] EIP94113 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC0.6 +// +// 4 5/14/12 5:29a Klzhan +// Remove Debug code +// +// 3 5/14/12 4:47a Klzhan +// [TAG] EIP89676 +// [Category] Spec Update +// [Severity] Important +// [Description] Support New ICC library +// [Files] IccSetup.mak +// IccSetup.sdl +// IccCallbacks.c +// IccCallbacks.h +// IccSetup.h +// IccSetupMenu.sd +// IccSetupSubmenu.sd +// IccStrings.uni +// IccLoadDefault.c +// IccSetup.cif +// +// 2 4/24/12 12:30a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 6 9/06/11 6:11a Klzhan +// [TAG] EIP67462 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ICC 08.00.00.022.1 +// [Files] IccSetup.mak +// IccSetup.sdl +// IccCallbacks.c +// IccCallbacks.h +// IccSetup.h +// IccSetupMenu.sd +// IccSetupSubmenu.sd +// IccStrings.uni +// IccLoadDefault.c +// IccSetup.cif +// +// 5 7/26/11 5:58a Klzhan +// Support EFI 2.3 +// +// 4 6/27/11 3:22a Klzhan +// Correct SscMode when Set frequency. +// +// 3 6/24/11 7:20a Klzhan +// Remove un-use debug message. +// +// 2 6/23/11 11:31p Klzhan +// [TAG] EIP62129 +// [Category] Spec Update +// [Severity] Important +// [Description] Support ICC Control Library 8.0.0.19. +// [Files] IccCallbacks.c, IccCallbacks.h +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccCallbacks.c +// +// Description: Setup hooks for ICC. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccCallbacks.c + +Abstract: + + Setup hooks for ICC. + +--*/ + +#include <AmiDxeLib.h> +#include <Setup.h> +#include <SetupStrTokens.h> +#include "AUTOID.h" +#include "Protocol\AMIPostMgr.h" +#include "Protocol\IccOverClocking\IccOverClocking.h" +#include "IccSetup.h" +#include "IccCallbacks.h" +#include "PchAccess.h" +#ifdef CougarPoint_SUPPORT +#include "Protocol\Wdt\Wdt.h" +#include "Protocol\WdtApp\WdtApp.h" +#endif +#include "Protocol\MePlatformPolicy\MePlatformPolicy.h" + +UINT8 mActiveSubmenu = ICC_CLOCK_COUNT; +ICC_OVERCLOCKING_PROTOCOL* gIccOverClockingProtocol; +ICC_CLOCK_RANGES mRanges[ICC_CLOCK_COUNT]; +CLOCK_DISPLAY_VALUES values; // Store clock Infomations of current page. +UINT16 mBootTimeClkDiv[ICC_CLOCK_COUNT]; +UINT8 mWatchdogEnabled; + +CHAR16* mClockUsageName[] = { + L"BCLK", + L"DMI", + L"PEG", + L"PCIe", + L"PCI33", + L"RESERVED", + L"SATA", + L"USB3", + L"IGD", + L"IGD Bending", + L"RESERVED", + L"GFX", + L"USB Legacy", + L"PCH Legacy" +}; + +CHAR16* mClockName[] = { + L"Clock1", + L"Clock2", + L"Clock3", + L"Clock4", + L"Clock5", + L"Clock6", + L"Clock7", + L"Clock8" +}; + +CHAR16* mClockUsageNone = L"Not used"; + +UINT16* mModeName[] = { + L"Down", + L"Center", + L"Up", + L"None" +}; + +EFI_HII_HANDLE gHiiHandle; +// +// Blocks entry to ICC clock submenus after End Of Post event +// +UINT8 mAfterEndOfPost = 0; + +#define NAME_ARRAY_SIZE (( sizeof(mClockUsageName)/sizeof(mClockUsageName[0]) )) + +#if (SUPPORTED_CLOCKS != ICC_CLOCK_COUNT) +#error Ambiguous number of supported clocks +#endif + +#ifndef StrCat +#define StrCat(a,b) Wcscpy (a + Wcslen (a), b) +#endif + +#define AMI_CALLBACK_CONTROL_UPDATE 1 +#define AMI_CALLBACK_RETRIEVE 2 +#define AMI_CALLBACK_FORM_OPEN 3 +#define AMI_CALLBACK_FORM_CLOSE 4 +#define AMI_CALLBACK_FORM_DEFAULT_STANDARD 0x1000 +#define AMI_CALLBACK_FORM_DEFAULT_MANUFACTURING 0x1001 + +EFI_STATUS +OnReadyToBoot ( +IN EFI_EVENT Event, +IN VOID *Context +) +/*++ +Routine Description: + + This function is executed on ReadyToBoot event. + If permanent or temporary ICC modifications were made, platform needs to be restarted. + Unlike ordinary setup options, ICC modifications can't be programmed to cause automatic reset. + Instead this function, executed on ReadyToBoot event, causes reset. + +Arguments: + Event pointer to event that caused this function to be executed + Context not used here + +Returns: + always SUCCESS +--*/ +{ + mAfterEndOfPost = 1; + pBS->CloseEvent(Event); + if (GetIccPersistentData() == ICC_SETTINGS_RECENTLY_MODIFIED) { + pRS->ResetSystem(EfiResetCold, 0, 0, 0); + } else if (GetIccPersistentData() == ICC_SETTINGS_PREVIOUSLY_MODIFIED) { + SetIccPersistentData(ICC_SETTINGS_NOT_MODIFIED); + } + return EFI_SUCCESS; +} + +VOID +InitICCStrings ( + EFI_HII_HANDLE HiiHandle, + UINT16 Class + ) +/*++ +Routine Description: + + This function is executed when Setup module loads. + Registers OnReadyToBoot function to be executed on ReadyToBoot event. + Remembers HiiHandle, pointer to setup browser's runtime variable store + +Arguments: + HiiHandle + Class + +Returns: + always SUCCESS +--*/ +{ + static UINT8 mInitStringComplete = 0; + EFI_EVENT Event; + EFI_GUID EfiEventReadyToBootGuid = EFI_EVENT_GROUP_READY_TO_BOOT; + + if (mInitStringComplete == 1) { + return; + } else { + if(Class == ADVANCED_FORM_SET_CLASS) { + mInitStringComplete = 1; + gHiiHandle = HiiHandle; + + if (GetIccPersistentData() == ICC_SETTINGS_RECENTLY_MODIFIED) { + SetIccPersistentData(ICC_SETTINGS_PREVIOUSLY_MODIFIED); + } + +#if (EFI_SPECIFICATION_VERSION < 0x00020000) + pBS->CreateEvent ( + EFI_EVENT_SIGNAL_READY_TO_BOOT | EFI_EVENT_NOTIFY_SIGNAL_ALL, + TPL_CALLBACK, + OnReadyToBoot, + NULL, + &Event + ); +#else + pBS->CreateEventEx ( + EFI_EVENT_NOTIFY_SIGNAL, + TPL_CALLBACK, + OnReadyToBoot, + NULL, + &EfiEventReadyToBootGuid, + &Event + ); +#endif + + } + } +} + +EFI_STATUS +InitIccMenu ( + IN ICC_VOLATILE_SETUP_DATA* IccSetupData + ) +/*++ +Routine Description: + Initializes text strings and setup variables connected with ICC menu. + If there is an error during initialization, displays messagebox with error details +Arguments: + Pointer to Icc setup data structure +Returns: + EFI_SUCCESS if everything went OK + otherwise, an ERROR +--*/ +{ + UINTN VariableSize; + UINT8 i; + EFI_STATUS Status; +#if IccOverClocking_SUPPORT + ICC_LIB_STATUS IccStatus; +#endif + ICC_LIB_VERSION Version; + SETUP_DATA SetupData; + EFI_GUID IccOverClockingProtocolGuid = ICC_OVERCLOCKING_PROTOCOL_GUID; + EFI_GUID IccSetupDataGuid = ICC_VOLATILE_SETUP_DATA_GUID; + EFI_GUID SetupGuid = SETUP_GUID; + CALLBACK_PARAMETERS *CallbackParameter = GetCallbackParameters(); + +#if EFI_SPECIFICATION_VERSION >= 0x2001E + if ((CallbackParameter->Action == AMI_CALLBACK_RETRIEVE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_OPEN) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_CLOSE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_DEFAULT_STANDARD) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_DEFAULT_MANUFACTURING)) + return EFI_SUCCESS; +#endif + + VariableSize = sizeof (SETUP_DATA); + + Status = pRS->GetVariable ( + L"Setup", + &SetupGuid, + NULL, + &VariableSize, + &SetupData + ); + if (EFI_ERROR (Status)) { + return Status; + } + + VariableSize = sizeof(UINT8); + Status = pRS->GetVariable ( + L"AfterReadyToBoot", + &IccSetupDataGuid, + NULL, + &VariableSize, + &mAfterEndOfPost); +#if IccOverClocking_SUPPORT + Status = pBS->LocateProtocol(&IccOverClockingProtocolGuid, NULL, &gIccOverClockingProtocol); + if (EFI_ERROR (Status)) { + return Status; + } + VariableSize = sizeof (UINTN); + mWatchdogEnabled = SetupData.IccWdtEnabled; + + IccStatus = IccInitOverclocking(&Version); + + if ( IccStatus != ICC_LIB_STATUS_SUCCESS ) { + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_INIT_ERROR_STRANGE), IccStatus); + IccSetupData->AllowAdvancedOptions = 0; + return EFI_DEVICE_ERROR; + } +#else + return EFI_SUCCESS; +#endif + // If init success, Set allowadvancedOption true +// IccSetupData->AllowAdvancedOptions = 1; + + InitString( + gHiiHandle, + STRING_TOKEN(STR_ICC_LIB_VERSION_NR), + L"%d.%d.%d.%d", + Version.Major, + Version.Minor, + Version.Hotfix, + Version.Build + ); + if(mAfterEndOfPost != 1) + { + IccSetupData->AllowAdvancedOptions = 1; + for (i=0; i<ICC_CLOCK_COUNT; i++) { + IccGetFrequencies(i, &values); + IccSetupData->Frequency[i] = values.ClkFreqCurrent; + IccSetupData->SscPercent[i] = values.SscPercentCurrent; + IccSetupData->SscMode[i] = values.SscModeCurrent; + // Workaround for architecture bugs: read - don't modify - write sequence doesn't work for some clocks + // These clocks must not be allowed to be modified - they'll cause ICC Lib to return misleading errors + if (/* (values.ClockUsage & (1<<ICC_CLOCK_USAGE_GFX)) || + (values.ClockUsage & (1<<ICC_CLOCK_USAGE_GFX_BENDING)) ||*/ + (values.ClockUsage == 0) + ) { + IccSetupData->ShowSsc[i] = 0; + IccSetupData->ShowClock[i] = 0; + } else { + IccSetupData->ShowSsc[i] = values.SscChangeAllowed; + if (values.ClkFreqMax == values.ClkFreqMin) { + IccSetupData->ShowClock[i] = 0; + } else { + IccSetupData->ShowClock[i] = 1; + } + } + } + }else + IccSetupData->AllowAdvancedOptions = 0; + + return EFI_SUCCESS; +} + +EFI_STATUS +EFIAPI +IccMenuEntry ( + IN EFI_HII_HANDLE HiiHandle, + IN UINT16 Class, + IN UINT16 SubClass, + IN UINT16 Key +) +/*++ +Routine Description: + Setup callback executed when user enters Advanced->ICC menu + Think of it as an entry point to efi overclocking module + Initializes ICC OverClocking and if there are errors, disables entry into submenus + Without access to submenus, it is guaranteed no other callback will be executed. +Arguments: +Returns: + always SUCCESS, but in case of errors entry into submenus is disabled +--*/ +{ + static UINT8 FirstEntry = 1; + static UINT8 EopReported = 0; + ICC_VOLATILE_SETUP_DATA* IccSetupData = NULL; + EFI_STATUS Status; + EFI_GUID IccSetupDataGuid = ICC_VOLATILE_SETUP_DATA_GUID; + UINTN SelectionBufferSize = sizeof(ICC_VOLATILE_SETUP_DATA); + CALLBACK_PARAMETERS *CallbackParameter = GetCallbackParameters(); + EFI_GUID DxePlatformMePolicyGuid = DXE_PLATFORM_ME_POLICY_GUID; + DXE_ME_POLICY_PROTOCOL *DxePlatformMePolicy; + +#if EFI_SPECIFICATION_VERSION >= 0x2001E + if ((CallbackParameter->Action == AMI_CALLBACK_RETRIEVE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_OPEN) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_CLOSE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_DEFAULT_STANDARD) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_DEFAULT_MANUFACTURING)) + return EFI_SUCCESS; +#endif + + if(mAfterEndOfPost == 0) { + Status = pBS->LocateProtocol(&DxePlatformMePolicyGuid, NULL, &DxePlatformMePolicy); + if(!EFI_ERROR (Status)) { + if(DxePlatformMePolicy->MeConfig.EndOfPostDone) { + mAfterEndOfPost = 1; + } + } + } + // + // No changes to ICC menu display + // + if (EopReported == 1 || (FirstEntry ==0 && mAfterEndOfPost == 0)) { + return EFI_SUCCESS; + } + + FirstEntry = 0; + +#if EFI_SPECIFICATION_VERSION>0x20000 + Status = pBS->AllocatePool(EfiBootServicesData, SelectionBufferSize, &IccSetupData); + if(EFI_ERROR(Status)) { + return Status; + } + + Status = HiiLibGetBrowserData(&SelectionBufferSize, + IccSetupData, + &IccSetupDataGuid, + ICC_VOLATILE_SETUP_DATA_C_NAME + ); + ASSERT_EFI_ERROR(Status); + +#else + IccSetupData = (ICC_VOLATILE_SETUP_DATA*)CallbackParameter->Data->NvRamMap; +#endif + + if (mAfterEndOfPost == 1 && EopReported == 0) { + IccSetupData->AllowAdvancedOptions = 0; + EopReported = 1; + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_AFTER_EOP)); + } else { + Status = InitIccMenu(IccSetupData); + if (EFI_ERROR(Status)) { +// IccSetupData->AllowAdvancedOptions = 0; + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_INIT_ERROR_STRANGE)); + } else { +// IccSetupData->AllowAdvancedOptions = 1; + } + } + + Status = pRS->SetVariable( + ICC_VOLATILE_SETUP_DATA_C_NAME, + &IccSetupDataGuid, + EFI_VARIABLE_BOOTSERVICE_ACCESS | + EFI_VARIABLE_NON_VOLATILE, + sizeof(ICC_VOLATILE_SETUP_DATA), + IccSetupData ); + +#if EFI_SPECIFICATION_VERSION>0x20000 + Status = HiiLibSetBrowserData( + SelectionBufferSize, IccSetupData, + &IccSetupDataGuid, ICC_VOLATILE_SETUP_DATA_C_NAME + ); + ASSERT_EFI_ERROR(Status); + pBS->FreePool(IccSetupData); + +#endif; + + return EFI_SUCCESS; +} + + + +EFI_STATUS +EFIAPI +IccSubmenuEntry ( + IN EFI_HII_HANDLE HiiHandle, + IN UINT16 Class, + IN UINT16 SubClass, + IN UINT16 Key +) + +/*++ +Routine Description: + Setup callback executed when user enters any submenu of Advanced->ICC + Personalizes common strings for that particular clock submenu + Stores information on which submenu we're in, that's needed for other callbacks +Arguments: +Returns: + always SUCCESS +--*/ +{ + UINT8 SubMenuNumber = ICC_CLOCK_COUNT; + CHAR16 StringBuffer[100]; + UINT8 i; + UINT8 NeedComma; + UINT8 LineOverflow; + CALLBACK_PARAMETERS *CallbackParameter = GetCallbackParameters(); + +#if EFI_SPECIFICATION_VERSION >= 0x2001E + if ((CallbackParameter->Action == AMI_CALLBACK_RETRIEVE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_OPEN) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_CLOSE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_DEFAULT_STANDARD) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_DEFAULT_MANUFACTURING)) + return EFI_SUCCESS; +#endif + + switch (Key) { + case KEY_FORM1: + SubMenuNumber = 0; + break; + case KEY_FORM2: + SubMenuNumber = 1; + break; + case KEY_FORM3: + SubMenuNumber = 2; + break; + case KEY_FORM4: + SubMenuNumber = 3; + break; + case KEY_FORM5: + SubMenuNumber = 4; + break; + case KEY_FORM6: + SubMenuNumber = 5; + break; + case KEY_FORM7: + SubMenuNumber = 6; + break; + case KEY_FORM8: + SubMenuNumber = 7; + break; + default: + ASSERT(FALSE); + } + + if (SubMenuNumber == mActiveSubmenu) { + // + //strings already personalized for this menu, no need to change them + // + return EFI_SUCCESS; + } + + mActiveSubmenu = SubMenuNumber; + + IccGetFrequencies(mActiveSubmenu, &values); + StringBuffer[0] = 0; + NeedComma = 0; + LineOverflow = 0; + + // + // Concatenate all clock usages into two strings. If first string gets too long, second will be written + // + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_CLOCK_USAGE_2), L"%s", StringBuffer); + if (values.ClockUsage != 0) { + for (i=0; i<NAME_ARRAY_SIZE; i++) { + if (values.ClockUsage & (1<<i)) { + if (NeedComma == 1) { + StrCat(StringBuffer, L", "); + } + if ( Wcslen(StringBuffer) + Wcslen(mClockUsageName[i]) > 25 ) { + LineOverflow = 1; + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_CLOCK_USAGE_1), L"%s", StringBuffer); + StringBuffer[0] = 0; + NeedComma = 0; + } + StrCat(StringBuffer, mClockUsageName[i]); + NeedComma = 1; + } + } + } else { + StrCat(StringBuffer, mClockUsageNone); + } + if (LineOverflow) { + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_CLOCK_USAGE_2), L"%s", StringBuffer); + } else { + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_CLOCK_USAGE_1), L"%s", StringBuffer); + } + + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_CLOCK_NUMBER), L"%s", mClockName[SubMenuNumber]); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_MAX_FREQUENCY_VALUE), L"%d.%02d MHz", values.ClkFreqMax/100, values.ClkFreqMax%100); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_MIN_FREQUENCY_VALUE), L"%d.%02d MHz", values.ClkFreqMin/100, values.ClkFreqMin%100); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_CURRENT_FREQUENCY_VALUE), L"%d.%02d MHz", values.ClkFreqCurrent/100, values.ClkFreqCurrent%100); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_SSC_MODES_VALUE), L"%s%s%s", + (values.SscModeDownAvailable) ? L"Down " : L" ", + (values.SscModeCenterAvailable)? L"Center " : L" ", + (values.SscModeUpAvailable) ? L"Up " : L" " + ); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_SSC_CURRENT_MODE_VALUE), L"%s", mModeName[values.SscModeCurrent]); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_SSC_MAX_VALUE), L"%d.%02d%%", values.SscPercentMax/100, values.SscPercentMax%100); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_SSC_CURRENT_VALUE), L"%d.%02d%%", values.SscPercentCurrent/100, values.SscPercentCurrent%100); + + return EFI_SUCCESS; +} + +EFI_STATUS +EFIAPI +IccAccept ( + IN EFI_HII_HANDLE HiiHandle, + IN UINT16 Class, + IN UINT16 SubClass, + IN UINT16 Key +) +/*++ +Routine Description: + Setup callback executed when user chooses 'Accept' + Sends requested clock parameters to ICC OverClocking +Arguments: + interface to ITEM_CALLBACK_EX +Returns: + always SUCCESS +--*/ +{ + EFI_STATUS Status; + ICC_VOLATILE_SETUP_DATA* IccSetupData = NULL; + CLOCK_DISPLAY_VALUES values; + UINT8 TypeOfChange; + UINTN VarSize = 0; +#if EFI_SPECIFICATION_VERSION>0x20000 + UINTN SelectionBufferSize = sizeof(ICC_VOLATILE_SETUP_DATA); + EFI_GUID IccSetupDataGuid = ICC_VOLATILE_SETUP_DATA_GUID; +#endif + CALLBACK_PARAMETERS *CallbackParameter = GetCallbackParameters(); + +#if EFI_SPECIFICATION_VERSION >= 0x2001E + if ((CallbackParameter->Action == AMI_CALLBACK_RETRIEVE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_OPEN) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_CLOSE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_DEFAULT_STANDARD) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_DEFAULT_MANUFACTURING)) + return EFI_SUCCESS; +#endif + + switch (Key) { + case KEY_CHANGE_NOW1: + case KEY_CHANGE_NOW2: + case KEY_CHANGE_NOW3: + case KEY_CHANGE_NOW4: + case KEY_CHANGE_NOW5: + case KEY_CHANGE_NOW6: + TypeOfChange = IMMEDIATE; + break; + case KEY_CHANGE_ONCE1: + case KEY_CHANGE_ONCE2: + case KEY_CHANGE_ONCE3: + case KEY_CHANGE_ONCE4: + case KEY_CHANGE_ONCE5: + case KEY_CHANGE_ONCE6: + TypeOfChange = TEMPORARY; + break; + case KEY_CHANGE_PERM1: + case KEY_CHANGE_PERM2: + case KEY_CHANGE_PERM3: + case KEY_CHANGE_PERM4: + case KEY_CHANGE_PERM5: + case KEY_CHANGE_PERM6: + TypeOfChange = PERMANENT; + break; + default: + ASSERT(FALSE); + TypeOfChange = 0; //prevent compilator warning + } + +#if EFI_SPECIFICATION_VERSION>0x20000 + Status = pBS->AllocatePool(EfiBootServicesData, SelectionBufferSize, &IccSetupData); + if(EFI_ERROR(Status)) + return Status; + + Status = HiiLibGetBrowserData( + &SelectionBufferSize, IccSetupData, + &IccSetupDataGuid, ICC_VOLATILE_SETUP_DATA_C_NAME + ); + ASSERT_EFI_ERROR(Status); +#else + IccSetupData = (ICC_VOLATILE_SETUP_DATA*)CallbackParameter->Data->NvRamMap; +#endif + Status = SendClockChangeRequest(IccSetupData, mActiveSubmenu, TypeOfChange); + IccGetFrequencies(mActiveSubmenu, &values); + + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_CURRENT_FREQUENCY_VALUE), L"%d.%02d MHz", values.ClkFreqCurrent/100, values.ClkFreqCurrent%100); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_SSC_CURRENT_MODE_VALUE), L"%s", mModeName[values.SscModeCurrent]); + InitString(gHiiHandle, STRING_TOKEN(STR_ICC_SSC_CURRENT_VALUE), L"%d.%02d%%", values.SscPercentCurrent/100, values.SscPercentCurrent%100); + +#if EFI_SPECIFICATION_VERSION>0x20000 + pBS->FreePool(IccSetupData); +#endif; + + return EFI_SUCCESS; +} + +EFI_STATUS +EFIAPI +IccFreqChange ( + IN EFI_HII_HANDLE HiiHandle, + IN UINT16 Class, + IN UINT16 SubClass, + IN UINT16 Key +) +/*++ +Routine Description: + Setup callback executed when user changes frequency + Calls IccFrequencyRounding() which fixes frequency and SSC parameters to allowed values + Having these parameters fixed decreases number of errors caused by sending wrong parameters +Arguments: +Returns: + always SUCCESS +--*/ +{ + EFI_STATUS Status; + ICC_VOLATILE_SETUP_DATA* IccSetupData = NULL; + ICC_CLOCK_FREQUENCY ExpectFrequency, UserFrequency; + BOOLEAN HigherFrequency = FALSE; + ICC_LIB_STATUS IccStatus; +#if EFI_SPECIFICATION_VERSION>0x20000 + UINTN SelectionBufferSize = sizeof(ICC_VOLATILE_SETUP_DATA); + EFI_GUID IccSetupDataGuid = ICC_VOLATILE_SETUP_DATA_GUID; +#endif + + CALLBACK_PARAMETERS *CallbackParameter = GetCallbackParameters(); + +#if EFI_SPECIFICATION_VERSION >= 0x2001E + if ((CallbackParameter->Action == AMI_CALLBACK_RETRIEVE) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_OPEN) || + (CallbackParameter->Action == AMI_CALLBACK_FORM_CLOSE)) + return EFI_SUCCESS; +#endif + +#if EFI_SPECIFICATION_VERSION>0x20000 + Status = pBS->AllocatePool(EfiBootServicesData, SelectionBufferSize, &IccSetupData); + if(EFI_ERROR(Status)) + return Status; + + Status = HiiLibGetBrowserData( + &SelectionBufferSize, IccSetupData, + &IccSetupDataGuid, ICC_VOLATILE_SETUP_DATA_C_NAME + ); + ASSERT_EFI_ERROR(Status); +#else + IccSetupData = (ICC_VOLATILE_SETUP_DATA*)CallbackParameter->Data->NvRamMap; +#endif + + UserFrequency = IccSetupData->Frequency[mActiveSubmenu]; + + if(UserFrequency >= values.ClkFreqMax) + { + IccSetupData->Frequency[mActiveSubmenu] = values.ClkFreqMax; +#if EFI_SPECIFICATION_VERSION>0x20000 + Status = HiiLibSetBrowserData( + SelectionBufferSize, IccSetupData, + &IccSetupDataGuid, ICC_VOLATILE_SETUP_DATA_C_NAME + ); + ASSERT_EFI_ERROR(Status); + + pBS->FreePool(IccSetupData); +#endif; + return EFI_SUCCESS; + } + + if(UserFrequency <= values.ClkFreqMin) + { + IccSetupData->Frequency[mActiveSubmenu] = values.ClkFreqMin; +#if EFI_SPECIFICATION_VERSION>0x20000 + Status = HiiLibSetBrowserData( + SelectionBufferSize, IccSetupData, + &IccSetupDataGuid, ICC_VOLATILE_SETUP_DATA_C_NAME + ); + ASSERT_EFI_ERROR(Status); + + pBS->FreePool(IccSetupData); +#endif; + return EFI_SUCCESS; + } + + if(UserFrequency > values.ClkFreqCurrent) + HigherFrequency = TRUE; + + { + UserFrequency = (UserFrequency) * 10000; + gIccOverClockingProtocol->GetNextFrequency(mActiveSubmenu, + UserFrequency, + &UserFrequency, + &IccStatus); + + gIccOverClockingProtocol->GetPreviousFrequency(mActiveSubmenu, + UserFrequency, + &ExpectFrequency, + &IccStatus); + } + + if (IccStatus == ICC_LIB_STATUS_SUCCESS) { + IccSetupData->Frequency[mActiveSubmenu] = ExpectFrequency/10000; + } + +#if EFI_SPECIFICATION_VERSION>0x20000 + Status = HiiLibSetBrowserData( + SelectionBufferSize, IccSetupData, + &IccSetupDataGuid, ICC_VOLATILE_SETUP_DATA_C_NAME + ); + ASSERT_EFI_ERROR(Status); + + pBS->FreePool(IccSetupData); +#endif; + + return EFI_SUCCESS; +} + +EFI_STATUS +SendClockChangeRequest ( + IN ICC_VOLATILE_SETUP_DATA* IccSetupData, + IN UINT8 ClockID, + IN UINT8 TypeOfChange + ) +/*++ +Routine Description: + Executed by setup calback function + Based on data entered by user, sends clock change requests to ICC OverClocking + Writing to susram or flash requires that old susram and flash contents be invalidated + In case of any problem, messagebox is displayed so user can know what corrective action is required +Arguments: + initial clock divider value +Returns: + validated clock divider value +--*/ +{ + + UINT8 answer = 1; + ICC_LIB_STATUS IccStatus; + ICC_CLOCK_SETTINGS RequestSetting; + BOOLEAN freqConsolidationBypass = TRUE, permanentChange; + + if(TypeOfChange == PERMANENT) + permanentChange = TRUE; + + if(TypeOfChange == TEMPORARY) + permanentChange = FALSE; + + // Prepare Setting + gIccOverClockingProtocol->GetCurrentClockSettings(ClockID, &RequestSetting, &IccStatus); + RequestSetting.Frequency = IccSetupData->Frequency[ClockID] * 10000; + RequestSetting.SscMode = SscNumberToSscMode(IccSetupData->SscMode[ClockID]); + RequestSetting.SscPercent = (UINT8)IccSetupData->SscPercent[ClockID]; + // Only ICC_DMI_PEG_RATIO_5_TO_5 is support in PPT. + RequestSetting.DmiPegRatio = (UINT8)IccSetupData->DmiPegRatio[ClockID]; + + if(TypeOfChange == IMMEDIATE) + { + gIccOverClockingProtocol->SetCurrentClockSettings(ClockID, + RequestSetting, + &IccStatus); + }else + { + gIccOverClockingProtocol->SetBootClockSettings(ClockID, + RequestSetting, + &IccStatus); + } + + if (IccStatus != ICC_LIB_STATUS_SUCCESS) { + if (TypeOfChange == TEMPORARY) { + MessageBox (MSGBOX_TYPE_OKCANCEL, &answer, STRING_TOKEN(STR_ICC_MSGBOX_ONCE_OVERWRITE)); + } else if (TypeOfChange == PERMANENT) { + MessageBox (MSGBOX_TYPE_OKCANCEL, &answer, STRING_TOKEN(STR_ICC_MSGBOX_PERM_OVERWRITE)); + } + if (answer != MSGBOX_YES) { + return ICC_LIB_STATUS_SUCCESS; + } + } + + switch (IccStatus) { + case ICC_LIB_STATUS_DYNAMIC_CHANGE_NOT_ALLOWED: + MessageBox (MSGBOX_TYPE_OKCANCEL, &answer, STRING_TOKEN(STR_ICC_MSGBOX_NO_DYNAMIC), mClockName[ClockID]); + break; + case ICC_LIB_STATUS_REGISTER_IS_LOCKED: + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_LOCKED)); + break; + case ICC_LIB_STATUS_FREQ_TOO_HIGH: + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_FREQ_HIGH), mClockName[ClockID] ); + break; + case ICC_LIB_STATUS_FREQ_TOO_LOW: + MessageBox (MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_FREQ_LOW), mClockName[ClockID] ); + break; + case ICC_LIB_STATUS_SSC_TOO_HIGH: + case ICC_LIB_STATUS_SSC_OUT_OF_RANGE: + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_SSC_HIGH), mClockName[ClockID] ); + break; + case ICC_LIB_STATUS_SSC_TOO_LOW: + MessageBox (MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_SSC_LOW), mClockName[ClockID] ); + break; + case ICC_LIB_STATUS_SSC_MODE_NOT_SUPPORTED: + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_SSC_MODE), mClockName[ClockID] ); + break; + case ICC_LIB_STATUS_FREQ_MUST_HAVE_ZERO_SSC: + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_SSC_DISABLED), mClockName[ClockID] ); + break; + case ICC_LIB_STATUS_SSC_CHANGE_NOT_ALLOWED: + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_SSC_CONSTANT), mClockName[ClockID] ); + break; + case ICC_LIB_STATUS_MEI_INITIALIZATION_FAILED: + case ICC_LIB_STATUS_MEI_CONNECTION_FAILED: + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_HECI)); + break; + case ICC_LIB_STATUS_SUCCESS: + if (TypeOfChange == IMMEDIATE) { + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_SUCCESS)); + } else { + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_SUCCESS_NEED_REBOOT)); + } + break; + default: + MessageBox ( MSGBOX_TYPE_OK, NULL, STRING_TOKEN(STR_ICC_MSGBOX_UNKNOWN), IccStatus ); + break; + } + + return IccStatus; +} + +EFI_STATUS +MessageBox ( + IN UINT8 type, + OPTIONAL OUT UINT8* answer, + IN UINT16 StringId, + ... + ) +/*++ +Routine Description: + Wrapper function that displays messagebox. Text for Messagebox is specified with printf-like parameters. + Arguments: + type - messagebox type + answer - pointer to where user's answer will be stored + format, ... - parameters to printf +Returns: +--*/ +{ + static AMI_POST_MANAGER_PROTOCOL* pAmiPostMgr = NULL; + EFI_GUID AmiPostManagerProtocolGuid = AMI_POST_MANAGER_PROTOCOL_GUID; + EFI_STATUS Status; + UINT8 LocalAnswer; + CHAR16* StrBuffer = 0; + CHAR16* LocalBuffer; + UINTN LocalBufferSize; + UINTN StrLen = 0; + va_list ArgList = va_start(ArgList,StringId); + + if (pAmiPostMgr == NULL) { + Status = pBS->LocateProtocol(&AmiPostManagerProtocolGuid, NULL, &pAmiPostMgr); + ASSERT (pAmiPostMgr); + ASSERT_EFI_ERROR (Status); + } + + HiiLibGetString(gHiiHandle, StringId, &StrLen, StrBuffer); + Status = pBS->AllocatePool(EfiBootServicesData, StrLen, &StrBuffer); + ASSERT_EFI_ERROR(Status); + HiiLibGetString(gHiiHandle, StringId, &StrLen, StrBuffer); + + LocalBufferSize = (StrLen+1)*2; + + while (1) { + Status = pBS->AllocatePool(EfiBootServicesData, LocalBufferSize, &LocalBuffer); + ASSERT_EFI_ERROR(Status); + if (LocalBufferSize <= Swprintf_s_va_list(LocalBuffer, LocalBufferSize, StrBuffer, ArgList) ) { + Status = pBS->FreePool(LocalBuffer); + ASSERT_EFI_ERROR(Status); + LocalBufferSize*=2; + } else { + break; + } + } + + va_end(ArgList); + + Status = pAmiPostMgr->DisplayMsgBox(L"Intel ICC", LocalBuffer, type, &LocalAnswer); + pBS->FreePool(StrBuffer); + pBS->FreePool(LocalBuffer); + + ASSERT_EFI_ERROR (Status); + if (answer != NULL) { + *answer = LocalAnswer; + } + return Status; +} + +ICC_LIB_STATUS +EFIAPI +IccInitOverclocking ( + ICC_LIB_VERSION* Version + ) +/*++ +Routine Description: + Initializes ICC OverClocking and asks about initial clock-related data. The data is: + clock parameters from CURRENT record (will be displayed as current and boot-time frequencies) + clock parameters from FLASH record (needed in case we try to write flash record later) + clock ranges - max/min supported frequencies +Arguments: + +Returns: + EFI_SUCCESS - if there were no errors, updates global variables + EFI_DEVICE_ERROR - if there were errors when interfacing ICC OverClocking + +--*/ +{ + UINT8 i; + ICC_LIB_STATUS IccStatus; + + gIccOverClockingProtocol->GetInfo(Version, &i, &IccStatus); + + if (IccStatus != ICC_LIB_STATUS_SUCCESS) { + TRACE ((TRACE_ALWAYS, "(ICC) IccOverClocking failed to start. IccStatus=0x%x, version = %d.%d.%d.%d\n", IccStatus, Version->Major, Version->Minor, Version->Hotfix, Version->Build)); + return IccStatus; + } + + return 0; +} + +VOID +IccGetFrequencies ( + IN UINT8 ClockNumber, + OUT CLOCK_DISPLAY_VALUES* Values + ) +/*++ +Routine Description: + Called by Setup module, feeds it with clock data required to display all clock related information on bios setup screen + Converts data from clock divider value to clock frequency +Arguments: + ClockNumber - data for which clock should be returned +Returns: + values - clock-related data required to display values on ICC setup screen +--*/ +{ + ICC_LIB_STATUS IccStatus; + ICC_CLOCK_RANGES ClockRange; + ICC_CLOCK_SETTINGS Clocksetting; + + gIccOverClockingProtocol->GetClockRanges(ClockNumber, &ClockRange, &IccStatus); + Values->ClockUsage = (UINT16)ClockRange.UsageMask; + Values->ClkFreqMax = ClockRange.FrequencyMax/10000; + Values->ClkFreqMin = ClockRange.FrequencyMin/10000; + Values->SscChangeAllowed = (UINT8)ClockRange.SscChangeAllowed; + Values->SscModeCenterAvailable = (UINT8)ClockRange.SscCenterAllowed; + Values->SscModeUpAvailable = (UINT8)ClockRange.SscUpAllowed; + Values->SscModeDownAvailable = (UINT8)ClockRange.SscDownAllowed; + Values->SscPercentMax = (UINT16)ClockRange.SscPercentMax; + + gIccOverClockingProtocol->GetCurrentClockSettings(ClockNumber, &Clocksetting, &IccStatus); + Values->ClkFreqCurrent = Clocksetting.Frequency/10000; + Values->SscPercentCurrent = (UINT16)Clocksetting.SscPercent; + Values->SscModeCurrent = SscModeToSscNumber(Clocksetting.SscMode); + +} + +UINT32 +SscNumberToSscMode ( + IN UINT8 SscModeNumber + ) +/*++ +Routine Description: + Converts SSC mode description. ICC OverClocking uses 3 bit one-hot format. + For displaying things in BIOS setup, numeric value is more convenient + This function should be called 3 times, once for each bit in ICC OverClocking format. +Arguments: + SscModeNumber - mode number from BIOS setup + Mode - particular mode we're checking for +Returns: + 0 - SSC number does not represent Mode + 1 - SSC number represents Mode +--*/ +{ + switch(SscModeNumber) + { + case SSC_MODE_NONE: + return ICC_SSC_NONE; + + case SSC_MODE_UP: + return ICC_SSC_UP; + + case SSC_MODE_CENTER: + return ICC_SSC_CENTER; + + case SSC_MODE_DOWN: + return ICC_SSC_DOWN; + + default: + TRACE ((TRACE_ALWAYS, "(ICC) Invalid SscModeNumber value \n")); + EFI_DEADLOOP(); + return 0; + } +}; + +UINT8 +SscModeToSscNumber ( + IN UINT8 SscMode + ) +/*++ +Routine Description: + Converts SSC mode description. ICC OverClocking uses 3 bit one-hot format. BIOS setup requires 8bit numeric value. +Arguments: + three bits from ICC OverClocking format +Returns: + SSC mode in BIOS setup format +--*/ +{ + switch(SscMode) + { + case ICC_SSC_NONE: + return SSC_MODE_NONE; + + case ICC_SSC_UP: + return SSC_MODE_UP; + + case ICC_SSC_CENTER: + return SSC_MODE_CENTER; + + case ICC_SSC_DOWN: + return SSC_MODE_DOWN; + + default: + TRACE ((TRACE_ALWAYS, "(ICC) Invalid SscMode value \n")); + EFI_DEADLOOP(); + return 0; + } +} + +VOID +SetIccPersistentData ( + IN UINT8 FlowPhase +) +/*++ +Routine Description: + Sets ClocksModified field of IccPersistentData EFI variable +Arguments: + new value of IccPersistentData +Returns: + none +--*/ +{ + + EFI_GUID IccPersistentDataGuid = ICC_PERSISTENT_DATA_GUID; + ICC_PERSISTENT_DATA IccPersistentData; + + IccPersistentData.ClocksModified = FlowPhase; + + pRS->SetVariable( + L"IccPersistentData", + &IccPersistentDataGuid, + EFI_VARIABLE_NON_VOLATILE | EFI_VARIABLE_BOOTSERVICE_ACCESS, + sizeof(IccPersistentData), + &IccPersistentData ); +} + +UINT8 +GetIccPersistentData ( + VOID +) +/*++ +Routine Description: + Reads IccPersistentData EFI variable +Arguments: + none +Returns: + value of ClocksModified field +--*/ +{ + EFI_GUID IccPersistentDataGuid = ICC_PERSISTENT_DATA_GUID; + ICC_PERSISTENT_DATA IccPersistentData; + UINTN VariableSize; + EFI_STATUS Status; + VariableSize = sizeof(IccPersistentData); + + Status = pRS->GetVariable( + L"IccPersistentData", + &IccPersistentDataGuid, + NULL, + &VariableSize, + &IccPersistentData ); + if(EFI_ERROR(Status)) + return ICC_SETTINGS_NOT_MODIFIED; + else + return IccPersistentData.ClocksModified; +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccCallbacks.h b/Board/EM/MeWrapper/Icc/IccSetup/IccCallbacks.h new file mode 100644 index 0000000..24bae4c --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccCallbacks.h @@ -0,0 +1,167 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccCallbacks.h 3 10/30/12 8:37a Klzhan $ +// +// $Revision: 3 $ +// +// $Date: 10/30/12 8:37a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccCallbacks.h $ +// +// 3 10/30/12 8:37a Klzhan +// Support DMI Ratio for new ICC. +// +// 2 5/14/12 4:47a Klzhan +// [TAG] EIP89676 +// [Category] Spec Update +// [Severity] Important +// [Description] Support New ICC library +// [Files] IccSetup.mak +// IccSetup.sdl +// IccCallbacks.c +// IccCallbacks.h +// IccSetup.h +// IccSetupMenu.sd +// IccSetupSubmenu.sd +// IccStrings.uni +// IccLoadDefault.c +// IccSetup.cif +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 3 6/27/11 10:46p Klzhan +// Update SscNumberToSscMode() for New Icc Control Library. +// +// 2 6/23/11 11:31p Klzhan +// [TAG] EIP62129 +// [Category] Spec Update +// [Severity] Important +// [Description] Support ICC Control Library 8.0.0.19. +// [Files] IccCallbacks.c, IccCallbacks.h +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccCallbacks.h +// +// Description: Setup hooks for ICC. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccCallbacks.h + +Abstract: + + Setup hooks for ICC + +--*/ + +#define MAX(a, b) ((a) > (b) ? (a) : (b)) +#define MIN(a, b) ((a) > (b) ? (b) : (a)) + +#define ICC_CLOCK_COUNT 8 + +typedef struct _CLOCK_DISPLAY_VALUES { + UINT32 ClkFreqMax; + UINT32 ClkFreqMin; + UINT32 ClkFreqCurrent; + UINT16 SscPercentMax; + UINT16 SscPercentCurrent; + UINT16 ClockUsage; + UINT8 SscChangeAllowed; + UINT8 SscModeUpAvailable; + UINT8 SscModeCenterAvailable; + UINT8 SscModeDownAvailable; + UINT8 SscModeCurrent; + UINT8 DmiPegRatio; +} CLOCK_DISPLAY_VALUES; + +typedef struct _ICC_CLK_REQUEST { + UINT16 Frequency; + UINT16 SscPercent; + UINT8 SscAllowed; + UINT8 SscMode; + UINT8 EveryBoot; +} ICC_CLK_REQUEST; + +#define IMMEDIATE 0 +#define TEMPORARY 1 +#define PERMANENT 2 + +#define SSC_MODE_NONE 3 +#define SSC_MODE_UP 2 +#define SSC_MODE_CENTER 1 +#define SSC_MODE_DOWN 0 + +#define ROUND_UP 1 +#define ROUND_DOWN 0 + +EFI_STATUS SendClockChangeRequest (IN ICC_VOLATILE_SETUP_DATA* IccSetupData, IN UINT8 ClkMask, IN UINT8 TypeOfChange); +EFI_STATUS MessageBox (IN UINT8 type, OUT UINT8* answer, IN UINT16 StringId, ...); +UINT16 FrequencyToDivider (IN UINT16 Frequency); +UINT16 DividerToFrequency (IN UINT16 Divider); +UINT16 FixDividerValue (IN UINT16 Divider, IN UINT8 Direction); +UINT32 SscNumberToSscMode (IN UINT8 SscModeNumber); +UINT8 SscModeToSscNumber (IN UINT8 SscMode); +ICC_LIB_STATUS IccInitOverclocking (ICC_LIB_VERSION*); +ICC_LIB_STATUS IccInvalidateRecord (IN UINT8 RecordType); +VOID IccGetFrequencies (IN UINT8 ClockNumber, OUT CLOCK_DISPLAY_VALUES* values); +EFI_STATUS IccRoundFrequency (IN OUT ICC_CLK_REQUEST* IccSetupData, IN UINT8 ClockNumber); +ICC_LIB_STATUS IccSendRequestRecord (IN UINT8 TypeOfChange, IN UINT32 ClockMask, IN ICC_CLK_REQUEST* IccExchange, OUT UINT8* ErrorLocation); +UINTN Wcslen(CHAR16 *string); +CHAR16* Wcscpy(CHAR16 *string1, CHAR16* string2); +VOID StrCat (IN OUT CHAR16 *Destination, IN CHAR16 *Source); +VOID SetIccPersistentData (IN UINT8 FlowPhase); +UINT8 GetIccPersistentData (VOID); + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccLoadDefault.c b/Board/EM/MeWrapper/Icc/IccSetup/IccLoadDefault.c new file mode 100644 index 0000000..94c558f --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccLoadDefault.c @@ -0,0 +1,141 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccLoadDefault.c 3 2/22/13 2:27a Klzhan $ +// +// $Revision: 3 $ +// +// $Date: 2/22/13 2:27a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccLoadDefault.c $ +// +// 3 2/22/13 2:27a Klzhan +// [TAG] EIP115268 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] Icc Setup Item be hidden after load default(F3) +// [RootCause] New TSE check gGrowserCallbackEnabled +// [Solution] Enable gGrowserCallbackEnabled when call HiiSetBrowserData +// +// 2 4/24/12 12:31a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 1 5/04/11 3:08a Klzhan +// EIP58767 : ICC Setup item will not be hidden when load default. +// +// 1 11/01/10 9:42a Tonywu +// Fix that the "ICC OverClocking" form will be hidden when setup loads +// defaults. +// +//********************************************************************** +//<AMI_FHDR_START> +// +// Name: IccLoadDefault.c +// +// Description: Enter when loaded default in SETUP. +// +//<AMI_FHDR_END> +//********************************************************************** + +#include <Setup.h> +#include <AmiLib.h> +#include <AmiDxeLib.h> +#include "IccSetup.h" + +EFI_STATUS FindVariableIndex(CHAR16 *Name, EFI_GUID *Guid, UINT32 *Index); + +extern BOOLEAN gBrowserCallbackEnabled; + +VOID IccSetupLoadDefault(VOID) +{ + UINT8 i; + EFI_STATUS Status; + + UINTN SelectionBufferSize = sizeof(ICC_VOLATILE_SETUP_DATA); + EFI_GUID IccSetupDataGuid = ICC_VOLATILE_SETUP_DATA_GUID; + ICC_VOLATILE_SETUP_DATA* IccSetupData = NULL; + ICC_VOLATILE_SETUP_DATA* TseIccSetupData = NULL; + BOOLEAN OrgBrowserCallbackEnabled = gBrowserCallbackEnabled; + + Status = pBS->AllocatePool(EfiBootServicesData, SelectionBufferSize, &IccSetupData); + if (!EFI_ERROR(Status)) + { + Status = pRS->GetVariable ( + ICC_VOLATILE_SETUP_DATA_C_NAME, + &IccSetupDataGuid, + NULL, + &SelectionBufferSize, + IccSetupData); + ASSERT_EFI_ERROR(Status); + if (!EFI_ERROR(Status)) + { + if (IccSetupData->AllowAdvancedOptions == 1) + { + Status = pBS->AllocatePool(EfiBootServicesData, SelectionBufferSize, &TseIccSetupData); + if(EFI_ERROR(Status)) { + return; + } + gBrowserCallbackEnabled = TRUE; + Status = HiiLibGetBrowserData(&SelectionBufferSize, + TseIccSetupData, + &IccSetupDataGuid, + L"IccAdvancedSetupDataVar" + ); + if(EFI_ERROR(Status)) + { + pBS->FreePool(TseIccSetupData); + gBrowserCallbackEnabled = OrgBrowserCallbackEnabled; + return; + } + + TseIccSetupData->AllowAdvancedOptions = IccSetupData->AllowAdvancedOptions; + for (i=0; i<6 ;i++) + { + TseIccSetupData->ShowClock[i] = IccSetupData->ShowClock[i]; + TseIccSetupData->ShowSsc[i] = IccSetupData->ShowSsc[i]; + TseIccSetupData->Frequency[i] = IccSetupData->Frequency[i]; + TseIccSetupData->SscPercent[i] = IccSetupData->SscPercent[i]; + } + Status = HiiLibSetBrowserData( + SelectionBufferSize, TseIccSetupData, + &IccSetupDataGuid, L"IccAdvancedSetupDataVar"); + + pBS->FreePool(TseIccSetupData); + gBrowserCallbackEnabled = OrgBrowserCallbackEnabled; + + } + } + + } +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.cif b/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.cif new file mode 100644 index 0000000..65e9d9f --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.cif @@ -0,0 +1,16 @@ +<component> + name = "IccSetup" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\Icc\IccSetup" + RefName = "IccSetup" +[files] +"IccSetup.mak" +"IccSetup.sdl" +"IccCallbacks.c" +"IccCallbacks.h" +"IccSetup.h" +"IccSetupMenu.sd" +"IccSetupSubmenu.sd" +"IccStrings.uni" +"IccLoadDefault.c" +<endComponent> diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.h b/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.h new file mode 100644 index 0000000..69ae39d --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.h @@ -0,0 +1,139 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccSetup.h 4 10/30/12 8:37a Klzhan $ +// +// $Revision: 4 $ +// +// $Date: 10/30/12 8:37a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccSetup.h $ +// +// 4 10/30/12 8:37a Klzhan +// Support DMI Ratio for new ICC. +// +// 3 5/14/12 4:47a Klzhan +// [TAG] EIP89676 +// [Category] Spec Update +// [Severity] Important +// [Description] Support New ICC library +// [Files] IccSetup.mak +// IccSetup.sdl +// IccCallbacks.c +// IccCallbacks.h +// IccSetup.h +// IccSetupMenu.sd +// IccSetupSubmenu.sd +// IccStrings.uni +// IccLoadDefault.c +// IccSetup.cif +// +// 2 4/24/12 12:30a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccSetup.h +// +// Description: Setup hooks for ICC. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccSetup.h + +Abstract: + + Setup hooks for ICC + +--*/ +#define SUPPORTED_CLOCKS 8 + +// +// Icc Persistent Data - needs to be remembered after platform power cycle +// +#define ICC_PERSISTENT_DATA_GUID \ +{0x64192dca, 0xd034, 0x49d2, 0xa6, 0xde, 0x65, 0xa8, 0x29, 0xeb, 0x4c, 0x74} + +#define ICC_PERSISTENT_DATA_C_NAME L"IccPersistentData" + +typedef struct _ICC_PERSISTENT_DATA { + UINT8 ClocksModified; +} ICC_PERSISTENT_DATA; + +#define ICC_SETTINGS_NOT_MODIFIED 0 +#define ICC_SETTINGS_RECENTLY_MODIFIED 1 +#define ICC_SETTINGS_PREVIOUSLY_MODIFIED 2 + +// +// Icc Volatile Setup Data - volatile (to prevent flash wear) data used by TSE +// +#define ICC_VOLATILE_SETUP_DATA_GUID \ +{0x7b77fb8b, 0x1e0d, 0x4d7e, 0x95, 0x3f, 0x39, 0x80, 0xa2, 0x61, 0xe0, 0x77} + +#define ICC_VOLATILE_SETUP_DATA_C_NAME L"IccAdvancedSetupDataVar" +#pragma pack(1) +typedef struct _ICC_VOLATILE_SETUP_DATA { + UINT16 Frequency[SUPPORTED_CLOCKS]; + UINT8 SscMode[SUPPORTED_CLOCKS]; + UINT16 SscPercent[SUPPORTED_CLOCKS]; + UINT8 ShowSsc[SUPPORTED_CLOCKS]; + UINT8 ShowClock[SUPPORTED_CLOCKS]; + UINT8 ShowDmiPegRatio[SUPPORTED_CLOCKS]; + UINT8 DmiPegRatio[SUPPORTED_CLOCKS]; + UINT8 ShowProfile; + UINT8 AllowAdvancedOptions; +} ICC_VOLATILE_SETUP_DATA; +#pragma pack() +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.mak b/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.mak new file mode 100644 index 0000000..24d038e --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.mak @@ -0,0 +1,99 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccSetup.mak 1 2/08/12 1:07a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:07a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccSetup.mak $ +# +# 1 2/08/12 1:07a Klzhan +# Initial Check in +# +# 2 5/04/11 3:06a Klzhan +# EIP58767 : ICC setup items will not be hidden when load default. +# +# 1 2/25/11 1:42a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: IccSetup.mak +# +# Description: Makefile Setup hooks for ICC. +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +All : + +SetupSdbs : $(BUILD_DIR)\IccSetup.sdb + +SetupBin : $(BUILD_DIR)\IccCallbacks.obj + +$(BUILD_DIR)\IccSetup.mak : $(IccSetup_DIR)\$(@B).cif $(IccSetup_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(IccSetup_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +$(BUILD_DIR)\IccSetup.sdb : $(BUILD_DIR)\IccSetup.mak $(IccSetup_DIR)\*.sd $(IccSetup_DIR)\*.uni + $(MAKE) /$(MAKEFLAGS) $(BUILD_DEFAULTS)\ + /f $(BUILD_DIR)\IccSetup.mak all\ + TYPE=SDB NAME=IccSetup + +$(BUILD_DIR)\IccCallbacks.obj : $(IccSetup_DIR)\IccCallbacks.c + $(CC) $(CFLAGS)\ + $(INTEL_MCH_INCLUDES) \ + $(INTEL_PCH_INCLUDES) \ + $(ME_INCLUDES)\ + $(ICC_INCLUDES)\ + $(NB_INCLUDES) \ + $(WDT_APP_INCLUDES) \ + /Fo$(BUILD_DIR)\ $(IccSetup_DIR)\IccCallbacks.c + +#--------------------------------------------------------------------------- +# Icc SETUP load dafault hook +#--------------------------------------------------------------------------- +AMITSEBin : $(BUILD_DIR)\IccLoadDefault.obj + +IccLoadDefault_CFLAGS=$(CFLAGS) \ + -I $(TSEBIN_DIR)\Inc \ + -I $(TSEBIN_DIR) + +$(BUILD_DIR)\IccLoadDefault.obj : $(IccSetup_DIR)\IccLoadDefault.c + $(CC) $(IccLoadDefault_CFLAGS) /Fo$(BUILD_DIR)\IccLoadDefault.obj $(IccSetup_DIR)\IccLoadDefault.c + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.sdl b/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.sdl new file mode 100644 index 0000000..a4ef233 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccSetup.sdl @@ -0,0 +1,263 @@ +TOKEN + Name = "IccSetup_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + TargetH = Yes + Master = Yes + Help = "Main switch to enable ICC support in Project in DXE Phase" +End + +MODULE + Help = "Includes IccSetup.mak to Project" + File = "IccSetup.mak" +End + +PATH + Name = "IccSetup_DIR" + Help = "Icc Setup dir" +End + +ELINK + Name = "/I$(IccSetup_DIR)" + Parent = "ICC_INCLUDES" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\IccSetup.sdb" + Parent = "SETUP_SDBS" + Priority = 86 + InvokeOrder = AfterParent +End + +ELINK + Name = "$(IccSetup_DIR)\IccSetupMenu.sd" + Parent = "SETUP_DEFINITIONS" + Priority = 86 + InvokeOrder = AfterParent +End + +ELINK + Name = "$(IccSetup_DIR)\IccSetupSubmenu.sd" + Parent = "SETUP_DEFINITIONS" + Priority = 86 + InvokeOrder = AfterParent +End + +ELINK + Name = "InitICCStrings," + Parent = "SetupStringInit" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_ICCMENU,IccMenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FORM1,IccSubmenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FORM2,IccSubmenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FORM3,IccSubmenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FORM4,IccSubmenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FORM5,IccSubmenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FORM6,IccSubmenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FORM7,IccSubmenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FORM8,IccSubmenuEntry)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_NOW1,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_NOW2,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_NOW3,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_NOW4,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_NOW5,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_NOW6,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_NOW7,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_NOW8,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_PERM1,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_PERM2,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_PERM3,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_PERM4,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_PERM5,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_PERM6,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_PERM7,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_CHANGE_PERM8,IccAccept)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FREQ1,IccFreqChange)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FREQ2,IccFreqChange)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FREQ3,IccFreqChange)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FREQ4,IccFreqChange)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FREQ5,IccFreqChange)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FREQ6,IccFreqChange)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FREQ7,IccFreqChange)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "ITEM_CALLBACK(ADVANCED_FORM_SET_CLASS,0,KEY_FREQ8,IccFreqChange)," + Parent = "SetupItemCallbacks" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\IccLoadDefault.obj" + Parent = "AMITSE_Objects" + InvokeOrder = AfterParent +End + +ELINK + Name = "IccSetupLoadDefault," + Parent = "LoadSetupDefaults," + InvokeOrder = AfterParent +End
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccSetupMenu.sd b/Board/EM/MeWrapper/Icc/IccSetup/IccSetupMenu.sd new file mode 100644 index 0000000..06ed9f7 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccSetupMenu.sd @@ -0,0 +1,438 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccSetupMenu.sd 4 12/24/12 6:37a Klzhan $ +// +// $Revision: 4 $ +// +// $Date: 12/24/12 6:37a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccSetupMenu.sd $ +// +// 4 12/24/12 6:37a Klzhan +// [TAG] EIP109624 +// [Category] New Feature +// [Description] Support Lock Icc registers. +// +// 3 5/14/12 4:47a Klzhan +// [TAG] EIP89676 +// [Category] Spec Update +// [Severity] Important +// [Description] Support New ICC library +// [Files] IccSetup.mak +// IccSetup.sdl +// IccCallbacks.c +// IccCallbacks.h +// IccSetup.h +// IccSetupMenu.sd +// IccSetupSubmenu.sd +// IccStrings.uni +// IccLoadDefault.c +// IccSetup.cif +// +// 2 4/24/12 12:31a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccSetup.sd +// +// Description: SD file for ICC Setup +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccSetupMenu.sd + +Abstract: + + Icc's advanced menu layout + +--*/ + +#ifdef SETUP_DATA_DEFINITION + + UINT8 IccWdtEnabled; + UINT8 IccSetClockEnables; + UINT8 IccLockRegisters; + UINT8 IccDisplayProfile; + UINT8 IccSelectedProfile; + UINT8 IccProfileEnable; + +#endif + +#ifdef CONTROL_DEFINITION + #define ICC_GOTO_INTELICC\ + goto ICC_FORM_ID, \ + prompt = STRING_TOKEN(STR_ICC_FORM),\ + help = STRING_TOKEN(STR_ICC_FORM_HELP),\ + flags = INTERACTIVE,\ + key = AUTO_ID(KEY_ICCMENU); +#endif +#ifdef ADVANCED_FORM_SET + +#ifdef FORM_SET_TYPEDEF + +#include "IccSetup.h" + +#endif + + +#ifdef FORM_SET_VARSTORE + + varstore ICC_VOLATILE_SETUP_DATA, + key = AUTO_ID(ICC_VOLATILE_SETUP_DATA_VAR), + name = IccAdvancedSetupDataVar, + guid = ICC_VOLATILE_SETUP_DATA_GUID; + +#endif + +#ifdef FORM_SET_ITEM +#endif + +#ifdef FORM_SET_GOTO + // + // this grayout is always false, but ensures that callback function will receive pointer to ICC_VOLATILE_SETUP_DATA instead SETUP_DATA + // + grayoutif ideqval ICC_VOLATILE_SETUP_DATA.AllowAdvancedOptions == 2; + ICC_GOTO_INTELICC + endif; +#endif + +#ifdef FORM_SET_FORM + #ifndef ICC_FORM_SETUP + #define ICC_FORM_SETUP + + form formid = AUTO_ID(ICC_FORM_ID), + title = STRING_TOKEN(STR_ENABLED); + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + oneof varid = SETUP_DATA.IccWdtEnabled, + prompt = STRING_TOKEN(STR_ICC_WDT_ENABLE), + help = STRING_TOKEN(STR_ICC_WDT_ENABLE_HELP), + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED; + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = RESET_REQUIRED; + endoneof; + + oneof varid = SETUP_DATA.IccSetClockEnables, + prompt = STRING_TOKEN(STR_ICC_CLOCK_ENABLING), + help = STRING_TOKEN(STR_ICC_CLOCK_ENABLING_HELP), + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = RESET_REQUIRED; + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED; + endoneof; + + oneof varid = SETUP_DATA.IccLockRegisters, + prompt = STRING_TOKEN(STR_ICC_LOCK_EOP), + help = STRING_TOKEN(STR_ICC_LOCK_HELP), + option text = STRING_TOKEN(STR_ICC_DEFAULT), value = 3, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED; + option text = STRING_TOKEN(STR_ICC_LOCK), value = 4, flags = MANUFACTURING | RESET_REQUIRED; + option text = STRING_TOKEN(STR_ICC_UNLOCK), value = 5, flags = RESET_REQUIRED; + endoneof; + endif; + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + suppressif ideqval SETUP_DATA.IccDisplayProfile == 0; + numeric varid = SETUP_DATA.IccSelectedProfile, + prompt = STRING_TOKEN(STR_ICC_PROFILE), + help = STRING_TOKEN(STR_ICC_PROFILE_HELP), + flags = RESET_REQUIRED, + minimum = 0, + maximum = 7, + step = 1, + default = 0, + endnumeric; + SUPPRESS_GRAYOUT_ENDIF + + SEPARATOR + + SUBTITLE(STRING_TOKEN(STR_ICC_OVERCLOCKING)) + + SEPARATOR + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_LIB_VERSION), + text = STRING_TOKEN(STR_ICC_LIB_VERSION_NR), + flags = 0, key = AUTO_ID(KEY_ACCEPT); + + suppressif ideqval ICC_VOLATILE_SETUP_DATA.AllowAdvancedOptions == 0; + + goto ICC_ADVFORM_ID1, + prompt = STRING_TOKEN(STR_ICC_SUBFORM1), + help = STRING_TOKEN(STR_ICC_FORM_HELP), + flags = INTERACTIVE, + key = AUTO_ID(KEY_FORM1); + + goto ICC_ADVFORM_ID2, + prompt = STRING_TOKEN(STR_ICC_SUBFORM2), + help = STRING_TOKEN(STR_ICC_FORM_HELP), + flags = INTERACTIVE, + key = AUTO_ID(KEY_FORM2); + + goto ICC_ADVFORM_ID3, + prompt = STRING_TOKEN(STR_ICC_SUBFORM3), + help = STRING_TOKEN(STR_ICC_FORM_HELP), + flags = INTERACTIVE, + key = AUTO_ID(KEY_FORM3); + + goto ICC_ADVFORM_ID4, + prompt = STRING_TOKEN(STR_ICC_SUBFORM4), + help = STRING_TOKEN(STR_ICC_FORM_HELP), + flags = INTERACTIVE, + key = AUTO_ID(KEY_FORM4); + + goto ICC_ADVFORM_ID5, + prompt = STRING_TOKEN(STR_ICC_SUBFORM5), + help = STRING_TOKEN(STR_ICC_FORM_HELP), + flags = INTERACTIVE, + key = AUTO_ID(KEY_FORM5); + + goto ICC_ADVFORM_ID6, + prompt = STRING_TOKEN(STR_ICC_SUBFORM6), + help = STRING_TOKEN(STR_ICC_FORM_HELP), + flags = INTERACTIVE, + key = AUTO_ID(KEY_FORM6); + + goto ICC_ADVFORM_ID7, + prompt = STRING_TOKEN(STR_ICC_SUBFORM7), + help = STRING_TOKEN(STR_ICC_FORM_HELP), + flags = INTERACTIVE, + key = AUTO_ID(KEY_FORM7); + + goto ICC_ADVFORM_ID8, + prompt = STRING_TOKEN(STR_ICC_SUBFORM8), + help = STRING_TOKEN(STR_ICC_FORM_HELP), + flags = INTERACTIVE, + key = AUTO_ID(KEY_FORM8); + endif; + + endform; + +#define INSIDE_ICC_SUBMENU + +#define CLOCK_NUMBER OFFSET_0 +#ifdef SETUP_DATA_DEFINITION +AUTO_ID(KEY_FREQ1) +AUTO_ID(KEY_CHANGE_NOW1) +AUTO_ID(KEY_CHANGE_ONCE1) +AUTO_ID(KEY_CHANGE_PERM1) +#endif +#define KEY_FREQ KEY_FREQ1 +#define MENU_NUMBER ICC_ADVFORM_ID1 +#define KEY_CHANGE_NOW KEY_CHANGE_NOW1 +#define KEY_CHANGE_ONCE KEY_CHANGE_ONCE1 +#define KEY_CHANGE_PERM KEY_CHANGE_PERM1 +form formid = AUTO_ID(ICC_ADVFORM_ID1), +#include "IccSetupSubmenu.sd" +#undef MENU_NUMBER +#undef KEY_CHANGE_NOW +#undef KEY_CHANGE_ONCE +#undef KEY_CHANGE_PERM +#undef CLOCK_NUMBER + +#define CLOCK_NUMBER OFFSET_1 +#ifdef SETUP_DATA_DEFINITION +AUTO_ID(KEY_FREQ2) +AUTO_ID(KEY_CHANGE_NOW2) +AUTO_ID(KEY_CHANGE_ONCE2) +AUTO_ID(KEY_CHANGE_PERM2) +#endif +#undef KEY_FREQ +#define KEY_FREQ KEY_FREQ2 +#define MENU_NUMBER ICC_ADVFORM_ID2 +#define KEY_CHANGE_NOW KEY_CHANGE_NOW2 +#define KEY_CHANGE_ONCE KEY_CHANGE_ONCE2 +#define KEY_CHANGE_PERM KEY_CHANGE_PERM2 +form formid = AUTO_ID(ICC_ADVFORM_ID2), +#include "IccSetupSubmenu.sd" +#undef MENU_NUMBER +#undef KEY_CHANGE_NOW +#undef KEY_CHANGE_ONCE +#undef KEY_CHANGE_PERM +#undef CLOCK_NUMBER + +#define CLOCK_NUMBER OFFSET_2 +#ifdef SETUP_DATA_DEFINITION +AUTO_ID(KEY_FREQ3) +AUTO_ID(KEY_CHANGE_NOW3) +AUTO_ID(KEY_CHANGE_ONCE3) +AUTO_ID(KEY_CHANGE_PERM3) +#endif +#undef KEY_FREQ +#define KEY_FREQ KEY_FREQ3 +#define KEY_CHANGE_NOW KEY_CHANGE_NOW3 +#define KEY_CHANGE_ONCE KEY_CHANGE_ONCE3 +#define KEY_CHANGE_PERM KEY_CHANGE_PERM3 +#define MENU_NUMBER ICC_ADVFORM_ID3 +form formid = AUTO_ID(ICC_ADVFORM_ID3), +#include "IccSetupSubmenu.sd" +#undef MENU_NUMBER +#undef KEY_CHANGE_NOW +#undef KEY_CHANGE_ONCE +#undef KEY_CHANGE_PERM +#undef CLOCK_NUMBER + +#define CLOCK_NUMBER OFFSET_3 +#ifdef SETUP_DATA_DEFINITION +AUTO_ID(KEY_FREQ4) +AUTO_ID(KEY_CHANGE_NOW4) +AUTO_ID(KEY_CHANGE_ONCE4) +AUTO_ID(KEY_CHANGE_PERM4) +#endif +#undef KEY_FREQ +#define KEY_FREQ KEY_FREQ4 +#define KEY_CHANGE_NOW KEY_CHANGE_NOW4 +#define KEY_CHANGE_ONCE KEY_CHANGE_ONCE4 +#define KEY_CHANGE_PERM KEY_CHANGE_PERM4 +#define MENU_NUMBER ICC_ADVFORM_ID4 +form formid = AUTO_ID(ICC_ADVFORM_ID4), +#include "IccSetupSubmenu.sd" +#undef MENU_NUMBER +#undef KEY_CHANGE_NOW +#undef KEY_CHANGE_ONCE +#undef KEY_CHANGE_PERM +#undef CLOCK_NUMBER + +#define CLOCK_NUMBER OFFSET_4 +#ifdef SETUP_DATA_DEFINITION +AUTO_ID(KEY_FREQ5) +AUTO_ID(KEY_CHANGE_NOW5) +AUTO_ID(KEY_CHANGE_ONCE5) +AUTO_ID(KEY_CHANGE_PERM5) +#endif +#undef KEY_FREQ +#define KEY_FREQ KEY_FREQ5 +#define KEY_CHANGE_NOW KEY_CHANGE_NOW5 +#define KEY_CHANGE_ONCE KEY_CHANGE_ONCE5 +#define KEY_CHANGE_PERM KEY_CHANGE_PERM5 +#define MENU_NUMBER ICC_ADVFORM_ID5 +form formid = AUTO_ID(ICC_ADVFORM_ID5), +#include "IccSetupSubmenu.sd" +#undef MENU_NUMBER +#undef KEY_CHANGE_NOW +#undef KEY_CHANGE_ONCE +#undef KEY_CHANGE_PERM +#undef CLOCK_NUMBER + +#define CLOCK_NUMBER OFFSET_5 +#ifdef SETUP_DATA_DEFINITION +AUTO_ID(KEY_FREQ6) +AUTO_ID(KEY_CHANGE_NOW6) +AUTO_ID(KEY_CHANGE_ONCE6) +AUTO_ID(KEY_CHANGE_PERM6) +#endif +#undef KEY_FREQ +#define KEY_FREQ KEY_FREQ6 +#define KEY_CHANGE_NOW KEY_CHANGE_NOW6 +#define KEY_CHANGE_ONCE KEY_CHANGE_ONCE6 +#define KEY_CHANGE_PERM KEY_CHANGE_PERM6 +#define MENU_NUMBER ICC_ADVFORM_ID6 +form formid = AUTO_ID(ICC_ADVFORM_ID6), +#include "IccSetupSubmenu.sd" +#undef MENU_NUMBER +#undef KEY_CHANGE_NOW +#undef KEY_CHANGE_ONCE +#undef KEY_CHANGE_PERM +#undef CLOCK_NUMBER + +#define CLOCK_NUMBER OFFSET_6 +#ifdef SETUP_DATA_DEFINITION +AUTO_ID(KEY_FREQ7) +AUTO_ID(KEY_CHANGE_NOW7) +AUTO_ID(KEY_CHANGE_ONCE7) +AUTO_ID(KEY_CHANGE_PERM7) +#endif +#undef KEY_FREQ +#define KEY_FREQ KEY_FREQ7 +#define KEY_CHANGE_NOW KEY_CHANGE_NOW7 +#define KEY_CHANGE_ONCE KEY_CHANGE_ONCE7 +#define KEY_CHANGE_PERM KEY_CHANGE_PERM7 +#define MENU_NUMBER ICC_ADVFORM_ID7 +form formid = AUTO_ID(ICC_ADVFORM_ID7), +#include "IccSetupSubmenu.sd" +#undef MENU_NUMBER +#undef KEY_CHANGE_NOW +#undef KEY_CHANGE_ONCE +#undef KEY_CHANGE_PERM +#undef CLOCK_NUMBER + +#define CLOCK_NUMBER OFFSET_7 +#ifdef SETUP_DATA_DEFINITION +AUTO_ID(KEY_FREQ8) +AUTO_ID(KEY_CHANGE_NOW8) +AUTO_ID(KEY_CHANGE_ONCE8) +AUTO_ID(KEY_CHANGE_PERM8) +#endif +#undef KEY_FREQ +#define KEY_FREQ KEY_FREQ8 +#define KEY_CHANGE_NOW KEY_CHANGE_NOW8 +#define KEY_CHANGE_ONCE KEY_CHANGE_ONCE8 +#define KEY_CHANGE_PERM KEY_CHANGE_PERM8 +#define MENU_NUMBER ICC_ADVFORM_ID8 +form formid = AUTO_ID(ICC_ADVFORM_ID8), +#include "IccSetupSubmenu.sd" +#undef MENU_NUMBER +#undef KEY_CHANGE_NOW +#undef KEY_CHANGE_ONCE +#undef KEY_CHANGE_PERM +#undef CLOCK_NUMBER + +#undef INSIDE_ICC_SUBMENU + + #endif // ICC_FORM_SETUP + +#endif + +#endif + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccSetupSubmenu.sd b/Board/EM/MeWrapper/Icc/IccSetup/IccSetupSubmenu.sd new file mode 100644 index 0000000..0ebcfab --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccSetupSubmenu.sd @@ -0,0 +1,239 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccSetupSubmenu.sd 3 11/20/12 3:09a Klzhan $ +// +// $Revision: 3 $ +// +// $Date: 11/20/12 3:09a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccSetup/IccSetupSubmenu.sd $ +// +// 3 11/20/12 3:09a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] AMI CSP Intel BIOS Setup Unify Rule. +// +// 2 10/30/12 8:37a Klzhan +// Support DMI Ratio for new ICC. +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 2 9/06/11 6:11a Klzhan +// [TAG] EIP67462 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ICC 08.00.00.022.1 +// [Files] IccSetup.mak +// IccSetup.sdl +// IccCallbacks.c +// IccCallbacks.h +// IccSetup.h +// IccSetupMenu.sd +// IccSetupSubmenu.sd +// IccStrings.uni +// IccLoadDefault.c +// IccSetup.cif +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccSetup.sd +// +// Description: SD file for ICC Setup +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccSetupSubmenu.sd + +Abstract: + + Icc's overclocking submenu layout + +--*/ + +//This file should be included multiple times into IccSetupMenu.sd + +#ifdef INSIDE_ICC_SUBMENU + +title = STRING_TOKEN(STR_EMPTY); + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_CLOCK_NUMBER), + text = STRING_TOKEN(STR_EMPTY), + flags = 0, key = 0; + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_CLOCK_USAGE_1), + text = STRING_TOKEN(STR_EMPTY), + flags = 0, key = 0; + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_CLOCK_USAGE_2), + text = STRING_TOKEN(STR_EMPTY), + flags = 0, key = 0; + + SEPARATOR + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_MAX_FREQUENCY), + text = STRING_TOKEN(STR_ICC_MAX_FREQUENCY_VALUE), + flags = 0, key = 0; + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_MIN_FREQUENCY), + text = STRING_TOKEN(STR_ICC_MIN_FREQUENCY_VALUE), + flags = 0, key = 0; + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_CURRENT_FREQUENCY), + text = STRING_TOKEN(STR_ICC_CURRENT_FREQUENCY_VALUE), + flags = 0, key = 0; + + suppressif ideqval ICC_VOLATILE_SETUP_DATA.ShowClock[CLOCK_NUMBER] == 0; + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + numeric varid = ICC_VOLATILE_SETUP_DATA.Frequency[CLOCK_NUMBER], + prompt = STRING_TOKEN(STR_ICC_NEW_FREQUENCY), + help = STRING_TOKEN(STR_ICC_NEW_FREQUENCY_HELP), + flags = INTERACTIVE, + key = KEY_FREQ, + minimum = 0, + maximum = 65535, + step = 1, + default = 0, + endnumeric; + SUPPRESS_GRAYOUT_ENDIF + + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + suppressif ideqval ICC_VOLATILE_SETUP_DATA.ShowSsc[CLOCK_NUMBER] == 0; + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_SSC_MODES), + text = STRING_TOKEN(STR_ICC_SSC_MODES_VALUE), + flags = 0, key = 0; + SUPPRESS_GRAYOUT_ENDIF + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_SSC_CURRENT_MODE), + text = STRING_TOKEN(STR_ICC_SSC_CURRENT_MODE_VALUE), + flags = 0, key = 0; + + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + suppressif ideqval ICC_VOLATILE_SETUP_DATA.ShowSsc[CLOCK_NUMBER] == 0; + oneof varid = ICC_VOLATILE_SETUP_DATA.SscMode[CLOCK_NUMBER], + prompt = STRING_TOKEN(STR_ICC_SSC_MODE_SELECTION), + help = STRING_TOKEN(STR_ICC_SSC_MODE_SELECTION_HELP), + option text = STRING_TOKEN(STR_ICC_MODE_DOWN), value = 0, flags = DEFAULT; + option text = STRING_TOKEN(STR_ICC_MODE_CENTRE), value = 1, flags = 0; + option text = STRING_TOKEN(STR_ICC_MODE_UP), value = 2, flags = 0; + endoneof; + SUPPRESS_GRAYOUT_ENDIF + + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + suppressif ideqval ICC_VOLATILE_SETUP_DATA.ShowSsc[CLOCK_NUMBER] == 0; + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_SSC_MAX), + text = STRING_TOKEN(STR_ICC_SSC_MAX_VALUE), + flags = 0, key = 0; + SUPPRESS_GRAYOUT_ENDIF + + text + help = STRING_TOKEN(STR_EMPTY), + text = STRING_TOKEN(STR_ICC_SSC_CURRENT), + text = STRING_TOKEN(STR_ICC_SSC_CURRENT_VALUE), + flags = 0, key = 0; + + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + suppressif ideqval ICC_VOLATILE_SETUP_DATA.ShowSsc[CLOCK_NUMBER] == 0; + numeric varid = ICC_VOLATILE_SETUP_DATA.SscPercent[CLOCK_NUMBER], + prompt = STRING_TOKEN(STR_ICC_SSC_NEW_PERCENT), + help = STRING_TOKEN(STR_ICC_SSC_NEW_PERCENT_HELP), + flags = 0, + key = 0, + minimum = 0, + maximum = 999, + step = 1, + default = 0, + endnumeric; + SUPPRESS_GRAYOUT_ENDIF + + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + suppressif ideqval ICC_VOLATILE_SETUP_DATA.ShowDmiPegRatio[CLOCK_NUMBER] == 0; + oneof varid = ICC_VOLATILE_SETUP_DATA.DmiPegRatio[CLOCK_NUMBER], + prompt = STRING_TOKEN(STR_DMI_PEG_RATIO), + help = STRING_TOKEN(STR_DMI_PEG_RATIO_HELP), + option text = STRING_TOKEN(STR_DMI_PEG_RATIO_55), value = 0, flags = DEFAULT; + option text = STRING_TOKEN(STR_DMI_PEG_RATIO_54), value = 1, flags = 0; + option text = STRING_TOKEN(STR_DMI_PEG_RATIO_53), value = 2, flags = 0; + option text = STRING_TOKEN(STR_DMI_PEG_RATIO_52), value = 3, flags = 0; + endoneof; + SUPPRESS_GRAYOUT_ENDIF + + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + suppressif ideqval ICC_VOLATILE_SETUP_DATA.ShowSsc[CLOCK_NUMBER] == 0 AND ideqval ICC_VOLATILE_SETUP_DATA.ShowClock[CLOCK_NUMBER] == 0; + goto MENU_NUMBER,prompt=STRING_TOKEN(STR_ICC_IMMEDIATE_CHANGES),help=STRING_TOKEN(STR_ICC_IMMEDIATE_CHANGES_HELP),flags=INTERACTIVE,key=KEY_CHANGE_NOW; + goto MENU_NUMBER,prompt=STRING_TOKEN(STR_ICC_PERMANENT_CHANGES),help=STRING_TOKEN(STR_ICC_PERMANENT_CHANGES_HELP),flags=INTERACTIVE,key=KEY_CHANGE_PERM; + SUPPRESS_GRAYOUT_ENDIF + + endform; + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/IccSetup/IccStrings.uni b/Board/EM/MeWrapper/Icc/IccSetup/IccStrings.uni Binary files differnew file mode 100644 index 0000000..29f0557 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/IccSetup/IccStrings.uni diff --git a/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.cif b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.cif new file mode 100644 index 0000000..b548eaf --- /dev/null +++ b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.cif @@ -0,0 +1,14 @@ +<component> + name = "IccOverClocking" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\Icc\OverClocking\" + RefName = "IccOverClocking" +[files] +"IccOverClocking.sdl" +"IccOverClocking.dxs" +"IccOverClocking.mak" +"IccOverClocking.efi" +"IccOverClocking9_5.dxs" +"IccOverClocking9_5.efi" +"IccProtocol.h" +<endComponent> diff --git a/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.dxs b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.dxs new file mode 100644 index 0000000..06ebd96 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.dxs @@ -0,0 +1,109 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccOverClocking/IccOverClocking.dxs 2 12/04/12 4:39a Klzhan $ +// +// $Revision: 2 $ +// +// $Date: 12/04/12 4:39a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccOverClocking/IccOverClocking.dxs $ +// +// 2 12/04/12 4:39a Klzhan +// [TAG] EIP107309 +// [Category] New Feature +// [Description] Support ICC library for ME 9.5 +// [Files] IccOverClocking.sdl +// IccOverClocking.dxs +// IccOverClocking.mak +// IccOverClocking.efi +// IccOverClocking.cif +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccOverClocking.dxs +// +// Description: Icc control library. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccOverClocking.dxs + +Abstract: + + Icc control library + +--*/ + +#include "AutoGen.h" +#include "DxeDepex.h" +#if defined (BUILD_WITH_GLUELIB) || defined (BUILD_WITH_EDKII_GLUE_LIB) +#include "EfiDepex.h" +#endif + +#include EFI_PROTOCOL_DEFINITION (Heci) +#ifdef CougarPoint_SUPPORT +#include EFI_PROTOCOL_DEFINITION (Wdt) +#endif +#include "IccProtocol.h" +DEPENDENCY_START +#ifdef CougarPoint_SUPPORT + WDT_PROTOCOL_GUID AND +#endif + EFI_HECI_PROTOCOL_GUID + AND + ICC_9_0_GUID +DEPENDENCY_END +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.efi b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.efi Binary files differnew file mode 100644 index 0000000..237ad24 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.efi diff --git a/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.mak b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.mak new file mode 100644 index 0000000..732fa52 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.mak @@ -0,0 +1,111 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccOverClocking/IccOverClocking.mak 2 1/18/13 12:31a Klzhan $ +# +# $Revision: 2 $ +# +# $Date: 1/18/13 12:31a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccOverClocking/IccOverClocking.mak $ +# +# 2 1/18/13 12:31a Klzhan +# [TAG] EIPNone +# [Category] Bug Fix +# [Symptom] ICC library not loaded when ME 9.5 +# [Files] IccOverClocking.sdl +# IccOverClocking.dxs +# IccOverClocking.mak +# IccOverClocking.efi +# IccOverClocking9_5.dxs +# IccOverClocking9_5.efi +# IccProtocol.h +# IccOverClocking.cif +# +# 1 2/08/12 1:07a Klzhan +# Initial Check in +# +# 2 9/26/11 6:21a Klzhan +# Fix build error with New EDK +# +# 1 2/25/11 1:42a Klzhan +# Initial Check-in +# +# 2 12/03/10 5:37a Klzhan +# Fix Build Error. +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: IccOverClocking.mak +# +# Description: Setup hooks for ICC. +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +all : $(BUILD_DIR)\IccOverClocking.ffs $(BUILD_DIR)\IccOverClocking9_5.ffs + +IccOverClocking_INCLUDES=\ + $(INTEL_PCH_INCLUDES)\ + $(EDK_INCLUDES)\ + $(EdkIIGlueLib_INCLUDES)\ + $(ME_INCLUDES)\ + $(ICC_INCLUDES)\ + +$(BUILD_DIR)\IccOverClocking.ffs : $(IccOverClocking_DIR)\$(@B).efi $(IccOverClocking_DIR)\$(@B).mak Core\FFS.mak + $(MAKE) /$(MAKEFLAGS) /f Core\FFS.mak \ + CPFLAGS="$(GLOBAL_DEFINES) /D TIANO_RELEASE_VERSION=0x00080006 $(EXTRA_DEFINES) $(IccOverClocking_INCLUDES)" \ + BUILD_DIR=$(BUILD_DIR) SOURCE_DIR=$(IccOverClocking_DIR) \ + GUID=5BBA83E5-F027-4ca7-BFD0-16358CC9E123\ + NAME=$(@B)\ + TYPE=EFI_FV_FILETYPE_DRIVER \ + DEPEX1=$(IccOverClocking_DIR)\IccOverClocking.dxs\ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + PEFILE=$(IccOverClocking_DIR)\$(@B).efi FFSFILE=$@ COMPRESS=1 \ + + +$(BUILD_DIR)\IccOverClocking9_5.ffs : $(IccOverClocking_DIR)\IccOverClocking9_5.efi $(IccOverClocking_DIR)\IccOverClocking.mak Core\FFS.mak + $(MAKE) /$(MAKEFLAGS) /f Core\FFS.mak \ + CPFLAGS="$(GLOBAL_DEFINES) /D TIANO_RELEASE_VERSION=0x00080006 $(EXTRA_DEFINES) $(IccOverClocking_INCLUDES)" \ + BUILD_DIR=$(BUILD_DIR) SOURCE_DIR=$(IccOverClocking_DIR) \ + GUID=8e68e3c5-fc59-4280-8467-3800d31a8162\ + NAME=$(@B)\ + TYPE=EFI_FV_FILETYPE_DRIVER \ + DEPEX1=$(IccOverClocking_DIR)\IccOverClocking9_5.dxs\ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + PEFILE=$(IccOverClocking_DIR)\$(@B).efi FFSFILE=$@ COMPRESS=1 \ + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.sdl b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.sdl new file mode 100644 index 0000000..782cb57 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking.sdl @@ -0,0 +1,32 @@ +TOKEN + Name = "IccOverClocking_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + TargetH = Yes + Master = Yes + Help = "Main switch to enable IccOverClocking support in Project" +End + +MODULE + Help = "Includes IccOverClocking.mak to Project" + File = "IccOverClocking.mak" +End + +PATH + Name = "IccOverClocking_DIR" + Help = "Icc Support commands" +End + +ELINK + Name = "$(BUILD_DIR)\IccOverClocking.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\IccOverClocking9_5.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking9_5.dxs b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking9_5.dxs new file mode 100644 index 0000000..be16aac --- /dev/null +++ b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking9_5.dxs @@ -0,0 +1,101 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccOverClocking/IccOverClocking9_5.dxs 1 12/04/12 4:42a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 12/04/12 4:42a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccOverClocking/IccOverClocking9_5.dxs $ +// +// 1 12/04/12 4:42a Klzhan +// [TAG] EIP107309 +// [Category] New Feature +// [Description] Support ICC library for ME 9.5 +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccOverClocking.dxs +// +// Description: Icc control library. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccOverClocking.dxs + +Abstract: + + Icc control library + +--*/ + +#include "AutoGen.h" +#include "DxeDepex.h" +#if defined (BUILD_WITH_GLUELIB) || defined (BUILD_WITH_EDKII_GLUE_LIB) +#include "EfiDepex.h" +#endif + +#include EFI_PROTOCOL_DEFINITION (Heci) +#ifdef CougarPoint_SUPPORT +#include EFI_PROTOCOL_DEFINITION (Wdt) +#endif +#include "IccProtocol.h" +DEPENDENCY_START +#ifdef CougarPoint_SUPPORT + WDT_PROTOCOL_GUID AND +#endif + EFI_HECI_PROTOCOL_GUID + AND + ICC_9_5_GUID +DEPENDENCY_END +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking9_5.efi b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking9_5.efi Binary files differnew file mode 100644 index 0000000..43dd6e3 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/OverClocking/IccOverClocking9_5.efi diff --git a/Board/EM/MeWrapper/Icc/OverClocking/IccProtocol.h b/Board/EM/MeWrapper/Icc/OverClocking/IccProtocol.h new file mode 100644 index 0000000..4d4f106 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/OverClocking/IccProtocol.h @@ -0,0 +1,67 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccOverClocking/IccProtocol.h 1 12/04/12 4:46a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 12/04/12 4:46a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccOverClocking/IccProtocol.h $ +// +// 1 12/04/12 4:46a Klzhan +// [TAG] EIP107309 +// [Category] New Feature +// [Description] Support ICC library for ME 9.5 +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccProtocol.h +// +// Description: Protocol GUID define. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> + +#ifndef _ICC_PROTOCOL_H_ +#define _ICC_PROTOCOL_H_ + +#define ICC_9_0_GUID \ + {0xAE4BD7F4, 0xB58F, 0x4D12, 0xBC, 0xC4, 0x98, 0x4, 0xD7, 0x55, 0xCF, 0x42} + +#define ICC_9_5_GUID \ + {0x33DDC8EC, 0x20D2, 0x45C6, 0x9C, 0xB0, 0x5D, 0x7A, 0xC6, 0xCA, 0x10, 0x8C} + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/Icc/Protocol/IccOverClocking/IccOverClocking.c b/Board/EM/MeWrapper/Icc/Protocol/IccOverClocking/IccOverClocking.c new file mode 100644 index 0000000..e26e236 --- /dev/null +++ b/Board/EM/MeWrapper/Icc/Protocol/IccOverClocking/IccOverClocking.c @@ -0,0 +1,98 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccProtocolLib/IccOverClocking/IccOverClocking.c 1 2/08/12 1:05a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:05a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccProtocolLib/IccOverClocking/IccOverClocking.c $ +// +// 1 2/08/12 1:05a Klzhan +// Initial Check in +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccOverClocking.c +// +// Description: ICC OverClocking protocol +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + IccOverClocking.c + +Abstract: + + ICC OverClocking protocol + +--*/ + +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) + +#include "EdkIIGlueDxe.h" +#endif + +#include "IccOverClocking.h" + +// +// Protocol GUID definition +// +EFI_GUID gIccOverClockingProtocolGuid = ICC_OVERCLOCKING_PROTOCOL_GUID; + +// +// Protocol description +// +EFI_GUID_STRING + (&gIccOverClockingProtocolGuid, "ICC OverClocking Protocol", "Integrated Clock Control OverClocking Protocol"); + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/Protocol/IccOverClocking/IccOverClocking.h b/Board/EM/MeWrapper/Icc/Protocol/IccOverClocking/IccOverClocking.h new file mode 100644 index 0000000..8dc0baa --- /dev/null +++ b/Board/EM/MeWrapper/Icc/Protocol/IccOverClocking/IccOverClocking.h @@ -0,0 +1,278 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccProtocolLib/IccOverClocking/IccOverClocking.h 3 5/14/12 4:45a Klzhan $ +// +// $Revision: 3 $ +// +// $Date: 5/14/12 4:45a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccProtocolLib/IccOverClocking/IccOverClocking.h $ +// +// 3 5/14/12 4:45a Klzhan +// [TAG] EIP89676 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ICC library +// +// 2 5/11/12 3:37a Klzhan +// [TAG] EIP89676 +// [Category] Spec Update +// [Severity] Important +// [Description] Update New ICC library 9.0.0.5 +// +// 1 2/08/12 1:05a Klzhan +// Initial Check in +// +// 3 9/06/11 6:09a Klzhan +// [TAG] EIP67462 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ICC 08.00.00.022.1 +// +// 2 6/23/11 11:29p Klzhan +// [TAG] EIP62129 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ICC control Library to 8.0.0.19. +// [Files] IccOverClocking.efi, IccOverClocking.h +// +// 1 2/25/11 1:42a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:10a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: IccOverClocking.h +// +// Description: ICC OverClocking protocol +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + + Any software source code reprinted in this document is furnished under + a software license and may only be used or copied in accordance with + the terms of that license. + + + Copyright 2010-2011, Intel Corporation. All rights reserved. + +--*/ + +#ifndef _ICC_OVERCLOCKING_H_ +#define _ICC_OVERCLOCKING_H_ + +/* Types used by ICC LIB */ + +typedef enum _ICC_LIB_STATUS +{ + ICC_LIB_STATUS_SUCCESS, // 0 + ICC_LIB_STATUS_INVALID_PARAMS, // 1 + ICC_LIB_STATUS_INVALID_CLOCK_NUMBER, // 2 + ICC_LIB_STATUS_CLOCK_NOT_FOUND, // 3 + ICC_LIB_STATUS_INVALID_FREQ_VALUE, // 4 + ICC_LIB_STATUS_FREQ_TOO_LOW, // 5 + ICC_LIB_STATUS_FREQ_TOO_HIGH, // 6 + ICC_LIB_STATUS_FREQ_MUST_HAVE_ZERO_SSC, // 7 + ICC_LIB_STATUS_SSC_CHANGE_NOT_ALLOWED, // 8 + ICC_LIB_STATUS_INVALID_SSC_MODE, // 9 + ICC_LIB_STATUS_SSC_MODE_NOT_SUPPORTED, // a + ICC_LIB_STATUS_SSC_OUT_OF_RANGE, // b + ICC_LIB_STATUS_SSC_TOO_HIGH, // c + ICC_LIB_STATUS_SSC_TOO_LOW, // d + ICC_LIB_STATUS_SSC_CHANGE_NOT_ALLOWED_SSC_DISABLED, // e + ICC_LIB_STATUS_DYNAMIC_CHANGE_NOT_ALLOWED, // f + ICC_LIB_STATUS_INVALID_DMI_PEG_RATIO, // 10 + ICC_LIB_STATUS_REGISTER_IS_LOCKED, // 11 + ICC_LIB_STATUS_MEI_INITIALIZATION_FAILED, // 12 + ICC_LIB_STATUS_MEI_CONNECTION_FAILED, // 13 + ICC_LIB_STATUS_UNEXPECTED_FW_ERROR, // 14 + ICC_LIB_STATUS_UNSUPPORTED_HW, // 15 + ICC_LIB_STATUS_CLOCK_DISABLED_FAILED_PROGRAMMING, // 16 + ICC_LIB_STATUS_FREQ_AND_SSC_NOT_MATCH, // 17 + ICC_LIB_STATUS_WAITING_FOR_WARM_RESET, // 18 + ICC_LIB_STATUS_NOT_ALLOWED_IN_USER_MODE, // 19 + ICC_LIB_STATUS_TOO_MANY_CONNECTIONS, // 1a + ICC_LIB_STATUS_INVALID_COOKIE, // 1b + ICC_LIB_STATUS_DMI_PEG_RATIO_CHANGE_NOT_ALLOWED, // 1c + ICC_LIB_STATUS_NO_USAGE_DEFINED_FOR_THE_CLOCK, // 1d + ICC_LIB_STATUS_DATA_NOT_AVAILABLE, // 1e + + ICC_LIB_STATUS_UNSPECIFIED_ERROR = 0xFFFF +} ICC_LIB_STATUS; + + typedef enum _ICC_CLOCK_USAGE + { + ICC_CLOCK_USAGE_BCLK = 0, + ICC_CLOCK_USAGE_DMI, + ICC_CLOCK_USAGE_PEG, + ICC_CLOCK_USAGE_PCIE, + ICC_CLOCK_USAGE_PCI33, + ICC_CLOCK_USAGE_RESERVED, + ICC_CLOCK_USAGE_SATA, + ICC_CLOCK_USAGE_USB3, + ICC_CLOCK_USAGE_DISPLAY, + ICC_CLOCK_USAGE_DISPLAY_NON_SPREAD, + ICC_CLOCK_USAGE_27MHZ_DOWN_GFX, + ICC_CLOCK_USAGE_DISPLAY_VGA, + ICC_CLOCK_USAGE_USB_LEGACY, + ICC_CLOCK_USAGE_14_31818_MHZ + } ICC_CLOCK_USAGE; + +// @brief Defines a generic version structure used in the software build process. +typedef struct _ICC_LIB_VERSION +{ + UINT16 Major; + UINT16 Minor; + UINT16 Hotfix; + UINT16 Build; +} ICC_LIB_VERSION; + +// ssc mode +typedef enum _ICC_SSC_MODE + { + ICC_SSC_NONE = 0, // if used in SET, it means DONT CARE and current percent + // value will be used regardless of percent value + ICC_SSC_UP = 1, + ICC_SSC_CENTER = 2, + ICC_SSC_DOWN = 4 +} ICC_SSC_MODE; + +typedef UINT32 ICC_CLOCK_FREQUENCY; + +// Ratio used to modify the BCLK value and to produce +// the PEG Slot Frequency (~100MHz). BCLK / ratio = PEG +// Used in HW where the BCLK, DMI, & PEG use a common clock +typedef enum _ICC_DMI_PEG_RATIO +{ + ICC_DMI_PEG_RATIO_5_TO_5 = 0, //< 5/5 = 1 - 1:1 ratio used when BCLK at 100MHz + ICC_DMI_PEG_RATIO_5_TO_4, //< 5/4 = 1.25 - Used when BCLK around 125MHz + ICC_DMI_PEG_RATIO_5_TO_3, //< 5/3 = 1.66 - Used when BCLK around 166MHz + ICC_DMI_PEG_RATIO_5_TO_2 //< 5/2 = 2.5 - Used when BCLK around 250MHz +} ICC_DMI_PEG_RATIO; + +typedef struct _ICC_CLOCK_SETTINGS +{ + ICC_CLOCK_FREQUENCY Frequency; + ICC_SSC_MODE SscMode; + UINT8 SscPercent; // encoding example: 1.28% -> SSC_SPREAD value is 128 + ICC_DMI_PEG_RATIO DmiPegRatio; +} ICC_CLOCK_SETTINGS; + +typedef UINT16 ICC_CLOCK_USAGE_MASK; + +typedef struct _ICC_CLOCK_RANGES +{ + ICC_CLOCK_FREQUENCY FrequencyMin; + ICC_CLOCK_FREQUENCY FrequencyMax; + UINT8 SscChangeAllowed; + UINT8 SscUpAllowed; + UINT8 SscCenterAllowed; + UINT8 SscDownAllowed; + UINT8 SscPercentMax; + // that field is actually still a bit mask, but usually applications will never use it. + ICC_CLOCK_USAGE_MASK UsageMask; + UINT8 SscHaltAllowed; +} ICC_CLOCK_RANGES; + +typedef UINT8 ICC_CLOCK_ID; + +typedef UINT32 ICC_CLOCK_ID_MASK; + +typedef enum _ICC_RECORD_INVALIDATION_REASON +{ + ICC_LIB_RIR_RECORD_VALID = 0, + ICC_LIB_RIR_AC_POWER_LOSS, + ICC_LIB_RIR_CMOS_BATTERY_REMOVED, + ICC_LIB_RIR_PLATFORM_BOOT_TIMEOUT, + ICC_LIB_RIR_WDT_EXPIRED, + ICC_LIB_RIR_RESERVED, + ICC_LIB_RIR_INVALIDATE_BY_REQUEST, + ICC_LIB_RIR_FW_BUG +} ICC_RECORD_INVALIDATION_REASON; + +// +// GUID for the ICC OverClocking Protocol +// +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#define ICC_OVERCLOCKING_PROTOCOL_GUID \ + {0x8e8cbc58, 0x834c, 0x41e3, 0xb8, 0xca, 0xf0, 0x0c, 0xcf, 0x5a, 0x71, 0x7c} + +#else + +#define ICC_OVERCLOCKING_PROTOCOL_GUID \ + {0x8e8cbc58, 0x834c, 0x41e3, { 0xb8, 0xca, 0xf0, 0x0c, 0xcf, 0x5a, 0x71, 0x7c } } + +#endif +// +// Extern the GUID for protocol users. +// +extern EFI_GUID gIccOverClockingProtocolGuid; + +typedef VOID (EFIAPI *ICC_LIB_GET_INFO) (ICC_LIB_VERSION*, UINT8*, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_GET_CLOCK_ID) (ICC_CLOCK_USAGE, ICC_CLOCK_ID_MASK*, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_GET_CLOCK_RANGES) (ICC_CLOCK_ID, ICC_CLOCK_RANGES*, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_GET_CURRENT_CLOCK_SETTINGS) (ICC_CLOCK_ID, ICC_CLOCK_SETTINGS*, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_SET_CURRENT_CLOCK_SETTINGS) (ICC_CLOCK_ID, ICC_CLOCK_SETTINGS, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_GET_BOOT_CLOCK_SETTINGS) (ICC_CLOCK_ID, ICC_CLOCK_SETTINGS*, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_SET_BOOT_CLOCK_SETTINGS) (ICC_CLOCK_ID, ICC_CLOCK_SETTINGS, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_GET_DEFAULT_BOOT_SETTINGS) (ICC_CLOCK_ID, ICC_CLOCK_SETTINGS*, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_RESET_CLOCK_BOOT_SETTINGS_TO_DEFAULTS) (ICC_CLOCK_ID, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_RESET_ALL_CLOCKS_BOOT_SETTINGS_TO_DEFAULTS) (ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_GET_NEXT_FREQUENCY) (ICC_CLOCK_ID, ICC_CLOCK_FREQUENCY, ICC_CLOCK_FREQUENCY*, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_GET_PREVIOUS_FREQUENCY) (ICC_CLOCK_ID, ICC_CLOCK_FREQUENCY, ICC_CLOCK_FREQUENCY*, ICC_LIB_STATUS*); +typedef VOID (EFIAPI *ICC_LIB_GET_BOOT_CLOCK_SETTINGS_INVALIDATION_REASON) (ICC_RECORD_INVALIDATION_REASON*, ICC_LIB_STATUS*); + + +typedef struct _ICC_OVERCLOCKING_PROTOCOL { + ICC_LIB_GET_INFO GetInfo; + ICC_LIB_GET_CLOCK_ID GetClockId; + ICC_LIB_GET_CLOCK_RANGES GetClockRanges; + ICC_LIB_GET_CURRENT_CLOCK_SETTINGS GetCurrentClockSettings; + ICC_LIB_SET_CURRENT_CLOCK_SETTINGS SetCurrentClockSettings; + ICC_LIB_GET_BOOT_CLOCK_SETTINGS GetBootClockSettings; + ICC_LIB_SET_BOOT_CLOCK_SETTINGS SetBootClockSettings; + ICC_LIB_GET_DEFAULT_BOOT_SETTINGS GetDefaultClockSettings; + ICC_LIB_RESET_CLOCK_BOOT_SETTINGS_TO_DEFAULTS ResetClockBootSettingsToDefaults; + ICC_LIB_RESET_ALL_CLOCKS_BOOT_SETTINGS_TO_DEFAULTS ResetAllClocksBootSettingsToDefaults; + ICC_GET_NEXT_FREQUENCY GetNextFrequency; + ICC_GET_PREVIOUS_FREQUENCY GetPreviousFrequency; + ICC_LIB_GET_BOOT_CLOCK_SETTINGS_INVALIDATION_REASON GetBootClockSettingsInvalidationReason; +} ICC_OVERCLOCKING_PROTOCOL; + +#endif /* _ICC_OVERCLOCKING_H_ */ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.cif b/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.cif new file mode 100644 index 0000000..178021d --- /dev/null +++ b/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.cif @@ -0,0 +1,11 @@ +<component> + name = "IccProtocolLib" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\Icc\Protocol" + RefName = "IccProtocolLib" +[files] +"IccProtocolLib.sdl" +"IccProtocolLib.mak" +"IccOverClocking\IccOverClocking.h" +"IccOverClocking\IccOverClocking.c" +<endComponent> diff --git a/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.mak b/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.mak new file mode 100644 index 0000000..3eb9b6b --- /dev/null +++ b/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.mak @@ -0,0 +1,78 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccProtocolLib/IccProtocolLib.mak 1 2/08/12 1:05a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 2/08/12 1:05a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Icc/IccProtocolLib/IccProtocolLib.mak $ +# +# 1 2/08/12 1:05a Klzhan +# Initial Check in +# +# 1 2/25/11 1:41a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: IccProtocolLib.mak +# +# Description: MakeFile for IccProtocolLib +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +all : IccProtocolLib + +$(IccProtocol_LIB) : IccProtocolLib + +IccProtocolLib : $(BUILD_DIR)\IccProtocolLib.mak IccProtocolLibBin + +$(BUILD_DIR)\IccProtocolLib.mak : $(IccProtocol_DIR)\$(@B).cif $(IccProtocol_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(IccProtocol_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +IccProtocolLib_INCLUDES =\ + $(EDK_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + +IccProtocolLibBin : + $(MAKE) /$(MAKEFLAGS) $(EDKIIGLUE_DEFAULTS)\ + /f $(BUILD_DIR)\IccProtocolLib.mak all\ + "MY_INCLUDES=$(IccProtocolLib_INCLUDES)" \ + TYPE=LIBRARY \ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.sdl b/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.sdl new file mode 100644 index 0000000..2f3f33e --- /dev/null +++ b/Board/EM/MeWrapper/Icc/Protocol/IccProtocolLib.sdl @@ -0,0 +1,29 @@ +TOKEN + Name = "IccProtocolLib_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes + Help = "Main switch to enable IccProtocolLib support in Project" +End + +PATH + Name = "IccProtocol_DIR" +End + +MODULE + File = "IccProtocolLib.mak" + Help = "Includes IccProtocolLib.mak to Project" +End + +ELINK + Name = "IccProtocol_LIB" + InvokeOrder = ReplaceParent +End + +ELINK + Name = "$(BUILD_DIR)\IccProtocolLib.lib" + Parent = "IccProtocol_LIB" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.cif b/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.cif new file mode 100644 index 0000000..8acdb06 --- /dev/null +++ b/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.cif @@ -0,0 +1,10 @@ +<component> + name = "MdesStatusCode" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\MdesStatusCode" + RefName = "MdesStatusCode" +[files] +"MdesStatusCode.sdl" +"MdesStatusCode.mak" +"MdesStatusCodeDxe.c" +<endComponent> diff --git a/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.mak b/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.mak new file mode 100644 index 0000000..ed2a77b --- /dev/null +++ b/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.mak @@ -0,0 +1,89 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MdesStatusCode/MdesStatusCode.mak 1 7/27/12 5:12a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 7/27/12 5:12a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MdesStatusCode/MdesStatusCode.mak $ +# +# 1 7/27/12 5:12a Klzhan +# [TAG] EIPNone +# [Category] New Feature +# [Description] Add support MDES +# [Files] MdesStatusCode.cif +# MdesStatusCode.sdl +# MdesStatusCode.mak +# MdesStatusCodeDxe.c +# +# 2 12/08/11 3:29a Klzhan +# [TAG] EIPNone +# [Category] Improvement +# [Description] Fix build error when AMT disabled. +# +# 1 10/19/11 9:06a Calvinchen +# [TAG] EIPNone +# [Category] New Feature +# [Description] Added MDES BIOS Status Code Support. +# [Files] MdesStatusCode.cif +# MdesStatusCode.sdl +# MdesStatusCode.mak +# MdesStatusCodeDxe.c +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#--------------------------------------------------------------------------- +# Name: MeStatusCode.mak +# +# Description: AMT Status Code Makfile. +# +#--------------------------------------------------------------------------- +#<AMI_FHDR_END> + +#--------------------------------------------------------------------------- +# AMT StatusCode for DXE +#--------------------------------------------------------------------------- +MdesStatusCodeIncludes =\ + /I$(MeProtocolLib_DIR)\MePlatformPolicy \ + $(ME_INCLUDES)\ + /I$(MdesStatusCodeDrv_DIR) + +CORE_DXEBin : $(BUILD_DIR)\$(STATUS_CODE_DIR)\MdesStatusCodeDxe.obj + +$(BUILD_DIR)\$(STATUS_CODE_DIR)\MdesStatusCodeDxe.obj : $(MdesStatusCode_DIR)\MdesStatusCodeDxe.c + $(CC) $(CFLAGS:/W4=/W3) /DTIANO_RELEASE_VERSION=0x00080006 $(MdesStatusCodeIncludes) /DDXE_STATUS_CODE $(AlertStandardFormatDxe_INCLUDES) $(EDK_INCLUDES) $(STATUS_CODE_INCLUDES) /Fo$(BUILD_DIR)\$(STATUS_CODE_DIR)\MdesStatusCodeDxe.obj $(MdesStatusCode_DIR)\MdesStatusCodeDxe.c + +RUNTIMEBin : $(BUILD_DIR)\$(STATUS_CODE_DIR)\MdesStatusCodeRuntime.obj +$(BUILD_DIR)\$(STATUS_CODE_DIR)\MdesStatusCodeRuntime.obj : $(MdesStatusCode_DIR)\MdesStatusCodeDxe.c + $(CC) $(CFLAGS:/W4=/W3) /DTIANO_RELEASE_VERSION=0x00080006 $(EDK_INCLUDES) $(STATUS_CODE_INCLUDES) /Fo$(BUILD_DIR)\$(STATUS_CODE_DIR)\MdesStatusCodeRuntime.obj $(MdesStatusCode_DIR)\MdesStatusCodeDxe.c + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2011, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.sdl b/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.sdl new file mode 100644 index 0000000..d936706 --- /dev/null +++ b/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCode.sdl @@ -0,0 +1,31 @@ +TOKEN + Name = "MdesStatusCode_SUPPORT" + Value = "1" + Help = "Main switch to enable MeStatusCode support in Project" + TokenType = Boolean + TargetH = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "MdesStatusCode_DIR" +End + +MODULE + Help = "Includes MdesStatusCode.mak to Project" + File = "MdesStatusCode.mak" +End + +ELINK + Name = "DXE(MdesBiosStatusCode)," + Parent = "ReportMiscStatus" + InvokeOrder = AfterParent +End + +ELINK + Name = "DXE(MdesBiosStatusCodeInit)," + Parent = "StatusCodeInitialize" + InvokeOrder = AfterParent +End + diff --git a/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCodeDxe.c b/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCodeDxe.c new file mode 100644 index 0000000..3f46c3e --- /dev/null +++ b/Board/EM/MeWrapper/MdesStatusCode/MdesStatusCodeDxe.c @@ -0,0 +1,206 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2011, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MdesStatusCode/MdesStatusCodeDxe.c 1 7/27/12 5:12a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 7/27/12 5:12a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MdesStatusCode/MdesStatusCodeDxe.c $ +// +// 1 7/27/12 5:12a Klzhan +// [TAG] EIPNone +// [Category] New Feature +// [Description] Add support MDES +// [Files] MdesStatusCode.cif +// MdesStatusCode.sdl +// MdesStatusCode.mak +// MdesStatusCodeDxe.c +// +// 1 10/19/11 9:06a Calvinchen +// [TAG] EIPNone +// [Category] New Feature +// [Description] Added MDES BIOS Status Code Support. +// [Files] MdesStatusCode.cif +// MdesStatusCode.sdl +// MdesStatusCode.mak +// MdesStatusCodeDxe.c +// +// +//********************************************************************** +// +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: MdesStatusCodeDxe.c +// +// Description: Processes ASF messages for DXE. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + + +Module Name: + + AmtStatusCodeDxe.c + +Abstract: + Processes ASF messages + +--*/ + +//#include "Tiano.h" +#include <AmiDxeLib.h> +#ifdef DXE_STATUS_CODE +#include <AmiDxeLib.h> +#include <token.h> +#include <Setup.h> +#include "MePlatformPolicy.h" +#include "MdesStatusCodeDxe.h" +EFI_GUID gSetupGuid = SETUP_GUID; +EFI_GUID gMdesStatusCodeProtocolGuid = MDES_STATUS_CODE_PROTOCOL_GUID; +EFI_GUID gDxePlatformMePolicyGuid = DXE_PLATFORM_ME_POLICY_GUID; +extern EFI_BOOT_SERVICES *pBS; +#endif + +VOID MdesBiosStatusCode( + IN VOID **Dummy, + IN EFI_STATUS_CODE_TYPE Type, + IN EFI_STATUS_CODE_VALUE Value, + IN UINT32 Instance, + IN EFI_GUID *CallerId OPTIONAL, + IN EFI_STATUS_CODE_DATA *Data OPTIONAL +) +/*++ +Routine Description: + + Provides an interface that a software module can call to report an ASF DXE status code. + +Arguments: + + PeiServices - PeiServices pointer. + + Type - Indicates the type of status code being reported. + + Value - Describes the current status of a hardware or software entity. + This included information about the class and subclass that is + used to classify the entity as well as an operation. + + Instance - The enumeration of a hardware or software entity within + the system. Valid instance numbers start with 1. + + CallerId - This optional parameter may be used to identify the caller. + This parameter allows the status code driver to apply different + rules to different callers. + + Data - This optional parameter may be used to pass additional data. + +Returns: + + None + +--*/ +{ +#ifdef DXE_STATUS_CODE + // + // Do nothing, because AMT ASF driver will handle that. + // + EFI_STATUS Status; + MDES_STATUS_CODE_PROTOCOL *MdesStatusCodeProtocol; + static UINTN MdesEnable = 0; + static UINTN MdesEnableChecked = 0; + DXE_ME_POLICY_PROTOCOL *MePlatformPolicy; + + if (MdesEnableChecked == 0) { + Status = pBS->LocateProtocol (&gDxePlatformMePolicyGuid, NULL, &MePlatformPolicy); + if (EFI_ERROR(Status)) { + // + // Check if GetVariable function has been initialized + // + return; + } else { + MdesEnableChecked = 1; + // + // set gfMDESCheck to 1 to lock geting variable next time + // + if (!(EFI_ERROR (Status))) { + if (MePlatformPolicy->MeConfig.MdesForBiosState == 1) { + // + // check if function is set in BIOS Menu + // + MdesEnable = 1; + } + } + } + } + if (MdesEnable == 1) { + Status = pBS->LocateProtocol (&gMdesStatusCodeProtocolGuid, NULL, &MdesStatusCodeProtocol); + if (EFI_ERROR (Status)) { + return; + } + + MdesStatusCodeProtocol->SendMdesStatusCode (Type, Value, Instance, CallerId, Data); + } +#endif + return ; +} + +EFI_STATUS +MdesBiosStatusCodeInit( + IN EFI_HANDLE *ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +/*++ +Routine Description: + + Init routine for DXE ASF StatusCode. + +Arguments: + + FfsHeader - FfsHeader pointer. + PeiServices - PeiServices pointer. + +Returns: + + EFI_SUCCESS - The function completed successfully + +--*/ +{ + return EFI_SUCCESS; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.c b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.c new file mode 100644 index 0000000..db1c1ee --- /dev/null +++ b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.c @@ -0,0 +1,342 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePciPlatform/MePciPlatform.c 1 2/08/12 1:05a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:05a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePciPlatform/MePciPlatform.c $ +// +// 1 2/08/12 1:05a Klzhan +// Initial Check in +// +// 1 2/25/11 1:41a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: MePciPlatform.c +// +// Description: +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +This file contains a 'Sample Driver' and is licensed as such +under the terms of your license agreement with Intel or your +vendor. This file may be modified by the user, subject to +the additional terms of the license agreement + +--*/ + +/*++ +Copyright (c) 2008 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePciPlatform.c + +Abstract: + + +--*/ +#include "MePciPlatform.h" + +#define SETUP_GUID \ + {0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9} +EFI_GUID gSetupGuid = SETUP_GUID; +//-jeff PLATFORM_INFO_PROTOCOL *gPlatformInfoProtocol; + +EFI_PCI_ROOT_BRIDGE_IO_PROTOCOL *PciRootBridgeIo; +EFI_PCI_PLATFORM_PROTOCOL *MePciPlatformInstance; +PLATFORM_PCI_EXPRESS_BRIDGE *mPlatformPciExpressBridge; + +EFI_STATUS +EFIAPI +PhaseNotify ( + IN EFI_PCI_PLATFORM_PROTOCOL *This, + IN EFI_HANDLE HostBridge, + IN EFI_PCI_HOST_BRIDGE_RESOURCE_ALLOCATION_PHASE Phase, + IN EFI_PCI_CHIPSET_EXECUTION_PHASE ChipsetPhase + ) +/*++ + + Routine Description: + The PlatformNotify() function can be used to notify the platform driver so that + it can perform platform-specific actions. No specific actions are required. + Eight notification points are defined at this time. More synchronization points + may be added as required in the future. The PCI bus driver calls the platform driver + twice for every Phase-once before the PCI Host Bridge Resource Allocation Protocol + driver is notified, and once after the PCI Host Bridge Resource Allocation Protocol + driver has been notified. + This member function may not perform any error checking on the input parameters. It + also does not return any error codes. If this member function detects any error condition, + it needs to handle those errors on its own because there is no way to surface any + errors to the caller. + + Arguments: + This - Pointer to the EFI_PCI_PLATFORM_PROTOCOL instance. + HostBridge - The handle of the host bridge controller. + Phase - The phase of the PCI bus enumeration. + ChipsetPhase - Defines the execution phase of the PCI chipset driver. + + Returns: + EFI_SUCCESS - The function completed successfully. + +--*/ +{ +/* + EFI_STATUS Status; + + if (Phase == EfiPciHostBridgeEndBusAllocation && ChipsetPhase == ChipsetEntry) { + Status = HeciSetClockEnables (CurrentClockMask, CurrentClockEnables, TRUE); + } +*/ + return EFI_SUCCESS; +} + +EFI_STATUS +EFIAPI +PlatformPrepController ( + IN EFI_PCI_PLATFORM_PROTOCOL *This, + IN EFI_HANDLE HostBridge, + IN EFI_HANDLE RootBridge, + IN EFI_PCI_ROOT_BRIDGE_IO_PROTOCOL_PCI_ADDRESS PciAddress, + IN EFI_PCI_CONTROLLER_RESOURCE_ALLOCATION_PHASE Phase, + IN EFI_PCI_CHIPSET_EXECUTION_PHASE ChipsetPhase + ) +/*++ + + Routine Description: + The PlatformPrepController() function can be used to notify the platform driver so that + it can perform platform-specific actions. No specific actions are required. + Several notification points are defined at this time. More synchronization points may be + added as required in the future. The PCI bus driver calls the platform driver twice for + every PCI controller-once before the PCI Host Bridge Resource Allocation Protocol driver + is notified, and once after the PCI Host Bridge Resource Allocation Protocol driver has + been notified. + This member function may not perform any error checking on the input parameters. It also + does not return any error codes. If this member function detects any error condition, it + needs to handle those errors on its own because there is no way to surface any errors to + the caller. + + Arguments: + This - Pointer to the EFI_PCI_PLATFORM_PROTOCOL instance. + HostBridge - The associated PCI host bridge handle. + RootBridge - The associated PCI root bridge handle. + PciAddress - The address of the PCI device on the PCI bus. + Phase - The phase of the PCI controller enumeration. + ChipsetPhase - Defines the execution phase of the PCI chipset driver. + + Returns: + EFI_SUCCESS - The function completed successfully. + +--*/ +{ + return EFI_SUCCESS; +} + +EFI_STATUS +EFIAPI +GetPlatformPolicy ( + IN EFI_PCI_PLATFORM_PROTOCOL *This, + OUT EFI_PCI_PLATFORM_POLICY *PciPolicy + ) +/*++ + + Routine Description: + The GetPlatformPolicy() function retrieves the platform policy regarding PCI + enumeration. The PCI bus driver and the PCI Host Bridge Resource Allocation Protocol + driver can call this member function to retrieve the policy. + + Arguments: + This - Pointer to the EFI_PCI_PLATFORM_PROTOCOL instance. + PciPolicy - The platform policy with respect to VGA and ISA aliasing. + + Returns: + EFI_SUCCESS - The function completed successfully. + EFI_INVALID_PARAMETER - PciPolicy is NULL. + +--*/ +{ + return EFI_SUCCESS; +} + +EFI_STATUS +EFIAPI +GetPciRom ( + IN EFI_PCI_PLATFORM_PROTOCOL *This, + IN EFI_HANDLE PciHandle, + OUT VOID **RomImage, + OUT UINTN *RomSize + ) +/*++ + + Routine Description: + The GetPciRom() function gets the PCI device's option ROM from a platform-specific location. + The option ROM will be loaded into memory. This member function is used to return an image + that is packaged as a PCI 2.2 option ROM. The image may contain both legacy and EFI option + ROMs. See the EFI 1.10 Specification for details. This member function can be used to return + option ROM images for embedded controllers. Option ROMs for embedded controllers are typically + stored in platform-specific storage, and this member function can retrieve it from that storage + and return it to the PCI bus driver. The PCI bus driver will call this member function before + scanning the ROM that is attached to any controller, which allows a platform to specify a ROM + image that is different from the ROM image on a PCI card. + + Arguments: + This - Pointer to the EFI_PCI_PLATFORM_PROTOCOL instance. + PciHandle - The handle of the PCI device. + RomImage - If the call succeeds, the pointer to the pointer to the option ROM image. + Otherwise, this field is undefined. The memory for RomImage is allocated + by EFI_PCI_PLATFORM_PROTOCOL.GetPciRom() using the EFI Boot Service AllocatePool(). + It is the caller's responsibility to free the memory using the EFI Boot Service + FreePool(), when the caller is done with the option ROM. + RomSize - If the call succeeds, a pointer to the size of the option ROM size. Otherwise, + this field is undefined. + + Returns: + EFI_SUCCESS - The option ROM was available for this device and loaded into memory. + EFI_NOT_FOUND - No option ROM was available for this device. + EFI_OUT_OF_RESOURCES - No memory was available to load the option ROM. + EFI_DEVICE_ERROR - An error occurred in getting the option ROM. + +--*/ +{ + return EFI_NOT_FOUND; +} + +// +// Driver entry point +// +EFI_DRIVER_ENTRY_POINT (MePlatformPolicyEntryPoint) + +// +// Function implementations +// +EFI_STATUS +EFIAPI +MePciPlatformEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +/*++ + +Routine Description: + + Entry point for the Management Engine Driver. + +Arguments: + + ImageHandle Image handle of this driver. + SystemTable Global system service table. + +Returns: + + EFI_SUCCESS Initialization complete. + EFI_UNSUPPORTED The chipset is unsupported by this driver. + EFI_OUT_OF_RESOURCES Do not have enough resources to initialize the driver. + EFI_DEVICE_ERROR Device error, driver exits abnormally. + +--*/ +{ + EFI_STATUS Status; + EFI_HECI_PROTOCOL *Heci; + UINT32 MeMode; + + + EfiInitializeDriverLib (ImageHandle, SystemTable); + + // + // Locate Heci protocol + // + Status = gBS->LocateProtocol (&gEfiHeciProtocolGuid, NULL, &Heci); + if (EFI_ERROR(Status)) { + DEBUG ((EFI_D_ERROR, "MePciPlatform locate Heci failed and the Status is %r\n", Status)); + return Status; + } + + Status = Heci->GetMeMode(&MeMode); + if (EFI_ERROR(Status)) { + DEBUG ((EFI_D_ERROR, "MePciPlatform Get Me mode failed and the Status is %r\n", Status)); + return Status; + } + if (MeMode == ME_MODE_SECOVER) { + DEBUG ((EFI_D_ERROR, "SetICC doesn't supported in this mode\n")); + return EFI_UNSUPPORTED; + } + + MePciPlatformInstance = (EFI_PCI_PLATFORM_PROTOCOL *) (UINTN) AllocatePool (sizeof (EFI_PCI_PLATFORM_PROTOCOL)); + + //-jeff Status = gBS->LocateProtocol(&gPlatformInfoProtocolGuid, NULL, &gPlatformInfoProtocol); + //-jeff ASSERT_EFI_ERROR (Status); + + // Locate root bridge IO protocol + // + Status = gBS->LocateProtocol (&gEfiPciRootBridgeIoProtocolGuid, NULL, &PciRootBridgeIo); + if (EFI_ERROR(Status)) { + return Status; + } + + MePciPlatformInstance->PhaseNotify = PhaseNotify; + MePciPlatformInstance->PlatformPrepController = PlatformPrepController; + MePciPlatformInstance->GetPlatformPolicy = GetPlatformPolicy; + MePciPlatformInstance->GetPciRom = GetPciRom; + + // + // Install the EFI_MANAGEMENT_ENGINE_PROTOCOL interface + // + Status = gBS->InstallProtocolInterface ( + &ImageHandle, + &gEfiPciPlatformProtocolGuid, + EFI_NATIVE_INTERFACE, + MePciPlatformInstance + ); + + return Status; +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.cif b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.cif new file mode 100644 index 0000000..3b2bea3 --- /dev/null +++ b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.cif @@ -0,0 +1,12 @@ +<component> + name = "MePciPlatform" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\MePciPlatform" + RefName = "MePciPlatform" +[files] +"MePciPlatform.c" +"MePciPlatform.h" +"MePciPlatform.sdl" +"MePciPlatform.mak" +"MePciPlatform.dxs" +<endComponent> diff --git a/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.dxs b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.dxs new file mode 100644 index 0000000..1a16fc8 --- /dev/null +++ b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.dxs @@ -0,0 +1,98 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePciPlatform/MePciPlatform.dxs 1 2/08/12 1:05a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:05a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePciPlatform/MePciPlatform.dxs $ +// +// 1 2/08/12 1:05a Klzhan +// Initial Check in +// +// 1 2/25/11 1:41a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: MePciPlatform.dxs +// +// Description: +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +This file contains a 'Sample Driver' and is licensed as such +under the terms of your license agreement with Intel or your +vendor. This file may be modified by the user, subject to +the additional terms of the license agreement + +--*/ + +/*++ +Copyright (c) 2008 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePciPlatform.dxs + +Abstract: + + Dependency expression source file. + +--*/ + +#include "EfiDepex.h" +#include EFI_PROTOCOL_DEFINITION (Heci) +#include EFI_PROTOCOL_DEFINITION (PciRootBridgeIo) + +DEPENDENCY_START + EFI_HECI_PROTOCOL_GUID AND + EFI_PCI_ROOT_BRIDGE_IO_PROTOCOL_GUID +DEPENDENCY_END + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.h b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.h new file mode 100644 index 0000000..818c3dc --- /dev/null +++ b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.h @@ -0,0 +1,154 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePciPlatform/MePciPlatform.h 1 2/08/12 1:05a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:05a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePciPlatform/MePciPlatform.h $ +// +// 1 2/08/12 1:05a Klzhan +// Initial Check in +// +// 1 2/25/11 1:41a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: MePciPlatform.h +// +// Description: +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +This file contains a 'Sample Driver' and is licensed as such +under the terms of your license agreement with Intel or your +vendor. This file may be modified by the user, subject to +the additional terms of the license agreement + +--*/ + +/*++ +Copyright (c) 2008 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePciPlatform.h + +Abstract: + + +--*/ +#ifndef _DXE_ME_PCI_PLATFORM_H_ +#define _DXE_ME_PCI_PLATFORM_H_ + +#include "EdkIIGlueDxe.h" +#include "MeLib.h" + +#include EFI_PROTOCOL_PRODUCER (PciPlatform) +#include EFI_PROTOCOL_DEFINITION (PciRootBridgeIo) + +#define EFI_DRIVER_ENTRY_POINT(x) + +#define Flex0 (1 << 0) +#define Flex1 (1 << 1) +#define Flex2 (1 << 2) +#define Flex3 (1 << 3) +#define PCI_Clock0 (1 << 7) +#define PCI_Clock1 (1 << 8) +#define PCI_Clock2 (1 << 9) +#define PCI_Clock3 (1 << 10) +#define PCI_Clock4 (1 << 11) +#define SRC0 (1 << 16) +#define SRC1 (1 << 17) +#define SRC2 (1 << 18) +#define SRC3 (1 << 19) +#define SRC4 (1 << 20) +#define SRC5 (1 << 21) +#define SRC6 (1 << 22) +#define SRC7 (1 << 23) +#define CSI_SRC8 (1 << 24) +#define CSI_DP (1 << 25) +#define PEG_A (1 << 26) +#define PEG_B (1 << 27) +#define DMI (1 << 28) + +#define PCI_SKIP 0xFF +#define R_PCH_PCIE_SLSTS 0x5A + +typedef union _R_PCH_PCIE_SLSTS_VALUE { + UINT16 REG; + struct { + UINT16 ReservedBIT0 : 1; + UINT16 PFD : 1; + UINT16 MSC : 1; + UINT16 PDC : 1; + UINT16 ReservedBIT4 : 1; + UINT16 MS : 1; + UINT16 PDS : 1; + UINT16 ReservedBIT7 : 1; + UINT16 LASC : 1; + UINT16 Reserved : 7; + } Fields; +} R_PCH_PCIE_SLSTS_VALUE; + +typedef union _PCI_CFG_ADDR { + UINT64 ADDR; + EFI_PCI_ROOT_BRIDGE_IO_PROTOCOL_PCI_ADDRESS Addr; +} PCI_CFG_ADDR; + +typedef struct { + PCI_CFG_ADDR PciExpressBridgeAddress; + BOOLEAN HotPlugSupport; + UINT32 ClockEnables; +} PLATFORM_PCI_EXPRESS_BRIDGE; + +#endif + + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.mak b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.mak new file mode 100644 index 0000000..b9ea7e4 --- /dev/null +++ b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.mak @@ -0,0 +1,122 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePciPlatform/MePciPlatform.mak 3 9/27/12 4:52a Klzhan $ +# +# $Revision: 3 $ +# +# $Date: 9/27/12 4:52a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePciPlatform/MePciPlatform.mak $ +# +# 3 9/27/12 4:52a Klzhan +# [TAG] EIP102254 +# [Category] Spec Update +# [Severity] Important +# [Description] Update ME RC 0.7 +# +# 2 2/23/12 8:57a Klzhan +# Support New EDK +# +# 1 2/08/12 1:05a Klzhan +# Initial Check in +# +# 1 2/25/11 1:41a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:10a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: MePciPlatform.h +# +# Description: +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +All : MePciPlatform + +MePciPlatform : $(BUILD_DIR)\MePciPlatform.mak MePciPlatformBin + +$(BUILD_DIR)\MePciPlatform.mak : $(MePciPlatform_DIR)\$(@B).cif $(MePciPlatform_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(MePciPlatform_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +MePciPlatform_INCLUDES=\ + $(EDK_INCLUDES) \ + $(ME_INCLUDES) \ + $(MISCFRAMEWORK_INCLUDES) \ + $(NB_INCLUDES)\ + $(SB_INCLUDES)\ + $(EdkIIGlueLib_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + +MePciPlatform_LIBS=\ + $(EFIDRIVERLIB)\ + $(MeProtocolLib_LIB)\ + $(MeLibDxe_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueDxeMemoryAllocationLib_LIB)\ + $(EDKFRAMEWORKPROTOCOLLIB)\ + +DxeCpuBuildDefine = \ +!IF "$(x64_BUILD)"=="1" + /DMDE_CPU_X64\ +!ELSE + /DMDE_CPU_IA32\ +!ENDIF + +MePciPlatform_DEFINES = \ + $(DxeCpuBuildDefine)\ + +MePciPlatformBin : $(MePciPlatform_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\MePciPlatform.mak all\ + GUID=459C70C3-9344-4484-9F93-7822530D0D11\ + "MY_INCLUDES = $(MePciPlatform_INCLUDES)" \ + "MY_DEFINES=$(MePciPlatform_DEFINES)"\ + ENTRY_POINT=MePciPlatformEntryPoint\ + DEPEX1=$(MePciPlatform_DIR)\MePciPlatform.dxs\ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX\ + TYPE=BS_DRIVER\ + COMPRESS=1 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.sdl b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.sdl new file mode 100644 index 0000000..5c9f445 --- /dev/null +++ b/Board/EM/MeWrapper/MePciPlatform/MePciPlatform.sdl @@ -0,0 +1,24 @@ +TOKEN + Name = "MePciPlatform_SUPPORT" + Value = "1" + Help = "Main switch to enable MePciPlatform support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "MePciPlatform_DIR" +End + +MODULE + Help = "Includes MePciPlatform.mak to Project" + File = "MePciPlatform.mak" +End + +ELINK + Name = "$(BUILD_DIR)\MePciPlatform.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.c b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.c new file mode 100644 index 0000000..cdff1aa --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.c @@ -0,0 +1,692 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePlatformPolicy/MePlatformPolicy.c 14 5/14/14 10:33p Tristinchou $ +// +// $Revision: 14 $ +// +// $Date: 5/14/14 10:33p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePlatformPolicy/MePlatformPolicy.c $ +// +// 14 5/14/14 10:33p Tristinchou +// [TAG] EIPNone +// [Category] Improvement +// [Description] Load ICC library while using ME 9.1 +// +// 13 5/14/14 9:59p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 12 5/13/14 4:02a Tristinchou +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix BPF version check error while using MEBX 9.1 +// +// 11 7/11/13 5:50a Klzhan +// [TAG] EIP128534 +// [Category] Improvement +// [Description] Restore Logo after information shows +// +// 10 6/21/13 3:07a Klzhan +// [TAG] EIP127189 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 1.60 +// +// 9 5/13/13 2:39a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix build error when ICC_OVERCLOCKING_SUPPORT disabled. +// +// 8 12/07/12 5:12a Klzhan +// [TAG] EIP107613 +// [Category] Improvement +// [Description] Skip Send HECI protocol when Boot on Flash Update +// +// 7 12/04/12 5:56a Klzhan +// [TAG] EIP107309 +// [Category] New Feature +// [Description] Support ICC library for ME 9.5 +// [Files] MePlatformPolicy.c +// MePlatformPolicy.h +// MePlatformPolicy.sdl +// MePlatformPolicy.mak +// MePlatformPolicy.cif +// +// 6 9/27/12 4:49a Klzhan +// [TAG] EIP102254 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.7 +// +// 5 7/02/12 11:34p Klzhan +// [TAG] EIP94113 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.6 +// +// 4 5/14/12 4:40a Klzhan +// [TAG] EIP89952 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.56 +// [Files] MePlatformPolicy.c +// MePlatformPolicy.h +// MePlatformPolicy.sdl +// MePlatformPolicy.mak +// MePlatformPolicy.cif +// +// 3 4/23/12 11:13p Klzhan +// +// 2 4/03/12 8:11a Klzhan +// [TAG] EIP86914 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC. +// +// 1 2/08/12 1:04a Klzhan +// Initial Check in +// +// 10 9/26/11 5:46a Klzhan +// [TAG] EIP70516 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME 8.0 RC 0.8 +// +// 9 9/15/11 6:36a Klzhan +// [TAG] EIP65738 +// [Category] Improvement +// [Description] Disable SOL and IDER when AMT is disabled. +// +// 8 9/07/11 4:49a Klzhan +// Get thermal reporting data from HOB. +// +// 7 7/26/11 8:25a Klzhan +// [TAG] EIP64542 +// [Category] Improvement +// [Description] Replace Getvariable by GetSBSetupData +// +// 6 7/26/11 6:33a Klzhan +// Always_MeFwDowngrade +// +// 5 7/11/11 4:41a Klzhan +// Fix system can't boot on ME FW 1076. +// +// 4 7/08/11 9:14a Klzhan +// Restore to older ME Platform Policy module part. +// To fix system hangs with other modules. +// +// 3 7/08/11 4:20a Klzhan +// [TAG] EIP64189 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC to 0.7 +// [Files] MePlatformPolicy.c +// MePlatformPolicy.h +// MePlatformPolicy.sdl +// MePlatformPolicy.mak +// MePlatformPolicy.cif +// +// 2 4/18/11 9:47a Klzhan +// Improvement : Move ME FW downgrade related code to ME platform policy. +// Improvement : Update ME platform policy revision to 7. +// +// 1 2/25/11 1:41a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: MePlatformPolicy.c +// +// Description: +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +This file contains a 'Sample Driver' and is licensed as such +under the terms of your license agreement with Intel or your +vendor. This file may be modified by the user, subject to +the additional terms of the license agreement + +--*/ + +/*++ +Copyright (c) 2008 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePlatformPolicy.c + +Abstract: + + +--*/ +#include "EdkIIGlueDxe.h" +#include "MePlatformPolicy.h" +#include "MeSetup.h" +#include <SetupDataDefinition.h> +#include "MeChipsetLib.h" +#include <token.h> +#if IccOverClocking_SUPPORT +#include "IccProtocol.h" +#endif +DXE_ME_POLICY_PROTOCOL mDxePlatformMePolicy = { 0 }; +SETUP_DATA *gSetupData = NULL; +EFI_MEBX_API_ENTRY_POINT HookedMebxEntryPoint; + +#define ME_INFO_SETUP_GUID \ + {0x78259433, 0x7B6D, 0x4DB3, 0x9A, 0xE8, 0x36, 0xC4, 0xC2, 0xC3, 0xA1, 0x7D} + +EFI_GUID gSetupGuid = SETUP_GUID; +EFI_GUID gEfiFirmwareVolumeProtocolGuid = EFI_FIRMWARE_VOLUME_PROTOCOL_GUID; +EFI_GUID gMeSetupInfoGuid = ME_INFO_SETUP_GUID; +EFI_GUID gEfiMebxProtocolGuid = INTEL_MEBX_PROTOCOL_GUID; + +// +// Driver entry point +// +EFI_DRIVER_ENTRY_POINT (MePlatformPolicyEntryPoint) + +// +// Module Global Variable +// +//TR_CONFIG mTrConfig = { 0 }; + +// +// TS DIMM thermal polling Smbus Address. +// This is platform specific. +// +EFI_STATUS +HookMebxEntry ( + IN UINT32 BiosParams, + OUT UINT32 *MebxReturnValue +) +{ + MEBX_BPF *MebxBpf = NULL; + ME_BIOS_EXTENSION_SETUP *MebxSetup = NULL; + + MebxBpf = (MEBX_BPF*)BiosParams; + MebxSetup = (ME_BIOS_EXTENSION_SETUP*)MebxBpf->MeBiosSyncDataPtr; + + //Modify the BPF version before MEBX entry + MebxBpf->BpfVersion = 0xA000; + MebxSetup->InterfaceVersion = 0xA000; + + return HookedMebxEntryPoint( BiosParams, MebxReturnValue); +} + +VOID +MebxProtocolCallBack ( + IN EFI_EVENT Event, + IN VOID *Context +) +{ + EFI_STATUS Status; + EFI_MEBX_PROTOCOL *MebxProtocol = NULL; + + Status = gBS->LocateProtocol( + &gEfiMebxProtocolGuid, + NULL, + &MebxProtocol ); + if( EFI_ERROR(Status) ) + return; + + //If MEBX version is 10, hook the entry to modify the BPF version + if( (MebxProtocol->MebxVersion.Major == 10) ) + { + HookedMebxEntryPoint = MebxProtocol->CoreMebxEntry; + MebxProtocol->CoreMebxEntry = HookMebxEntry; + } + + gBS->CloseEvent( Event ); +} + +UINT8 mTsDimmSmbusAddress[] = { 0x30, 0x34 }; +EFI_STATUS +DummyHeciSendACK( + IN OUT UINT32 *Message, + IN OUT UINT32 Length, + IN OUT UINT32 *RecLength, + IN UINT8 HostAddress, + IN UINT8 MEAddress + ) +{ + return EFI_SUCCESS; +} +// +// Function implementations +// +EFI_STATUS +EFIAPI +MePlatformPolicyEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +/*++ + +Routine Description: + + Entry point for the Management Engine Driver. + +Arguments: + + ImageHandle Image handle of this driver. + SystemTable Global system service table. + +Returns: + + EFI_SUCCESS Initialization complete. + EFI_UNSUPPORTED The chipset is unsupported by this driver. + EFI_OUT_OF_RESOURCES Do not have enough resources to initialize the driver. + EFI_DEVICE_ERROR Device error, driver exits abnormally. + +--*/ +{ + EFI_STATUS Status; + SETUP_DATA SetupData; + UINT32 SetupVarAttr; + UINTN SetupVariableSize; + EFI_HECI_PROTOCOL *Heci; + UINT32 MeMode = ME_MODE_FAILED; + ME_INFO_SETUP_DATA MeInfoSetupData; + UINT8 Index = 0; + DXE_MBP_DATA_PROTOCOL *mBIOSPayLoad; + EFI_GUID gEfiHeciProtocolGuid = HECI_PROTOCOL_GUID; + EFI_GUID gDimmTsInfoGuid = DIMM_TS_INFO_GUID; + EFI_BOOT_MODE BootMode; + EFI_PEI_HOB_POINTERS HobList; + EFI_EVENT MebxProtocolEvent; + VOID *MebxProtocolReg = NULL; + + EfiInitializeDriverLib (ImageHandle, SystemTable); + Status = gBS->LocateProtocol ( + &gEfiHeciProtocolGuid, + NULL, + &Heci + ); + + if (EFI_ERROR(Status)) return EFI_SUCCESS; + + EfiGetSystemConfigurationTable (&gEfiHobListGuid, &HobList.Raw); + if (HobList.Header->HobType != EFI_HOB_TYPE_HANDOFF) { + DEBUG ((EFI_D_ERROR, "(Wdt) Handoff Hob missing!\n")); + return EFI_NOT_FOUND; + } + + BootMode = HobList.HandoffInformationTable->BootMode; + + if((BootMode == BOOT_ON_FLASH_UPDATE) || + (BootMode == BOOT_ASSUMING_NO_CONFIGURATION_CHANGES)) + { + // Install Dummy HECI protocol. + Heci->SendwACK = DummyHeciSendACK; + } + + + Status = Heci->GetMeMode (&MeMode); + // + // Default ME information for SETUP + // + MeInfoSetupData.MeFirmwareInfo = MeMode; + MeInfoSetupData.MeMajor = 0; + MeInfoSetupData.MeMinor = 0; + MeInfoSetupData.MeHotFix = 0; + MeInfoSetupData.MeBuildNo = 0; + // + // ME DXE Policy Init + // + mDxePlatformMePolicy.Revision = DXE_PLATFORM_ME_POLICY_PROTOCOL_REVISION_2; + + SetupVarAttr = 0; + SetupVariableSize = sizeof(SETUP_DATA); + Status = gRT->GetVariable ( + L"Setup", + &gSetupGuid, + &SetupVarAttr, + &SetupVariableSize, + &SetupData + ); + if(EFI_ERROR(Status)) + { + mDxePlatformMePolicy.MeConfig.MeFwDownGrade = 0; + SetupVarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_NON_VOLATILE; + } + + if(!EFI_ERROR(Status)) + { + // + // Initialzie the Me Configuration + // + mDxePlatformMePolicy.MeConfig.EndOfPostEnabled = 1; + mDxePlatformMePolicy.MeConfig.MeLocalFwUpdEnabled = 0; + mDxePlatformMePolicy.MeConfig.MdesForBiosState = SetupData.MDESForBiosState; + + // + // Please don't change the default value of EndOfPostDone, + // the value will be update to 1 after the moment EOP message should be sent + // + mDxePlatformMePolicy.MeConfig.EndOfPostDone = 0; + + + }else + { + // Default + mDxePlatformMePolicy.MeConfig.EndOfPostEnabled = 1; + mDxePlatformMePolicy.MeConfig.MeLocalFwUpdEnabled = 0; + } + + // + // Thermal reporting policy is based on strap settings + // + MmioAndThenOr32 ( + PCH_RCRB_BASE + R_PCH_SPI_FDOC, + (UINT32) (~(B_PCH_SPI_FDOC_FDSS_MASK | B_PCH_SPI_FDOC_FDSI_MASK)), + (UINT32) (V_PCH_SPI_FDOC_FDSS_PCHS | R_PCH_SPI_STRP15) + ); + mDxePlatformMePolicy.MeReportError = ShowMeReportError; + +// Debug UpdateDxeMePlatformPolicy (&mMeDxePlatformPolicy); + mDxePlatformMePolicy.MeConfig.MeFwDownGrade = SetupData.MeFwDowngrade; + // + // If Me Fw is in ME_MODE_SECOVER, we will clear "Simple Firmware Downgrade" BIOS setup options + // + if (MeMode == ME_MODE_SECOVER) { + SetupData.MeFwDowngrade = 0; + } + Status = gBS->LocateProtocol ( + &gMeBiosPayloadDataProtocolGuid, + NULL, + &mBIOSPayLoad + ); + if(!EFI_ERROR(Status)) + { + SetupData.MeImageType = (UINT8)mBIOSPayLoad->MeBiosPayload.FwPlatType.RuleData.Fields.IntelMeFwImageType; + SetupData.MeFirmwareInfo = MeMode; + + MeInfoSetupData.MeMajor = mBIOSPayLoad->MeBiosPayload.FwVersionName.MajorVersion; + MeInfoSetupData.MeMinor = mBIOSPayLoad->MeBiosPayload.FwVersionName.MinorVersion; + MeInfoSetupData.MeHotFix = mBIOSPayLoad->MeBiosPayload.FwVersionName.HotfixVersion; + MeInfoSetupData.MeBuildNo = mBIOSPayLoad->MeBiosPayload.FwVersionName.BuildVersion; + } +#if IccOverClocking_SUPPORT + if((MeInfoSetupData.MeMajor == 9) && (MeInfoSetupData.MeMinor == 5)) + { + EFI_GUID gIcc95Guid = ICC_9_5_GUID; + Status = gBS->InstallMultipleProtocolInterfaces ( + &ImageHandle, + &gIcc95Guid, + NULL, + NULL + ); + } + + if( (MeInfoSetupData.MeMajor == 9) && + ((MeInfoSetupData.MeMinor == 0) || (MeInfoSetupData.MeMinor == 1)) ) + { + EFI_GUID gIcc90Guid = ICC_9_0_GUID; + Status = gBS->InstallMultipleProtocolInterfaces ( + &ImageHandle, + &gIcc90Guid, + NULL, + NULL + ); + } +#endif + Status = gRT->SetVariable ( + L"MeInfoSetup", + &gMeSetupInfoGuid, + EFI_VARIABLE_BOOTSERVICE_ACCESS, + sizeof(MeInfoSetupData), + &MeInfoSetupData + ); + + Status = gRT->SetVariable ( + L"Setup", + &gSetupGuid, + SetupVarAttr, + sizeof(SETUP_DATA), + &SetupData + ); + + //Create the event for MEBX_PROTOCOL + Status = gBS->CreateEvent( + EFI_EVENT_NOTIFY_SIGNAL, + EFI_TPL_NOTIFY, + MebxProtocolCallBack, + NULL, + &MebxProtocolEvent ); + + Status = gBS->RegisterProtocolNotify( + &gEfiMebxProtocolGuid, + MebxProtocolEvent, + &MebxProtocolReg ); + + // + // Install protocol to to allow access to this Policy. + // + Status = gBS->InstallMultipleProtocolInterfaces ( + &ImageHandle, + &gDxePlatformMePolicyGuid, + &mDxePlatformMePolicy, + NULL + ); + ASSERT_EFI_ERROR (Status); + + return Status; +} +#include EFI_PROTOCOL_CONSUMER (ConsoleControl) +#include EFI_PROTOCOL_CONSUMER (GraphicsOutput) +EFI_CONSOLE_CONTROL_PROTOCOL *ConsoleControl; +EFI_GRAPHICS_OUTPUT_PROTOCOL *GraphicsOutput; +EFI_CONSOLE_CONTROL_SCREEN_MODE ScreenMode; +UINTN UgaBltSize = 0; +EFI_UGA_PIXEL *UgaBlt = NULL; +VOID +GraphicsSave +( + VOID +) +{ + EFI_STATUS + Status = gBS->LocateProtocol( &gEfiConsoleControlProtocolGuid, NULL, &ConsoleControl); + + if(EFI_ERROR(Status)) + { + ConsoleControl = NULL; + return; + } + + Status = ConsoleControl->GetMode(ConsoleControl, &ScreenMode, NULL, NULL); + if(ScreenMode == EfiConsoleControlScreenText) + { + ConsoleControl = NULL; + return; + } + + Status = gBS->LocateProtocol( &gEfiGraphicsOutputProtocolGuid, NULL, &GraphicsOutput); + if(EFI_ERROR(Status)) + { + GraphicsOutput = NULL; + return; + } + UgaBltSize = GraphicsOutput->Mode->Info[GraphicsOutput->Mode->Mode].HorizontalResolution * + GraphicsOutput->Mode->Info[GraphicsOutput->Mode->Mode].VerticalResolution * + sizeof(EFI_UGA_PIXEL); + + UgaBlt = AllocateZeroPool (UgaBltSize); + + Status = GraphicsOutput->Blt( + GraphicsOutput, + UgaBlt, + EfiBltVideoToBltBuffer, + 0, 0, + 0, 0, + GraphicsOutput->Mode->Info->HorizontalResolution, + GraphicsOutput->Mode->Info->VerticalResolution, + 0); + + Status = ConsoleControl->SetMode( ConsoleControl, EfiConsoleControlScreenText ); +} + +VOID +GraphicsRestore +( + VOID +) +{ + if(!ConsoleControl) + return; + + ConsoleControl->SetMode( ConsoleControl, EfiConsoleControlScreenGraphics ); + + if(!GraphicsOutput) + return; + + GraphicsOutput->Blt( + GraphicsOutput, + UgaBlt, + EfiBltBufferToVideo, + 0, 0, + 0, 0, + GraphicsOutput->Mode->Info->HorizontalResolution, + GraphicsOutput->Mode->Info->VerticalResolution, + 0); + +} +VOID +ShowMeReportError ( + IN ME_ERROR_MSG_ID MsgId + ) +/*++ + +Routine Description: + + Show Me Error message. + +Arguments: + + MsgId Me error message ID. + +Returns: + + None. + +--*/ +{ + UINTN MsgDelay; + + MsgDelay = HECI_MSG_DELAY; + GraphicsSave(); + gST->ConOut->ClearScreen (gST->ConOut); + + switch (MsgId) { + case MSG_EOP_ERROR: + gST->ConOut->OutputString (gST->ConOut, L"Error sending End Of Post message to ME, System HALT!\n"); + break; + + case MSG_ME_FW_UPDATE_FAILED: + gST->ConOut->OutputString (gST->ConOut, L"ME FW Update Failed, please try again!\n"); + break; + + case MSG_ASF_BOOT_DISK_MISSING: + gST->ConOut->OutputString (gST->ConOut, L"Boot disk missing, please insert boot disk and press ENTER\r\n"); + break; + + case MSG_KVM_TIMES_UP: + gST->ConOut->OutputString (gST->ConOut, L"Error!! Times up and the KVM session was cancelled!!"); + break; + + case MSG_KVM_REJECTED: + gST->ConOut->OutputString (gST->ConOut, L"Error!! The request has rejected and the KVM session was cancelled!!"); + break; + + case MSG_HMRFPO_LOCK_FAILURE: + gST->ConOut->OutputString (gST->ConOut, L"(A7) Me FW Downgrade - Request MeSpiLock Failed\n"); + break; + + case MSG_HMRFPO_UNLOCK_FAILURE: + gST->ConOut->OutputString (gST->ConOut, L"(A7) Me FW Downgrade - Request MeSpiEnable Failed\n"); + break; + + case MSG_ME_FW_UPDATE_WAIT: + gST->ConOut->OutputString ( + gST->ConOut, + L"Intel(R) Firmware Update is in progress. It may take up to 90 seconds. Please wait.\n" + ); + break; + + case MSG_ILLEGAL_CPU_PLUGGED_IN: + gST->ConOut->OutputString ( + gST->ConOut, + L"\n\n\rAn unsupported CPU/PCH configuration has been identified.\n" + ); + gST->ConOut->OutputString ( + gST->ConOut, + L"\rPlease refer to the Haswell Platform Validation Matrix\n\rfor supported CPU/PCH combinations." + ); + break; + + case MSG_KVM_WAIT: + gST->ConOut->OutputString (gST->ConOut, L"Waiting Up to 8 Minutes For KVM FW....."); + break; + + case MSG_PLAT_DISABLE_WAIT: + gST->ConOut->OutputString (gST->ConOut, L"WARNING! Firmware encountered errors and will reboot the platform in 30 minutes."); + MsgDelay = 5 * HECI_MSG_DELAY; + break; + + default: + DEBUG ((EFI_D_ERROR, "This Message Id hasn't been defined yet, MsgId = %x\n", MsgId)); + break; + } + + gBS->Stall (MsgDelay); + GraphicsRestore(); +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.cif b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.cif new file mode 100644 index 0000000..8db83d4 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.cif @@ -0,0 +1,13 @@ +<component> + name = "MePlatformPolicy" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\MePlatformPolicy" + RefName = "MePlatformPolicy" +[files] +"MePlatformPolicy.c" +"MePlatformPolicy.h" +"MePlatformPolicy.sdl" +"MePlatformPolicy.mak" +[parts] +"MePeiPolicyInit" +<endComponent> diff --git a/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.h b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.h new file mode 100644 index 0000000..f90a135 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.h @@ -0,0 +1,232 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePlatformPolicy/MePlatformPolicy.h 3 5/13/14 4:02a Tristinchou $ +// +// $Revision: 3 $ +// +// $Date: 5/13/14 4:02a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePlatformPolicy/MePlatformPolicy.h $ +// +// 3 5/13/14 4:02a Tristinchou +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix BPF version check error while using MEBX 9.1 +// +// 2 5/14/12 4:40a Klzhan +// [TAG] EIP89952 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.56 +// [Files] MePlatformPolicy.c +// MePlatformPolicy.h +// MePlatformPolicy.sdl +// MePlatformPolicy.mak +// MePlatformPolicy.cif +// +// 1 2/08/12 1:04a Klzhan +// Initial Check in +// +// 5 9/07/11 4:49a Klzhan +// Get thermal reporting data from HOB. +// +// 4 7/11/11 4:41a Klzhan +// Fix system can't boot on ME FW 1076. +// +// 3 7/08/11 9:14a Klzhan +// Restore to older ME Platform Policy module part. +// To fix system hangs with other modules. +// +// 2 7/08/11 4:20a Klzhan +// [TAG] EIP64189 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC to 0.7 +// [Files] MePlatformPolicy.c +// MePlatformPolicy.h +// MePlatformPolicy.sdl +// MePlatformPolicy.mak +// MePlatformPolicy.cif +// +// 1 2/25/11 1:41a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: MePlatformPolicy.h +// +// Description: +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +This file contains a 'Sample Driver' and is licensed as such +under the terms of your license agreement with Intel or your +vendor. This file may be modified by the user, subject to +the additional terms of the license agreement + +--*/ + +/*++ +Copyright (c) 2008 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePlatformPolicy.h + +Abstract: + + +--*/ +#ifndef _DXE_ME_PLATFORM_POLICY_H_ +#define _DXE_ME_PLATFORM_POLICY_H_ + +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGlueDxe.h" +#endif + +#include EFI_PROTOCOL_PRODUCER (MEPlatformPolicy) +#include "PchAccess.h" +#include "token.h" +#include "MeLib.h" +#include "HeciRegs.h" +#include "MeChipset.h" +// Debug #include "MePlatformPolicyUpdateDxeLib.h" + +#include EFI_PROTOCOL_DEFINITION (PciRootBridgeIo) +#include EFI_PROTOCOL_CONSUMER (MePlatformPolicy) +#include EFI_PROTOCOL_CONSUMER (MebxProtocol) +#include EFI_GUID_DEFINITION (MeBiosExtensionSetup) +#if EFI_SPECIFICATION_VERSION<=0x20000 +#include EFI_PROTOCOL_DEFINITION (Hii) +#include EFI_PROTOCOL_DEFINITION (FormCallBack) +#endif +#define EFI_DRIVER_ENTRY_POINT(x) + +#define DIMM_TS_INFO_GUID \ + { \ + 0xce673a28, 0x800d, 0x4b4a, 0x83, 0x16, 0x26, 0x61, 0xf9, 0xb3, 0xd9, 0xc6 \ + } + +#define HECI_MSG_DELAY 2000000 // show warning msg and stay for 2 seconds. +#ifndef GUID_VARIABLE_DECLARATION +#define GUID_VARIABLE_DECLARATION(Variable, Guid) extern EFI_GUID Variable +#endif +typedef struct{ + UINT8 MeFirmwareInfo; + UINT32 MeMajor; + UINT32 MeMinor; + UINT32 MeHotFix; + UINT32 MeBuildNo; +} ME_INFO_SETUP_DATA; +#ifndef TS_DIMM1_SMBUS_ADDRESS +#define TS_DIMM1_SMBUS_ADDRESS 0x30 +#endif + +#ifndef TS_DIMM2_SMBUS_ADDRESS +#define TS_DIMM2_SMBUS_ADDRESS 0x32 +#endif + +#ifndef TS_DIMM3_SMBUS_ADDRESS +#define TS_DIMM3_SMBUS_ADDRESS 0x34 +#endif + +#ifndef TS_DIMM4_SMBUS_ADDRESS +#define TS_DIMM4_SMBUS_ADDRESS 0x36 +#endif + +#define SETUP_GUID { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } + +typedef struct _MEBX_DEBUG_FLAGS_ { + UINT16 Port80 : 1; ///< Port 80h + UINT16 Rsvd : 15; ///< Reserved +} MEBX_DEBUG_FLAGS; + +typedef struct _MEBX_OEM_RESOLUTION_SETTINGS_ { + UINT16 MebxNonUiTextMode : 4; + UINT16 MebxUiTextMode : 4; + UINT16 MebxGraphicsMode : 4; + UINT16 Rsvd : 4; +} MEBX_OEM_RESOLUTION_SETTINGS; + +typedef struct { + UINT16 BpfVersion; + UINT8 CpuReplacementTimeout; + UINT8 Reserved[7]; + UINT8 ActiveRemoteAssistanceProcess; + UINT8 CiraTimeout; + UINT16 OemFlags; + MEBX_DEBUG_FLAGS MebxDebugFlags; + UINT32 MeBiosSyncDataPtr; + UINT32 UsbKeyDataStructurePtr; + MEBX_OEM_RESOLUTION_SETTINGS OemResolutionSettings; + UINT8 Reserved3[0x2E]; +} MEBX_BPF; + +VOID +EFIAPI +ShowMeReportError ( + IN ME_ERROR_MSG_ID MsgId + ) +/*++ + +Routine Description: + + Show Me Error message. + +Arguments: + + MsgId Me error message ID. + +Returns: + + None. + +--*/ +; +#endif + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.mak b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.mak new file mode 100644 index 0000000..21937b0 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.mak @@ -0,0 +1,139 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePlatformPolicy/MePlatformPolicy.mak 4 12/04/12 5:57a Klzhan $ +# +# $Revision: 4 $ +# +# $Date: 12/04/12 5:57a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePlatformPolicy/MePlatformPolicy.mak $ +# +# 4 12/04/12 5:57a Klzhan +# [TAG] EIP107309 +# [Category] New Feature +# [Description] Support ICC library for ME 9.5 +# [Files] MePlatformPolicy.c +# MePlatformPolicy.h +# MePlatformPolicy.sdl +# MePlatformPolicy.mak +# MePlatformPolicy.cif +# +# 3 4/23/12 11:13p Klzhan +# +# 2 2/23/12 8:56a Klzhan +# Support New EDK +# +# 1 2/08/12 1:04a Klzhan +# Initial Check in +# +# 5 9/07/11 4:49a Klzhan +# Get thermal reporting data from HOB. +# +# 4 7/26/11 8:23a Klzhan +# [TAG] EIP64542 +# [Category] Improvement +# [Description] Replace GetSbSetupData. +# +# 3 7/11/11 4:41a Klzhan +# Fix system can't boot on ME FW 1076. +# +# 2 7/08/11 4:20a Klzhan +# [TAG] EIP64189 +# [Category] Spec Update +# [Severity] Important +# [Description] Update ME RC to 0.7 +# [Files] MePlatformPolicy.c +# MePlatformPolicy.h +# MePlatformPolicy.sdl +# MePlatformPolicy.mak +# MePlatformPolicy.cif +# +# 1 2/25/11 1:41a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:09a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: MePlatformPolicy.mak +# +# Description: +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +All : MePlatformPolicy + +MePlatformPolicy : $(BUILD_DIR)\MePlatformPolicy.mak MePlatformPolicyBin + +$(BUILD_DIR)\MePlatformPolicy.mak : $(MePlatformPolicy_DIR)\$(@B).cif $(MePlatformPolicy_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(MePlatformPolicy_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +MePlatformPolicy_INCLUDES=\ + $(EdkIIGlueLib_INCLUDES)\ + $(ME_INCLUDES) \ + $(MISCFRAMEWORK_INCLUDES) \ + $(NB_INCLUDES)\ + $(SB_INCLUDES)\ + /I$(PROJECT_DIR)\ + /IInclude\ + /I$(IccOverClocking_DIR)\ + /I$(INTEL_COUGAR_POINT_INCLUDE_DIR) + +MePlatformPolicy_LIBS=\ + $(EdkIIGlueBaseLib_LIB)\ + $(EFIDRIVERLIB)\ + $(MeProtocolLib_LIB)\ + $(MeLibDxe_LIB)\ + $(MeChipsetDxeLib_LIB)\ + $(EdkIIGlueDxeMemoryAllocationLib_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + +MePlatformPolicyBin : $(MePlatformPolicy_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\MePlatformPolicy.mak all\ + GUID=BA67550C-3628-4137-A53E-42660E081604\ + "MY_INCLUDES = $(MePlatformPolicy_INCLUDES)" \ + ENTRY_POINT=MePlatformPolicyEntryPoint\ + TYPE=BS_DRIVER\ + COMPRESS=1 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.sdl b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.sdl new file mode 100644 index 0000000..4588fa3 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/MePlatformPolicy.sdl @@ -0,0 +1,24 @@ +TOKEN + Name = "MePlatformPolicy_SUPPORT" + Value = "1" + Help = "Main switch to enable MePlatformPolicy support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "MePlatformPolicy_DIR" +End + +MODULE + Help = "Includes MePlatformPolicy.mak to Project" + File = "MePlatformPolicy.mak" +End + +ELINK + Name = "$(BUILD_DIR)\MePlatformPolicy.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.c b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.c new file mode 100644 index 0000000..f534303 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.c @@ -0,0 +1,196 @@ +/*++ + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +--*/ + +/*++ + +Copyright (c) 1999 - 2010 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePeiPolicyInit.c + +Abstract: + + This file is SampleCode for Intel ME PEI Platform Policy initialzation. + +--*/ +#include <Token.h> +#include "MePeiPolicyInit.h" +#include <Ppi\PchPlatformPolicy\PchPlatformPolicy.h> +#include <SetupDataDefinition.h> + +#define SETUP_GUID { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } +static EFI_GUID gSetupGuid = SETUP_GUID; + + +// +// Function implementations +// +VOID +PrepareThermalHob ( + IN EFI_PEI_SERVICES **PeiServices +) +{ + EFI_STATUS Status; + EFI_HOB_GUID_TYPE *Hob; + UINT8 TsOnDimm[4]; + EFI_GUID gPchPolicyPpiGuid = PCH_PLATFORM_POLICY_PPI_GUID; + PCH_PLATFORM_POLICY_PPI *PchPlatformPolicy; + EFI_GUID gDimmTsInfoGuid = DIMM_TS_INFO_GUID; + + Status = (**PeiServices).LocatePpi (PeiServices, &gPchPolicyPpiGuid, 0, + NULL, (VOID **)&PchPlatformPolicy); + + if(EFI_ERROR(Status)) + { + return; + } + // Build the GUID'd HOB for DXE + Status = (*PeiServices)->CreateHob ( + PeiServices, + EFI_HOB_TYPE_GUID_EXTENSION, + (UINT16) (sizeof (EFI_HOB_GUID_TYPE) + 4), + &Hob + ); + + if (EFI_ERROR (Status))return; + + ((EFI_HOB_GUID_TYPE *)(Hob))->Name = gDimmTsInfoGuid; + + Hob++; + +//- TsOnDimm[0] = PchPlatformPolicy->ThermalReportConfig->ThermalReportControl->Dimm1TempReadEnable; +//- TsOnDimm[1] = PchPlatformPolicy->ThermalReportConfig->ThermalReportControl->Dimm2TempReadEnable; +//- TsOnDimm[2] = PchPlatformPolicy->ThermalReportConfig->ThermalReportControl->Dimm3TempReadEnable; +//- TsOnDimm[3] = PchPlatformPolicy->ThermalReportConfig->ThermalReportControl->Dimm4TempReadEnable; + + GlueCopyMem (Hob, TsOnDimm, sizeof(TsOnDimm)); + +} + +EFI_STATUS +MePeiPolicyInitEntryPoint ( + IN EFI_FFS_FILE_HEADER *FfsHeader, + IN EFI_PEI_SERVICES **PeiServices + ) +/*++ + +Routine Description: + + Initilize Intel ME PEI Platform Policy + +Arguments: + + FfsHeader Pointer to Firmware File System file header. + PeiServices General purpose services available to every PEIM. + +Returns: + + EFI_STATUS + +--*/ +{ + EFI_STATUS Status; + PEI_ME_PLATFORM_POLICY_PPI *MePlatformPolicyPpi; + EFI_PEI_PPI_DESCRIPTOR *MePlatformPolicyPpiDesc; + EFI_PEI_READ_ONLY_VARIABLE_PPI *VariableServices; + UINTN VariableSize; + SETUP_DATA SetupData; + + // + // Allocate descriptor and PPI structures + // + MePlatformPolicyPpi = (PEI_ME_PLATFORM_POLICY_PPI *) AllocateZeroPool (sizeof (PEI_ME_PLATFORM_POLICY_PPI)); + ASSERT (MePlatformPolicyPpi != NULL); + if (MePlatformPolicyPpi == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + MePlatformPolicyPpiDesc = (EFI_PEI_PPI_DESCRIPTOR *) AllocateZeroPool (sizeof (EFI_PEI_PPI_DESCRIPTOR)); + ASSERT (MePlatformPolicyPpiDesc != NULL); + if (MePlatformPolicyPpiDesc == NULL) { + return EFI_OUT_OF_RESOURCES; + } + + // + // Locate Variable Ppi + // + Status = (*PeiServices)->LocatePpi(PeiServices, + &gPeiReadOnlyVariablePpiGuid, + 0, + NULL, + &VariableServices); + + // + // Make sure we have a PPI, if not, just return. + // + if (!VariableServices) { + return EFI_UNSUPPORTED; + } + VariableSize = sizeof(SETUP_DATA); + // + // Get Setup Variable + // + Status = VariableServices->PeiGetVariable ( + PeiServices, + L"Setup", + &gSetupGuid, + NULL, + &VariableSize, + &SetupData); + + // + // Update Itnel PPT + // + if ( !EFI_ERROR(Status) ) { +#if IntelPTT_SUPPORT + MePlatformPolicyPpi->FTpmSwitch = SetupData.FTpmSwitch; +#else + MePlatformPolicyPpi->FTpmSwitch = 0; +#endif + } else { + MePlatformPolicyPpi->FTpmSwitch = 0; + } + + // + // Initialize the PPI + // + MePlatformPolicyPpiDesc->Flags = EFI_PEI_PPI_DESCRIPTOR_PPI | EFI_PEI_PPI_DESCRIPTOR_TERMINATE_LIST; + MePlatformPolicyPpiDesc->Guid = &gPeiMePlatformPolicyPpiGuid; + + // + // Update the REVISION number + // + MePlatformPolicyPpi->Revision = PEI_ME_PLATFORM_POLICY_PPI_REVISION_2; + + + // + // Initialize the Platform Configuration + // +// Debug UpdatePeiMePlatformPolicy (PeiServices, MePlatformPolicyPpi); + + MePlatformPolicyPpiDesc->Ppi = MePlatformPolicyPpi; + + /// + /// TBD put initialize codes in here if needs + /// + /// + /// Install the ME PEI Platform Policy PPI + /// + Status = (**PeiServices).InstallPpi (PeiServices, MePlatformPolicyPpiDesc); + ASSERT_PEI_ERROR (PeiServices, Status); + DEBUG ((EFI_D_INFO, "ME PEI Platform Policy PPI Installed\n")); + + return Status; +} diff --git a/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.cif b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.cif new file mode 100644 index 0000000..2c5d34f --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.cif @@ -0,0 +1,12 @@ +<component> + name = "MePeiPolicyInit" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\MePlatformPolicy\Pei" + RefName = "MePeiPolicyInit" +[files] +"MePeiPolicyInit.c" +"MePeiPolicyInit.h" +"MePeiPolicyInit.sdl" +"MePeiPolicyInit.mak" +"MePeiPolicyInit.dxs" +<endComponent> diff --git a/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.dxs b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.dxs new file mode 100644 index 0000000..01778d0 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.dxs @@ -0,0 +1,35 @@ +/*++ + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +--*/ + +/*++ + +Copyright (c) 1999 - 2010 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePeiPolicyInit.dxs + +Abstract: + + Dependency expression source file. + +--*/ + +#include "EfiDepex.h" +#include <Ppi\PchPlatformPolicy\PchPlatformPolicy.h> +DEPENDENCY_START + PCH_PLATFORM_POLICY_PPI_GUID +DEPENDENCY_END + + diff --git a/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.h b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.h new file mode 100644 index 0000000..5d64667 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.h @@ -0,0 +1,64 @@ +/*++ + This file contains a 'Sample Driver' and is licensed as such + under the terms of your license agreement with Intel or your + vendor. This file may be modified by the user, subject to + the additional terms of the license agreement +--*/ + +/*++ + +Copyright (c) 1999 - 2010 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MePeiPolicyInit.h + +Abstract: + + Header file for the MePeiPolicyInit PEIM. + +--*/ +#ifndef _ME_PEI_PLATFORM_POLICY_H_ +#define _ME_PEI_PLATFORM_POLICY_H_ + +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGluePeim.h" +#endif + +#include EFI_PPI_DEFINITION (MePlatformPolicyPei) +// Debug #include "MePlatformPolicyUpdatePeiLib.h" +#define DIMM_TS_INFO_GUID \ + { \ + 0xce673a28, 0x800d, 0x4b4a, 0x83, 0x16, 0x26, 0x61, 0xf9, 0xb3, 0xd9, 0xc6 \ + } + +EFI_STATUS +MePeiPolicyInitEntryPoint ( + IN EFI_FFS_FILE_HEADER *FfsHeader, + IN EFI_PEI_SERVICES **PeiServices + ) +/*++ + +Routine Description: + + Initilize Intel ME PEI Platform Policy + +Arguments: + + FfsHeader Pointer to Firmware File System file header. + PeiServices General purpose services available to every PEIM. + +Returns: + + EFI_STATUS + +--*/ +; +#endif diff --git a/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.mak b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.mak new file mode 100644 index 0000000..4a097e0 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.mak @@ -0,0 +1,111 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* + +#********************************************************************** +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePlatformPolicy/MePeiPolicyInit/MePeiPolicyInit.mak 2 2/23/12 8:56a Klzhan $ +# +# $Revision: 2 $ +# +# $Date: 2/23/12 8:56a $ +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MePlatformPolicy/MePeiPolicyInit/MePeiPolicyInit.mak $ +# +# 2 2/23/12 8:56a Klzhan +# Support New EDK +# +# 1 2/08/12 1:05a Klzhan +# Initial Check in +# +# 1 3/29/11 4:53a Klzhan +# +# 1 2/25/11 1:45a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:11a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +#<AMI_FHDR_START> +# +# Name: AmtPlatformPolicy.mak +# +# Description: +# +#<AMI_FHDR_END> +#********************************************************************** +All : MEPeiPolicyInit + +MEPeiPolicyInit : $(BUILD_DIR)\MEPeiPolicyInit.mak MEPeiPolicyInitBin + +$(BUILD_DIR)\MEPeiPolicyInit.mak : $(MEPeiPlatformPolicy_DIR)\$(@B).cif $(MEPeiPlatformPolicy_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(MEPeiPlatformPolicy_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +MEPeiPlatformPolicy_INCLUDES=\ + $(EDK_INCLUDES)\ + $(EdkIIGlueLib_INCLUDES)\ + $(ME_INCLUDES)\ + $(INTEL_PCH_INCLUDES) + + +MEPeiPlatformPolicy_DEFINES=$(MY_DEFINES)\ + /D "__EDKII_GLUE_MODULE_ENTRY_POINT__=MePeiPolicyInitEntryPoint" \ + /D __EDKII_GLUE_BASE_LIB__ \ + /D __EDKII_GLUE_BASE_MEMORY_LIB__ \ + /D __EDKII_GLUE_PEI_DEBUG_LIB_REPORT_STATUS_CODE__ \ + /D __EDKII_GLUE_PEI_REPORT_STATUS_CODE_LIB__ \ + /D __EDKII_GLUE_PEI_SERVICES_LIB__ \ + /D __EDKII_GLUE_PEI_MEMORY_ALLOCATION_LIB__ \ + +MEPeiPlatformPolicy_LIBS=\ + $(EDKPROTOCOLLIB)\ + $(EdkIIGlueBaseLib_LIB)\ + $(EdkIIGlueBaseLibIA32_LIB)\ + $(EdkIIGlueBaseIoLibIntrinsic_LIB)\ + $(EdkIIGluePeiDebugLibReportStatusCode_LIB)\ + $(EdkIIGluePeiReportStatusCodeLib_LIB)\ + $(EdkIIGluePeiServicesLib_LIB)\ + $(MeLibPpi_LIB)\ + $(EdkIIGluePeiHobLib_LIB)\ + $(EdkIIGluePeiMemoryAllocationLib_LIB)\ + $(PEILIB) + +MEPeiPolicyInitBin : $(MEPeiPlatformPolicy_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDKIIGLUE_DEFAULTS)\ + /f $(BUILD_DIR)\MEPeiPolicyInit.mak all\ + GUID=12C67BE1-AD2E-4f13-A95F-6EDC2C4392DE\ + "MY_INCLUDES = $(MEPeiPlatformPolicy_INCLUDES)" \ + "MY_DEFINES=$(MEPeiPlatformPolicy_DEFINES)"\ + ENTRY_POINT=MePeiPolicyInitEntryPoint\ + TYPE=PEIM\ + EDKIIModule=PEIM\ + DEPEX1=$(MEPeiPlatformPolicy_DIR)\MEPeiPolicyInit.dxs\ + DEPEX1_TYPE=EFI_SECTION_PEI_DEPEX\ + COMPRESS=0 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.sdl b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.sdl new file mode 100644 index 0000000..ff7d692 --- /dev/null +++ b/Board/EM/MeWrapper/MePlatformPolicy/Pei/MePeiPolicyInit.sdl @@ -0,0 +1,25 @@ +TOKEN + Name = "MEPeiPlatformPolicy_SUPPORT" + Value = "1" + Help = "Main switch to enable AmtPlatformPolicy support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "MEPeiPlatformPolicy_DIR" +End + +MODULE + Help = "Includes AmtPlatformPolicy.mak to Project" + File = "MEPeiPolicyInit.mak" +End + +ELINK + Name = "$(BUILD_DIR)\MEPeiPolicyInit.ffs" + Parent = "FV_BB" + InvokeOrder = AfterParent +End + diff --git a/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.c b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.c new file mode 100644 index 0000000..e9525c8 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.c @@ -0,0 +1,171 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/Dxe/MeSetupDxe.c 5 5/14/14 10:01p Tristinchou $ +// +// $Revision: 5 $ +// +// $Date: 5/14/14 10:01p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/Dxe/MeSetupDxe.c $ +// +// 5 5/14/14 10:01p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 4 3/14/13 2:39a Klzhan +// Modify for PTT check +// +// 2 2/23/13 1:27a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Return SUCCESS in entry point. +// +// 1 2/07/13 2:04a Klzhan +// [TAG] EIP114344 +// [Category] Improvement +// [Description] Create a setup item for TPM Device Selection +// [Files] MeSetupDxe.cif +// MeSetupDxe.c +// MeSetupDxe.h +// MeSetupDxe.sdl +// MeSetupDxe.dxs +// MeSetupDxe.mak +// +// +//********************************************************************** +#include "MeSetupDxe.h" + +EFI_STATUS +MeSetupDxeEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + EFI_STATUS Status; + UINT32 SetupVarAttr; + UINT32 PttInfoVarAttr; + UINTN VariableSize; + EFI_GUID SetupGuid = SYSTEM_CONFIGURATION_GUID; + EFI_GUID PttInfoVariableGuid = PTT_INFO_VARIABLE_GUID; + SETUP_DATA gSetupData; + PTT_INFO_VARIABLE_DATA gPttInfoVariable; + PCH_SERIES PchSeries = GetPchSeries(); + + DEBUG ((EFI_D_INFO, "[MeSetupDxe.c] : Entry Point...\n")); + + if ( PchSeries != PchLp ) { + return EFI_SUCCESS; + } + + PttInfoVarAttr = 0; + VariableSize = sizeof (PTT_INFO_VARIABLE_DATA); + Status = gRT->GetVariable ( + L"PttInfoVariable", + &PttInfoVariableGuid, + &PttInfoVarAttr, + &VariableSize, + &gPttInfoVariable ); + if( EFI_ERROR(Status) ) + PttInfoVarAttr = EFI_VARIABLE_NON_VOLATILE | EFI_VARIABLE_BOOTSERVICE_ACCESS; + + PttHeciGetCapability(&gPttInfoVariable.PTTCapability); + PttHeciGetState(&gPttInfoVariable.PTTState); + + Status = gRT->SetVariable ( + L"PttInfoVariable", + &PttInfoVariableGuid, + PttInfoVarAttr, + VariableSize, + &gPttInfoVariable + ); + + if ( EFI_ERROR (Status) ) { + DEBUG((EFI_D_INFO, "[MeSetupDxe.c] : Failed to Set PttInfoVariable Status = %x\n", Status)); + return EFI_SUCCESS; + } + + SetupVarAttr = 0; + VariableSize = sizeof (SETUP_DATA); + Status = gRT->GetVariable( + L"Setup", + &SetupGuid, + &SetupVarAttr, + &VariableSize, + &gSetupData ); + + if ( gPttInfoVariable.PTTCapability ) { + if ( (gSetupData.TpmDeviceSelectionUpdate == 1) && (gPttInfoVariable.PTTState != gSetupData.TpmDeviceSelection) ) { + if ( gSetupData.TpmDeviceSelection == 1 ) { + PttHeciSetState(TRUE); + } else { + PttHeciSetState(FALSE); + } + gSetupData.TpmDeviceSelectionUpdate = 0; + + Status = gRT->SetVariable( + L"Setup", + &SetupGuid, + SetupVarAttr, + VariableSize, + &gSetupData ); + + Status = HeciSendCbmResetRequest (CBM_RR_REQ_ORIGIN_BIOS_POST, CBM_HRR_GLOBAL_RESET); + if( !EFI_ERROR(Status) ) { + EFI_DEADLOOP(); + } + } + } + + if ( gPttInfoVariable.PTTState ) { + gSetupData.TpmDeviceSelection = 1; + } else { + gSetupData.TpmDeviceSelection = 0; + } + + Status = gRT->SetVariable( + L"Setup", + &SetupGuid, + SetupVarAttr, + VariableSize, + &gSetupData ); + + if ( EFI_ERROR (Status) ) { + DEBUG((EFI_D_INFO, "[MeSetupDxe.c] : Failed to Set SetupVariable Status = %x\n", Status)); + return EFI_SUCCESS; + } + + DEBUG ((EFI_D_INFO, "[MeSetupDxe.c] : Entry End...\n")); + + return EFI_SUCCESS; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.cif b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.cif new file mode 100644 index 0000000..7835bf7 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.cif @@ -0,0 +1,12 @@ +<component> + name = "MeSetupDxe" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\MeSetup\Dxe" + RefName = "MeSetupDxe" +[files] +"MeSetupDxe.c" +"MeSetupDxe.h" +"MeSetupDxe.sdl" +"MeSetupDxe.dxs" +"MeSetupDxe.mak" +<endComponent> diff --git a/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.dxs b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.dxs new file mode 100644 index 0000000..e6a5140 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.dxs @@ -0,0 +1,68 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/Dxe/MeSetupDxe.dxs 1 2/07/13 2:04a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/07/13 2:04a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/Dxe/MeSetupDxe.dxs $ +// +// 1 2/07/13 2:04a Klzhan +// [TAG] EIP114344 +// [Category] Improvement +// [Description] Create a setup item for TPM Device Selection +// [Files] MeSetupDxe.cif +// MeSetupDxe.c +// MeSetupDxe.h +// MeSetupDxe.sdl +// MeSetupDxe.dxs +// MeSetupDxe.mak +// +// +//********************************************************************** +#include "AutoGen.h" +#include "DxeDepex.h" +#if defined (BUILD_WITH_GLUELIB) || defined (BUILD_WITH_EDKII_GLUE_LIB) +#include "EfiDepex.h" + +#include EFI_PROTOCOL_DEFINITION (Heci) +#include EFI_ARCH_PROTOCOL_DEFINITION (Variable) +#include EFI_PROTOCOL_DEFINITION (PchReset) + +#endif + +DEPENDENCY_START + EFI_HECI_PROTOCOL_GUID AND + PCH_RESET_PROTOCOL_GUID AND + EFI_VARIABLE_ARCH_PROTOCOL_GUID +DEPENDENCY_END +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.h b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.h new file mode 100644 index 0000000..eca06b6 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.h @@ -0,0 +1,79 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/Dxe/MeSetupDxe.h 2 3/01/13 3:13a Klzhan $ +// +// $Revision: 2 $ +// +// $Date: 3/01/13 3:13a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/Dxe/MeSetupDxe.h $ +// +// 2 3/01/13 3:13a Klzhan +// +// 1 2/07/13 2:04a Klzhan +// [TAG] EIP114344 +// [Category] Improvement +// [Description] Create a setup item for TPM Device Selection +// [Files] MeSetupDxe.cif +// MeSetupDxe.c +// MeSetupDxe.h +// MeSetupDxe.sdl +// MeSetupDxe.dxs +// MeSetupDxe.mak +// +// +//********************************************************************** +#ifndef _MeSetupDxe_H_ +#define _MeSetupDxe_H_ + +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGlueDxe.h" +#include "PttHciDeviceDxeLib.h" +#include "PttHeciDxeLib.h" +#include "PchAccess.h" +#include "PchPlatformLib.h" +#include "MELib.h" +#include <token.h> + +#include <SetupDataDefinition.h> +#define SYSTEM_CONFIGURATION_GUID { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } +#endif + +typedef struct { + BOOLEAN PTTCapability; + BOOLEAN PTTState; +} PTT_INFO_VARIABLE_DATA; + +#define PTT_INFO_VARIABLE_GUID \ + {0x9e6eae27, 0xc452, 0x49e6, 0x99, 0xd9, 0xb4, 0x5d, 0x1c, 0xf9, 0x1c, 0x5a} + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.mak b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.mak new file mode 100644 index 0000000..7a5ba6e --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.mak @@ -0,0 +1,126 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/Dxe/MeSetupDxe.mak 2 3/01/13 3:13a Klzhan $ +# +# $Revision: 2 $ +# +# $Date: 3/01/13 3:13a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/Dxe/MeSetupDxe.mak $ +# +# 2 3/01/13 3:13a Klzhan +# +# 1 2/07/13 2:04a Klzhan +# [TAG] EIP114344 +# [Category] Improvement +# [Description] Create a setup item for TPM Device Selection +# [Files] MeSetupDxe.cif +# MeSetupDxe.c +# MeSetupDxe.h +# MeSetupDxe.sdl +# MeSetupDxe.dxs +# MeSetupDxe.mak +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: MeSetupDxe.mak +# +# Description: Makfile for ME Setup Dxe module. +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +all : MeSetupDxe + +MeSetupDxe : $(BUILD_DIR)\MeSetupDxe.mak MeSetupDxe_Bin + +$(BUILD_DIR)\MeSetupDxe.mak : $(ME_SETUP_DXE_PATH)\$(@B).cif $(ME_SETUP_DXE_PATH)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(ME_SETUP_DXE_PATH)\$(@B).cif $(CIF2MAK_DEFAULTS) + +MeSetupDxe_INCLUDES=\ + $(EdkIIGlueLib_INCLUDES)\ + $(EDK_INCLUDES)\ + $(ME_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + +MeSetupDxe_LIBS=\ + $(EDKPROTOCOLLIB)\ + $(EFIGUIDLIB)\ + $(EdkIIGlueBaseLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EDKFRAMEWORKGUIDLIB)\ + $(EDKFRAMEWORKPROTOCOLLIB)\ + $(EdkIIGlueBaseIoLibIntrinsic_LIB)\ + $(EdkIIGlueBaseMemoryLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeServicesTableLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueUefiBootServicesTableLib_LIB)\ + $(EdkIIGlueUefiDevicePathLib_LIB)\ + $(EdkIIGlueBasePciLibPciExpress_LIB)\ + $(EdkIIGlueEdkDxeRuntimeDriverLib_LIB)\ + $(EdkIIGlueDxeHobLib_LIB)\ + $(PttDxe_LIB)\ + $(PttHeciDxeLib_LIB)\ + $(MeLibDxe_LIB)\ + $(PchPlatformDxeLib_LIB)\ + +MeSetupDxe_DEFINES=\ + $(MY_DEFINES)\ + /D"__EDKII_GLUE_MODULE_ENTRY_POINT__=MeSetupDxeEntryPoint"\ + /D __EDKII_GLUE_BASE_MEMORY_LIB__ \ + /D __EDKII_GLUE_DXE_REPORT_STATUS_CODE_LIB__ \ + /D __EDKII_GLUE_DXE_DEBUG_LIB_REPORT_STATUS_CODE__ \ + /D __EDKII_GLUE_UEFI_BOOT_SERVICES_TABLE_LIB__\ + /D __EDKII_GLUE_BASE_IO_LIB_INTRINSIC__ \ + /D __EDKII_GLUE_DXE_SERVICES_TABLE_LIB__ \ + /D __EDKII_GLUE_DXE_HOB_LIB__ \ + +MeSetupDxe_Bin : $(MeSetupDxe_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDKIIGLUE_DEFAULTS)\ + /f $(BUILD_DIR)\MeSetupDxe.mak all\ + "MY_INCLUDES=$(MeSetupDxe_INCLUDES)"\ + "MY_DEFINES=$(MeSetupDxe_DEFINES)"\ + GUID=D27AC0E1-D553-4c59-BCFE-89E5FFE9BEA6 \ + ENTRY_POINT=_ModuleEntryPoint \ + EDKIIModule=DXEDRIVER\ + TYPE=BS_DRIVER \ + DEPEX1=$(ME_SETUP_DXE_PATH)\MeSetupDxe.dxs \ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + COMPRESS=1\ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.sdl b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.sdl new file mode 100644 index 0000000..88b0f63 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/Dxe/MeSetupDxe.sdl @@ -0,0 +1,27 @@ + +TOKEN + Name = "ME_SETUP_DXE_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + TargetH = Yes + Master = Yes + Help = "Main switch to enable MeSetupDxe support in DXE Phase" + Token = "IntelPTT_SUPPORT" "=" "1" +End + +MODULE + File = "MeSetupDxe.mak" + Help = "Includes MeSetupDxe.mak to Project" +End + +PATH + Name = "ME_SETUP_DXE_PATH" +End + +ELINK + Name = "$(BUILD_DIR)\MeSetupDxe.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/MeSetup/MeSetup.c b/Board/EM/MeWrapper/MeSetup/MeSetup.c new file mode 100644 index 0000000..74efeca --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MeSetup.c @@ -0,0 +1,263 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetup.c 3 11/02/14 9:48p Tristinchou $ +// +// $Revision: 3 $ +// +// $Date: 11/02/14 9:48p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetup.c $ +// +// 3 11/02/14 9:48p Tristinchou +// [TAG] EIP189985 +// [Category] Improvement +// [Description] For ME 9.1.20.1035, add NFC related option in setup +// +// 2 2/20/13 10:50p Klzhan +// [TAG] EIP114344 +// [Category] Improvement +// [Description] Update PTT capability / State information in Setup. +// +// 1 2/08/12 1:04a Klzhan +// Initial Check in +// +// 1 2/25/11 1:41a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: MeSetup.c +// +// Description: Setup hooks for MeSetup module. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ +Copyright (c) 2008-2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MeSetup.c + +Abstract: + + +--*/ +#include <Setup.h> +#include <SetupStrTokens.h> +#include <AmiDxeLib.h> +#if EFI_SPECIFICATION_VERSION>0x20000 +#include <Protocol\HiiDatabase.h> +#include <Protocol\HiiString.h> +#else +#include <Protocol/Hii.h> +#endif +#include "MeSetup.h" +#if NFC_SUPPORT_DXE_SUPPORT == 1 +#include "NfcSupportDxe\NfcSupportDxe.h" +#endif + +typedef struct{ + UINT8 MeFirmwareInfo; + UINT32 MeMajor; + UINT32 MeMinor; + UINT32 MeHotFix; + UINT32 MeBuildNo; +} ME_INFO_SETUP_DATA; + +#define ME_INFO_SETUP_GUID \ + {0x78259433, 0x7B6D, 0x4DB3, 0x9A, 0xE8, 0x36, 0xC4, 0xC2, 0xC3, 0xA1, 0x7D} + +typedef struct{ + BOOLEAN PTTCapability; + BOOLEAN PTTState; +} PTT_INFO_VARIABLE_DATA; + +#define PTT_INFO_VARIABLE_GUID \ + {0x9e6eae27, 0xc452, 0x49e6, 0x99, 0xd9, 0xb4, 0x5d, 0x1c, 0xf9, 0x1c, 0x5a} + +EFI_GUID PttInfoVariableGuid = PTT_INFO_VARIABLE_GUID; +PTT_INFO_VARIABLE_DATA gPttInfoVariable; + +EFI_GUID gMeInfoSetupGuid = ME_INFO_SETUP_GUID; +EFI_GUID gSetupGuid = SETUP_GUID; +ME_INFO_SETUP_DATA mMeInfoSetupData; +SETUP_DATA gSetupData; + +VOID InitMeInfo(EFI_HII_HANDLE HiiHandle) +{ + EFI_STATUS Status; + UINTN VariableSize; + UINT8 *MeFwSkuValue; + CHAR16 String[0x100]; + UINTN StringLength; +#if EFI_SPECIFICATION_VERSION>0x20000 +static EFI_HII_STRING_PROTOCOL *HiiString=NULL; +static EFI_HII_DATABASE_PROTOCOL *HiiDatabase=NULL; +#else + EFI_GUID guidHII = EFI_HII_PROTOCOL_GUID; + EFI_HII_PROTOCOL *Hii = NULL; +#endif + STRING_REF MeMode[] = { + STRING_TOKEN(STR_ME_NORMAL_MODE), +#ifdef Ibexpeak_SUPPORT + STRING_TOKEN(STR_ME_IGNITION), +#else + STRING_TOKEN(STR_ME_FAILED), +#endif + STRING_TOKEN(STR_ME_ALT_DISABLED), + STRING_TOKEN(STR_ME_TEMP_DISABLED), + STRING_TOKEN(STR_ME_SECOVER), + STRING_TOKEN(STR_ME_FAILED), + + }; + UINT8 *FwMeSku[] = { + STR_ME_FW_SKU_1_5MB, + STR_ME_FW_SKU_5MB, + STR_ME_FW_SKU_UNIDENTIFIED + }; +#if NFC_SUPPORT_DXE_SUPPORT == 1 + EFI_GUID NfcSupportDataGuid = NFC_SUPPORT_DATA_GUID; + NFC_SUPPORT_DATA NfcSupportData; +#endif + // + // Set default string size assumption at no more than 256 bytes + // + StringLength = 0x100; +#if EFI_SPECIFICATION_VERSION<=0x20000 + pBS->LocateProtocol(&guidHII, NULL, &Hii); +#endif + VariableSize = sizeof(ME_INFO_SETUP_DATA); + Status = pRS->GetVariable( + L"MeInfoSetup", + &gMeInfoSetupGuid, + NULL, + &VariableSize, + &mMeInfoSetupData + ); + if (EFI_ERROR(Status)) return; + + InitString( + HiiHandle,STRING_TOKEN(STR_ME_FW_VERSION_VALUE), + L"%d.%d.%d.%d", + mMeInfoSetupData.MeMajor,mMeInfoSetupData.MeMinor, + mMeInfoSetupData.MeHotFix,mMeInfoSetupData.MeBuildNo + ); + + VariableSize = sizeof (PTT_INFO_VARIABLE_DATA); + Status = pRS->GetVariable ( + L"PttInfoVariable", + &PttInfoVariableGuid, + NULL, + &VariableSize, + &gPttInfoVariable + ); + + if (!EFI_ERROR(Status)) + { + InitString( + HiiHandle,STRING_TOKEN(STR_PTT_CAPABILITY_STATE_VALUE), + L"%d / %d", + gPttInfoVariable.PTTCapability,gPttInfoVariable.PTTState + ); + } + +#if NFC_SUPPORT_DXE_SUPPORT == 1 + VariableSize = sizeof(NFC_SUPPORT_DATA); + Status = pRS->GetVariable( + L"NfcSupportData", + &NfcSupportDataGuid, + NULL, + &VariableSize, + &NfcSupportData ); + if( !EFI_ERROR(Status) ) + { + if( NfcSupportData.NFCCapability == 1 ) + InitString( HiiHandle, STRING_TOKEN(STR_NFC_SUPPORT_VALUE), L"Enabled" ); + else + InitString( HiiHandle, STRING_TOKEN(STR_NFC_SUPPORT_VALUE), L"Disabled" ); + } +#endif + + +#if EFI_SPECIFICATION_VERSION>0x20000 + Status = HiiLibGetString( + HiiHandle, MeMode[(mMeInfoSetupData.MeFirmwareInfo & ME_MODE_MASK)], + &StringLength, String); +#else + Status = Hii->GetString(Hii, HiiHandle, MeMode[(mMeInfoSetupData.MeFirmwareInfo & ME_MODE_MASK)], FALSE, NULL, &StringLength, String); +#endif + InitString( + HiiHandle,STRING_TOKEN(STR_ME_FW_INFO_VALUE), + L"%s", + String + ); + + VariableSize = sizeof(SETUP_DATA); + Status = pRS->GetVariable( + L"Setup", + &gSetupGuid, + NULL, + &VariableSize, + &gSetupData + ); + ASSERT_EFI_ERROR(Status); + + if (gSetupData.MeImageType == ME_IMAGE_1_5MB_FW) { + MeFwSkuValue = FwMeSku[0]; + } else if (gSetupData.MeImageType == ME_IMAGE_5MB_FW) { + MeFwSkuValue = FwMeSku[1]; + } else { + MeFwSkuValue = FwMeSku[2]; + } + InitString ( + HiiHandle, + STRING_TOKEN (STR_ME_FW_SKU_VALUE), + L"%S", + MeFwSkuValue + ); + +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/MeSetup.cif b/Board/EM/MeWrapper/MeSetup/MeSetup.cif new file mode 100644 index 0000000..d7e4b42 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MeSetup.cif @@ -0,0 +1,18 @@ +<component> + name = "MeSetup" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\MeSetup" + RefName = "MeSetup" +[files] +"MeSetup.sdl" +"MeSetup.mak" +"MeSetup.sd" +"MeSetup.uni" +"MeSetup.c" +"MeSetup.h" +"MebxPrompt.c" +"MeSetupReset.c" +[parts] +"MeSetupDxe" +"NfcSupportDxe" +<endComponent> diff --git a/Board/EM/MeWrapper/MeSetup/MeSetup.h b/Board/EM/MeWrapper/MeSetup/MeSetup.h new file mode 100644 index 0000000..0a27a88 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MeSetup.h @@ -0,0 +1,113 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetup.h 1 2/08/12 1:04a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:04a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetup.h $ +// +// 1 2/08/12 1:04a Klzhan +// Initial Check in +// +// 1 2/25/11 1:41a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: MeSetup.h +// +// Description: Header file for MeSetup module. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +This file contains a 'Sample Driver' and is licensed as such +under the terms of your license agreement with Intel or your +vendor. This file may be modified by the user, subject to +the additional terms of the license agreement + +--*/ + +/*++ +Copyright (c) 2009 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + MeSetup.h + +Abstract: + + +--*/ +#ifndef __ME_SETUP_H__ +#define __ME_SETUP_H__ + +#ifdef __cplusplus +extern "C" { +#endif + +#define ME_MODE_MASK 0x0F + +#define NORMAL_MODE 0x00 +#define QUALIFIER_MODE 0xE0 +#define LOCAL_FW_UPD_MODE 0xF0 + +#define TEMP_DISABLE_MODE 0x03 +#define ME_IMAGE_1_5MB_FW 0x03 +#define ME_IMAGE_5MB_FW 0x04 + +#define STR_ME_FW_SKU_1_5MB "1.5MB" +#define STR_ME_FW_SKU_5MB "5MB" +#define STR_ME_FW_SKU_UNIDENTIFIED "Unidentified" + +/****** DO NOT WRITE BELOW THIS LINE *******/ +#ifdef __cplusplus +} +#endif +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/MeSetup.mak b/Board/EM/MeWrapper/MeSetup/MeSetup.mak new file mode 100644 index 0000000..c012aff --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MeSetup.mak @@ -0,0 +1,130 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetup.mak 3 3/01/13 3:11a Klzhan $ +# +# $Revision: 3 $ +# +# $Date: 3/01/13 3:11a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetup.mak $ +# +# 3 3/01/13 3:11a Klzhan +# [TAG] EIPNone +# [Category] Improvement +# [Description] Fix ICBO project build error. +# [Files] MeSetup.sdl +# MeSetup.mak +# MeSetup.sd +# MeSetup.uni +# MeSetup.c +# MeSetup.h +# MebxPrompt.c +# MeSetupReset.c +# MeSetup.cif +# +# 2 2/07/13 3:24a Klzhan +# +# 1 2/08/12 1:04a Klzhan +# Initial Check in +# +# 6 9/06/11 3:51a Klzhan +# Read key by RegisterKeyNofity. +# +# 5 6/28/11 2:41a Klzhan +# Fix build error when iAMT_Support is off. +# +# 4 6/20/11 8:17a Klzhan +# Not Show Remote Assistance message when SOL and KVM. +# +# 3 6/20/11 4:18a Klzhan +# Support Remote assistance hot key detect. +# +# 2 5/23/11 8:42a Klzhan +# Support CTRL + P check. +# +# 1 2/25/11 1:41a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:09a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: Me Setup.mak +# +# Description: Makfile for ME Setup module. +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +All : MeSetup + +MeSetup : $(BUILD_DIR)\MeSetup.mak + +SetupSdbs : $(BUILD_DIR)\MeSetup.sdb + +$(BUILD_DIR)\MeSetup.sdb : $(ME_SETUP_DIR)\$(@B).sd $(ME_SETUP_DIR)\$(@B).uni + $(STRGATHER) -i INCLUDE -parse -newdb -db $(BUILD_DIR)\$(@B).sdb $(ME_SETUP_DIR)\$(@B).uni + $(STRGATHER) -scan -db $(BUILD_DIR)\$(@B).sdb -od $(BUILD_DIR)\$(@B).sdb $(ME_SETUP_DIR)\$(@B).sd + +$(BUILD_DIR)\MeSetup.mak : $(ME_SETUP_DIR)\$(@B).cif $(ME_SETUP_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(ME_SETUP_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +SetupBin : $(BUILD_DIR)\MeSetup.obj + +$(BUILD_DIR)\MeSetup.obj : $(PROJECT_DIR)\$(ME_SETUP_DIR)\MeSetup.c $(BUILD_DIR)\SetupStrTokens.h + $(CC) $(CFLAGS) /Fo$(BUILD_DIR)\ $(ME_SETUP_DIR)\MeSetup.c + +!IF DEFINED(IntelPTT_SUPPORT) && "$(IntelPTT_SUPPORT)" == "1" +SetupData : $(BUILD_DIR)\MebxPrompt.obj $(BUILD_DIR)\MeSetupReset.obj +!ELSE +SetupData : $(BUILD_DIR)\MebxPrompt.obj +!ENDIF + +MebxPrompt_CFLAGS=$(CFLAGS) \ + -I $(TSEBIN_DIR)\Inc \ + -I $(TSEBIN_DIR)\ + -I ReferenceCode\ME\Protocol\ +!IF DEFINED(AmtWrapper_SUPPORT) && "$(AmtWrapper_SUPPORT)" == "1" + -I $(AmtWrapperProtocolLib_DIR)\ +!ENDIF + -I $(MeGuidLib_DIR)\ + $(ME_INCLUDES) + +$(BUILD_DIR)\MebxPrompt.obj : $(ME_SETUP_DIR)\MebxPrompt.c + $(CC) $(MebxPrompt_CFLAGS) /Fo$(BUILD_DIR)\ $(ME_SETUP_DIR)\MebxPrompt.c + +$(BUILD_DIR)\MeSetupReset.obj : $(ME_SETUP_DIR)\MeSetupReset.c + $(CC) $(MebxPrompt_CFLAGS) /Fo$(BUILD_DIR)\ $(ME_SETUP_DIR)\MeSetupReset.c +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/MeSetup/MeSetup.sd b/Board/EM/MeWrapper/MeSetup/MeSetup.sd new file mode 100644 index 0000000..ab985af --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MeSetup.sd @@ -0,0 +1,309 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetup.sd 7 11/02/14 9:47p Tristinchou $ +// +// $Revision: 7 $ +// +// $Date: 11/02/14 9:47p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetup.sd $ +// +// 7 11/02/14 9:47p Tristinchou +// [TAG] EIP189985 +// [Category] Improvement +// [Description] For ME 9.1.20.1035, add NFC related option in setup +// +// 6 3/14/13 2:37a Klzhan +// Add PTT setup itrem default value. +// +// 5 3/01/13 3:11a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix ICBO project build error. +// [Files] MeSetup.sdl +// MeSetup.mak +// MeSetup.sd +// MeSetup.uni +// MeSetup.c +// MeSetup.h +// MebxPrompt.c +// MeSetupReset.c +// MeSetup.cif +// +// 4 2/07/13 1:57a Klzhan +// [TAG] EIP114334 +// [Category] Improvement +// [Description] Create a setup item for TPM Device Selection +// [Files] MeSetup.sdl +// MeSetup.mak +// MeSetup.sd +// MeSetup.uni +// MeSetup.c +// MeSetup.h +// MebxPrompt.c +// MeSetup.cif +// +// 3 11/20/12 4:32a Klzhan +// Add Setup Item for Ftpm +// +// 2 4/23/12 11:09p Klzhan +// +// 1 2/08/12 1:04a Klzhan +// Initial Check in +// +// 1 2/25/11 1:41a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: Me Setup.sd +// +// Description: Setup for ME Setup. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#ifdef SETUP_DATA_DEFINITION +/***********************************************************/ +/* Put NVRAM data definitions here. +/* For example: UINT8 Data1; +/* These definitions will be converted by the build process +/* to a definitions of SETUP_DATA fields. +/***********************************************************/ + + UINT8 MeFirmwareInfo; + UINT8 MeImageType; + UINT8 MeFwDowngrade; + UINT8 LocalFwUpdEnabled; + UINT8 LocalFwQualifier; + UINT8 MebxType; + UINT8 MDESForBiosState; + UINT8 FTpmSwitch; + UINT8 TpmDeviceSelection; + UINT8 TpmDeviceSelectionUpdate; +#endif + +#ifdef CONTROL_DEFINITION + #define MESETUP_GOTO_PCHFWCONFIG\ + goto ME_FORM_ID,\ + prompt = STRING_TOKEN(STR_ME_FORM),\ + help = STRING_TOKEN(STR_ME_FORM_HELP); + +#if defined NFC_SUPPORT_DXE_SUPPORT && NFC_SUPPORT_DXE_SUPPORT == 1 + #define NFC_STATE \ + oneof varid = NFC_SUPPORT_DATA.NFCEnable, \ + prompt = STRING_TOKEN(STR_NFC_STATE_PROMPT), \ + help = STRING_TOKEN(STR_NFC_STATE_HELP), \ + default = DEFAULT_NFC_SETTING,\ + option text = STRING_TOKEN(STR_DISABLED_STRING), value = 0, flags = MANUFACTURING | RESET_REQUIRED; \ + option text = STRING_TOKEN(STR_ENABLED_STRING), value = 1, flags = RESET_REQUIRED; \ + endoneof; +#endif + +#endif +//********************************************************************** +// Advanced - ME Configuration Form +//********************************************************************** + +#ifdef ADVANCED_FORM_SET + +#ifdef FORM_SET_TYPEDEF + #include <MeSetup.h> +#if defined NFC_SUPPORT_DXE_SUPPORT && NFC_SUPPORT_DXE_SUPPORT == 1 + #include "NfcSupportDxe.h" +#endif +#endif + +#ifdef FORM_SET_VARSTORE +#if defined NFC_SUPPORT_DXE_SUPPORT && NFC_SUPPORT_DXE_SUPPORT == 1 + varstore NFC_SUPPORT_DATA, + key = AUTO_ID(NFC_SUPPORT_DATA_ID), + name = NfcSupportData, + guid = NFC_SUPPORT_DATA_GUID; +#endif +#endif + + #ifdef FORM_SET_GOTO + // Define goto commands for the forms defined in this file + MESETUP_GOTO_PCHFWCONFIG + #endif + + #ifdef FORM_SET_FORM + // Define forms + #ifndef ME_FORM_SETUP + #define ME_FORM_SETUP + + form formid = AUTO_ID(ME_FORM_ID), + title = STRING_TOKEN(STR_ME_FORM); + + text + help = STRING_TOKEN(STR_ME_FW_VERSION_HELP), + text = STRING_TOKEN(STR_ME_FW_VERSION_PROMPT), + text = STRING_TOKEN(STR_ME_FW_VERSION_VALUE), + flags = 0, + key = 0; + + suppressif + NOT ideqval SETUP_DATA.MeFirmwareInfo == 0xFF; + + INVENTORY(STRING_TOKEN(STR_ME_FW_INFO_PROMPT),STRING_TOKEN(STR_ME_NORMAL_MODE)) + INVENTORY(STRING_TOKEN(STR_ME_FW_INFO_PROMPT),STRING_TOKEN(STR_ME_ALT_DISABLED)) + INVENTORY(STRING_TOKEN(STR_ME_FW_INFO_PROMPT),STRING_TOKEN(STR_ME_TEMP_DISABLED)) + INVENTORY(STRING_TOKEN(STR_ME_FW_INFO_PROMPT),STRING_TOKEN(STR_ME_SECOVER)) + INVENTORY(STRING_TOKEN(STR_ME_FW_INFO_PROMPT),STRING_TOKEN(STR_ME_FAILED)) + endif; + + text + help = STRING_TOKEN(STR_ME_FW_INFO_HELP), + text = STRING_TOKEN(STR_ME_FW_INFO_PROMPT), + text = STRING_TOKEN(STR_ME_FW_INFO_VALUE), + flags = 0, + key = 0; + + suppressif + NOT ideqval SETUP_DATA.MeFirmwareInfo == QUALIFIER_MODE + AND NOT ideqval SETUP_DATA.MeFirmwareInfo == LOCAL_FW_UPD_MODE; + text + help = STRING_TOKEN(STR_ME_FW_TYPE_HELP), + text = STRING_TOKEN(STR_ME_FW_TYPE_PROMPT), + text = STRING_TOKEN(STR_ME_FW_TYPE_MIN), + flags = 0, + key = 0; + endif; + + suppressif + ideqval SETUP_DATA.MeFirmwareInfo == QUALIFIER_MODE + AND ideqval SETUP_DATA.MeFirmwareInfo == LOCAL_FW_UPD_MODE; + text + help = STRING_TOKEN(STR_ME_FW_TYPE_HELP), + text = STRING_TOKEN(STR_ME_FW_TYPE_PROMPT), + text = STRING_TOKEN(STR_ME_FW_TYPE_NORMAL), + flags = 0, + key = 0; + endif; + + + text + help = STRING_TOKEN(STR_ME_FW_SKU_HELP), + text = STRING_TOKEN(STR_ME_FW_SKU_PROMPT), + text = STRING_TOKEN(STR_ME_FW_SKU_VALUE), + flags = 0, + key = 0; +#if IntelPTT_SUPPORT + suppressif ideqval SB_PLATFORM_DATA.LPTType == 0; + text + help = STRING_TOKEN(STR_PTT_CAPABILITY_STATE_HELP), + text = STRING_TOKEN(STR_PTT_CAPABILITY_STATE_PROMPT), + text = STRING_TOKEN(STR_PTT_CAPABILITY_STATE_VALUE), + flags = 0, + key = 0; + endif; +#endif + +#if defined NFC_SUPPORT_DXE_SUPPORT && NFC_SUPPORT_DXE_SUPPORT == 1 + text + help = STRING_TOKEN(STR_NFC_SUPPORT_PROMPT), + text = STRING_TOKEN(STR_NFC_SUPPORT_HELP), + text = STRING_TOKEN(STR_NFC_SUPPORT_VALUE); + + suppressif ideqval NFC_SUPPORT_DATA.NFCCapability == 0; + grayoutif ideqval NFC_SUPPORT_DATA.MeSupportNFC == 0; + NFC_STATE + SUPPRESS_GRAYOUT_ENDIF +#endif + + suppressif NOT ideqval SETUP_DATA.MeImageType == ME_IMAGE_1_5MB_FW; + oneof varid = SETUP_DATA.MebxType, + prompt = STRING_TOKEN(STR_MEBX_TYPE_PROMPT), + help = STRING_TOKEN(STR_MEBX_TYPE_HELP), + option text = STRING_TOKEN(STR_MEBX_TYPE_NONE), value = 0, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0; + option text = STRING_TOKEN(STR_MEBX_TYPE_MEBX), value = 1, flags = RESET_REQUIRED, key = 0; + endoneof; + endif; + +#if MdesStatusCode_SUPPORT + oneof varid = SETUP_DATA.MDESForBiosState, + prompt = STRING_TOKEN(STR_MDES_STATUS_PROMPT), + help = STRING_TOKEN(STR_MDES_STATUS_HELP), + option text = STRING_TOKEN(STR_DISABLED_STRING), value = 0, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0; + option text = STRING_TOKEN(STR_ENABLED_STRING), value = 1, flags = RESET_REQUIRED, key = 0; + endoneof; +#endif + +#if IntelPTT_SUPPORT + suppressif ideqval SB_PLATFORM_DATA.LPTType == 0; + oneof varid = SETUP_DATA.FTpmSwitch, + prompt = STRING_TOKEN(STR_FTPMSWITCH_STATUS_PROMPT), + help = STRING_TOKEN(STR_FTPMSWITCH_STATUS_HELP), + option text = STRING_TOKEN(STR_GPDMA_STRING), value = 0, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0; + option text = STRING_TOKEN(STR_MSFT_STRING), value = 1, flags = RESET_REQUIRED, key = 0; + endoneof; + + oneof varid = SETUP_DATA.TpmDeviceSelection, + prompt = STRING_TOKEN(STR_TPMDEVICE_SELECTION_PROMPT), + help = STRING_TOKEN(STR_TPMDEVICE_SELECTION_HELP), + default = DefaultTpmDeviceSelection, + option text = STRING_TOKEN(STR_DTPM_STRING), value = 0, flags = RESET_REQUIRED, key = 0; + option text = STRING_TOKEN(STR_PTT_STRING), value = 1, flags = MANUFACTURING | RESET_REQUIRED, key = 0; + endoneof; + endif; +#endif + + goto ME_FW_UPGRADE_ID, + prompt = STRING_TOKEN(STR_FW_UPGRADE_FORM), + help = STRING_TOKEN(STR_FW_UPGRADE_FORM_HELP); + + endform; + + form formid = AUTO_ID(ME_FW_UPGRADE_ID), + title = STRING_TOKEN(STR_FW_UPGRADE_FORM); + + grayoutif ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + oneof varid = SETUP_DATA.MeFwDowngrade, + prompt = STRING_TOKEN(STR_AMT_ME_FW_DOWNGRADE_PROMPT), + help = STRING_TOKEN(STR_AMT_ME_FW_DOWNGRADE_HELP), + option text = STRING_TOKEN(STR_DISABLED), value = 0, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0; + option text = STRING_TOKEN(STR_ENABLED), value = 1, flags = RESET_REQUIRED, key = 0; + endoneof; + endif; + + endform; + #endif // ME_FW_UPGRADE_FORM_SETUP + #endif +#endif // ADVANCED_FORM_SET + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/MeSetup.sdl b/Board/EM/MeWrapper/MeSetup/MeSetup.sdl new file mode 100644 index 0000000..8742e82 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MeSetup.sdl @@ -0,0 +1,192 @@ +TOKEN + Name = "ME_Setup" + Value = "1" + Help = "Main switch to enable ME Setup support in Project" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes +End + +TOKEN + Name = "CIRA_SUPPORT" + Value = "1" + Help = "Enable Disable CIRA" + TokenType = Boolean + TargetH = Yes + Token = "iAMT_SUPPORT" "=" "1" +End + +TOKEN + Name = "MEBX_SCANCODE" + Value = "0" + Help = "The scancode of MEBX in Project" + TokenType = Integer + TargetH = Yes +End + +TOKEN + Name = "MEBX_UNICODE" + Value = "0x50" + Help = "The unicode of MEBX in Project" + TokenType = integer + TargetH = Yes +End + +TOKEN + Name = "MEBX_KeyShiftState" + Value = "RIGHT_CONTROL_PRESSED | LEFT_CONTROL_PRESSED | SHIFT_STATE_VALID" + Help = "The KeyShiftState of MEBX in Project" + TokenType = Expression + TargetH = Yes +End + +TOKEN + Name = "MEBX_KeyToggleState" + Value = "0" + Help = "The KeyToggleState of MEBX in Project" + TokenType = integer + TargetH = Yes +End + +TOKEN + Name = "CIRA_SCANCODE" + Value = "EFI_SCAN_F1" + Help = "The scancode value of CIRA in Project" + TokenType = Expression + TargetH = Yes + Token = "CIRA_SUPPORT" "=" "1" +End + +TOKEN + Name = "CIRA_UNICODE" + Value = "0" + Help = "The unicode value of CIRA in Project" + TokenType = integer + TargetH = Yes + Token = "CIRA_SUPPORT" "=" "1" +End + +TOKEN + Name = "CIRA_KeyShiftState" + Value = "RIGHT_CONTROL_PRESSED | LEFT_CONTROL_PRESSED | SHIFT_STATE_VALID | RIGHT_ALT_PRESSED | LEFT_ALT_PRESSED" + Help = "The KeyShiftState of CIRA in Project" + TokenType = Expression + TargetH = Yes + Token = "CIRA_SUPPORT" "=" "1" +End + +TOKEN + Name = "CIRA_KeyToggleState" + Value = "0" + Help = "The KeyToggleState of CIRA in Project" + TokenType = integer + TargetH = Yes + Token = "CIRA_SUPPORT" "=" "1" +End + +TOKEN + Name = "DefaultTpmDeviceSelection" + Value = "1" + Help = "dTpm set to 0, PTT set to 1 for default setup setting" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + TargetH = Yes +End + +PATH + Name = "ME_SETUP_DIR" +End + +MODULE + Help = "Includes MeSetup.mak to Project" + File = "MeSetup.mak" +End + +ELINK + Name = "$(BUILD_DIR)\MeSetup.sdb" + Parent = "SETUP_SDBS" + Priority = 30 + Help = "Includes generic ME setup screens to the project" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(ME_SETUP_DIR)\MeSetup.sd" + Parent = "SETUP_DEFINITIONS" + Priority = 30 + InvokeOrder = AfterParent +End + +ELINK + Name = "/I$(ME_SETUP_DIR)" + Parent = "ME_INCLUDES" + InvokeOrder = AfterParent +End + +ELINK + Name = "-i $(ME_SETUP_DIR)" + Parent = "SETUP_VFR_INCLUDES" + InvokeOrder = AfterParent +End + +ELINK + Name = "InitMeInfo," + Parent = "SetupStringInit" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\MebxPrompt.obj" + Parent = "AMITSE_Objects" + InvokeOrder = AfterParent +End + +ELINK + Name = "MebxPromptConInAvailabilityHook," + Parent = "ProcessConInAvailabilityHook," + InvokeOrder = AfterParent +End + +ELINK + Name = "RemoteAssistConInAvailabilityHook," + Parent = "ProcessConInAvailabilityHook," + InvokeOrder = AfterParent + Token = "CIRA_SUPPORT" "=" "1" +End + +ELINK + Name = "MEProcessEnterSetup," + Parent = "ProcessEnterSetup," + InvokeOrder = AfterParent +End + +ELINK + Name = "MEProcessEnterSetup," + Parent = "BeforeEfiBootLaunchHook," + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\MeSetupReset.obj" + Parent = "AMITSE_Objects" + InvokeOrder = AfterParent + Token = "IntelPTT_SUPPORT" "=" "1" +End + +ELINK + Name = "MeSetupProcessEnterSetupForPTT," + Parent = "ProcessEnterSetup," + InvokeOrder = AfterParent + Token = "IntelPTT_SUPPORT" "=" "1" +End + +ELINK + Name = "MeSetupResetHookForPTT," + Parent = "PreSystemResetHook," + Priority = 60 + InvokeOrder = AfterParent + Token = "IntelPTT_SUPPORT" "=" "1" +End + diff --git a/Board/EM/MeWrapper/MeSetup/MeSetup.uni b/Board/EM/MeWrapper/MeSetup/MeSetup.uni Binary files differnew file mode 100644 index 0000000..feae8ed --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MeSetup.uni diff --git a/Board/EM/MeWrapper/MeSetup/MeSetupReset.c b/Board/EM/MeWrapper/MeSetup/MeSetupReset.c new file mode 100644 index 0000000..3e8e13d --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MeSetupReset.c @@ -0,0 +1,156 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetupReset.c 2 5/14/14 10:02p Tristinchou $ +// +// $Revision: 2 $ +// +// $Date: 5/14/14 10:02p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MeSetupReset.c $ +// +// 2 5/14/14 10:02p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 1 2/07/13 1:59a Klzhan +// [TAG] EIP114334 +// [Category] Improvement +// [Description] Create a setup item for TPM Device Selection +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: MeSetupReset.c +// +// Description: Setup hooks for MeSetup module. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include <Token.h> +#include <Setup.h> +#include <AmiLib.h> +#include <AmiDxeLib.h> +#include <AmiCSPLib.h> + +//---------------------------------------------------------------------------- +// Variable and External Declaration(s) +//---------------------------------------------------------------------------- +// Variable Declaration(s) +static SETUP_DATA gNewSetupData; +static SETUP_DATA gOldSetupData; + +// GUID Definition(s) +static EFI_GUID gEfiSetupGuid = SETUP_GUID; + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: MeSetupProcessEnterSetupForPTT +// +// Description: This function is a hook called when TSE determines +// that it has to load the boot options in the boot +// order. This function is available as ELINK. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +MeSetupProcessEnterSetupForPTT ( + VOID +) +{ + EFI_STATUS Status; + UINT32 VarAttr; + UINTN VariableSize; + + VariableSize = sizeof (SETUP_DATA); + Status = pRS->GetVariable( + L"Setup", + &gEfiSetupGuid, + &VarAttr, + &VariableSize, + &gOldSetupData ); + return; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: MeSetupResetHookForPTT +// +// Description: This function is a hook called after some control +// modified in the setup utility by user. This +// function is available as ELINK. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +MeSetupResetHookForPTT ( + VOID +) +{ + EFI_STATUS Status; + UINT32 VarAttr; + UINTN VariableSize; + + VariableSize = sizeof (SETUP_DATA); + Status = pRS->GetVariable( + L"Setup", + &gEfiSetupGuid, + &VarAttr, + &VariableSize, + &gNewSetupData ); + + if ( !EFI_ERROR (Status) ) { + if (gNewSetupData.TpmDeviceSelection != gOldSetupData.TpmDeviceSelection) { + gNewSetupData.TpmDeviceSelectionUpdate = 1; + + Status = pRS->SetVariable ( + L"Setup", + &gEfiSetupGuid, + VarAttr, + VariableSize, + &gNewSetupData ); + } + } + + return; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/MebxPrompt.c b/Board/EM/MeWrapper/MeSetup/MebxPrompt.c new file mode 100644 index 0000000..aaa2635 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/MebxPrompt.c @@ -0,0 +1,520 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2011, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MebxPrompt.c 5 11/06/12 5:34a Klzhan $ +// +// $Revision: 5 $ +// +// $Date: 11/06/12 5:34a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/MebxPrompt.c $ +// +// 5 11/06/12 5:34a Klzhan +// Improvement : Support MEBX full screen when enable Hot key pressed in +// AMT setup page. +// Fix : Sometimes Mebx not full screen(CreateEvent) +// +// 4 10/04/12 8:43a Klzhan +// [TAG] EIP102464 +// [Category] Improvement +// [Description] Make Mebx setup full screen. +// +// 3 9/19/12 5:51a Klzhan +// Read MEFwType from Setup Variable. +// +// 2 4/23/12 11:09p Klzhan +// +// 1 2/08/12 1:04a Klzhan +// Initial Check in +// +// 12 10/04/11 5:22a Klzhan +// Fix build error when iAMT_SUPPORT is disabled. +// +// 11 9/27/11 5:41a Klzhan +// Add Tokens for Hot key detected. +// +// 10 9/07/11 4:54a Klzhan +// Remove keynotify when entering Setup. +// +// 9 9/06/11 3:51a Klzhan +// Read key by RegisterKeyNofity. +// +// 8 7/19/11 4:41a Klzhan +// Skip MEBX detect when SOL and KVM is running. +// +// 7 7/19/11 1:49a Klzhan +// [TAG] EIP62343 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] Can't Enter MEBX when S4 resume +// [RootCause] BIOS block CTRL + P +// +// 6 6/28/11 7:46a Klzhan +// Fix Remote Assistance can't work property. +// +// 5 6/28/11 2:39a Klzhan +// Fix build error when iAMT_Support is off. +// +// 4 6/20/11 8:19a Klzhan +// Not Show Remote Assistance message when SOL and KVM. +// +// 3 6/20/11 4:20a Klzhan +// 1. Support Remote assistance hot key detect. +// 2. Not prompt CTRL + P when S4 resume. +// +// 2 5/26/11 2:36a Klzhan +// No Prompt Press CTRL + P to enter MEBX message with 1.5M ME. +// +// 1 5/24/11 4:38a Klzhan +// Support Mebx prompt. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//--------------------------------------------------------------------------- +// Name: MebxPrompt.c +// +// Description: AMT TSE Functions. +// +//--------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include <Setup.h> +#include "variable.h" +#include "AmiDxeLib.h" +#include "Protocol\ConsoleControl.h" +#include "Protocol\SimpleTextInEx.h" +#include "AmtPlatformPolicy\AmtPlatformPolicy.h" +#include "MeBiosExtensionSetup\MeBiosExtensionSetup.h" +#include "MeBiosPayloadData\MeBiosPayloadData.h" +#include "Heci\Heci.h" + +#if defined iAMT_SUPPORT && iAMT_SUPPORT == 1 +#include "AmtWrapper\AmtWrapper.h" +#endif +extern EFI_STATUS PostManagerDisplayPostMessage( CHAR16 *message ); + +extern EFI_BOOT_SERVICES *gBS; +extern EFI_SYSTEM_TABLE *gST; +extern EFI_RUNTIME_SERVICES *gRT; +ME_BIOS_EXTENSION_SETUP MeBiosExtensionSetupData; + +EFI_HANDLE MebxKeyHandle[2]; +EFI_HANDLE CIRAKeyHandle[2]; +DXE_AMT_POLICY_PROTOCOL *mDxePlatformAmtPolicy = NULL; +EFI_GUID gDxePlatformAmtPolicyGuid = DXE_PLATFORM_AMT_POLICY_GUID; +#define EFI_EVENT_ME_PLATFORM_READY_TO_BOOT \ + { \ + 0x3fdf171, 0x1d67, 0x4ace, 0xa9, 0x4, 0x3e, 0x36, 0xd3, 0x38, 0xfa, 0x74 \ + } +EFI_GUID gMePlatformReadyToBootGuid = EFI_EVENT_ME_PLATFORM_READY_TO_BOOT; +//<AMI_PHDR_START> +//******************************************************************************* +// Procedure: SetConsoleControlModeBack +// +// Description: Set to GraphicMode +// +// Input: Event +// Context +// +// Output: VOID +// +//******************************************************************************* +//<AMI_PHDR_END> +EFI_STATUS +SetConsoleControlModeBack( + EFI_EVENT Event, + VOID *ParentImageHandle +) +{ + + EFI_STATUS Status; + EFI_CONSOLE_CONTROL_PROTOCOL *ConsoleControl; + + Status = gBS->LocateProtocol( &gEfiConsoleControlProtocolGuid, NULL, &ConsoleControl); + + //Set back to Graphics + Status = ConsoleControl->SetMode( ConsoleControl, EfiConsoleControlScreenGraphics ); + + gBS->CloseEvent(Event); + return Status; +} + +//<AMI_PHDR_START> +//******************************************************************************* +// Procedure: CIRACheckForKey +// +// Description: +// +// Input: Event: Timer event. +// Context: Event context; always NULL +// +// Output: VOID +// +//******************************************************************************* +//<AMI_PHDR_END> +EFI_STATUS CIRACheckForKey +( + IN EFI_KEY_DATA *Key +) +{ +#if CIRA_SCANCODE + EFI_SIMPLE_TEXT_INPUT_EX_PROTOCOL *SimpleTextInEX; + EFI_STATUS Status; + + if(mDxePlatformAmtPolicy == NULL) + { + Status = gBS->LocateProtocol (&gDxePlatformAmtPolicyGuid, NULL, &mDxePlatformAmtPolicy); + if (EFI_ERROR(Status)) return Status; + } + + Status = gBS->HandleProtocol(gST->ConsoleInHandle, + &gEfiSimpleTextInExProtocolGuid, + (void*)&SimpleTextInEX); + + if (EFI_ERROR(Status)) return Status; + + Status = SimpleTextInEX->UnregisterKeyNotify (SimpleTextInEX, CIRAKeyHandle[0]); + if((CIRA_UNICODE>0x40 && CIRA_UNICODE<0x5b) || (CIRA_UNICODE>0x60 && CIRA_UNICODE<0x7b)){ + Status = SimpleTextInEX->UnregisterKeyNotify (SimpleTextInEX, CIRAKeyHandle[1]); + } + + mDxePlatformAmtPolicy->AmtConfig.CiraRequest = 1; + PostManagerDisplayPostMessage(L"Requesting CIRA ......"); +#endif + return EFI_SUCCESS; +} +//<AMI_PHDR_START> +//******************************************************************************* +// Procedure: MebxCheckForKey +// +// Description: +// +// Input: Event: Timer event. +// Context: Event context; always NULL +// +// Output: VOID +// +//******************************************************************************* +//<AMI_PHDR_END> +EFI_STATUS MebxCheckForKey +( + IN EFI_KEY_DATA *Key +) +{ + EFI_SIMPLE_TEXT_INPUT_EX_PROTOCOL *SimpleTextInEX; + EFI_STATUS Status; + EFI_CONSOLE_CONTROL_PROTOCOL *ConsoleControl; + EFI_EVENT SetConsoleControlModeBackEvent; + EFI_CONSOLE_CONTROL_SCREEN_MODE ScreenMode; + + if(mDxePlatformAmtPolicy == NULL) + { + Status = gBS->LocateProtocol (&gDxePlatformAmtPolicyGuid, NULL, &mDxePlatformAmtPolicy); + if (EFI_ERROR(Status)) return Status; + } + + Status = gBS->HandleProtocol(gST->ConsoleInHandle, + &gEfiSimpleTextInExProtocolGuid, + (void*)&SimpleTextInEX); + + if (EFI_ERROR(Status)) return Status; + + Status = SimpleTextInEX->UnregisterKeyNotify (SimpleTextInEX, MebxKeyHandle[0]); + if((MEBX_UNICODE>0x40 && MEBX_UNICODE<0x5b) || (MEBX_UNICODE>0x60 && MEBX_UNICODE<0x7b)){ + Status = SimpleTextInEX->UnregisterKeyNotify (SimpleTextInEX, MebxKeyHandle[1]); + } + + mDxePlatformAmtPolicy->AmtConfig.iAmtbxHotkeyPressed = 1; + PostManagerDisplayPostMessage(L"Entering MEBX setup menu ......"); + + // Fix Mebx Setup screen not full screen. + Status = gBS->LocateProtocol( &gEfiConsoleControlProtocolGuid, NULL, &ConsoleControl); + + ConsoleControl->GetMode(ConsoleControl, &ScreenMode, NULL, NULL); + + if (ScreenMode == EfiConsoleControlScreenGraphics) + { + ConsoleControl->SetMode( ConsoleControl, EfiConsoleControlScreenText ); + Status = gBS->CreateEventEx ( + EFI_EVENT_NOTIFY_SIGNAL, + TPL_CALLBACK, + SetConsoleControlModeBack, + NULL, + &gMePlatformReadyToBootGuid, + &SetConsoleControlModeBackEvent + ); + } + + return EFI_SUCCESS; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: MebxPromptConInAvailabilityHook +// +// Description: This function is a hook called when TSE determines +// that SETUP utility has to be displayed. This function +// is available as ELINK. In the generic implementation +// setup password is prompted in this function. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +BOOLEAN MebxPromptConInAvailabilityHook (VOID) +{ + EFI_STATUS Status; + EFI_GUID gSetupGuid = SETUP_GUID; + UINTN VarSize; + SETUP_DATA SetupData; +#if MEBX_UNICODE>0x40 && MEBX_UNICODE<0x5b == 1 + // ScanCode, UnicodeChar, KeyShiftState, KeyToggleState + EFI_KEY_DATA Key[] = {{MEBX_SCANCODE, MEBX_UNICODE, MEBX_KeyShiftState, MEBX_KeyToggleState}, + {MEBX_SCANCODE, MEBX_UNICODE+0x20, MEBX_KeyShiftState, MEBX_KeyToggleState}}; + +#else +#if MEBX_UNICODE>0x60 && MEBX_UNICODE<0x7b == 1 + EFI_KEY_DATA Key[] = {{MEBX_SCANCODE, MEBX_UNICODE-0x20, MEBX_KeyShiftState, MEBX_KeyToggleState}, + {MEBX_SCANCODE, MEBX_UNICODE, MEBX_KeyShiftState, MEBX_KeyToggleState}}; +#else + EFI_KEY_DATA Key[] = {{MEBX_SCANCODE, MEBX_UNICODE, MEBX_KeyShiftState, MEBX_KeyToggleState}}; +#endif +#endif + EFI_HECI_PROTOCOL *Heci; + UINT32 MeMode = ME_MODE_FAILED; + EFI_GUID gEfiHeciProtocolGuid = HECI_PROTOCOL_GUID; + EFI_SIMPLE_TEXT_INPUT_EX_PROTOCOL *SimpleTextInEX; + EFI_GUID gMeBiosPayloadDataProtocolGuid = + ME_BIOS_PAYLOAD_DATA_PROTOCOL_GUID; +#if defined iAMT_SUPPORT && iAMT_SUPPORT == 1 + EFI_GUID gEfiAmtWrapperGuid = EFI_AMT_WRAPPER_PROTOCOL_GUID; + AMT_WRAPPER_PROTOCOL *AmtWrapperProtocol; + + Status = gBS->LocateProtocol (&gEfiAmtWrapperGuid, NULL, &AmtWrapperProtocol); + if (EFI_ERROR(Status)) return FALSE; + if ((AmtWrapperProtocol->ActiveManagementEnableKvm()) || + (AmtWrapperProtocol->ActiveManagementEnableSol())) + return FALSE; +#endif + VarSize = sizeof(SETUP_DATA); + Status = gRT->GetVariable ( + L"Setup", + &gSetupGuid, + NULL, + &VarSize, + &SetupData + ); + + if (EFI_ERROR(Status)) return FALSE; + if(SetupData.MeImageType == 3) + return FALSE; + + Status = pBS->LocateProtocol ( + &gEfiHeciProtocolGuid, + NULL, + &Heci + ); + + if (EFI_ERROR(Status)) return EFI_SUCCESS; + + Status = Heci->GetMeMode (&MeMode); + + // If not normal mode + if(MeMode != 0) + return FALSE; + + if(mDxePlatformAmtPolicy == NULL) + { + Status = gBS->LocateProtocol (&gDxePlatformAmtPolicyGuid, NULL, &mDxePlatformAmtPolicy); + + if (EFI_ERROR(Status)) + return FALSE; + } + + if(mDxePlatformAmtPolicy->AmtConfig.iAmtbxHotkeyPressed == 1) + { + EFI_EVENT SetConsoleControlModeBackEvent; + EFI_CONSOLE_CONTROL_PROTOCOL *ConsoleControl; + EFI_CONSOLE_CONTROL_SCREEN_MODE ScreenMode; + + // Fix Mebx Setup screen not full screen. + Status = gBS->LocateProtocol( + &gEfiConsoleControlProtocolGuid, NULL, &ConsoleControl); + + + + ConsoleControl->GetMode(ConsoleControl, &ScreenMode, NULL, NULL); + if (ScreenMode == EfiConsoleControlScreenGraphics) { + ConsoleControl->SetMode( ConsoleControl, EfiConsoleControlScreenText ); + + Status = gBS->CreateEventEx ( + EFI_EVENT_NOTIFY_SIGNAL, + TPL_CALLBACK, + SetConsoleControlModeBack, + NULL, + &gMePlatformReadyToBootGuid, + &SetConsoleControlModeBackEvent + ); + } + return FALSE; + } + + PostManagerDisplayPostMessage(L"Press <CTRL + P> to Enter MEBX setup menu "); + + Status = gBS->HandleProtocol(gST->ConsoleInHandle, &gEfiSimpleTextInExProtocolGuid, (void*)&SimpleTextInEX); + if (EFI_ERROR(Status)) return FALSE; + + + Status = SimpleTextInEX->RegisterKeyNotify (SimpleTextInEX, &Key[0], &MebxCheckForKey, &MebxKeyHandle[0]); + if((MEBX_UNICODE>0x40 && MEBX_UNICODE<0x5b) || (MEBX_UNICODE>0x60 && MEBX_UNICODE<0x7b)){ + Status = SimpleTextInEX->RegisterKeyNotify (SimpleTextInEX, &Key[1], &MebxCheckForKey, &MebxKeyHandle[1]); + } + + return FALSE; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: RemoteAssistConInAvailabilityHook +// +// Description: This function is a hook called when TSE determines +// that SETUP utility has to be displayed. This function +// is available as ELINK. In the generic implementation +// setup password is prompted in this function. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +BOOLEAN RemoteAssistConInAvailabilityHook (VOID) +{ +#if CIRA_SUPPORT + EFI_STATUS Status; + UINTN VariableSize = sizeof (ME_BIOS_EXTENSION_SETUP); + EFI_GUID gEfiMeBiosExtensionSetupGuid = EFI_ME_BIOS_EXTENSION_SETUP_GUID; + CHAR16 gEfiMeBiosExtensionSetupName[] = EFI_ME_BIOS_EXTENSION_SETUP_VARIABLE_NAME; + EFI_GUID gEfiAmtWrapperGuid = EFI_AMT_WRAPPER_PROTOCOL_GUID; + AMT_WRAPPER_PROTOCOL *AmtWrapperProtocol; + + Status = gBS->LocateProtocol (&gDxePlatformAmtPolicyGuid, NULL, &mDxePlatformAmtPolicy); + if (EFI_ERROR(Status)) return FALSE; + + Status = gBS->LocateProtocol (&gEfiAmtWrapperGuid, NULL, &AmtWrapperProtocol); + if (EFI_ERROR(Status)) return FALSE; + + Status = gRT->GetVariable ( + gEfiMeBiosExtensionSetupName, + &gEfiMeBiosExtensionSetupGuid, + NULL, + &VariableSize, + &MeBiosExtensionSetupData); + + if(EFI_ERROR(Status)) + return FALSE; + + if((MeBiosExtensionSetupData.RemoteAssistanceTriggerAvailablilty) && + (mDxePlatformAmtPolicy->AmtConfig.iAmtEnabled) && + (!AmtWrapperProtocol->ActiveManagementEnableKvm()) && + (!AmtWrapperProtocol->ActiveManagementEnableSol())) + { +#if CIRA_UNICODE>0x40 && CIRA_UNICODE<0x5b == 1 + // ScanCode, UnicodeChar, KeyShiftState, KeyToggleState + EFI_KEY_DATA Key[] = {{CIRA_SCANCODE, CIRA_UNICODE, CIRA_KeyShiftState, CIRA_KeyToggleState}, + {CIRA_SCANCODE, CIRA_UNICODE+0x20, CIRA_KeyShiftState, CIRA_KeyToggleState}}; + +#else +#if CIRA_UNICODE>0x60 && CIRA_UNICODE<0x7b == 1 + // ScanCode, UnicodeChar, KeyShiftState, KeyToggleState + EFI_KEY_DATA Key[] = {{CIRA_SCANCODE, CIRA_UNICODE-0x20, CIRA_KeyShiftState, CIRA_KeyToggleState}, + {CIRA_SCANCODE, CIRA_UNICODE, CIRA_KeyShiftState, CIRA_KeyToggleState}}; +#else + EFI_KEY_DATA Key[] = {{CIRA_SCANCODE, CIRA_UNICODE, CIRA_KeyShiftState, CIRA_KeyToggleState}}; +#endif +#endif + + EFI_SIMPLE_TEXT_INPUT_EX_PROTOCOL *SimpleTextInEX; + + + Status = gBS->HandleProtocol(gST->ConsoleInHandle, + &gEfiSimpleTextInExProtocolGuid, (void*)&SimpleTextInEX); + + if (EFI_ERROR(Status)) return FALSE; + PostManagerDisplayPostMessage(L"Press <CTRL + ALT + F1> Remote Assistance"); + Status = SimpleTextInEX->RegisterKeyNotify (SimpleTextInEX, &Key[0], + &CIRACheckForKey, &CIRAKeyHandle[0]); + if((CIRA_UNICODE>0x40 && CIRA_UNICODE<0x5b) || (CIRA_UNICODE>0x60 && CIRA_UNICODE<0x7b)){ + Status = SimpleTextInEX->RegisterKeyNotify (SimpleTextInEX, &Key[1], + &CIRACheckForKey, &CIRAKeyHandle[1]); + } + + } +#endif //CIRA_SUPPORT + return FALSE; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: MEProcessEnterSetup +// +// Description: This function is a hook called when TSE determines +// that it has to load the boot options in the boot +// order. This function is available as ELINK. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID MEProcessEnterSetup(VOID) +{ + EFI_SIMPLE_TEXT_INPUT_EX_PROTOCOL *SimpleTextInEX; + EFI_STATUS Status; + + Status = gBS->HandleProtocol(gST->ConsoleInHandle, + &gEfiSimpleTextInExProtocolGuid, + (void*)&SimpleTextInEX); + if(EFI_ERROR(Status)) + return; + +#if CIRA_SUPPORT + Status = SimpleTextInEX->UnregisterKeyNotify (SimpleTextInEX, CIRAKeyHandle[0]); + if((CIRA_UNICODE>0x40 && CIRA_UNICODE<0x5b) || (CIRA_UNICODE>0x60 && CIRA_UNICODE<0x7b)){ + Status = SimpleTextInEX->UnregisterKeyNotify (SimpleTextInEX, CIRAKeyHandle[1]); + } +#endif + + Status = SimpleTextInEX->UnregisterKeyNotify (SimpleTextInEX, MebxKeyHandle[0]); + if((MEBX_UNICODE>0x40 && MEBX_UNICODE<0x5b) || (MEBX_UNICODE>0x60 && MEBX_UNICODE<0x7b)){ + Status = SimpleTextInEX->UnregisterKeyNotify (SimpleTextInEX, MebxKeyHandle[1]); + } +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.c b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.c new file mode 100644 index 0000000..b490873 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.c @@ -0,0 +1,190 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2014, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.c 1 11/02/14 9:43p Tristinchou $ +// +// $Revision: 1 $ +// +// $Date: 11/02/14 9:43p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.c $ +// +// 1 11/02/14 9:43p Tristinchou +// [TAG] EIP189985 +// [Category] Improvement +// [Description] For ME 9.1.20.1035, add NFC related option in setup +// [Files] NfcSupportDxe.cif +// NfcSupportDxe.c +// NfcSupportDxe.h +// NfcSupportDxe.sdl +// NfcSupportDxe.dxs +// NfcSupportDxe.mak +// +//********************************************************************** +#if !defined(EDK_RELEASE_VERSION) || (EDK_RELEASE_VERSION < 0x00020000) +#include "EdkIIGlueDxe.h" +#include "HeciMsgLib.h" +#include EFI_PROTOCOL_DEFINITION (MeBiosPayloadData) +#include "MELib.h" +#include <token.h> +#endif + +#include "NfcSupportDxe.h" + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: MeSupportNfc +// +// Description: This function determines ME firmware support enable/disable +// NFC state. From ME 9.1.20.1035, ME firmware support this +// feature. +// +// Input: DXE_MBP_DATA_PROTOCOL *MbpDataProtocol +// +// Output: BOOLEAN +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +BOOLEAN +MeSupportNfc( + IN DXE_MBP_DATA_PROTOCOL *MbpDataProtocol +) +{ + //If ME version is above 9.1.20.1035 + if( (MbpDataProtocol != NULL) && + ( (MbpDataProtocol->MeBiosPayload.FwVersionName.MajorVersion == 0x09) && + (MbpDataProtocol->MeBiosPayload.FwVersionName.MinorVersion == 0x01) && + ( (MbpDataProtocol->MeBiosPayload.FwVersionName.HotfixVersion >= 0x14) || + (MbpDataProtocol->MeBiosPayload.FwVersionName.BuildVersion >= 0x040B) ) ) ) + { + return TRUE; + } + + return FALSE; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: NfcSupportDxeEntryPoint +// +// Description: Module entry point +// +// Input: EFI_HANDLE ImageHandle +// EFI_SYSTEM_TABLE *SystemTable +// +// Output: EFI_STATUS +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +NfcSupportDxeEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + EFI_STATUS Status; + DXE_MBP_DATA_PROTOCOL *MbpData = NULL; + UINT32 VarAttr; + UINTN VarSize; + EFI_GUID NfcSupportDataGuid = NFC_SUPPORT_DATA_GUID; + NFC_SUPPORT_DATA NfcSupportData; + MEFWCAPS_SKU FwFeatureState; + + DEBUG ((EFI_D_INFO, "[NfcSupportDxe.c] : Entry Point...\n")); + + Status = gBS->LocateProtocol( + &gMeBiosPayloadDataProtocolGuid, + NULL, + (VOID**)&MbpData ); + if( EFI_ERROR(Status) ) + MbpData = NULL; + + VarAttr = 0; + VarSize = sizeof( NFC_SUPPORT_DATA ); + Status = gRT->GetVariable ( + L"NfcSupportData", + &NfcSupportDataGuid, + &VarAttr, + &VarSize, + &NfcSupportData ); + if( EFI_ERROR(Status) ) + VarAttr = EFI_VARIABLE_BOOTSERVICE_ACCESS | EFI_VARIABLE_NON_VOLATILE; + + if( MbpData != NULL ) + { + NfcSupportData.NFCCapability = MbpData->MeBiosPayload.FwCapsSku.FwCapabilities.Fields.NFC;; + NfcSupportData.NFCDeviceType = MbpData->MeBiosPayload.NfcSupport.NfcData.DeviceType; + } + else + { + NfcSupportData.NFCCapability = 0; + NfcSupportData.NFCDeviceType = 0; + } + + Status = HeciGetFwFeatureStateMsg( &FwFeatureState ); + if( !EFI_ERROR(Status) ) + NfcSupportData.NFCState = FwFeatureState.Fields.NFC; + else + NfcSupportData.NFCState = 0; + + if( MeSupportNfc(MbpData) ) + NfcSupportData.MeSupportNFC = 1; + else + NfcSupportData.MeSupportNFC = 0; + + Status = gRT->SetVariable( + L"NfcSupportData", + &NfcSupportDataGuid, + VarAttr, + VarSize, + &NfcSupportData ); + if ( EFI_ERROR(Status) ) + return EFI_SUCCESS; + + //If ME support NFC and NFC capability is on + if( (NfcSupportData.MeSupportNFC == 1) && + (NfcSupportData.NFCCapability == 1) ) + { + if( (NfcSupportData.NFCEnableUpdate == 1) && + (NfcSupportData.NFCState != NfcSupportData.NFCEnable) ) + { + if( NfcSupportData.NFCEnable == 1 ) + Status = HeciFwFeatureStateOverride( 0x80000000, 0 ); + else + Status = HeciFwFeatureStateOverride( 0, 0x80000000 ); + + Status = HeciSendCbmResetRequest(CBM_RR_REQ_ORIGIN_BIOS_POST, CBM_HRR_GLOBAL_RESET); +// if( !EFI_ERROR(Status) ) +// EFI_DEADLOOP(); + } + } + + return EFI_SUCCESS; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2014, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.cif b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.cif new file mode 100644 index 0000000..4c5ff29 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.cif @@ -0,0 +1,14 @@ +<component> + name = "NfcSupportDxe" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\MeSetup\NfcSupportDxe" + RefName = "NfcSupportDxe" +[files] +"NfcSupportDxe.c" +"NfcSupportDxe.h" +"NfcSupportDxe.sdl" +"NfcSupportDxe.dxs" +"NfcSupportDxe.mak" +[parts] +"NfcSupportSetupHook" +<endComponent> diff --git a/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.dxs b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.dxs new file mode 100644 index 0000000..8395065 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.dxs @@ -0,0 +1,70 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2014, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.dxs 1 11/02/14 9:43p Tristinchou $ +// +// $Revision: 1 $ +// +// $Date: 11/02/14 9:43p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.dxs $ +// +// 1 11/02/14 9:43p Tristinchou +// [TAG] EIP189985 +// [Category] Improvement +// [Description] For ME 9.1.20.1035, add NFC related option in setup +// [Files] NfcSupportDxe.cif +// NfcSupportDxe.c +// NfcSupportDxe.h +// NfcSupportDxe.sdl +// NfcSupportDxe.dxs +// NfcSupportDxe.mak +// +// +//********************************************************************** +#include "AutoGen.h" +#include "DxeDepex.h" +#if defined (BUILD_WITH_GLUELIB) || defined (BUILD_WITH_EDKII_GLUE_LIB) +#include "EfiDepex.h" + +#include EFI_PROTOCOL_DEFINITION (Heci) +#include EFI_ARCH_PROTOCOL_DEFINITION (Variable) +#include EFI_PROTOCOL_DEFINITION (PchReset) +#include EFI_PROTOCOL_DEFINITION (MeBiosPayloadData) + +#endif + +DEPENDENCY_START + EFI_HECI_PROTOCOL_GUID AND + PCH_RESET_PROTOCOL_GUID AND + EFI_VARIABLE_ARCH_PROTOCOL_GUID AND + ME_BIOS_PAYLOAD_DATA_PROTOCOL_GUID +DEPENDENCY_END +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2014, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.h b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.h new file mode 100644 index 0000000..6e12a2d --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.h @@ -0,0 +1,71 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2014, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.h 1 11/02/14 9:43p Tristinchou $ +// +// $Revision: 1 $ +// +// $Date: 11/02/14 9:43p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.h $ +// +// 1 11/02/14 9:43p Tristinchou +// [TAG] EIP189985 +// [Category] Improvement +// [Description] For ME 9.1.20.1035, add NFC related option in setup +// [Files] NfcSupportDxe.cif +// NfcSupportDxe.c +// NfcSupportDxe.h +// NfcSupportDxe.sdl +// NfcSupportDxe.dxs +// NfcSupportDxe.mak +// +// +//********************************************************************** +#ifndef _NfcSupportDxe_H_ +#define _NfcSupportDxe_H_ + +#pragma pack(push, 1) +typedef struct { + BOOLEAN NFCCapability; + BOOLEAN NFCState; + UINT8 NFCDeviceType; + UINT8 MeSupportNFC; + UINT8 NFCEnable; + UINT8 NFCEnableUpdate; +} NFC_SUPPORT_DATA; +#pragma pack(pop) + +//1E5ACFFE-ED4C-4BC0-AE51-511EFDA0522E +#define NFC_SUPPORT_DATA_GUID \ + {0x1E5ACFFE, 0xED4C, 0x4BC0, 0xAE, 0x51, 0x51, 0x1E, 0xFD, 0xA0, 0x52, 0x2E} + +#endif +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2014, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.mak b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.mak new file mode 100644 index 0000000..567adc0 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.mak @@ -0,0 +1,134 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2014, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.mak 1 11/02/14 9:43p Tristinchou $ +# +# $Revision: 1 $ +# +# $Date: 11/02/14 9:43p $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.mak $ +# +# 1 11/02/14 9:43p Tristinchou +# [TAG] EIP189985 +# [Category] Improvement +# [Description] For ME 9.1.20.1035, add NFC related option in setup +# [Files] NfcSupportDxe.cif +# NfcSupportDxe.c +# NfcSupportDxe.h +# NfcSupportDxe.sdl +# NfcSupportDxe.dxs +# NfcSupportDxe.mak +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: NfcSupportDxe.mak +# +# Description: Makfile for ME NFC Setup module. +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +all : NfcSupportDxe + +NfcSupportDxe : $(BUILD_DIR)\NfcSupportDxe.mak NfcSupportDxe_Bin + +$(BUILD_DIR)\NfcSupportDxe.mak : $(NFC_SUPPORT_DXE_PATH)\$(@B).cif $(NFC_SUPPORT_DXE_PATH)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(NFC_SUPPORT_DXE_PATH)\$(@B).cif $(CIF2MAK_DEFAULTS) + +NfcSupportDxe_INCLUDES=\ + $(EdkIIGlueLib_INCLUDES)\ + $(EDK_INCLUDES)\ + $(ME_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + +NfcSupportDxe_LIBS=\ + $(EDKPROTOCOLLIB)\ + $(EFIGUIDLIB)\ + $(EdkIIGlueBaseLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EDKFRAMEWORKGUIDLIB)\ + $(EDKFRAMEWORKPROTOCOLLIB)\ + $(EdkIIGlueBaseIoLibIntrinsic_LIB)\ + $(EdkIIGlueBaseMemoryLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeServicesTableLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueUefiBootServicesTableLib_LIB)\ + $(EdkIIGlueUefiDevicePathLib_LIB)\ + $(EdkIIGlueBasePciLibPciExpress_LIB)\ + $(EdkIIGlueEdkDxeRuntimeDriverLib_LIB)\ + $(EdkIIGlueDxeHobLib_LIB)\ + $(MeLibDxe_LIB)\ + $(PchPlatformDxeLib_LIB)\ + +NfcSupportDxe_DEFINES=\ + $(MY_DEFINES)\ + /D"__EDKII_GLUE_MODULE_ENTRY_POINT__=NfcSupportDxeEntryPoint"\ + /D __EDKII_GLUE_BASE_MEMORY_LIB__ \ + /D __EDKII_GLUE_DXE_REPORT_STATUS_CODE_LIB__ \ + /D __EDKII_GLUE_DXE_DEBUG_LIB_REPORT_STATUS_CODE__ \ + /D __EDKII_GLUE_UEFI_BOOT_SERVICES_TABLE_LIB__\ + /D __EDKII_GLUE_BASE_IO_LIB_INTRINSIC__ \ + /D __EDKII_GLUE_DXE_SERVICES_TABLE_LIB__ \ + +NfcSupportDxe_Bin : $(NfcSupportDxe_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDKIIGLUE_DEFAULTS)\ + /f $(BUILD_DIR)\NfcSupportDxe.mak all\ + "MY_INCLUDES=$(NfcSupportDxe_INCLUDES)"\ + "MY_DEFINES=$(NfcSupportDxe_DEFINES)"\ + GUID=1E5ACFFE-ED4C-4BC0-AE51-511EFDA0522E \ + ENTRY_POINT=_ModuleEntryPoint \ + EDKIIModule=DXEDRIVER\ + TYPE=BS_DRIVER \ + DEPEX1=$(NFC_SUPPORT_DXE_PATH)\NfcSupportDxe.dxs \ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + COMPRESS=1\ + +!IF DEFINED(NFC_SUPPORT_DXE_SUPPORT) && "$(NFC_SUPPORT_DXE_SUPPORT)" == "1" +SetupData : $(BUILD_DIR)\NfcSupportSetupHook.obj +!ENDIF + +NfcSupportSetupHook_CFLAGS=$(CFLAGS) \ + -I $(TSEBIN_DIR)\Inc \ + -I $(TSEBIN_DIR)\ + -I $(NFC_SUPPORT_DXE_PATH)\ + -I $(PROJECT_DIR)\Include + +$(BUILD_DIR)\NfcSupportSetupHook.obj : $(NFC_SUPPORT_DXE_PATH)\NfcSupportSetupHook.c + $(CC) $(NfcSupportSetupHook_CFLAGS) /Fo$(BUILD_DIR)\ $(NFC_SUPPORT_DXE_PATH)\NfcSupportSetupHook.c +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2014, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.sdl b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.sdl new file mode 100644 index 0000000..4e3500d --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportDxe.sdl @@ -0,0 +1,62 @@ +TOKEN + Name = "NFC_SUPPORT_DXE_SUPPORT" + Value = "1" + Help = "Main switch to enable NfcSupportDxe support in DXE Phase" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + TargetH = Yes + Master = Yes +End + +TOKEN + Name = "DEFAULT_NFC_SETTING" + Value = "1" + Help = "Default value of NFC Enable option" + TokenType = Integer + TargetH = Yes +End + +PATH + Name = "NFC_SUPPORT_DXE_PATH" +End + +MODULE + Help = "Includes NfcSupportDxe.mak to Project" + File = "NfcSupportDxe.mak" +End + +ELINK + Name = "NfcSupportResetHook," + Parent = "PreSystemResetHook," + Priority = 60 + Token = "NFC_SUPPORT_DXE_SUPPORT" "=" "1" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\NfcSupportDxe.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + +ELINK + Name = "-i $(NFC_SUPPORT_DXE_PATH)" + Parent = "SETUP_VFR_INCLUDES" + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\NfcSupportSetupHook.obj" + Parent = "AMITSE_Objects" + Token = "NFC_SUPPORT_DXE_SUPPORT" "=" "1" + InvokeOrder = AfterParent +End + +ELINK + Name = "NfcSupportEnterSetup," + Parent = "ProcessEnterSetup," + Token = "NFC_SUPPORT_DXE_SUPPORT" "=" "1" + InvokeOrder = AfterParent +End + diff --git a/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportSetupHook.c b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportSetupHook.c new file mode 100644 index 0000000..98cecc2 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportSetupHook.c @@ -0,0 +1,154 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2014, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportSetupHook.c 1 11/02/14 9:43p Tristinchou $ +// +// $Revision: 1 $ +// +// $Date: 11/02/14 9:43p $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportSetupHook.c $ +// +// 1 11/02/14 9:43p Tristinchou +// [TAG] EIP189985 +// [Category] Improvement +// [Description] For ME 9.1.20.1035, add NFC related option in setup +// [Files] NfcSupportSetupHook.cif +// NfcSupportSetupHook.c +// +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: NfcSupportSetupHook.c +// +// Description: Setup hooks for NfcSupportDxe module. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include <Token.h> +#include <Setup.h> +#include <AmiLib.h> +#include <AmiDxeLib.h> +#include "NfcSupportDxe.h" + +//---------------------------------------------------------------------------- +// Variable and External Declaration(s) +//---------------------------------------------------------------------------- +// Variable Declaration(s) +static NFC_SUPPORT_DATA gNewNfcSupportData; +static NFC_SUPPORT_DATA gOldNfcSupportData; + +// GUID Definition(s) +static EFI_GUID gNfcSupportDataGuid = NFC_SUPPORT_DATA_GUID; + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: NfcSupportEnterSetup +// +// Description: This function is a hook called when TSE determines +// that it has to load the boot options in the boot +// order. This function is available as ELINK. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +NfcSupportEnterSetup( + VOID +) +{ + EFI_STATUS Status; + UINT32 VarAttr; + UINTN VariableSize; + + VariableSize = sizeof(NFC_SUPPORT_DATA); + Status = pRS->GetVariable( + L"NfcSupportData", + &gNfcSupportDataGuid, + &VarAttr, + &VariableSize, + &gOldNfcSupportData ); + return; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: NfcSupportResetHook +// +// Description: This function is a hook called after some control +// modified in the setup utility by user. This +// function is available as ELINK. +// +// Input: VOID +// +// Output: VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +NfcSupportResetHook( + VOID +) +{ + EFI_STATUS Status; + UINT32 VarAttr; + UINTN VariableSize; + + VariableSize = sizeof(NFC_SUPPORT_DATA); + Status = pRS->GetVariable( + L"NfcSupportData", + &gNfcSupportDataGuid, + &VarAttr, + &VariableSize, + &gNewNfcSupportData ); + if ( !EFI_ERROR (Status) ) + { + if( gNewNfcSupportData.NFCEnable != gOldNfcSupportData.NFCEnable ) + { + gNewNfcSupportData.NFCEnableUpdate = 1; + + Status = pRS->SetVariable ( + L"NfcSupportData", + &gNfcSupportDataGuid, + VarAttr, + VariableSize, + &gNewNfcSupportData ); + } + } + + return; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2014, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportSetupHook.cif b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportSetupHook.cif new file mode 100644 index 0000000..f07c1a0 --- /dev/null +++ b/Board/EM/MeWrapper/MeSetup/NfcSupportDxe/NfcSupportSetupHook.cif @@ -0,0 +1,8 @@ +<component> + name = "NfcSupportSetupHook" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\MeSetup\NfcSupportDxe" + RefName = "NfcSupportSetupHook" +[files] +"NfcSupportSetupHook.c" +<endComponent>
\ No newline at end of file diff --git a/Board/EM/MeWrapper/MeWrapper.cif b/Board/EM/MeWrapper/MeWrapper.cif new file mode 100644 index 0000000..a2ce9f5 --- /dev/null +++ b/Board/EM/MeWrapper/MeWrapper.cif @@ -0,0 +1,18 @@ +<component> + name = "MeWrapper" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper" + RefName = "MeWrapper" +[files] +"MeWrapper.sdl" +[parts] +"MeSetup" +"MePlatformPolicy" +"MePciPlatform" +"Icc" +"Smbios131" +"TdtWrapper" +"MdesStatusCode" +"AtAmUi" +"PttWrapper" +<endComponent> diff --git a/Board/EM/MeWrapper/MeWrapper.sdl b/Board/EM/MeWrapper/MeWrapper.sdl new file mode 100644 index 0000000..9ee98b4 --- /dev/null +++ b/Board/EM/MeWrapper/MeWrapper.sdl @@ -0,0 +1,20 @@ +TOKEN + Name = "MeWrapper_SUPPORT" + Value = "1" + TokenType = Boolean + TargetEQU = Yes + TargetMAK = Yes + Master = Yes + Help = "Main switch to enable ME Wrapper support in Project" + Token = "iME_SUPPORT" "=" "1" +End + +PATH + Name = "MeWrapper_DIR" +End + +ELINK + Name = "/I$(MeWrapper_DIR)" + Parent = "ME_INCLUDES" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/PttWrapper/PttWrapper.c b/Board/EM/MeWrapper/PttWrapper/PttWrapper.c new file mode 100644 index 0000000..6a8c668 --- /dev/null +++ b/Board/EM/MeWrapper/PttWrapper/PttWrapper.c @@ -0,0 +1,142 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/PttWrapper/PttWrapper.c 4 11/05/14 6:00a Tristinchou $ +// +// $Revision: 4 $ +// +// $Date: 11/05/14 6:00a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/PttWrapper/PttWrapper.c $ +// +// 4 11/05/14 6:00a Tristinchou +// [TAG] EIP190594 +// [Description] Avoid install smm protocol with bootservice +// InstallProtocol() +// +// 3 1/18/13 12:20a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix SMM Variable protocol fail. +// [Files] PttWrapper.dxs +// PttWrapper.c +// PttWrapper.mak +// PttWrapper.sdl +// PttWrapper.cif +// +// 2 11/20/12 3:35a Klzhan +// [TAG] EIPNone +// [Category] Bug Fix +// [Severity] Important +// [Symptom] Smm Variable Protocol not installed +// +// 1 11/07/12 6:21a Klzhan +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: PttWrapper.c +// +// Description: Setup Hooks for Tdt. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include <EFI.h> +#include <AmiDxeLib.h> +#include <ReferenceCode\ME\SampleCode\Protocol\SmmVariable\SmmVariable.h> + + +#define EFI_SMM_RUNTIME_SERVICES_TABLE_GUID \ + { 0x395c33fe, 0x287f, 0x413e, { 0xa0, 0x55, 0x80, 0x88, 0xc0, 0xe1, 0xd4, 0x3e } } + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: InSmmFunction +// +// Description: InSmmFunction +// +// Input: +// +// Output: +// +// Modified: +// +// Referrals: +// +// Notes: +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +InSmmFunction +( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + //Modification in PttHciSmm.c uses RuntimeServices' variable service + //directly, so we don't need to install SmmVariableProtocol in gBS. + + return EFI_SUCCESS; +} + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: PttWrapperEntryPoint +// +// Description: Driver EntryPoint +// +// Input: +// +// Output: +// +// Modified: +// +// Referrals: +// +// Notes: +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +EFIAPI +PttWrapperEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + InitAmiLib(ImageHandle, SystemTable); + InitSmmHandlerEx(ImageHandle, SystemTable, InSmmFunction, NULL); + + return EFI_SUCCESS; +} + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/PttWrapper/PttWrapper.cif b/Board/EM/MeWrapper/PttWrapper/PttWrapper.cif new file mode 100644 index 0000000..9b38c3e --- /dev/null +++ b/Board/EM/MeWrapper/PttWrapper/PttWrapper.cif @@ -0,0 +1,11 @@ +<component> + name = "PttWrapper" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\PttWrapper\" + RefName = "PttWrapper" +[files] +"PttWrapper.dxs" +"PttWrapper.c" +"PttWrapper.mak" +"PttWrapper.sdl" +<endComponent> diff --git a/Board/EM/MeWrapper/PttWrapper/PttWrapper.dxs b/Board/EM/MeWrapper/PttWrapper/PttWrapper.dxs new file mode 100644 index 0000000..c75d348 --- /dev/null +++ b/Board/EM/MeWrapper/PttWrapper/PttWrapper.dxs @@ -0,0 +1,99 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/PttWrapper/PttWrapper.dxs 2 1/18/13 12:20a Klzhan $ +// +// $Revision: 2 $ +// +// $Date: 1/18/13 12:20a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/PttWrapper/PttWrapper.dxs $ +// +// 2 1/18/13 12:20a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix SMM Variable protocol fail. +// [Files] PttWrapper.dxs +// PttWrapper.c +// PttWrapper.mak +// PttWrapper.sdl +// PttWrapper.cif +// +// 1 11/07/12 6:21a Klzhan +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: TdtSetup.dxs +// +// Description: Dependency expression file. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004-2006 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + TDTPlatformPolicy.h + +Abstract: + + Dependency expression file for TDTPlatformPolicy Invocation Driver. + +--*/ +/*++ + This file contains an 'Intel Peripheral Driver' and is + licensed for Intel CPUs and chipsets under the terms of your + license agreement with Intel or your vendor. This file may + be modified by the user, subject to additional terms of the + license agreement +--*/ +#include <Protocol/SmmBase.h> +#include <Protocol/SmmSwDispatch.h> + +DEPENDENCY_START + EFI_SMM_BASE_PROTOCOL_GUID AND + EFI_SMM_SW_DISPATCH_PROTOCOL_GUID +DEPENDENCY_END + + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/PttWrapper/PttWrapper.mak b/Board/EM/MeWrapper/PttWrapper/PttWrapper.mak new file mode 100644 index 0000000..66da210 --- /dev/null +++ b/Board/EM/MeWrapper/PttWrapper/PttWrapper.mak @@ -0,0 +1,68 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/PttWrapper/PttWrapper.mak 1 11/07/12 6:21a Klzhan $ +# +# $Revision: 1 $ +# +# $Date: 11/07/12 6:21a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/PttWrapper/PttWrapper.mak $ +# +# 1 11/07/12 6:21a Klzhan +# +# +# +#********************************************************************** +#<AMI_FHDR_START> +# +# Name: PttWrapper.mak +# +# Description: +# +#<AMI_FHDR_END> +#********************************************************************** + +all : PttWrapper + +PttWrapper : $(BUILD_DIR)\PttWrapper.mak PttWrapperBin + +$(BUILD_DIR)\PttWrapper.mak : $(PttWrapper_DIR)\$(@B).cif $(PttWrapper_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(PttWrapper_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +PttWrapperBin : $(AMIDXELIB) + $(MAKE) /$(MAKEFLAGS) $(BUILD_DEFAULTS)\ + /f $(BUILD_DIR)\PttWrapper.mak all\ + GUID=b19ef33c-10a6-4066-9217-8e5ee011a52f\ + ENTRY_POINT=PttWrapperEntryPoint\ + TYPE=BS_DRIVER \ + COMPRESS=1 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/PttWrapper/PttWrapper.sdl b/Board/EM/MeWrapper/PttWrapper/PttWrapper.sdl new file mode 100644 index 0000000..c7643e3 --- /dev/null +++ b/Board/EM/MeWrapper/PttWrapper/PttWrapper.sdl @@ -0,0 +1,27 @@ +TOKEN + Name = "PttWrapper_SUPPORT" + Value = "0" + Help = "Main switch to enable TdtWrapper support in Project" + TokenType = Boolean + TargetMAK = Yes + TargetH = Yes + Master = Yes + Token = "PTTHciSmm_SUPPORT" "=" "1" +End + + +PATH + Name = "PttWrapper_DIR" +End + +MODULE + Help = "Includes TdtWrapper.mak to Project" + File = "PttWrapper.mak" +End + +ELINK + Name = "$(BUILD_DIR)\PttWrapper.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + diff --git a/Board/EM/MeWrapper/Smbios131/Smbios131.c b/Board/EM/MeWrapper/Smbios131/Smbios131.c new file mode 100644 index 0000000..0b703ac --- /dev/null +++ b/Board/EM/MeWrapper/Smbios131/Smbios131.c @@ -0,0 +1,553 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Smbios131/Smbios131.c 7 3/06/13 4:12a Klzhan $ +// +// $Revision: 7 $ +// +// $Date: 3/06/13 4:12a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Smbios131/Smbios131.c $ +// +// 7 3/06/13 4:12a Klzhan +// Spec update : PlatformBrand = 5 means SBA +// +// 6 2/18/13 2:25a Klzhan +// Improvement : Checking SBA Platform. +// +// 5 1/25/13 4:27a Klzhan +// Return EFI_SUCCESS in entrypoint. +// +// 4 12/18/12 2:29a Klzhan +// [TAG] EIP109707 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.81 +// [Files] Smbios131.sdl +// Smbios131.mak +// Smbios131.c +// Smbios131.dxs +// Smbios131.h +// Smbios131.cif +// +// 3 7/02/12 11:38p Klzhan +// [TAG] EIP94113 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC0.6 +// [Files] Smbios131.sdl +// Smbios131.mak +// Smbios131.c +// Smbios131.dxs +// Smbios131.h +// Smbios131.cif +// +// 2 4/24/12 12:32a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 6 7/26/11 9:57a Klzhan +// Create token for some Bios capabilities parameters. +// +// 5 7/26/11 8:37a Klzhan +// [TAG] EIP64542 +// [Category] Improvement +// [Description] Replace Getvariable by GetNbSetupdata. +// [Files] Smbios131.sdl +// Smbios131.mak +// Smbios131.c +// Smbios131.dxs +// Smbios131.h +// Smbios131.cif +// +// 4 7/11/11 5:40a Klzhan +// Close Event after SMBIOS 131 created. +// +// 3 7/08/11 4:23a Klzhan +// [TAG] EIP64189 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC to 0.7 +// +// 2 5/19/11 4:39a Klzhan +// Improvement : Fill MEBX version with EFI MEBX. +// +// 1 2/25/11 1:40a Klzhan +// Initial Check-in +// +// 2 12/16/10 4:00a Klzhan +// [TAG] EIP50237 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] Txt Support is not been set in SMBIOS type 131 +// [RootCause] SETUP_CPU_FEATURES has been changed. +// [Solution] Include PlatformCPULib.h +// [Files] Smbios131.c and Smbios131.h +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: Smbios131.c +// +// Description: Create SMbios type 131. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> + +#define _SMBIOS_GUID_H_ +#define __EDKII_GLUE_MEMORY_ALLOCATION_LIB_H__ +#define __EDKII_GLUE_BASE_MEMORY_LIB_H__ + +#include "Smbios131.h" +#include <Protocol\GlobalNvsArea\GlobalNvsArea.h> +#include "MePlatformPolicy.h" +#if EFI_SPECIFICATION_VERSION>0x20000 +#include "SaAccess.h" +#include "PchAccess.h" +#else +#include "Efi.h" +#include "EfiDriverLib.h" +#include "SaAccess.h" +#include "PchAccess.h" +#include "EdkIIGluePcd.h" +#include "EdkIIGluePcdPciExpressLib.h" +#include "EdkIIGlueConfig.h" +#include "EdkIIGlueIoLib.h" +#include "EdkIIGluePciExpressLib.h" +#include "EdkIIGlueUefiLib.h" +#define __UEFI_HII__H__ +#define __HII_PROTOCOL_H__ +#define _HII_H_ +#define __FORM_CALLBACK_PROTOCOL_H__ +#endif +#define SETUP_GUID { 0xEC87D643, 0xEBA4, 0x4BB5, 0xA1, 0xE5, 0x3F, 0x3E, 0x36, 0xB2, 0x0D, 0xA9 } + + +#define ME_INFO_SETUP_GUID \ + {0x78259433, 0x7B6D, 0x4DB3, 0x9A, 0xE8, 0x36, 0xC4, 0xC2, 0xC3, 0xA1, 0x7D} + +#include EFI_PROTOCOL_CONSUMER (MebxProtocol) + +EFI_GUID gSetupGuid = SETUP_GUID; +EFI_GUID gMeSetupInfoGuid = ME_INFO_SETUP_GUID; +EFI_GUID gEfiSmbiosProtocolGuid = EFI_SMBIOS_PROTOCOL_GUID; +EFI_GUID gEfiEventReadyToBootGuid = EFI_EVENT_GROUP_READY_TO_BOOT; +EFI_GUID gEfiMeBiosExtensionSetupGuid = EFI_ME_BIOS_EXTENSION_SETUP_GUID; +CHAR16 gEfiMeBiosExtensionSetupName[] = EFI_ME_BIOS_EXTENSION_SETUP_VARIABLE_NAME; +EFI_GUID gEfiGlobalVariableGuid = EFI_GLOBAL_VARIABLE_GUID; +UINT8 METype = 0; +EFI_EVENT mLegacyBootEvent; +MEFWCAPS_SKU gMeFwCapsSkuData; +#if VA_SUPPORT +EFI_GUID gEfiVaNVMVariableGuid = EFI_VA_NVM_VARIABLE_GUID; +#endif +UINT8 TdtWwanSuport = 0; +EFI_RUNTIME_SERVICES *gRT; +EFI_BOOT_SERVICES *gBS; + +EFI_STATUS +GetRawImage ( + IN EFI_GUID *NameGuid, + IN OUT VOID **Buffer, + IN OUT UINTN *Size + ) +/*++ + +Routine Description: + + Loads binary from RAW section of main firwmare volume + +Arguments: + + NameGuid - The guid of binary file + Buffer - Returns a pointer to allocated memory. Caller must free it when done. + Size - Returns the size of the binary loaded into the buffer. + +Returns: + + EFI_NOT_FOUND - Can't found the binary. + EFI_LOAD_ERROR - Load fail. + EFI_SUCCESS - Load success. + +--*/ +{ + EFI_STATUS Status; + UINTN HandleCount; + UINTN Index; + EFI_FIRMWARE_VOLUME_PROTOCOL *Fv; + EFI_HANDLE *HandleBuff; + UINT32 AuthenticationStatus; + + Status = gBS->LocateHandleBuffer ( + ByProtocol, + &gEfiFirmwareVolumeProtocolGuid, + NULL, + &HandleCount, + &HandleBuff + ); + if (EFI_ERROR (Status) || HandleCount == 0) { + return EFI_NOT_FOUND; + } + // + // Find desired image in all Fvs + // + for (Index = 0; Index < HandleCount; Index++) { + Status = gBS->HandleProtocol ( + HandleBuff[Index], + &gEfiFirmwareVolumeProtocolGuid, + &Fv + ); + + if (EFI_ERROR (Status)) { + if (HandleBuff != NULL) { + gBS->FreePool (HandleBuff); + } + + return EFI_LOAD_ERROR; + } + // + // Try a raw file + // + Status = Fv->ReadSection ( + Fv, + NameGuid, + EFI_SECTION_RAW, + 0, + Buffer, + Size, + &AuthenticationStatus + ); + + if (!EFI_ERROR (Status)) { + break; + } + } + + if (HandleBuff != NULL) { + gBS->FreePool (HandleBuff); + } + + if (Index >= HandleCount) { + return EFI_NOT_FOUND; + } + + return EFI_SUCCESS; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: UpdateSmbios131Table +// +// Description: SMBIOS tables 83 are filled here +// +// Input: EFI_EVENT Event, +// VOID *ParentImageHandle +// +// Output: EFI_STATUS +// +// Modified: +// +// Referrals: +// +// Notes: +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +MePlatformCapabilities ( + EFI_MISC_OEM_TYPE_0x83 *Type131 +) +{ + ME_INFO_SETUP_DATA MeInfoSetupData; + PLATFORM_TYPE_RULE_DATA PlatformTypeDate; + EFI_STATUS Status; + UINTN DataSize; + + DataSize = sizeof (ME_INFO_SETUP_DATA); + Status = gRT->GetVariable ( + L"MeInfoSetup", + &gMeSetupInfoGuid, + NULL, + &DataSize, + &MeInfoSetupData + ); + if (EFI_ERROR(Status)) return ; + Type131->MeCapabilities.MeEnabled = 1; + Type131->MeCapabilities.MeMajorVer = MeInfoSetupData.MeMajor; + Type131->MeCapabilities.MeMinorVer = MeInfoSetupData.MeMinor; + Type131->MeCapabilities.MeBuildNo = MeInfoSetupData.MeBuildNo; + Type131->MeCapabilities.MeHotFixNo = MeInfoSetupData.MeHotFix; + Type131->MeCapabilities.AtSupported = gMeFwCapsSkuData.Fields.IntelAT; + Type131->MeCapabilities.IntelKVM = gMeFwCapsSkuData.Fields.KVM; + Status = HeciGetPlatformType(&PlatformTypeDate); + if (EFI_ERROR(Status)) return ; + if (PlatformTypeDate.Fields.PlatformBrand == 1) { + Type131->MeCapabilities.IntelAmtFw = 1; + Type131->MeCapabilities.LocalWakeupTimer = 1; + } + if (PlatformTypeDate.Fields.PlatformBrand == 2) + Type131->MeCapabilities.IntelAmtFwStandard = 1; + + if (PlatformTypeDate.Fields.PlatformBrand == 5) + Type131->MeCapabilities.IntelSmallBusiness = 1; + + METype = (UINT8)PlatformTypeDate.Fields.IntelMeFwImageType; +} + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: UpdateSmbios131Table +// +// Description: SMBIOS tables 83 are filled here +// +// Input: EFI_EVENT Event, +// VOID *ParentImageHandle +// +// Output: EFI_STATUS +// +// Modified: +// +// Referrals: +// +// Notes: +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +UpdateSmbios131Table( + EFI_EVENT Event, + VOID *ParentImageHandle +) +{ + EFI_STATUS Status; + EFI_MISC_OEM_TYPE_0x83 Data83; + EFI_SMBIOS_PROTOCOL *mSmbiosProtocol; + UINT64 Ia32FeatureControl; + EFI_CPUID_REGISTER CpuidRegs ; +#if VA_SUPPORT + EFI_VA_NVM_VAR VaNVMVar; +#endif + + mSmbiosProtocol = NULL; + Status = gBS->LocateProtocol( + &gEfiSmbiosProtocolGuid, + NULL, + &mSmbiosProtocol + ); + if (EFI_ERROR(Status)) return Status; + + //Clear all data + gBS->SetMem (&Data83, sizeof(EFI_MISC_OEM_TYPE_0x83), 0); + +// Data83 + + Data83.Header.Type = 0x83; + Data83.Header.Length = 0x40; + Data83.Header.Handle = 0; + gBS->CopyMem ( + Data83.vProSignature, + vPro_Signature, + sizeof (UINT32) + ); + + Ia32FeatureControl = EfiReadMsr(EFI_MSR_IA32_FEATURE_CONTROL); + EfiCpuid (1, &CpuidRegs) ; + +//CPU + Data83.CpuCapabilities.VMXState = (UINT32)(RShiftU64(Ia32FeatureControl, 2)); + Data83.CpuCapabilities.SMXState = (UINT32)(RShiftU64(Ia32FeatureControl, 1)); + + if (CpuidRegs.RegEcx & BIT6) { + Data83.CpuCapabilities.LtTxtCap = 1; + } else { + Data83.CpuCapabilities.LtTxtCap = 0; + } + + if ((Ia32FeatureControl & TXT_OPT_IN_VMX_AND_SMX_MSR_VALUE) == TXT_OPT_IN_VMX_AND_SMX_MSR_VALUE) { + Data83.CpuCapabilities.LtTxtEnabled = 1; + } else { + Data83.CpuCapabilities.LtTxtEnabled = 0; + } + + if (CpuidRegs.RegEcx & BIT5) { + Data83.CpuCapabilities.VTxCap = 1; + } else { + Data83.CpuCapabilities.VTxCap = 0; + } + Data83.CpuCapabilities.VTxEnabled = (UINT32)(RShiftU64(Ia32FeatureControl, 2)); + +//Pch + Data83.PchCapabilities.FunctionNumber = PCI_FUNCTION_NUMBER_PCH_LPC; + Data83.PchCapabilities.DeviceNumber = PCI_DEVICE_NUMBER_PCH_LPC; + Data83.PchCapabilities.BusNumber = DEFAULT_PCI_BUS_NUMBER_PCH; + Data83.PchCapabilities.DeviceID = PchLpcPciCfg16(R_PCH_LPC_DEVICE_ID); + Data83.PchCapabilities.Reserved = 0; + +//Me +//Filled above along with Data82 table + MePlatformCapabilities(&Data83); + +// MEBX Version + // Fill MEBX Version when ME FW is 5MB + if(METype == 4) + { + EFI_MEBX_PROTOCOL *MebxProtocol; + Status = gBS->LocateProtocol (&gEfiMebxProtocolGuid, NULL, &MebxProtocol); + if (!EFI_ERROR (Status)) { + Data83.vMEBX_Major = MebxProtocol->MebxVersion.Major; + Data83.vMEBX_Minor = MebxProtocol->MebxVersion.Minor; + Data83.vMEBX_HotFix = MebxProtocol->MebxVersion.Hotfix; + Data83.vMEBX_Build = MebxProtocol->MebxVersion.Build; + } else { + Data83.vMEBX_Major = 0; + Data83.vMEBX_Minor = 0; + Data83.vMEBX_HotFix = 0; + Data83.vMEBX_Build = 0; + } + } + +//NetworkDevice + Data83.NetworkDevice.FunctionNumber = PCI_FUNCTION_NUMBER_PCH_LAN; //[2:0] PCI Device Function Number of Wired LAN + Data83.NetworkDevice.DeviceNumber = PCI_DEVICE_NUMBER_PCH_LAN; //[7:3] PCI Device Device Number of Wired LAN + Data83.NetworkDevice.BusNumber = PCI_BUS_NUMBER_PCH_LAN; //[15:8] PCI Device Bus Number of Wired LAN + Data83.NetworkDevice.DeviceID = MmPci16( 0, DEFAULT_PCI_BUS_NUMBER_PCH, PCI_DEVICE_NUMBER_PCH_LAN, PCI_FUNCTION_NUMBER_PCH_LAN, R_PCH_LAN_DEVICE_ID ); + +//BIOS + if(SetupSupportItem & BIT3) + Data83.BiosCapabilities.VTxSupport = 1; + + if(SetupSupportItem & BIT1) + Data83.BiosCapabilities.TxtSupport = 1; + + Data83.BiosCapabilities.Reserved1 = 0; + Data83.BiosCapabilities.Reserved2 = 0; + + if(SetupSupportItem & BIT0) + Data83.BiosCapabilities.VTdSupport = 1; + + if(SetupSupportItem & BIT2) + Data83.BiosCapabilities.MeSupport = 0; + +#if VA_SUPPORT + // + // Set Default Value for VA + // + Data83.BiosCapabilities.MaxVASupported = 7; //None. Means BIOS do not support VA. + + // + // Get VA Info + // + DataSize = sizeof(EFI_VA_NVM_VAR); + Status = gRT->GetVariable ( + EFI_VA_NVM_VARIABLE_NAME, + &gEfiVaNVMVariableGuid, + NULL, + &DataSize, + &VaNVMVar + ); + + if (!EFI_ERROR(Status)) { + if (VaNVMVar.VAVersion == EFI_VA30_VERSION) { + Data83.BiosCapabilities.MaxVASupported = 1; + } else if (VaNVMVar.VAVersion == EFI_VA26_VERSION) { + Data83.BiosCapabilities.MaxVASupported = 0; + } + } +#endif + + // Get TDT Info + if(Data83.MeCapabilities.AtSupported){ + Data83.BiosCapabilities.TdtPbaSupport = 1; + Data83.BiosCapabilities.TdtWwanSuport = TdtWwanSuport; + } + Status = mSmbiosProtocol->SmbiosAddStructure((UINT8 *)&Data83, sizeof(EFI_MISC_OEM_TYPE_0x83)); + gBS->CloseEvent(Event); + return Status; +} + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: AmtSmbios131EntryPoint +// +// Description: iAMT SMBIOS Type 131 driver entry point +// +// Input: EFI_HANDLE ImageHandle, +// EFI_SYSTEM_TABLE *SystemTable +// +// Output: EFI_STATUS +// +// Modified: +// +// Referrals: +// +// Notes: +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +AmtSmbios131EntryPoint( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +{ + EFI_STATUS Status; + DXE_MBP_DATA_PROTOCOL *mBIOSPayLoad = NULL; + + EfiInitializeDriverLib (ImageHandle, SystemTable); + + Status = HeciGetFwCapsSku(&gMeFwCapsSkuData); + if (EFI_ERROR(Status)) return Status; + Status = EfiCreateEventReadyToBootEx( + EFI_TPL_CALLBACK, + UpdateSmbios131Table, + (VOID *)&ImageHandle, + &mLegacyBootEvent + ); + ASSERT_EFI_ERROR (Status); + Status = gBS->LocateProtocol ( + &gMeBiosPayloadDataProtocolGuid, + NULL, + &mBIOSPayLoad + ); + if(!EFI_ERROR(Status)) + { +#if 0 + if(mBIOSPayLoad->MeBiosPayload.AtState.flags.WWAN3GPresent && + mBIOSPayLoad->MeBiosPayload.AtState.flags.WWAN3GOOB) + TdtWwanSuport = 1; +#endif + } + return EFI_SUCCESS; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Smbios131/Smbios131.cif b/Board/EM/MeWrapper/Smbios131/Smbios131.cif new file mode 100644 index 0000000..02aafea --- /dev/null +++ b/Board/EM/MeWrapper/Smbios131/Smbios131.cif @@ -0,0 +1,12 @@ +<component> + name = "Smbios131" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\Smbios131\" + RefName = "Smbios131" +[files] +"Smbios131.sdl" +"Smbios131.mak" +"Smbios131.c" +"Smbios131.dxs" +"Smbios131.h" +<endComponent> diff --git a/Board/EM/MeWrapper/Smbios131/Smbios131.dxs b/Board/EM/MeWrapper/Smbios131/Smbios131.dxs new file mode 100644 index 0000000..8373f04 --- /dev/null +++ b/Board/EM/MeWrapper/Smbios131/Smbios131.dxs @@ -0,0 +1,72 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Smbios131/Smbios131.dxs 1 2/08/12 1:07a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:07a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Smbios131/Smbios131.dxs $ +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 1 2/25/11 1:40a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: Smbios131.dxs +// +// Description: +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "EfiDepex.h" + +#include "Protocol\SmbiosGetFlashDataProtocol.h" +#include EFI_PROTOCOL_DEFINITION (AmtPlatformPolicy) +#include EFI_PROTOCOL_DEFINITION (Heci) +#include EFI_PROTOCOL_DEFINITION (MePlatformPolicy) + +DEPENDENCY_START + DXE_PLATFORM_ME_POLICY_GUID AND + EFI_HECI_PROTOCOL_GUID +DEPENDENCY_END + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Smbios131/Smbios131.h b/Board/EM/MeWrapper/Smbios131/Smbios131.h new file mode 100644 index 0000000..d8ac599 --- /dev/null +++ b/Board/EM/MeWrapper/Smbios131/Smbios131.h @@ -0,0 +1,176 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Smbios131/Smbios131.h 1 2/08/12 1:07a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:07a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Smbios131/Smbios131.h $ +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 1 2/25/11 1:40a Klzhan +// Initial Check-in +// +// 2 12/16/10 3:58a Klzhan +// [TAG] EIP50237 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] Txt Support is not been set in SMBIOS type 131 +// [RootCause] SETUP_CPU_FEATURES structure has been changed. +// [Solution] Include PlatformCPULib.h. +// [Files] Smbios131.c and Smbios131.h +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: Smbios131.h +// +// Description: Header file for SMbios131 module. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#include "Token.h" +#include <Tiano.h> +#include <Include\Protocol\SMBios.h> +#include <Include\Protocol\SmbiosGetFlashDataProtocol.h> +#include <AmtLib.h> +#include <MeLib.h> +#include "CpuFuncs.h" + +#include EFI_GUID_DEFINITION (MeBiosExtensionSetup) +#include EFI_GUID_DEFINITION (GlobalVariable) +#include EFI_PROTOCOL_DEFINITION (PciIo) +#include EFI_PROTOCOL_CONSUMER (PciRootBridgeIo) +#include EFI_PROTOCOL_DEPENDENCY (SaPlatformPolicy) +#include EFI_PROTOCOL_CONSUMER (Heci) +#include EFI_PROTOCOL_CONSUMER (TcgService) +#define MEBX_FILE_GUID \ + { \ + 0x7c81c66a, 0x4f11, 0x47ab, 0x82, 0xd3, 0x67, 0xc4, 0xd6, 0x35, 0xae, 0xd1 \ + } +#if VA_SUPPORT +#include EFI_PROTOCOL_DEFINITION(PlatformVaPolicy) +#endif + +#define vPro_Signature "vPro" + +#define EFI_MSR_IA32_FEATURE_CONTROL 0x3A +#define TXT_OPT_IN_VMX_AND_SMX_MSR_VALUE 0xFF03 +#define EFI_VA30_VERSION 0x0300 +#define EFI_VA26_VERSION 0x0206 + + + + +#define PciMeRegBase PCIEX_BASE_ADDRESS + (UINT32) (22 << 15) +#define FW_STATUS_REGISTER 0x40 + +// +// This is definition for SMBIOS Oem data type 0x81 +// +#pragma pack (1) +// +// This is definition for SMBIOS Oem data type 0x83 +// +typedef struct { + UINT32 VMXState : 1; //[0] VMX state (On/Off) + UINT32 SMXState : 1; //[1] SMX state (On/Off) + UINT32 LtTxtCap : 1; //[2] LT/TXT capability + UINT32 LtTxtEnabled : 1; //[3] LT/TXT Enabled state (Optional for vPro verification) + UINT32 VTxCap : 1; //[4] VT-x capability + UINT32 VTxEnabled : 1; //[5] VT-x Enabled state (Optional for vPro verification) + UINT32 Reserved : 26; //[31:6] Reserved, set to 0 +} CPU_CAP; + +typedef struct { + UINT32 FunctionNumber : 3; //[2:0] PCI Device Function Number + UINT32 DeviceNumber : 5; //[7:3] PCI Device Device Number + UINT32 BusNumber : 8; //[15:8] PCI Device Bus Number + UINT32 DeviceID : 16; //[31:16] Device Identification Number (DID): This field is the identifier of ICHx PCI device.DID will be set to 0xFF if not found. + UINT32 Reserved : 32; //[63:32] Reserved, must set to 0xFF +} PCH_CAP; + +typedef struct { + UINT32 FunctionNumber : 3; //[2:0] PCI Device Function Number of Wired LAN + UINT32 DeviceNumber : 5; //[7:3] PCI Device Device Number of Wired LAN + UINT32 BusNumber : 8; //[15:8] PCI Device Bus Number of Wired LAN + UINT32 DeviceID : 16; //[31:16] PCI Device Identifier (DID) of wired NIC. DID will be set to 0xFF if not found. + UINT16 Reserved1; //[47:32] Reserved for Wired NIC. + UINT32 wFunctionNumber : 3; //[51:48] PCI Device Function Number of Wireless LAN + UINT32 wDeviceNumber : 5; //[56:52] PCI Device Device Number of Wireless LAN + UINT32 wBusNumber : 8; //[64:57] PCI Device Bus Number of Wireless LAN + UINT32 wDeviceID : 16; //[80:65] PCI Device Identifier (DID) of Wireless NIC. DID will be set to 0xFF if not found. + UINT16 wReserved1; //[95:81] Reserved for Wireless NIC. +} NETWORK_DEV; + + +typedef struct { + UINT32 Reserved1 : 1; //[0] Reserved, must be set to 0 + UINT32 VTdSupport : 1; //[1] BIOS supports VT-d in BIOS setup screen (can be editable). + UINT32 TxtSupport : 1; //[2] BIOS supports TXT in BIOS setup screen (can be editable). + UINT32 Reserved2 : 1; //[3] Reserved, must be set to 0 + UINT32 MeSupport : 1; //[4] BIOS supports ME in BIOS setup screen (can be editable). + UINT32 VTxSupport : 1; //[5] BIOS supports VT-x in BIOS setup screen (can be editable). + // The PlaformDataInSpi & MaxVASupported moved from Bit 6 & 7 to 8, 9 + UINT32 TdtPbaSupport : 1; //[6] BIOS supports VT-d in BIOS setup screen (can be editable). + UINT32 TdtWwanSuport : 1; //[7] BIOS supports TXT in BIOS setup screen (can be editable). + UINT32 Reserved : 24; //[31:8] Reserved, must set to 0 +} BIOS_CAP; + +typedef struct { + SMBIOS_STRUCTURE_HEADER Header; + CPU_CAP CpuCapabilities; + UINT16 vMEBX_Major; + UINT16 vMEBX_Minor; + UINT16 vMEBX_HotFix; + UINT16 vMEBX_Build; + PCH_CAP PchCapabilities; + ME_CAP MeCapabilities; + UINT16 Reserved1[2]; + NETWORK_DEV NetworkDevice; + BIOS_CAP BiosCapabilities; + UINT8 vProSignature[4]; + UINT32 Reserved2; + UINT16 Zero; //terminator +} EFI_MISC_OEM_TYPE_0x83; + +#pragma pack () + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/Smbios131/Smbios131.mak b/Board/EM/MeWrapper/Smbios131/Smbios131.mak new file mode 100644 index 0000000..90ff37b --- /dev/null +++ b/Board/EM/MeWrapper/Smbios131/Smbios131.mak @@ -0,0 +1,158 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Smbios131/Smbios131.mak 5 12/18/12 2:29a Klzhan $ +# +# $Revision: 5 $ +# +# $Date: 12/18/12 2:29a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/Smbios131/Smbios131.mak $ +# +# 5 12/18/12 2:29a Klzhan +# [TAG] EIP109707 +# [Category] Spec Update +# [Severity] Important +# [Description] Update ME RC 0.81 +# [Files] Smbios131.sdl +# Smbios131.mak +# Smbios131.c +# Smbios131.dxs +# Smbios131.h +# Smbios131.cif +# +# 4 7/02/12 11:38p Klzhan +# [TAG] EIP94113 +# [Category] Spec Update +# [Severity] Important +# [Description] Update ME RC0.6 +# [Files] Smbios131.sdl +# Smbios131.mak +# Smbios131.c +# Smbios131.dxs +# Smbios131.h +# Smbios131.cif +# +# 3 4/24/12 12:32a Klzhan +# Update modulepart to latest +# +# 2 2/23/12 8:57a Klzhan +# Support New EDK +# +# 1 2/08/12 1:07a Klzhan +# Initial Check in +# +# 3 7/26/11 9:57a Klzhan +# Create token for some Bios capabilities parameters. +# +# 2 7/26/11 8:37a Klzhan +# [TAG] EIP64542 +# [Category] Improvement +# [Description] Replace Getvariable by GetNbSetupdata. +# [Files] Smbios131.sdl +# Smbios131.mak +# Smbios131.c +# Smbios131.dxs +# Smbios131.h +# Smbios131.cif +# +# 1 2/25/11 1:40a Klzhan +# Initial Check-in +# +# 1 12/03/10 5:09a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +# +#<AMI_FHDR_START> +#---------------------------------------------------------------------------- +# +# Name: Smbios131.c +# +# Description: Create SMbios type 131. +# +#---------------------------------------------------------------------------- +#<AMI_FHDR_END> +# MAK file for the ModulePart:AmtSmbios +all : AmtSmbios131 + +$(BUILD_DIR)\Smbios131.mak : $(Smbios131_DIR)\$(@B).cif $(Smbios131_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(Smbios131_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + +AmtSmbios131 : $(BUILD_DIR)\Smbios131.mak AmtSmbios131Bin + +AmtSmbios131_INCLUDES=\ + $(EdkIIGlueLib_INCLUDES)\ + $(INTEL_PLATFORM_PROTOCOL_INCLUDES)\ + /I$(EDK_SOURCE)\Foundation\Efi\Include\ + $(NB_INCLUDES)\ + $(ME_INCLUDES)\ + $(INTEL_PCH_INCLUDES)\ + $(INTEL_MCH_INCLUDES)\ + /I$(MePlatformPolicy_DIR)\ + /I$(PROJECT_DIR)\ + /IInclude\ + +AmtSmbios131_LIBS=\ + $(AmtLibDxe_LIB)\ + $(MeLibDxe_LIB)\ + $(MeChipsetDxeLib_LIB)\ + $(EDKPROTOCOLLIB)\ + $(EFIDRIVERLIB)\ + $(CPUIA32LIB)\ + $(VaProtocolLib_LIB)\ + $(EdkIIGlueDxeReportStatusCodeLib_LIB)\ + $(EdkIIGlueDxeDebugLibReportStatusCode_LIB)\ + $(EdkIIGlueBaseLib_LIB)\ +!IF "$(x64_BUILD)"=="1" + $(EdkIIGlueBaseLibX64_LIB)\ +!ELSE + $(EdkIIGlueBaseLibIA32_LIB)\ +!ENDIF + $(EdkIIGlueDxeMemoryAllocationLib_LIB)\ + $(EdkIIGlueUefiLib_LIB)\ + $(IntelPlatformProtocolLib_LIB)\ + $(PchPlatformDxeLib_LIB)\ + +AmtSmbios131Bin : $(AmtSmbios131_LIBS) + $(MAKE) /$(MAKEFLAGS) $(EDK_DEFAULTS)\ + /f $(BUILD_DIR)\Smbios131.mak all \ + NAME=Smbios131 \ + MAKEFILE=$(BUILD_DIR)\Smbios131.mak \ + "MY_INCLUDES=$(AmtSmbios131_INCLUDES)" \ + GUID=2b341c7b-0b32-4a65-9d46-e1b3abd4c25c \ + ENTRY_POINT=AmtSmbios131EntryPoint \ + DEPEX1=$(Smbios131_DIR)\Smbios131.dxs \ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX \ + TYPE=BS_DRIVER \ + COMPRESS=1 + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* diff --git a/Board/EM/MeWrapper/Smbios131/Smbios131.sdl b/Board/EM/MeWrapper/Smbios131/Smbios131.sdl new file mode 100644 index 0000000..c57ae1e --- /dev/null +++ b/Board/EM/MeWrapper/Smbios131/Smbios131.sdl @@ -0,0 +1,33 @@ +TOKEN + Name = "Smbios131_SUPPORT" + Value = "1" + Help = "Main switch to enable Smbios type 131 support in Project" + TokenType = Boolean + TargetMAK = Yes + Master = Yes +End + +PATH + Name = "Smbios131_DIR" + Help = "AMT Smbios file source directory" +End + +MODULE + Help = "Includes AmtSmbios.mak to Project" + File = "Smbios131.mak" +End + +ELINK + Name = "$(BUILD_DIR)\Smbios131.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + +TOKEN + Name = "SetupSupportItem" + Value = "0xF" + Help = "Set BIOS Setup Item exist or not. Bit0 = Vt-d, Bit1 = Txt, Bit2 = ME, Bit3 = VTx" + TokenType = Integer + TargetH = Yes + Range = "0 - 2" +End
\ No newline at end of file diff --git a/Board/EM/MeWrapper/TdtWrapper/TDTSetup.sd b/Board/EM/MeWrapper/TdtWrapper/TDTSetup.sd new file mode 100644 index 0000000..2f7d21f --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TDTSetup.sd @@ -0,0 +1,161 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TDTSetup.sd 4 9/27/12 4:56a Klzhan $ +// +// $Revision: 4 $ +// +// $Date: 9/27/12 4:56a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TDTSetup.sd $ +// +// 4 9/27/12 4:56a Klzhan +// [TAG] EIP102254 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.7 +// [Files] TDTWrapper.dxs +// TDTWrapper.c +// TDTWrapper.mak +// TDTWrapper.sdl +// TDTSetup.sd +// TDTSetup.uni +// TdtCallback.h +// TDTWrapper.cif +// +// 3 9/19/12 6:31a Klzhan +// Set AT to default enabled. +// +// 2 4/24/12 12:33a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 2 4/20/11 10:51p Klzhan +// Improvement : Gray out Suspend item when system is not enroll. +// +// 1 2/25/11 1:40a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: TdtSetup.sd +// +// Description: Setup menu for Tdt. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +//********************************************************************** +#ifdef SETUP_DATA_DEFINITION +/***********************************************************/ +/* Put NVRAM data definitions here. +/* For example: UINT8 Data1; +/* These definitions will be converted by the build process +/* to a definitions of SETUP_DATA fields. +/***********************************************************/ + UINT8 Tdt; + UINT8 TdtConfig; + UINT8 TdtEnterSuspendState; + +#endif + +#ifdef ADVANCED_FORM_SET + #ifdef FORM_SET_ITEM + // Define controls to be added to the main page of the formset + + #endif + +#ifdef FORM_SET_TYPEDEF + +#include "TdtCallback.h" + +#endif + +#ifdef FORM_SET_VARSTORE + varstore TDT_VOLATILE_SETUP_DATA, + key = AUTO_ID(TDT_VOLATILE_SETUP_DATA_VAR), + name = TdtAdvancedSetupDataVar, + guid = TDT_VOLATILE_SETUP_DATA_GUID; + +#endif + + #ifdef FORM_SET_GOTO + // Define goto commands for the forms defined in this file + goto TDT_FORM_ID, + + prompt = STRING_TOKEN(STR_TDT_FORM), + help = STRING_TOKEN(STR_TDT_FORM_HELP); + #endif + + #ifdef FORM_SET_FORM + // Define forms + #ifndef TDT_FORM_SETUP + #define TDT_FORM_SETUP + + form formid = AUTO_ID(TDT_FORM_ID), + title = STRING_TOKEN(STR_TDT_FORM_TITLE); + + SEPARATOR + SUBTITLE(STRING_TOKEN(STR_ITDT_SUBTITLE)) + SEPARATOR + + grayoutif ideqval TDT_VOLATILE_SETUP_DATA.TdtEnroll == 1 OR ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + oneof varid = SETUP_DATA.TdtConfig, + prompt = STRING_TOKEN(STR_TDT_CONFIG_PROMPT), + help = STRING_TOKEN(STR_TDT_CONFIG_HELP), + option text = STRING_TOKEN(STR_TDT_DISABLED), value = 0, flags = RESET_REQUIRED, key = 0; + option text = STRING_TOKEN(STR_TDT_ENABLED), value = 1, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0; + endoneof; + endif; + + grayoutif ideqval TDT_VOLATILE_SETUP_DATA.TdtEnroll == 0 OR ideqval SYSTEM_ACCESS.Access == SYSTEM_PASSWORD_USER; + oneof varid = SETUP_DATA.TdtEnterSuspendState, + prompt = STRING_TOKEN(STR_TDT_SUSPEND_PROMPT), + help = STRING_TOKEN(STR_TDT_SUSPEND_HELP), + option text = STRING_TOKEN(STR_TDT_DISABLED), value = 0, flags = DEFAULT | MANUFACTURING | RESET_REQUIRED, key = 0; + option text = STRING_TOKEN(STR_TDT_ENABLED), value = 1, flags = RESET_REQUIRED, key = 0; + endoneof; + endif; + + endform; + #endif // TDT_FORM_SETUP + #endif //End FORM_SET_FORM + +#endif //End ADVANCED_FORM_SET + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/TdtWrapper/TDTSetup.uni b/Board/EM/MeWrapper/TdtWrapper/TDTSetup.uni Binary files differnew file mode 100644 index 0000000..89c89b3 --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TDTSetup.uni diff --git a/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.c b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.c new file mode 100644 index 0000000..5485043 --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.c @@ -0,0 +1,521 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TDTWrapper.c 12 6/18/14 3:04a Larryliu $ +// +// $Revision: 12 $ +// +// $Date: 6/18/14 3:04a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TDTWrapper.c $ +// +// 12 6/18/14 3:04a Larryliu +// [TAG] EIP173999 +// [Category] Improvement +// [Description] [HWR]Remove useless comments from Intel ME +// component.(except RC) +// [Files] TDTWrapper.c +// +// 10 5/14/14 10:04p Tristinchou +// [TAG] EIP167030 +// [Category] Improvement +// [Description] Remove the variable runtime attribute and keep original +// attributes. +// +// 9 12/17/13 9:50p Tristinchou +// [TAG] EIP146961 +// [Category] Bug Fix +// [Severity] Normal +// [Symptom] After Initiated Resume, "Enter Intel AT Suspend Mode" +// option is still enable in Bios setup menu +// [RootCause] The conditional expression is never true to clean steup +// item. +// [Solution] Use MBP data to check AT status. +// +// 8 6/21/13 3:08a Klzhan +// [TAG] EIP127189 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 1.60 +// +// 7 6/02/13 9:13a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Report PBA not support when AT is disabled. +// +// 6 4/02/13 1:51a Klzhan +// [TAG] EIPNone +// [Category] Bug Fix +// [Severity] Critical +// [Symptom] Setup Variable crash +// [RootCause] Variable not been initialized. +// +// 5 9/27/12 4:56a Klzhan +// [TAG] EIP102254 +// [Category] Spec Update +// [Severity] Important +// [Description] Update ME RC 0.7 +// [Files] TDTWrapper.dxs +// TDTWrapper.c +// TDTWrapper.mak +// TDTWrapper.sdl +// TDTSetup.sd +// TDTSetup.uni +// TdtCallback.h +// TDTWrapper.cif +// +// 4 8/30/12 2:57a Klzhan +// +// 3 4/24/12 3:33a Klzhan +// +// 2 4/24/12 12:33a Klzhan +// Update modulepart to latest +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 3 9/20/11 9:40a Klzhan +// Check TdtConfig by Wrapper not SetupData. +// +// 2 4/21/11 2:58a Klzhan +// +// 1 2/25/11 1:40a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: TdtSetup.c +// +// Description: Setup Hooks for Tdt. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004-2006 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + TDTPlatformPolicy.c + +Abstract: + + TDTPlatformPolicy to check and set TDT Platform Policy. + +--*/ +/*++ + This file contains an 'Intel Peripheral Driver' and is + licensed for Intel CPUs and chipsets under the terms of your + license agreement with Intel or your vendor. This file may + be modified by the user, subject to additional terms of the + license agreement +--*/ + + +//This needs to be merged with AMT Platform Policy. + +// +// Statements that include other files +// +//#include "Efi.h" + + +#include <EFI.h> +#include <AmiDxeLib.h> +#include <Protocol\SMBios.h> +#include <Include\Protocol\SmbiosGetFlashDataProtocol.h> +#if (defined(CSM_SUPPORT) && (CSM_SUPPORT != 0)) +#include <Include\Protocol\LegacyRegion.h> +#endif +#include "Setup.h" +#include "ReferenceCode\ME\Protocol\AtPlatformPolicy\AtPlatformPolicy.h" +#include "MkhiMsgs.h" +#include "Protocol\MeBiosPayloadData\MeBiosPayloadData.h" +#include "TdtCallback.h" +#define BDS_ALL_DRIVERS_CONNECTED_PROTOCOL_GUID \ + { 0xdbc9fd21, 0xfad8, 0x45b0, 0x9e, 0x78, 0x27, 0x15, 0x88, 0x67, 0xcc, 0x93 } + +#define ME_ALERT_AT_HANDLER_GUID {0xb441df87, 0x8d94, 0x4811, 0x85, 0xf7, 0xf, 0x9a, 0x7b, 0xf8, 0x9d, 0x2a} + +#define SMB131_IDENTIFIER_OFFSET 0x38 +#define SMB131_ME_CAPS_OFFSET 0x18 +#define SMB131_AT_ENROLL_OFFSET 0x24 +#define SMB131_BIOS_SEC_CAPS_OFFSET 0x34 + +EFI_GUID gSetupGuid = SETUP_GUID; +EFI_GUID gDxePlatformTdtPolicyGuid = DXE_PLATFORM_AT_POLICY_GUID; +EFI_GUID gEfiSmbiosProtocolGuid = EFI_SMBIOS_PROTOCOL_GUID; +#if (defined(CSM_SUPPORT) && (CSM_SUPPORT != 0)) +EFI_GUID gEfiLegacyRegionProtocol = EFI_LEGACY_REGION_PROTOCOL_GUID; +#endif +EFI_GUID gBdsAllDriversConnectedProtocolGuid = \ + BDS_ALL_DRIVERS_CONNECTED_PROTOCOL_GUID; +EFI_GUID gMEAlertATHandlerGuid = ME_ALERT_AT_HANDLER_GUID; +EFI_EVENT mReady2BootEvent; +EFI_RUNTIME_SERVICES *gRT; +EFI_BOOT_SERVICES *gBS; + +DXE_AT_POLICY_PROTOCOL *TDTPlatformPolicyInstance; + +#define EFI_TPL_DRIVER 6 +#define EFI_TPL_APPLICATION 4 +#define EFI_TPL_CALLBACK 8 +#define EFI_TPL_NOTIFY 16 +#define EFI_TPL_HIGH_LEVEL 31 + +VOID +EFIAPI +TDTEventModSmbiosType131 ( + IN EFI_EVENT Event, + IN VOID *Context +); + +DXE_MBP_DATA_PROTOCOL *mBIOSPayLoad; +VOID NullFunction( + EFI_EVENT Event, + VOID *ParentImageHandle +) +{ + return; +} + +// +// Function implementations +// +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// +// Procedure: TxtExitSetupEvent +// +// Description: This routine for reset the TPM Establishment flag. +// +// Input: EFI_EVENT - Efi event. +// VOID* - Image handle. +// +// Output: None. +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS +TdtAllDriverConnectEvent ( + IN EFI_EVENT Event, + IN VOID *ParentImageHandle +) +{ + EFI_STATUS Status; + EFI_EVENT MEAlertAT; + UINT32 SetupVarAttr; + EFI_GUID TdtSetupDataGuid = TDT_VOLATILE_SETUP_DATA_GUID; + TDT_VOLATILE_SETUP_DATA TdtSetupData; + SETUP_DATA SetupData; + UINTN VariableSize = sizeof(SETUP_DATA); + + // Get current Setup Data. + Status = gRT->GetVariable( L"Setup", + &gSetupGuid, + &SetupVarAttr, + &VariableSize, + &SetupData ); + if( !EFI_ERROR(Status) ) + { + if( (mBIOSPayLoad->MeBiosPayload.AtState.State == AT_STATE_INACTIVE) && + (SetupData.TdtEnterSuspendState != 0) ) + { + SetupData.TdtEnterSuspendState = 0; + Status = gRT->SetVariable ( L"Setup", + &gSetupGuid, + SetupVarAttr, + VariableSize, + &SetupData ); + } + } + + TdtSetupData.TdtEnroll = 0; + if (mBIOSPayLoad->MeBiosPayload.AtState.State != 0) TdtSetupData.TdtEnroll = 1; + Status = gRT->SetVariable ( TDT_VOLATILE_SETUP_DATA_C_NAME, \ + &TdtSetupDataGuid, \ + EFI_VARIABLE_NON_VOLATILE | \ + EFI_VARIABLE_BOOTSERVICE_ACCESS, \ + sizeof(TDT_VOLATILE_SETUP_DATA), \ + &TdtSetupData ); + // Signal Event To support New AT AM module. + Status = gBS->CreateEventEx( + EFI_EVENT_NOTIFY_SIGNAL, + EFI_TPL_NOTIFY, + NullFunction, + NULL, + &gMEAlertATHandlerGuid, + &MEAlertAT); + gBS->SignalEvent(MEAlertAT); + gBS->CloseEvent(MEAlertAT); + return EFI_SUCCESS; +} +VOID LocateMBP(IN EFI_EVENT Event, IN VOID *Context) +{ + pBS->LocateProtocol (&gMeBiosPayloadDataProtocolGuid, NULL, &mBIOSPayLoad); +} +EFI_STATUS +EFIAPI +TdtWrapperEntryPoint ( + IN EFI_HANDLE ImageHandle, + IN EFI_SYSTEM_TABLE *SystemTable +) +/*++ + +Routine Description: + + Entry point for the TDTPlatformPolicy Driver. + +Arguments: + + ImageHandle Image handle of this driver. + SystemTable Global system service table. + +Returns: + + EFI_SUCCESS Initialization complete. + EFI_UNSUPPORTED The chipset is unsupported by this driver. + EFI_OUT_OF_RESOURCES Do not have enough resources to initialize the driver. + EFI_DEVICE_ERROR Device error, driver exits abnormally. + +--*/ +{ + EFI_STATUS Status; + EFI_GUID gSetupGuid = SETUP_GUID; + UINT32 SetupVarAttr; + UINTN VariableSize = 0; + SETUP_DATA SetupDataBuffer; + SETUP_DATA* SetupData = &SetupDataBuffer; + EFI_EVENT AllDriverConnectEvent; + VOID *Registration; + EFI_GUID TdtSetupDataGuid = TDT_VOLATILE_SETUP_DATA_GUID; + TDT_VOLATILE_SETUP_DATA TdtSetupData; + // + // Initialize the EFI Driver Library + // + + VariableSize = sizeof (SETUP_DATA); + InitAmiLib(ImageHandle, SystemTable); + gBS = SystemTable->BootServices; + gRT = SystemTable->RuntimeServices; + + Status = gBS->LocateProtocol(&gMeBiosPayloadDataProtocolGuid, NULL, &mBIOSPayLoad); + if (EFI_ERROR (Status)) + { + EFI_EVENT AmiCpuInfoEvt; + VOID *CpuNotifyReg; + + Status = RegisterProtocolCallback( + &gMeBiosPayloadDataProtocolGuid, + LocateMBP, + NULL, + &AmiCpuInfoEvt, + &CpuNotifyReg + ); + } + // + // Allocate Ide private data structure + // + Status = gBS->AllocatePool ( + EfiBootServicesData, + sizeof (DXE_AT_POLICY_PROTOCOL), + (VOID**)&TDTPlatformPolicyInstance + ); + if (EFI_ERROR(Status)) + return EFI_OUT_OF_RESOURCES; + + // + // Get TDT BIOS Setup + // + Status = gRT->GetVariable ( + L"Setup", + &gSetupGuid, + &SetupVarAttr, + &VariableSize, + &SetupDataBuffer + ); + VariableSize = sizeof(TDT_VOLATILE_SETUP_DATA); + Status = gRT->GetVariable ( TDT_VOLATILE_SETUP_DATA_C_NAME, \ + &TdtSetupDataGuid, \ + NULL, \ + &VariableSize, \ + &TdtSetupData ); + // If Tdt is in Enroll state, Set Tdt config to Enable. + if((!EFI_ERROR(Status)) && (TdtSetupData.TdtEnroll == 1)) + { + SetupData->TdtConfig = 1; + Status = gRT->SetVariable ( L"Setup", \ + &gSetupGuid, \ + SetupVarAttr, \ + sizeof(SETUP_DATA), \ + &SetupDataBuffer ); + } + if (EFI_ERROR(Status)){ + TDTPlatformPolicyInstance->At.AtAmBypass = 1; + TDTPlatformPolicyInstance->At.AtEnterSuspendState = 0; + TDTPlatformPolicyInstance->At.AtSupported = 1; + TDTPlatformPolicyInstance->At.AtPba = 1; + } else { + TDTPlatformPolicyInstance->At.AtAmBypass = SetupData->TdtConfig == 1 ? 0 : 1; + TDTPlatformPolicyInstance->At.AtEnterSuspendState = SetupData->TdtEnterSuspendState; + TDTPlatformPolicyInstance->At.AtSupported = 1; + TDTPlatformPolicyInstance->At.AtPba = 1; + } + TDTPlatformPolicyInstance->Revision = DXE_PLATFORM_AT_POLICY_PROTOCOL_REVISION_2; + + // + // Install the TDT Platform Policy PROTOCOL interface + // + Status = gBS->InstallMultipleProtocolInterfaces ( + &ImageHandle, + &gDxePlatformTdtPolicyGuid, TDTPlatformPolicyInstance, + NULL + ); + // If TDT support is disabled in BIOS SETUP, clear the AT support flag of + // SMBIOS TYPE131 to avoid that system can be enrolled. + Status = RegisterProtocolCallback ( &gBdsAllDriversConnectedProtocolGuid, \ + TdtAllDriverConnectEvent, \ + NULL, \ + &AllDriverConnectEvent, \ + &Registration ); + + // If TDT support is disabled in BIOS SETUP, clear the AT support flag of + // SMBIOS TYPE131 to avoid that system can be enrolled. + Status = CreateReadyToBootEvent ( TPL_CALLBACK - 1, \ + TDTEventModSmbiosType131, \ + NULL, \ + &mReady2BootEvent ); + + return Status; +} + +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// +// Procedure: TDTEventModSmbiosType131 +// +// Description: This routine clear the AT support flag of Type 131. +// +// Input: +// IN EFI_EVENT Event - signalled event +// IN VOID *Context - event context +// +// Output: None +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID +EFIAPI +TDTEventModSmbiosType131 ( + IN EFI_EVENT Event, + IN VOID *Context +) +{ + EFI_STATUS Status; + EFI_SMBIOS_PROTOCOL *mSmbiosProtocol; + SMBIOS_TABLE_ENTRY_POINT *SmbTblEntry; +#if (defined(CSM_SUPPORT) && (CSM_SUPPORT != 0)) + EFI_LEGACY_REGION_PROTOCOL* iRegion; +#endif + UINT16 i, MeCaps, AtEnroll, BiosSecurityCaps; + UINT8* pStrucPtr; + UINTN VariableSize = sizeof(TDT_VOLATILE_SETUP_DATA); + EFI_GUID TdtSetupDataGuid = TDT_VOLATILE_SETUP_DATA_GUID; + TDT_VOLATILE_SETUP_DATA TdtSetupData; + + Status = gBS->LocateProtocol ( &gEfiSmbiosProtocolGuid, \ + NULL, \ + &mSmbiosProtocol ); + if (EFI_ERROR(Status)) return ; + + Status = gRT->GetVariable ( TDT_VOLATILE_SETUP_DATA_C_NAME, \ + &TdtSetupDataGuid, \ + NULL, \ + &VariableSize, \ + &TdtSetupData ); + if (EFI_ERROR(Status)) return ; + + // Get SMBIOS Table Entry Point. + SmbTblEntry = mSmbiosProtocol->SmbiosGetTableEntryPoint (); + + // Search SMBIOS Type 131. + for ( pStrucPtr = (UINT8*)SmbTblEntry->TableAddress, i = 0; \ + i < SmbTblEntry->TableLength; i++ ) { + // search SMBIOS Type 131 structure identifier - vPro + if ( *(UINT32*)(pStrucPtr + i) != 0x6f725076 ) continue; + // Pointer to ME Capabilities field. + MeCaps = i - (SMB131_IDENTIFIER_OFFSET - SMB131_ME_CAPS_OFFSET); + AtEnroll = i - (SMB131_IDENTIFIER_OFFSET - SMB131_AT_ENROLL_OFFSET); + BiosSecurityCaps = i - (SMB131_IDENTIFIER_OFFSET - SMB131_BIOS_SEC_CAPS_OFFSET); + if (*(UINT32*)(pStrucPtr + MeCaps) & BIT13) { +#if (defined(CSM_SUPPORT) && (CSM_SUPPORT != 0)) + Status = pBS->LocateProtocol ( &gEfiLegacyRegionProtocol, \ + NULL, \ + &iRegion ); + if (EFI_ERROR(Status)) return ; + // Unlock Shadow ram. + iRegion->UnLock ( iRegion, 0xE0000, 0x20000, NULL ); +#endif + // AT-P is disabled in SETUP, clear the AT-p support flag to avoid + // that system can be enrolled. + if (TDTPlatformPolicyInstance->At.AtAmBypass == 1) + { + *(UINT32*)(pStrucPtr + MeCaps) &= ~BIT13; + *(UINT32*)(pStrucPtr + BiosSecurityCaps) &= ~BIT6; + } + // Set AT is configured if AT is enrolled. + if (TdtSetupData.TdtEnroll != 0) + *(UINT8*)(pStrucPtr + AtEnroll) |= BIT5; + // Lock Shadow ram. +#if (defined(CSM_SUPPORT) && (CSM_SUPPORT != 0)) + iRegion->Lock ( iRegion, 0xE0000, 0x20000, NULL ); +#endif + } + break; + } + return ; +} + + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* diff --git a/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.cif b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.cif new file mode 100644 index 0000000..b72653d --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.cif @@ -0,0 +1,15 @@ +<component> + name = "TdtWrapper" + category = ModulePart + LocalRoot = "Board\EM\MeWrapper\TdtWrapper\" + RefName = "TdtWrapper" +[files] +"TDTWrapper.dxs" +"TDTWrapper.c" +"TDTWrapper.mak" +"TDTWrapper.sdl" +"TDTSetup.sd" +"TDTSetup.uni" +"TdtCallback.h" +"TdtOfbd.c" +<endComponent> diff --git a/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.dxs b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.dxs new file mode 100644 index 0000000..6226366 --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.dxs @@ -0,0 +1,93 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TDTWrapper.dxs 1 2/08/12 1:07a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:07a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TDTWrapper.dxs $ +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 1 2/25/11 1:40a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: TdtSetup.dxs +// +// Description: Dependency expression file. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +/*++ + +Copyright (c) 2004-2006 Intel Corporation. All rights reserved +This software and associated documentation (if any) is furnished +under a license and may only be used or copied in accordance +with the terms of the license. Except as permitted by such +license, no part of this software or documentation may be +reproduced, stored in a retrieval system, or transmitted in any +form or by any means without the express written consent of +Intel Corporation. + +Module Name: + + TDTPlatformPolicy.h + +Abstract: + + Dependency expression file for TDTPlatformPolicy Invocation Driver. + +--*/ +/*++ + This file contains an 'Intel Peripheral Driver' and is + licensed for Intel CPUs and chipsets under the terms of your + license agreement with Intel or your vendor. This file may + be modified by the user, subject to additional terms of the + license agreement +--*/ + +DEPENDENCY_START + TRUE +DEPENDENCY_END + + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.mak b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.mak new file mode 100644 index 0000000..8436e78 --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.mak @@ -0,0 +1,158 @@ +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#************************************************************************* +#********************************************************************** +# +# $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TDTWrapper.mak 3 2/23/13 6:33a Klzhan $ +# +# $Revision: 3 $ +# +# $Date: 2/23/13 6:33a $ +# +#********************************************************************** +# Revision History +# ---------------- +# $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TDTWrapper.mak $ +# +# 3 2/23/13 6:33a Klzhan +# [TAG] EIPNone +# [Category] Improvement +# [Description] Fix build error when OFDB disabled +# +# 2 1/24/13 3:51a Klzhan +# [TAG] EIP113197 +# [Category] Improvement +# [Description] Block AFU when DTimer is running out. +# [Files] TDTWrapper.dxs +# TDTWrapper.c +# TDTWrapper.mak +# TDTWrapper.sdl +# TDTSetup.sd +# TDTSetup.uni +# TdtCallback.h +# TDTWrapper.cif +# +# 1 2/08/12 1:07a Klzhan +# Initial Check in +# +# 1 2/25/11 1:40a Klzhan +# Initial Check-in +# +# 2 12/03/10 5:56a Klzhan +# Fix Build error. +# +# 1 12/03/10 5:09a Klzhan +# Initial Check-in. +# +# +#********************************************************************** +#<AMI_FHDR_START> +# +# Name: TDTDxe.mak +# +# Description: +# +#<AMI_FHDR_END> +#********************************************************************** +# MAK file for the ModulePart:TDTPlatformPolicy +!IFDEF OFBD_SUPPORT + +!IF $(OFBD_SUPPORT) == 1 +all : TdtWrapper TdtOfbd +!ELSE #!IF $(OFBD_SUPPORT) == 1 +all : TdtWrapper +!ENDIF + +!ELSE #!IFDEF OFBD_SUPPORT +all : TdtWrapper +!ENDIF + +BUILD_TDTWRAPPER_DIR = $(BUILD_DIR)\$(TdtWrapper_DIR) + +TdtWrapper : $(BUILD_DIR)\TdtWrapper.mak TdtWrapperBin + +$(BUILD_DIR)\TdtWrapper.mak : $(TdtWrapper_DIR)\$(@B).cif $(TdtWrapper_DIR)\$(@B).mak $(BUILD_RULES) + $(CIF2MAK) $(TdtWrapper_DIR)\$(@B).cif $(CIF2MAK_DEFAULTS) + + +# MAK file for the eModule:TdtWrapper +TdtAm_INCLUDES =\ + $(TDT_INCLUDES)\ + $(ME_INCLUDES) + +TdtWrapper_OBJECTS = $(BUILD_TDTWRAPPER_DIR)\TdtWrapper.obj + +TdtWrapper_CFLAGS = $(CFLAGS) + +TdtWrapperBin : $(AMIDXELIB) $(AMICSPLib) $(MeLibDxe_LIB) + $(MAKE) /$(MAKEFLAGS) $(BUILD_DEFAULTS)\ + /f $(BUILD_DIR)\TdtWrapper.mak all\ + "MY_INCLUDES=$(TdtAm_INCLUDES)"\ + NAME=TdtWrapper\ + MAKEFILE=$(BUILD_DIR)\TdtWrapper.mak \ + "CFLAGS=$(TdtWrapper_CFLAGS) /I$(TdtWrapper_DIR)"\ + GUID=CA5E3DF0-940A-48f1-8C14-DB2FB5998B36\ + OBJECTS="$(TdtWrapper_OBJECTS)" \ + ENTRY_POINT=TdtWrapperEntryPoint\ + TYPE=BS_DRIVER \ + DEPEX1=$(TdtWrapper_DIR)\TdtWrapper.dxs\ + DEPEX1_TYPE=EFI_SECTION_DXE_DEPEX\ + COMPRESS=1 + +#--------------------------------------------------------------------------- +# Create TDT OFBD Library +#--------------------------------------------------------------------------- +TdtOfbd : $(BUILD_DIR)\TdtWrapper.mak TdtOfbdLibBin + +TDT_OFBD_INCLUDES =\ +/I$(OFBD_DIR)\ +/I$(MeProtocolLib_DIR)\ +/I$(AtAmDxe_DIR)\ +$(ME_INCLUDES) + +TdtOfbd_OBJECTS = $(BUILD_TDTWRAPPER_DIR)\TdtOfbd.obj + +TdtOfbdLibBin : $(AMIDXELIB) + @set INCLUDE=%%INCLUDE%% + $(MAKE) /$(MAKEFLAGS) $(BUILD_DEFAULTS)\ + /f $(BUILD_DIR)\TdtWrapper.mak all\ + "MY_INCLUDES=$(TDT_OFBD_INCLUDES)" \ + "CFLAGS=$(CFLAGS:/W4=/W3)" \ + OBJECTS="$(TdtOfbd_OBJECTS)" \ + TYPE=LIBRARY LIBRARY_NAME=$(TDTOFBDLIB) + +$(TDTOFBDLIB) : TdtOfbd +#--------------------------------------------------------------------------- +# Create Intel TDT Setup Screens +#--------------------------------------------------------------------------- +SetupSdbs : $(BUILD_DIR)\TdtWrapper.mak TDTSetupSDB + +TDTSetupSDB : + $(MAKE) /$(MAKEFLAGS) $(BUILD_DEFAULTS)\ + /f $(BUILD_DIR)\TdtWrapper.mak all \ + TYPE=SDB NAME=TdtWrapper STRING_CONSUMERS=$(TdtWrapper_DIR)\TDTSetup.sd + + +#************************************************************************* +#************************************************************************* +#** ** +#** (C)Copyright 1985-2010, American Megatrends, Inc. ** +#** ** +#** All Rights Reserved. ** +#** ** +#** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +#** ** +#** Phone: (770)-246-8600 ** +#** ** +#************************************************************************* +#*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.sdl b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.sdl new file mode 100644 index 0000000..cebc89e --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TDTWrapper.sdl @@ -0,0 +1,98 @@ +TOKEN + Name = "TdtWrapper_SUPPORT" + Value = "1" + Help = "Main switch to enable TdtWrapper support in Project" + TokenType = Boolean + TargetMAK = Yes + TargetH = Yes + Master = Yes + Token = "AT_SUPPORT" "=" "1" +End + + +PATH + Name = "TdtWrapper_DIR" +End + +MODULE + Help = "Includes TdtWrapper.mak to Project" + File = "TdtWrapper.mak" +End +ELINK + Name = "$(BUILD_DIR)\TdtWrapper.sdb" + Parent = "SETUP_SDBS" + Priority = 30 + InvokeOrder = AfterParent +End + +ELINK + Name = "$(TdtWrapper_DIR)\TdtSetup.sd" + Parent = "SETUP_DEFINITIONS" + Priority = 30 + InvokeOrder = AfterParent +End + +ELINK + Name = "$(BUILD_DIR)\TdtWrapper.ffs" + Parent = "FV_MAIN" + InvokeOrder = AfterParent +End + + +TOKEN + Name = "EXPECTED_FLASH_UPDATE_TIME" + Value = "300" + Help = "Expected Flash update time in seconds. 0 - Disable" + TokenType = Integer + Token = "OFBD_SUPPORT" "=" "1" + TargetH = Yes +End + +TOKEN + Name = "TDT_FLASH_UPDATE_ERROR_MESSAGE_1" + Value = "DTimer of Anti-Theft Technology is less than the expected time to perform the flash update." + TokenType = Expression + TargetH = Yes + Token = "EXPECTED_FLASH_UPDATE_TIME" "!=" "0" + Token = "OFBD_SUPPORT" "=" "1" +End + +TOKEN + Name = "TDT_FLASH_UPDATE_ERROR_MESSAGE_2" + Value = "BIOS can not be updated at this time and please reconnect to Internet." + TokenType = Expression + TargetH = Yes + Token = "EXPECTED_FLASH_UPDATE_TIME" "!=" "0" + Token = "OFBD_SUPPORT" "=" "1" +End + +TOKEN + Name = "TDTOFBDLIB" + Value = "$(BUILD_DIR)\TDTOFBDLIB.lib" + TokenType = Expression + TargetMAK = Yes +End + +ELINK + Name = "$(BUILD_DIR)\TDTOFBDLIB.lib" + Parent = "OFBDLISTLIB" + Token = "EXPECTED_FLASH_UPDATE_TIME" "!=" "0" + InvokeOrder = AfterParent + Token = "OFBD_SUPPORT" "=" "1" +End + +ELINK + Name = "TDTOfbdEntry," + Parent = "OFBDPartsList" + Token = "EXPECTED_FLASH_UPDATE_TIME" "!=" "0" + Token = "OFBD_SUPPORT" "=" "1" + InvokeOrder = AfterParent +End + +ELINK + Name = "TDTOfbdInSmmEntry," + Parent = "OFBDInSmmFuncList" + Token = "EXPECTED_FLASH_UPDATE_TIME" "!=" "0" + Token = "OFBD_SUPPORT" "=" "1" + InvokeOrder = AfterParent +End diff --git a/Board/EM/MeWrapper/TdtWrapper/TdtCallback.h b/Board/EM/MeWrapper/TdtWrapper/TdtCallback.h new file mode 100644 index 0000000..61b29b9 --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TdtCallback.h @@ -0,0 +1,69 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* +//********************************************************************** +// +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TdtCallback.h 1 2/08/12 1:07a Klzhan $ +// +// $Revision: 1 $ +// +// $Date: 2/08/12 1:07a $ +// +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TdtCallback.h $ +// +// 1 2/08/12 1:07a Klzhan +// Initial Check in +// +// 1 2/25/11 1:40a Klzhan +// Initial Check-in +// +// 1 12/03/10 5:09a Klzhan +// Initial Check-in. +// +// +//********************************************************************** + +//<AMI_FHDR_START> +//---------------------------------------------------------------------------- +// +// Name: TdtCallBack.h +// +// Description: Setup Var definetion. +// +//---------------------------------------------------------------------------- +//<AMI_FHDR_END> +#define TDT_VOLATILE_SETUP_DATA_GUID \ +{0x7b77fb8b, 0x1e0d, 0x4d7e, 0x95, 0x3f, 0x39, 0x80, 0xa2, 0x61, 0xe0, 0x76} + +#define TDT_VOLATILE_SETUP_DATA_C_NAME L"TdtAdvancedSetupDataVar" + +typedef struct _TDT_VOLATILE_SETUP_DATA { + UINT8 TdtEnroll; +} TDT_VOLATILE_SETUP_DATA; + +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//*************************************************************************
\ No newline at end of file diff --git a/Board/EM/MeWrapper/TdtWrapper/TdtOfbd.c b/Board/EM/MeWrapper/TdtWrapper/TdtOfbd.c new file mode 100644 index 0000000..b64b09e --- /dev/null +++ b/Board/EM/MeWrapper/TdtWrapper/TdtOfbd.c @@ -0,0 +1,296 @@ +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2010, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* + +//********************************************************************** +// $Header: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TdtOfbd.c 7 4/30/13 7:59a Tristinchou $ +// +// $Revision: 7 $ +// +// $Date: 4/30/13 7:59a $ +//********************************************************************** +// Revision History +// ---------------- +// $Log: /Alaska/SOURCE/Modules/SharkBayRefCodes/ME/MeWrapper/TdtWrapper/TdtOfbd.c $ +// +// 7 4/30/13 7:59a Tristinchou +// [TAG] EIPNone +// [Category] Bug Fix +// [Severity] Normal +// [RootCause] Pointer may be destroyed in smm. +// [Solution] Get value instead of using pointer. +// [Files] TdtOfbd.c +// +// 6 3/26/13 8:09a Calvinchen +// [TAG] EIP119036.2 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] SecureFlash fail with ME "AT disable" +// [RootCause] SMM HECI not installed if ME is disabled by FDO Jumper. +// [Solution] Added check SmmHeci protocol before AtGetTimerInfo call. +// +// 5 3/26/13 4:49a Calvinchen +// [TAG] EIP119036.1 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] SecureFlash fail with ME ¡§AT disable¡¨ +// [RootCause] HECI returns "UNSUPPORTED" not "TIMEOUT" if ME is +// disabled. +// [Solution] Added check ME Mode and AT state before AtGetTimeInfo +// call. +// [Files] TdtOfbd.c +// +// 4 3/25/13 10:17a Calvinchen +// [TAG] EIP119036 +// [Category] Bug Fix +// [Severity] Important +// [Symptom] SecureFlash fail with ME "AT disable" +// [RootCause] HECI Timeout if AtGetTimeInfo call. +// [Solution] To Skip AtGetTimeInfo call if HECI Timeout at first call. +// [Files] TdtOfbd.c +// +// 3 3/12/13 8:01a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Fix AFU can update after frist time enrolled +// +// 2 3/04/13 4:48a Klzhan +// [TAG] EIPNone +// [Category] Improvement +// [Description] Update for get timer fail in windows. +// +// 1 1/24/13 3:52a Klzhan +// [TAG] EIP113197 +// [Category] Improvement +// [Description] Block AFU when AT DTimer is running out +// +// +//********************************************************************** +//<AMI_FHDR_START> +// +// Name: TDTOfbd.c +// +// Description: +// +//<AMI_FHDR_END> +//********************************************************************** +#include <AmiLib.h> +#include <AmiDxeLib.h> +#include <Setup.h> +#include "token.h" +#include "OFBD.h" +#include "HeciSmm\HeciSmm.h" +#include "MkhiMsgs.h" +#define _ME_LIB_H_ +#include "AtHi.h" +#include "MeBiosPayloadData\MeBiosPayloadData.h" + +EFI_GUID gSetupGuid = SETUP_GUID; +SMM_HECI_PROTOCOL *mHeci; +EFI_GUID gSmmHeciProtocolGuid = SMM_HECI_PROTOCOL_GUID; +DXE_MBP_DATA_PROTOCOL *MbpData; +EFI_GUID gMeBiosPayloadDataProtocolGuid = ME_BIOS_PAYLOAD_DATA_PROTOCOL_GUID; +BOOLEAN gIntelAT; + +//<AMI_PHDR_START> +//--------------------------------------------------------------------------- +// +// Procedure: AsciiStrLen +// +// Description: +// +// Input: +// +// +// Output: +// +//--------------------------------------------------------------------------- +//<AMI_PHDR_END> +UINTN +EFIAPI +AsciiStrLen ( + IN CONST CHAR8 *String + ) +{ + UINTN Length; + + for (Length = 0; *String != '\0'; String++, Length++) {} + return Length; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------- +// Procedure: HMRFPO_ENABLE_MSG +// +// Description: Send Enable HECI message to ME FW. +// +// Input: NONE +// +// Output: EFI_STATUS +// +// Returns: +// +//---------------------------------------------------------------------- +//<AMI_PHDR_END> +EFI_STATUS AtGetTimerInfo ( + IN OUT UINT32 *Interval, + IN OUT UINT32 *TimeLeft +) +{ + UINT32 HeciLength; + EFI_STATUS Status; + + ATHI_GET_TIMER_INFO_CMD AtGetTimerInfoCmd; + ATHI_GET_TIMER_INFO_RSP AtGetTimerInfoRsp; + + MemSet ((VOID *)&AtGetTimerInfoCmd, sizeof (ATHI_GET_TIMER_INFO_CMD), 0); + MemSet ((VOID *)&AtGetTimerInfoRsp, sizeof (ATHI_GET_TIMER_INFO_RSP), 0); + + AtGetTimerInfoCmd.Header.Version.Minor = ATHI_PROTOCOL_VERSION_MINOR; + AtGetTimerInfoCmd.Header.Version.Major = ATHI_PROTOCOL_VERSION_MAJOR; + AtGetTimerInfoCmd.Header.Command.Category = ATHI_CMD_GROUP_THEFT_DETECTION; + AtGetTimerInfoCmd.Header.Command.IsResponse = AT_COMMAND; + AtGetTimerInfoCmd.Header.Command.Code = ATHI_THEFT_DETECT_GRP_GET_TIMER_INFO_CMD; + // + // 0- Length 0 only header with command is send as message + // + AtGetTimerInfoCmd.Header.Length = sizeof (ATHI_GET_TIMER_INFO_CMD) - sizeof (ATHI_HEADER); + AtGetTimerInfoCmd.TimerId = AT_TID_DISABLE_TIMER; + + + HeciLength = sizeof (ATHI_GET_TIMER_INFO_CMD); + Status = mHeci->ResetHeci(); + Status = mHeci->SendMsg ( + (UINT32 *) &AtGetTimerInfoCmd, + HeciLength, + BIOS_FIXED_HOST_ADDR, + HECI_AT_MESSAGE_ADDR + ); + + if (EFI_ERROR (Status)) { + return Status; + } + + HeciLength = sizeof (ATHI_GET_TIMER_INFO_RSP); + + + Status = mHeci->ReadMsg ( + BLOCKING, + (UINT32 *) &AtGetTimerInfoRsp, + &HeciLength + ); + + if (EFI_ERROR (Status)) { + + return Status; + } + + *Interval = AtGetTimerInfoRsp.TimerInfo.Interval; + *TimeLeft = AtGetTimerInfoRsp.TimerInfo.TimeLeft; + + return EFI_SUCCESS; + +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: TDTOfbdEntry +// +// Description: +// +// Input: +// IN VOID *Buffer +// IN OUT UINT8 *pOFBDDataHandled +// Output: +// VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID TDTOfbdEntry ( + IN VOID *Buffer, + IN OUT UINT8 *pOFBDDataHandled ) +{ + UINTN VariableSize; + UINT32 TimeLeft, Interval; + EFI_STATUS Status = EFI_SUCCESS; + OFBD_HDR *pOFBDHdr = (OFBD_HDR*)Buffer; + char *TDTErrorMsg_1 = \ + CONVERT_TO_STRING(TDT_FLASH_UPDATE_ERROR_MESSAGE_1); + char *TDTErrorMsg_2 = \ + CONVERT_TO_STRING(TDT_FLASH_UPDATE_ERROR_MESSAGE_2); + OFBD_EXT_HDR *pOFBDExtHdr = (OFBD_EXT_HDR*)((UINT8 *)Buffer + pOFBDHdr->OFBD_HDR_SIZE); + UINT32 MeMode; + + // Check AT timer one time when AFU is checking OFBD version. + if ((pOFBDHdr->OFBD_FS != 0) || (pOFBDExtHdr->TypeCodeID != 0)) return; + if ((mHeci == NULL)) return; + // Check AT timer if ME is normal state. + Status = mHeci->GetMeMode(&MeMode); + if (EFI_ERROR(Status) || (MeMode != ME_MODE_NORMAL)) return; + // Check AT timer if AT is enabled in FITC. + if (!gIntelAT) return; + Status = AtGetTimerInfo(&Interval, &TimeLeft); + // If not enrolled, TimeLeft will be 0 + if (EFI_ERROR(Status) || (TimeLeft == 0)) return ; + if (TimeLeft > EXPECTED_FLASH_UPDATE_TIME) return ; + // Set the AFU Force Exit +>>> + VariableSize = AsciiStrLen(TDTErrorMsg_1); + (UINT8*)Buffer += pOFBDHdr->OFBD_Size; + MemSet ((UINT8*)Buffer + pOFBDHdr->OFBD_Size, VariableSize + 1, 0); + MemCpy ((UINT8*)Buffer , TDTErrorMsg_1, VariableSize); + (UINT8*)Buffer += VariableSize; + VariableSize = AsciiStrLen(TDTErrorMsg_2); + MemSet ((UINT8*)Buffer, VariableSize + 1, 0); + MemCpy ((UINT8*)Buffer, TDTErrorMsg_2, VariableSize); + pOFBDHdr->OFBD_RS |= (OFBD_RS_ERR_OUT + OFBD_RS_DIS_OEMSTR); // Tell the AFU display the OEM Message + // Set the AFU Force Exit <<<+ + return; +} +//<AMI_PHDR_START> +//---------------------------------------------------------------------------- +// Procedure: TDTOfbdInSmmEntry +// +// Description: +// +// Input: +// IN VOID *Buffer +// IN OUT UINT8 *pOFBDDataHandled +// Output: +// VOID +// +//---------------------------------------------------------------------------- +//<AMI_PHDR_END> +VOID TDTOfbdInSmmEntry (VOID) +{ + + EFI_STATUS Status; + + Status = pBS->LocateProtocol (&gSmmHeciProtocolGuid, NULL, &mHeci); + if (EFI_ERROR (Status)) mHeci = NULL; + Status = pBS->LocateProtocol (&gMeBiosPayloadDataProtocolGuid, NULL, (VOID **) &MbpData); + if (EFI_ERROR (Status)) gIntelAT = FALSE; + else gIntelAT = (BOOLEAN)MbpData->MeBiosPayload.FwCapsSku.FwCapabilities.Fields.IntelAT; + + return ; +} +//************************************************************************* +//************************************************************************* +//** ** +//** (C)Copyright 1985-2009, American Megatrends, Inc. ** +//** ** +//** All Rights Reserved. ** +//** ** +//** 5555 Oakbrook Parkway, Suite 200, Norcross, GA 30093 ** +//** ** +//** Phone: (770)-246-8600 ** +//** ** +//************************************************************************* +//************************************************************************* |